| function doRun() { |
| let __startupMark = performance.mark("gcc-loops-wasm-startup"); |
| let __startupStartTime = benchmarkTime(); |
| var moduleOverrides = {}; |
| var key; |
| for (key in Module) { |
| if (Module.hasOwnProperty(key)) { |
| moduleOverrides[key] = Module[key]; |
| } |
| } |
| Module["arguments"] = []; |
| Module["thisProgram"] = "./this.program"; |
| Module["quit"] = (function(status, toThrow) { |
| throw toThrow; |
| }); |
| Module["preRun"] = []; |
| Module["postRun"] = []; |
| var ENVIRONMENT_IS_WEB = false; |
| var ENVIRONMENT_IS_WORKER = false; |
| var ENVIRONMENT_IS_NODE = false; |
| var ENVIRONMENT_IS_SHELL = false; |
| if (Module["ENVIRONMENT"]) { |
| if (Module["ENVIRONMENT"] === "WEB") { |
| ENVIRONMENT_IS_WEB = true; |
| } else if (Module["ENVIRONMENT"] === "WORKER") { |
| ENVIRONMENT_IS_WORKER = true; |
| } else if (Module["ENVIRONMENT"] === "NODE") { |
| ENVIRONMENT_IS_NODE = true; |
| } else if (Module["ENVIRONMENT"] === "SHELL") { |
| ENVIRONMENT_IS_SHELL = true; |
| } else { |
| throw new Error("Module['ENVIRONMENT'] value is not valid. must be one of: WEB|WORKER|NODE|SHELL."); |
| } |
| } else { |
| ENVIRONMENT_IS_WEB = typeof window === "object"; |
| ENVIRONMENT_IS_WORKER = typeof importScripts === "function"; |
| ENVIRONMENT_IS_NODE = typeof process === "object" && typeof require === "function" && !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_WORKER; |
| ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER; |
| } |
| if (ENVIRONMENT_IS_NODE) { |
| var nodeFS; |
| var nodePath; |
| Module["read"] = function shell_read(filename, binary) { |
| var ret; |
| if (!nodeFS) nodeFS = require("fs"); |
| if (!nodePath) nodePath = require("path"); |
| filename = nodePath["normalize"](filename); |
| ret = nodeFS["readFileSync"](filename); |
| return binary ? ret : ret.toString(); |
| }; |
| Module["readBinary"] = function readBinary(filename) { |
| var ret = Module["read"](filename, true); |
| if (!ret.buffer) { |
| ret = new Uint8Array(ret); |
| } |
| assert(ret.buffer); |
| return ret; |
| }; |
| if (process["argv"].length > 1) { |
| Module["thisProgram"] = process["argv"][1].replace(/\\/g, "/"); |
| } |
| Module["arguments"] = process["argv"].slice(2); |
| if (typeof module !== "undefined") { |
| module["exports"] = Module; |
| } |
| process["on"]("uncaughtException", (function(ex) { |
| if (!(ex instanceof ExitStatus)) { |
| throw ex; |
| } |
| })); |
| process["on"]("unhandledRejection", (function(reason, p) { |
| process["exit"](1); |
| })); |
| Module["inspect"] = (function() { |
| return "[Emscripten Module object]"; |
| }); |
| } else if (ENVIRONMENT_IS_SHELL) { |
| if (typeof read != "undefined") { |
| Module["read"] = function shell_read(f) { |
| return read(f); |
| }; |
| } |
| Module["readBinary"] = function readBinary(f) { |
| var data; |
| if (typeof readbuffer === "function") { |
| return new Uint8Array(readbuffer(f)); |
| } |
| data = read(f, "binary"); |
| assert(typeof data === "object"); |
| return data; |
| }; |
| if (typeof scriptArgs != "undefined") { |
| Module["arguments"] = scriptArgs; |
| } else if (typeof arguments != "undefined") { |
| Module["arguments"] = arguments; |
| } |
| if (typeof quit === "function") { |
| Module["quit"] = (function(status, toThrow) { |
| quit(status); |
| }); |
| } |
| } else if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) { |
| Module["read"] = function shell_read(url) { |
| var xhr = new XMLHttpRequest; |
| xhr.open("GET", url, false); |
| xhr.send(null); |
| return xhr.responseText; |
| }; |
| if (ENVIRONMENT_IS_WORKER) { |
| Module["readBinary"] = function readBinary(url) { |
| var xhr = new XMLHttpRequest; |
| xhr.open("GET", url, false); |
| xhr.responseType = "arraybuffer"; |
| xhr.send(null); |
| return new Uint8Array(xhr.response); |
| }; |
| } |
| Module["readAsync"] = function readAsync(url, onload, onerror) { |
| var xhr = new XMLHttpRequest; |
| xhr.open("GET", url, true); |
| xhr.responseType = "arraybuffer"; |
| xhr.onload = function xhr_onload() { |
| if (xhr.status == 200 || xhr.status == 0 && xhr.response) { |
| onload(xhr.response); |
| return; |
| } |
| onerror(); |
| }; |
| xhr.onerror = onerror; |
| xhr.send(null); |
| }; |
| Module["setWindowTitle"] = (function(title) { |
| document.title = title; |
| }); |
| } |
| Module["print"] = typeof console !== "undefined" ? console.log.bind(console) : typeof print !== "undefined" ? print : null; |
| Module["printErr"] = typeof printErr !== "undefined" ? printErr : typeof console !== "undefined" && console.warn.bind(console) || Module["print"]; |
| Module.print = Module["print"]; |
| Module.printErr = Module["printErr"]; |
| for (key in moduleOverrides) { |
| if (moduleOverrides.hasOwnProperty(key)) { |
| Module[key] = moduleOverrides[key]; |
| } |
| } |
| moduleOverrides = undefined; |
| var STACK_ALIGN = 16; |
| function staticAlloc(size) { |
| assert(!staticSealed); |
| var ret = STATICTOP; |
| STATICTOP = STATICTOP + size + 15 & -16; |
| return ret; |
| } |
| function dynamicAlloc(size) { |
| assert(DYNAMICTOP_PTR); |
| var ret = HEAP32[DYNAMICTOP_PTR >> 2]; |
| var end = ret + size + 15 & -16; |
| HEAP32[DYNAMICTOP_PTR >> 2] = end; |
| if (end >= TOTAL_MEMORY) { |
| var success = enlargeMemory(); |
| if (!success) { |
| HEAP32[DYNAMICTOP_PTR >> 2] = ret; |
| return 0; |
| } |
| } |
| return ret; |
| } |
| function alignMemory(size, factor) { |
| if (!factor) factor = STACK_ALIGN; |
| var ret = size = Math.ceil(size / factor) * factor; |
| return ret; |
| } |
| function getNativeTypeSize(type) { |
| switch (type) { |
| case "i1": |
| case "i8": |
| return 1; |
| case "i16": |
| return 2; |
| case "i32": |
| return 4; |
| case "i64": |
| return 8; |
| case "float": |
| return 4; |
| case "double": |
| return 8; |
| default: |
| { |
| if (type[type.length - 1] === "*") { |
| return 4; |
| } else if (type[0] === "i") { |
| var bits = parseInt(type.substr(1)); |
| assert(bits % 8 === 0); |
| return bits / 8; |
| } else { |
| return 0; |
| } |
| } |
| } |
| } |
| function warnOnce(text) { |
| if (!warnOnce.shown) warnOnce.shown = {}; |
| if (!warnOnce.shown[text]) { |
| warnOnce.shown[text] = 1; |
| Module.printErr(text); |
| } |
| } |
| var jsCallStartIndex = 1; |
| var functionPointers = new Array(0); |
| var funcWrappers = {}; |
| function dynCall(sig, ptr, args) { |
| if (args && args.length) { |
| return Module["dynCall_" + sig].apply(null, [ ptr ].concat(args)); |
| } else { |
| return Module["dynCall_" + sig].call(null, ptr); |
| } |
| } |
| var GLOBAL_BASE = 1024; |
| var ABORT = 0; |
| var EXITSTATUS = 0; |
| function assert(condition, text) { |
| if (!condition) { |
| abort("Assertion failed: " + text); |
| } |
| } |
| function getCFunc(ident) { |
| var func = Module["_" + ident]; |
| assert(func, "Cannot call unknown function " + ident + ", make sure it is exported"); |
| return func; |
| } |
| var JSfuncs = { |
| "stackSave": (function() { |
| stackSave(); |
| }), |
| "stackRestore": (function() { |
| stackRestore(); |
| }), |
| "arrayToC": (function(arr) { |
| var ret = stackAlloc(arr.length); |
| writeArrayToMemory(arr, ret); |
| return ret; |
| }), |
| "stringToC": (function(str) { |
| var ret = 0; |
| if (str !== null && str !== undefined && str !== 0) { |
| var len = (str.length << 2) + 1; |
| ret = stackAlloc(len); |
| stringToUTF8(str, ret, len); |
| } |
| return ret; |
| }) |
| }; |
| var toC = { |
| "string": JSfuncs["stringToC"], |
| "array": JSfuncs["arrayToC"] |
| }; |
| function ccall(ident, returnType, argTypes, args, opts) { |
| var func = getCFunc(ident); |
| var cArgs = []; |
| var stack = 0; |
| if (args) { |
| for (var i = 0; i < args.length; i++) { |
| var converter = toC[argTypes[i]]; |
| if (converter) { |
| if (stack === 0) stack = stackSave(); |
| cArgs[i] = converter(args[i]); |
| } else { |
| cArgs[i] = args[i]; |
| } |
| } |
| } |
| var ret = func.apply(null, cArgs); |
| if (returnType === "string") ret = Pointer_stringify(ret); else if (returnType === "boolean") ret = Boolean(ret); |
| if (stack !== 0) { |
| stackRestore(stack); |
| } |
| return ret; |
| } |
| function setValue(ptr, value, type, noSafe) { |
| type = type || "i8"; |
| if (type.charAt(type.length - 1) === "*") type = "i32"; |
| switch (type) { |
| case "i1": |
| HEAP8[ptr >> 0] = value; |
| break; |
| case "i8": |
| HEAP8[ptr >> 0] = value; |
| break; |
| case "i16": |
| HEAP16[ptr >> 1] = value; |
| break; |
| case "i32": |
| HEAP32[ptr >> 2] = value; |
| break; |
| case "i64": |
| tempI64 = [ value >>> 0, (tempDouble = value, +Math_abs(tempDouble) >= 1 ? tempDouble > 0 ? (Math_min(+Math_floor(tempDouble / 4294967296), 4294967295) | 0) >>> 0 : ~~+Math_ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0) ], HEAP32[ptr >> 2] = tempI64[0], HEAP32[ptr + 4 >> 2] = tempI64[1]; |
| break; |
| case "float": |
| HEAPF32[ptr >> 2] = value; |
| break; |
| case "double": |
| HEAPF64[ptr >> 3] = value; |
| break; |
| default: |
| abort("invalid type for setValue: " + type); |
| } |
| } |
| var ALLOC_STATIC = 2; |
| var ALLOC_NONE = 4; |
| function Pointer_stringify(ptr, length) { |
| if (length === 0 || !ptr) return ""; |
| var hasUtf = 0; |
| var t; |
| var i = 0; |
| while (1) { |
| t = HEAPU8[ptr + i >> 0]; |
| hasUtf |= t; |
| if (t == 0 && !length) break; |
| i++; |
| if (length && i == length) break; |
| } |
| if (!length) length = i; |
| var ret = ""; |
| if (hasUtf < 128) { |
| var MAX_CHUNK = 1024; |
| var curr; |
| while (length > 0) { |
| curr = String.fromCharCode.apply(String, HEAPU8.subarray(ptr, ptr + Math.min(length, MAX_CHUNK))); |
| ret = ret ? ret + curr : curr; |
| ptr += MAX_CHUNK; |
| length -= MAX_CHUNK; |
| } |
| return ret; |
| } |
| return UTF8ToString(ptr); |
| } |
| var UTF8Decoder = typeof TextDecoder !== "undefined" ? new TextDecoder("utf8") : undefined; |
| function UTF8ArrayToString(u8Array, idx) { |
| var endPtr = idx; |
| while (u8Array[endPtr]) ++endPtr; |
| if (endPtr - idx > 16 && u8Array.subarray && UTF8Decoder) { |
| return UTF8Decoder.decode(u8Array.subarray(idx, endPtr)); |
| } else { |
| var u0, u1, u2, u3, u4, u5; |
| var str = ""; |
| while (1) { |
| u0 = u8Array[idx++]; |
| if (!u0) return str; |
| if (!(u0 & 128)) { |
| str += String.fromCharCode(u0); |
| continue; |
| } |
| u1 = u8Array[idx++] & 63; |
| if ((u0 & 224) == 192) { |
| str += String.fromCharCode((u0 & 31) << 6 | u1); |
| continue; |
| } |
| u2 = u8Array[idx++] & 63; |
| if ((u0 & 240) == 224) { |
| u0 = (u0 & 15) << 12 | u1 << 6 | u2; |
| } else { |
| u3 = u8Array[idx++] & 63; |
| if ((u0 & 248) == 240) { |
| u0 = (u0 & 7) << 18 | u1 << 12 | u2 << 6 | u3; |
| } else { |
| u4 = u8Array[idx++] & 63; |
| if ((u0 & 252) == 248) { |
| u0 = (u0 & 3) << 24 | u1 << 18 | u2 << 12 | u3 << 6 | u4; |
| } else { |
| u5 = u8Array[idx++] & 63; |
| u0 = (u0 & 1) << 30 | u1 << 24 | u2 << 18 | u3 << 12 | u4 << 6 | u5; |
| } |
| } |
| } |
| if (u0 < 65536) { |
| str += String.fromCharCode(u0); |
| } else { |
| var ch = u0 - 65536; |
| str += String.fromCharCode(55296 | ch >> 10, 56320 | ch & 1023); |
| } |
| } |
| } |
| } |
| function UTF8ToString(ptr) { |
| return UTF8ArrayToString(HEAPU8, ptr); |
| } |
| function stringToUTF8Array(str, outU8Array, outIdx, maxBytesToWrite) { |
| if (!(maxBytesToWrite > 0)) return 0; |
| var startIdx = outIdx; |
| var endIdx = outIdx + maxBytesToWrite - 1; |
| for (var i = 0; i < str.length; ++i) { |
| var u = str.charCodeAt(i); |
| if (u >= 55296 && u <= 57343) u = 65536 + ((u & 1023) << 10) | str.charCodeAt(++i) & 1023; |
| if (u <= 127) { |
| if (outIdx >= endIdx) break; |
| outU8Array[outIdx++] = u; |
| } else if (u <= 2047) { |
| if (outIdx + 1 >= endIdx) break; |
| outU8Array[outIdx++] = 192 | u >> 6; |
| outU8Array[outIdx++] = 128 | u & 63; |
| } else if (u <= 65535) { |
| if (outIdx + 2 >= endIdx) break; |
| outU8Array[outIdx++] = 224 | u >> 12; |
| outU8Array[outIdx++] = 128 | u >> 6 & 63; |
| outU8Array[outIdx++] = 128 | u & 63; |
| } else if (u <= 2097151) { |
| if (outIdx + 3 >= endIdx) break; |
| outU8Array[outIdx++] = 240 | u >> 18; |
| outU8Array[outIdx++] = 128 | u >> 12 & 63; |
| outU8Array[outIdx++] = 128 | u >> 6 & 63; |
| outU8Array[outIdx++] = 128 | u & 63; |
| } else if (u <= 67108863) { |
| if (outIdx + 4 >= endIdx) break; |
| outU8Array[outIdx++] = 248 | u >> 24; |
| outU8Array[outIdx++] = 128 | u >> 18 & 63; |
| outU8Array[outIdx++] = 128 | u >> 12 & 63; |
| outU8Array[outIdx++] = 128 | u >> 6 & 63; |
| outU8Array[outIdx++] = 128 | u & 63; |
| } else { |
| if (outIdx + 5 >= endIdx) break; |
| outU8Array[outIdx++] = 252 | u >> 30; |
| outU8Array[outIdx++] = 128 | u >> 24 & 63; |
| outU8Array[outIdx++] = 128 | u >> 18 & 63; |
| outU8Array[outIdx++] = 128 | u >> 12 & 63; |
| outU8Array[outIdx++] = 128 | u >> 6 & 63; |
| outU8Array[outIdx++] = 128 | u & 63; |
| } |
| } |
| outU8Array[outIdx] = 0; |
| return outIdx - startIdx; |
| } |
| function stringToUTF8(str, outPtr, maxBytesToWrite) { |
| return stringToUTF8Array(str, HEAPU8, outPtr, maxBytesToWrite); |
| } |
| function lengthBytesUTF8(str) { |
| var len = 0; |
| for (var i = 0; i < str.length; ++i) { |
| var u = str.charCodeAt(i); |
| if (u >= 55296 && u <= 57343) u = 65536 + ((u & 1023) << 10) | str.charCodeAt(++i) & 1023; |
| if (u <= 127) { |
| ++len; |
| } else if (u <= 2047) { |
| len += 2; |
| } else if (u <= 65535) { |
| len += 3; |
| } else if (u <= 2097151) { |
| len += 4; |
| } else if (u <= 67108863) { |
| len += 5; |
| } else { |
| len += 6; |
| } |
| } |
| return len; |
| } |
| var UTF16Decoder = typeof TextDecoder !== "undefined" ? new TextDecoder("utf-16le") : undefined; |
| function allocateUTF8(str) { |
| var size = lengthBytesUTF8(str) + 1; |
| var ret = _malloc(size); |
| if (ret) stringToUTF8Array(str, HEAP8, ret, size); |
| return ret; |
| } |
| function allocateUTF8OnStack(str) { |
| var size = lengthBytesUTF8(str) + 1; |
| var ret = stackAlloc(size); |
| stringToUTF8Array(str, HEAP8, ret, size); |
| return ret; |
| } |
| function demangle(func) { |
| return func; |
| } |
| function demangleAll(text) { |
| var regex = /__Z[\w\d_]+/g; |
| return text.replace(regex, (function(x) { |
| var y = demangle(x); |
| return x === y ? x : x + " [" + y + "]"; |
| })); |
| } |
| function jsStackTrace() { |
| var err = new Error; |
| if (!err.stack) { |
| try { |
| throw new Error(0); |
| } catch (e) { |
| err = e; |
| } |
| if (!err.stack) { |
| return "(no stack trace available)"; |
| } |
| } |
| return err.stack.toString(); |
| } |
| function stackTrace() { |
| var js = jsStackTrace(); |
| if (Module["extraStackTrace"]) js += "\n" + Module["extraStackTrace"](); |
| return demangleAll(js); |
| } |
| var WASM_PAGE_SIZE = 65536; |
| var ASMJS_PAGE_SIZE = 16777216; |
| function alignUp(x, multiple) { |
| if (x % multiple > 0) { |
| x += multiple - x % multiple; |
| } |
| return x; |
| } |
| var buffer, HEAP8, HEAPU8, HEAP16, HEAPU16, HEAP32, HEAPU32, HEAPF32, HEAPF64; |
| function updateGlobalBuffer(buf) { |
| Module["buffer"] = buffer = buf; |
| } |
| function updateGlobalBufferViews() { |
| Module["HEAP8"] = HEAP8 = new Int8Array(buffer); |
| Module["HEAP16"] = HEAP16 = new Int16Array(buffer); |
| Module["HEAP32"] = HEAP32 = new Int32Array(buffer); |
| Module["HEAPU8"] = HEAPU8 = new Uint8Array(buffer); |
| Module["HEAPU16"] = HEAPU16 = new Uint16Array(buffer); |
| Module["HEAPU32"] = HEAPU32 = new Uint32Array(buffer); |
| Module["HEAPF32"] = HEAPF32 = new Float32Array(buffer); |
| Module["HEAPF64"] = HEAPF64 = new Float64Array(buffer); |
| } |
| var STATIC_BASE, STATICTOP, staticSealed; |
| var STACK_BASE, STACKTOP, STACK_MAX; |
| var DYNAMIC_BASE, DYNAMICTOP_PTR; |
| STATIC_BASE = STATICTOP = STACK_BASE = STACKTOP = STACK_MAX = DYNAMIC_BASE = DYNAMICTOP_PTR = 0; |
| staticSealed = false; |
| function abortOnCannotGrowMemory() { |
| abort("Cannot enlarge memory arrays. Either (1) compile with -s TOTAL_MEMORY=X with X higher than the current value " + TOTAL_MEMORY + ", (2) compile with -s ALLOW_MEMORY_GROWTH=1 which allows increasing the size at runtime, or (3) if you want malloc to return NULL (0) instead of this abort, compile with -s ABORTING_MALLOC=0 "); |
| } |
| function enlargeMemory() { |
| abortOnCannotGrowMemory(); |
| } |
| var TOTAL_STACK = Module["TOTAL_STACK"] || 5242880; |
| var TOTAL_MEMORY = Module["TOTAL_MEMORY"] || 67108864; |
| if (TOTAL_MEMORY < TOTAL_STACK) Module.printErr("TOTAL_MEMORY should be larger than TOTAL_STACK, was " + TOTAL_MEMORY + "! (TOTAL_STACK=" + TOTAL_STACK + ")"); |
| if (Module["buffer"]) { |
| buffer = Module["buffer"]; |
| } else { |
| if (typeof WebAssembly === "object" && typeof WebAssembly.Memory === "function") { |
| Module["wasmMemory"] = new WebAssembly.Memory({ |
| "initial": TOTAL_MEMORY / WASM_PAGE_SIZE, |
| "maximum": TOTAL_MEMORY / WASM_PAGE_SIZE |
| }); |
| buffer = Module["wasmMemory"].buffer; |
| } else { |
| buffer = new ArrayBuffer(TOTAL_MEMORY); |
| } |
| Module["buffer"] = buffer; |
| } |
| updateGlobalBufferViews(); |
| function getTotalMemory() { |
| return TOTAL_MEMORY; |
| } |
| HEAP32[0] = 1668509029; |
| HEAP16[1] = 25459; |
| if (HEAPU8[2] !== 115 || HEAPU8[3] !== 99) throw "Runtime error: expected the system to be little-endian!"; |
| function callRuntimeCallbacks(callbacks) { |
| while (callbacks.length > 0) { |
| var callback = callbacks.shift(); |
| if (typeof callback == "function") { |
| callback(); |
| continue; |
| } |
| var func = callback.func; |
| if (typeof func === "number") { |
| if (callback.arg === undefined) { |
| Module["dynCall_v"](func); |
| } else { |
| Module["dynCall_vi"](func, callback.arg); |
| } |
| } else { |
| func(callback.arg === undefined ? null : callback.arg); |
| } |
| } |
| } |
| var __ATPRERUN__ = []; |
| var __ATINIT__ = []; |
| var __ATMAIN__ = []; |
| var __ATEXIT__ = []; |
| var __ATPOSTRUN__ = []; |
| var runtimeInitialized = false; |
| var runtimeExited = false; |
| function preRun() { |
| if (Module["preRun"]) { |
| if (typeof Module["preRun"] == "function") Module["preRun"] = [ Module["preRun"] ]; |
| while (Module["preRun"].length) { |
| addOnPreRun(Module["preRun"].shift()); |
| } |
| } |
| callRuntimeCallbacks(__ATPRERUN__); |
| } |
| function ensureInitRuntime() { |
| if (runtimeInitialized) return; |
| runtimeInitialized = true; |
| callRuntimeCallbacks(__ATINIT__); |
| } |
| function preMain() { |
| callRuntimeCallbacks(__ATMAIN__); |
| } |
| function exitRuntime() { |
| callRuntimeCallbacks(__ATEXIT__); |
| runtimeExited = true; |
| } |
| function postRun() { |
| if (Module["postRun"]) { |
| if (typeof Module["postRun"] == "function") Module["postRun"] = [ Module["postRun"] ]; |
| while (Module["postRun"].length) { |
| addOnPostRun(Module["postRun"].shift()); |
| } |
| } |
| callRuntimeCallbacks(__ATPOSTRUN__); |
| } |
| function addOnPreRun(cb) { |
| __ATPRERUN__.unshift(cb); |
| } |
| function addOnPostRun(cb) { |
| __ATPOSTRUN__.unshift(cb); |
| } |
| function writeArrayToMemory(array, buffer) { |
| HEAP8.set(array, buffer); |
| } |
| function writeAsciiToMemory(str, buffer, dontAddNull) { |
| for (var i = 0; i < str.length; ++i) { |
| HEAP8[buffer++ >> 0] = str.charCodeAt(i); |
| } |
| if (!dontAddNull) HEAP8[buffer >> 0] = 0; |
| } |
| var Math_abs = Math.abs; |
| var Math_cos = Math.cos; |
| var Math_sin = Math.sin; |
| var Math_tan = Math.tan; |
| var Math_acos = Math.acos; |
| var Math_asin = Math.asin; |
| var Math_atan = Math.atan; |
| var Math_atan2 = Math.atan2; |
| var Math_exp = Math.exp; |
| var Math_log = Math.log; |
| var Math_sqrt = Math.sqrt; |
| var Math_ceil = Math.ceil; |
| var Math_floor = Math.floor; |
| var Math_pow = Math.pow; |
| var Math_imul = Math.imul; |
| var Math_fround = Math.fround; |
| var Math_round = Math.round; |
| var Math_min = Math.min; |
| var Math_max = Math.max; |
| var Math_clz32 = Math.clz32; |
| var Math_trunc = Math.trunc; |
| var runDependencies = 0; |
| var runDependencyWatcher = null; |
| var dependenciesFulfilled = null; |
| function getUniqueRunDependency(id) { |
| return id; |
| } |
| function addRunDependency(id) { |
| runDependencies++; |
| if (Module["monitorRunDependencies"]) { |
| Module["monitorRunDependencies"](runDependencies); |
| } |
| } |
| function removeRunDependency(id) { |
| runDependencies--; |
| if (Module["monitorRunDependencies"]) { |
| Module["monitorRunDependencies"](runDependencies); |
| } |
| if (runDependencies == 0) { |
| if (runDependencyWatcher !== null) { |
| clearInterval(runDependencyWatcher); |
| runDependencyWatcher = null; |
| } |
| if (dependenciesFulfilled) { |
| var callback = dependenciesFulfilled; |
| dependenciesFulfilled = null; |
| callback(); |
| } |
| } |
| } |
| Module["preloadedImages"] = {}; |
| Module["preloadedAudios"] = {}; |
| var dataURIPrefix = "data:application/octet-stream;base64,"; |
| function isDataURI(filename) { |
| return String.prototype.startsWith ? filename.startsWith(dataURIPrefix) : filename.indexOf(dataURIPrefix) === 0; |
| } |
| function integrateWasmJS() { |
| var wasmTextFile = "gcc-loops.wast"; |
| var wasmBinaryFile = "gcc-loops.wasm"; |
| var asmjsCodeFile = "gcc-loops.temp.asm.js"; |
| if (typeof Module["locateFile"] === "function") { |
| if (!isDataURI(wasmTextFile)) { |
| wasmTextFile = Module["locateFile"](wasmTextFile); |
| } |
| if (!isDataURI(wasmBinaryFile)) { |
| wasmBinaryFile = Module["locateFile"](wasmBinaryFile); |
| } |
| if (!isDataURI(asmjsCodeFile)) { |
| asmjsCodeFile = Module["locateFile"](asmjsCodeFile); |
| } |
| } |
| var wasmPageSize = 64 * 1024; |
| var info = { |
| "global": null, |
| "env": null, |
| "asm2wasm": { |
| "f64-rem": (function(x, y) { |
| return x % y; |
| }), |
| "debugger": (function() { |
| debugger; |
| }) |
| }, |
| "parent": Module |
| }; |
| var exports = null; |
| function mergeMemory(newBuffer) { |
| var oldBuffer = Module["buffer"]; |
| if (newBuffer.byteLength < oldBuffer.byteLength) { |
| Module["printErr"]("the new buffer in mergeMemory is smaller than the previous one. in native wasm, we should grow memory here"); |
| } |
| var oldView = new Int8Array(oldBuffer); |
| var newView = new Int8Array(newBuffer); |
| newView.set(oldView); |
| updateGlobalBuffer(newBuffer); |
| updateGlobalBufferViews(); |
| } |
| function fixImports(imports) { |
| return imports; |
| } |
| function getBinary() { |
| try { |
| if (Module["wasmBinary"]) { |
| return new Uint8Array(Module["wasmBinary"]); |
| } |
| throw "on the web, we need the wasm binary to be preloaded and set on Module['wasmBinary']. emcc.py will do that for you when generating HTML (but not JS)"; |
| } catch (err) { |
| abort(err); |
| } |
| } |
| function getBinaryPromise() { |
| if (!Module["wasmBinary"] && (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && typeof fetch === "function") { |
| return fetch(wasmBinaryFile, { |
| credentials: "same-origin" |
| }).then((function(response) { |
| if (!response["ok"]) { |
| throw "failed to load wasm binary file at '" + wasmBinaryFile + "'"; |
| } |
| return response["arrayBuffer"](); |
| })).catch((function() { |
| return getBinary(); |
| })); |
| } |
| return new Promise((function(resolve, reject) { |
| resolve(getBinary()); |
| })); |
| } |
| function doNativeWasm(global, env, providedBuffer) { |
| if (typeof WebAssembly !== "object") { |
| Module["printErr"]("no native wasm support detected"); |
| return false; |
| } |
| if (!(Module["wasmMemory"] instanceof WebAssembly.Memory)) { |
| Module["printErr"]("no native wasm Memory in use"); |
| return false; |
| } |
| env["memory"] = Module["wasmMemory"]; |
| info["global"] = { |
| "NaN": NaN, |
| "Infinity": Infinity |
| }; |
| info["global.Math"] = Math; |
| info["env"] = env; |
| function receiveInstance(instance, module) { |
| exports = instance.exports; |
| if (exports.memory) mergeMemory(exports.memory); |
| Module["asm"] = exports; |
| Module["usingWasm"] = true; |
| removeRunDependency("wasm-instantiate"); |
| } |
| addRunDependency("wasm-instantiate"); |
| if (Module["instantiateWasm"]) { |
| try { |
| return Module["instantiateWasm"](info, receiveInstance); |
| } catch (e) { |
| Module["printErr"]("Module.instantiateWasm callback failed with error: " + e); |
| return false; |
| } |
| } |
| function receiveInstantiatedSource(output) { |
| receiveInstance(output["instance"], output["module"]); |
| } |
| function instantiateArrayBuffer(receiver) { |
| getBinaryPromise().then((function(binary) { |
| return WebAssembly.instantiate(binary, info); |
| })) |
| .then((...args) => { |
| reportCompileTime(benchmarkTime() - __startupStartTime); |
| performanceMeasure("gcc-loops-wasm-startup", __startupMark); |
| return Promise.resolve(...args); |
| }) |
| .then(receiver).catch((function(reason) { |
| Module["printErr"]("failed to asynchronously prepare wasm: " + reason); |
| abort(reason); |
| })); |
| } |
| if (!Module["wasmBinary"] && typeof WebAssembly.instantiateStreaming === "function" && !isDataURI(wasmBinaryFile) && typeof fetch === "function") { |
| WebAssembly.instantiateStreaming(fetch(wasmBinaryFile, { |
| credentials: "same-origin" |
| }), info).then(receiveInstantiatedSource).catch((function(reason) { |
| Module["printErr"]("wasm streaming compile failed: " + reason); |
| Module["printErr"]("falling back to ArrayBuffer instantiation"); |
| instantiateArrayBuffer(receiveInstantiatedSource); |
| })); |
| } else { |
| instantiateArrayBuffer(receiveInstantiatedSource); |
| } |
| return {}; |
| } |
| Module["asmPreload"] = Module["asm"]; |
| var asmjsReallocBuffer = Module["reallocBuffer"]; |
| var wasmReallocBuffer = (function(size) { |
| var PAGE_MULTIPLE = Module["usingWasm"] ? WASM_PAGE_SIZE : ASMJS_PAGE_SIZE; |
| size = alignUp(size, PAGE_MULTIPLE); |
| var old = Module["buffer"]; |
| var oldSize = old.byteLength; |
| if (Module["usingWasm"]) { |
| try { |
| var result = Module["wasmMemory"].grow((size - oldSize) / wasmPageSize); |
| if (result !== (-1 | 0)) { |
| return Module["buffer"] = Module["wasmMemory"].buffer; |
| } else { |
| return null; |
| } |
| } catch (e) { |
| return null; |
| } |
| } |
| }); |
| Module["reallocBuffer"] = (function(size) { |
| if (finalMethod === "asmjs") { |
| return asmjsReallocBuffer(size); |
| } else { |
| return wasmReallocBuffer(size); |
| } |
| }); |
| var finalMethod = ""; |
| Module["asm"] = (function(global, env, providedBuffer) { |
| env = fixImports(env); |
| if (!env["table"]) { |
| var TABLE_SIZE = Module["wasmTableSize"]; |
| if (TABLE_SIZE === undefined) TABLE_SIZE = 1024; |
| var MAX_TABLE_SIZE = Module["wasmMaxTableSize"]; |
| if (typeof WebAssembly === "object" && typeof WebAssembly.Table === "function") { |
| if (MAX_TABLE_SIZE !== undefined) { |
| env["table"] = new WebAssembly.Table({ |
| "initial": TABLE_SIZE, |
| "maximum": MAX_TABLE_SIZE, |
| "element": "anyfunc" |
| }); |
| } else { |
| env["table"] = new WebAssembly.Table({ |
| "initial": TABLE_SIZE, |
| element: "anyfunc" |
| }); |
| } |
| } else { |
| env["table"] = new Array(TABLE_SIZE); |
| } |
| Module["wasmTable"] = env["table"]; |
| } |
| if (!env["memoryBase"]) { |
| env["memoryBase"] = Module["STATIC_BASE"]; |
| } |
| if (!env["tableBase"]) { |
| env["tableBase"] = 0; |
| } |
| var exports; |
| exports = doNativeWasm(global, env, providedBuffer); |
| if (!exports) abort("no binaryen method succeeded. consider enabling more options, like interpreting, if you want that: https://github.com/kripken/emscripten/wiki/WebAssembly#binaryen-methods"); |
| return exports; |
| }); |
| } |
| integrateWasmJS(); |
| STATIC_BASE = GLOBAL_BASE; |
| STATICTOP = STATIC_BASE + 242832; |
| __ATINIT__.push({ |
| func: (function() { |
| __GLOBAL__I_000101(); |
| }) |
| }, { |
| func: (function() { |
| __GLOBAL__sub_I_iostream_cpp(); |
| }) |
| }); |
| var STATIC_BUMP = 242832; |
| Module["STATIC_BASE"] = STATIC_BASE; |
| Module["STATIC_BUMP"] = STATIC_BUMP; |
| var tempDoublePtr = STATICTOP; |
| STATICTOP += 16; |
| function __ZSt18uncaught_exceptionv() { |
| return !!__ZSt18uncaught_exceptionv.uncaught_exception; |
| } |
| function ___cxa_allocate_exception(size) { |
| return _malloc(size); |
| } |
| var EXCEPTIONS = { |
| last: 0, |
| caught: [], |
| infos: {}, |
| deAdjust: (function(adjusted) { |
| if (!adjusted || EXCEPTIONS.infos[adjusted]) return adjusted; |
| for (var key in EXCEPTIONS.infos) { |
| var ptr = +key; |
| var info = EXCEPTIONS.infos[ptr]; |
| if (info.adjusted === adjusted) { |
| return ptr; |
| } |
| } |
| return adjusted; |
| }), |
| addRef: (function(ptr) { |
| if (!ptr) return; |
| var info = EXCEPTIONS.infos[ptr]; |
| info.refcount++; |
| }), |
| decRef: (function(ptr) { |
| if (!ptr) return; |
| var info = EXCEPTIONS.infos[ptr]; |
| assert(info.refcount > 0); |
| info.refcount--; |
| if (info.refcount === 0 && !info.rethrown) { |
| if (info.destructor) { |
| Module["dynCall_vi"](info.destructor, ptr); |
| } |
| delete EXCEPTIONS.infos[ptr]; |
| ___cxa_free_exception(ptr); |
| } |
| }), |
| clearRef: (function(ptr) { |
| if (!ptr) return; |
| var info = EXCEPTIONS.infos[ptr]; |
| info.refcount = 0; |
| }) |
| }; |
| function ___cxa_begin_catch(ptr) { |
| var info = EXCEPTIONS.infos[ptr]; |
| if (info && !info.caught) { |
| info.caught = true; |
| __ZSt18uncaught_exceptionv.uncaught_exception--; |
| } |
| if (info) info.rethrown = false; |
| EXCEPTIONS.caught.push(ptr); |
| EXCEPTIONS.addRef(EXCEPTIONS.deAdjust(ptr)); |
| return ptr; |
| } |
| function ___resumeException(ptr) { |
| if (!EXCEPTIONS.last) { |
| EXCEPTIONS.last = ptr; |
| } |
| throw ptr + " - Exception catching is disabled, this exception cannot be caught. Compile with -s DISABLE_EXCEPTION_CATCHING=0 or DISABLE_EXCEPTION_CATCHING=2 to catch."; |
| } |
| function ___cxa_find_matching_catch() { |
| var thrown = EXCEPTIONS.last; |
| if (!thrown) { |
| return (setTempRet0(0), 0) | 0; |
| } |
| var info = EXCEPTIONS.infos[thrown]; |
| var throwntype = info.type; |
| if (!throwntype) { |
| return (setTempRet0(0), thrown) | 0; |
| } |
| var typeArray = Array.prototype.slice.call(arguments); |
| var pointer = Module["___cxa_is_pointer_type"](throwntype); |
| if (!___cxa_find_matching_catch.buffer) ___cxa_find_matching_catch.buffer = _malloc(4); |
| HEAP32[___cxa_find_matching_catch.buffer >> 2] = thrown; |
| thrown = ___cxa_find_matching_catch.buffer; |
| for (var i = 0; i < typeArray.length; i++) { |
| if (typeArray[i] && Module["___cxa_can_catch"](typeArray[i], throwntype, thrown)) { |
| thrown = HEAP32[thrown >> 2]; |
| info.adjusted = thrown; |
| return (setTempRet0(typeArray[i]), thrown) | 0; |
| } |
| } |
| thrown = HEAP32[thrown >> 2]; |
| return (setTempRet0(throwntype), thrown) | 0; |
| } |
| function ___cxa_throw(ptr, type, destructor) { |
| EXCEPTIONS.infos[ptr] = { |
| ptr: ptr, |
| adjusted: ptr, |
| type: type, |
| destructor: destructor, |
| refcount: 0, |
| caught: false, |
| rethrown: false |
| }; |
| EXCEPTIONS.last = ptr; |
| if (!("uncaught_exception" in __ZSt18uncaught_exceptionv)) { |
| __ZSt18uncaught_exceptionv.uncaught_exception = 1; |
| } else { |
| __ZSt18uncaught_exceptionv.uncaught_exception++; |
| } |
| throw ptr + " - Exception catching is disabled, this exception cannot be caught. Compile with -s DISABLE_EXCEPTION_CATCHING=0 or DISABLE_EXCEPTION_CATCHING=2 to catch."; |
| } |
| function ___gxx_personality_v0() {} |
| function ___lock() {} |
| var ERRNO_CODES = { |
| EPERM: 1, |
| ENOENT: 2, |
| ESRCH: 3, |
| EINTR: 4, |
| EIO: 5, |
| ENXIO: 6, |
| E2BIG: 7, |
| ENOEXEC: 8, |
| EBADF: 9, |
| ECHILD: 10, |
| EAGAIN: 11, |
| EWOULDBLOCK: 11, |
| ENOMEM: 12, |
| EACCES: 13, |
| EFAULT: 14, |
| ENOTBLK: 15, |
| EBUSY: 16, |
| EEXIST: 17, |
| EXDEV: 18, |
| ENODEV: 19, |
| ENOTDIR: 20, |
| EISDIR: 21, |
| EINVAL: 22, |
| ENFILE: 23, |
| EMFILE: 24, |
| ENOTTY: 25, |
| ETXTBSY: 26, |
| EFBIG: 27, |
| ENOSPC: 28, |
| ESPIPE: 29, |
| EROFS: 30, |
| EMLINK: 31, |
| EPIPE: 32, |
| EDOM: 33, |
| ERANGE: 34, |
| ENOMSG: 42, |
| EIDRM: 43, |
| ECHRNG: 44, |
| EL2NSYNC: 45, |
| EL3HLT: 46, |
| EL3RST: 47, |
| ELNRNG: 48, |
| EUNATCH: 49, |
| ENOCSI: 50, |
| EL2HLT: 51, |
| EDEADLK: 35, |
| ENOLCK: 37, |
| EBADE: 52, |
| EBADR: 53, |
| EXFULL: 54, |
| ENOANO: 55, |
| EBADRQC: 56, |
| EBADSLT: 57, |
| EDEADLOCK: 35, |
| EBFONT: 59, |
| ENOSTR: 60, |
| ENODATA: 61, |
| ETIME: 62, |
| ENOSR: 63, |
| ENONET: 64, |
| ENOPKG: 65, |
| EREMOTE: 66, |
| ENOLINK: 67, |
| EADV: 68, |
| ESRMNT: 69, |
| ECOMM: 70, |
| EPROTO: 71, |
| EMULTIHOP: 72, |
| EDOTDOT: 73, |
| EBADMSG: 74, |
| ENOTUNIQ: 76, |
| EBADFD: 77, |
| EREMCHG: 78, |
| ELIBACC: 79, |
| ELIBBAD: 80, |
| ELIBSCN: 81, |
| ELIBMAX: 82, |
| ELIBEXEC: 83, |
| ENOSYS: 38, |
| ENOTEMPTY: 39, |
| ENAMETOOLONG: 36, |
| ELOOP: 40, |
| EOPNOTSUPP: 95, |
| EPFNOSUPPORT: 96, |
| ECONNRESET: 104, |
| ENOBUFS: 105, |
| EAFNOSUPPORT: 97, |
| EPROTOTYPE: 91, |
| ENOTSOCK: 88, |
| ENOPROTOOPT: 92, |
| ESHUTDOWN: 108, |
| ECONNREFUSED: 111, |
| EADDRINUSE: 98, |
| ECONNABORTED: 103, |
| ENETUNREACH: 101, |
| ENETDOWN: 100, |
| ETIMEDOUT: 110, |
| EHOSTDOWN: 112, |
| EHOSTUNREACH: 113, |
| EINPROGRESS: 115, |
| EALREADY: 114, |
| EDESTADDRREQ: 89, |
| EMSGSIZE: 90, |
| EPROTONOSUPPORT: 93, |
| ESOCKTNOSUPPORT: 94, |
| EADDRNOTAVAIL: 99, |
| ENETRESET: 102, |
| EISCONN: 106, |
| ENOTCONN: 107, |
| ETOOMANYREFS: 109, |
| EUSERS: 87, |
| EDQUOT: 122, |
| ESTALE: 116, |
| ENOTSUP: 95, |
| ENOMEDIUM: 123, |
| EILSEQ: 84, |
| EOVERFLOW: 75, |
| ECANCELED: 125, |
| ENOTRECOVERABLE: 131, |
| EOWNERDEAD: 130, |
| ESTRPIPE: 86 |
| }; |
| function ___setErrNo(value) { |
| if (Module["___errno_location"]) HEAP32[Module["___errno_location"]() >> 2] = value; |
| return value; |
| } |
| function ___map_file(pathname, size) { |
| ___setErrNo(ERRNO_CODES.EPERM); |
| return -1; |
| } |
| var ERRNO_MESSAGES = { |
| 0: "Success", |
| 1: "Not super-user", |
| 2: "No such file or directory", |
| 3: "No such process", |
| 4: "Interrupted system call", |
| 5: "I/O error", |
| 6: "No such device or address", |
| 7: "Arg list too long", |
| 8: "Exec format error", |
| 9: "Bad file number", |
| 10: "No children", |
| 11: "No more processes", |
| 12: "Not enough core", |
| 13: "Permission denied", |
| 14: "Bad address", |
| 15: "Block device required", |
| 16: "Mount device busy", |
| 17: "File exists", |
| 18: "Cross-device link", |
| 19: "No such device", |
| 20: "Not a directory", |
| 21: "Is a directory", |
| 22: "Invalid argument", |
| 23: "Too many open files in system", |
| 24: "Too many open files", |
| 25: "Not a typewriter", |
| 26: "Text file busy", |
| 27: "File too large", |
| 28: "No space left on device", |
| 29: "Illegal seek", |
| 30: "Read only file system", |
| 31: "Too many links", |
| 32: "Broken pipe", |
| 33: "Math arg out of domain of func", |
| 34: "Math result not representable", |
| 35: "File locking deadlock error", |
| 36: "File or path name too long", |
| 37: "No record locks available", |
| 38: "Function not implemented", |
| 39: "Directory not empty", |
| 40: "Too many symbolic links", |
| 42: "No message of desired type", |
| 43: "Identifier removed", |
| 44: "Channel number out of range", |
| 45: "Level 2 not synchronized", |
| 46: "Level 3 halted", |
| 47: "Level 3 reset", |
| 48: "Link number out of range", |
| 49: "Protocol driver not attached", |
| 50: "No CSI structure available", |
| 51: "Level 2 halted", |
| 52: "Invalid exchange", |
| 53: "Invalid request descriptor", |
| 54: "Exchange full", |
| 55: "No anode", |
| 56: "Invalid request code", |
| 57: "Invalid slot", |
| 59: "Bad font file fmt", |
| 60: "Device not a stream", |
| 61: "No data (for no delay io)", |
| 62: "Timer expired", |
| 63: "Out of streams resources", |
| 64: "Machine is not on the network", |
| 65: "Package not installed", |
| 66: "The object is remote", |
| 67: "The link has been severed", |
| 68: "Advertise error", |
| 69: "Srmount error", |
| 70: "Communication error on send", |
| 71: "Protocol error", |
| 72: "Multihop attempted", |
| 73: "Cross mount point (not really error)", |
| 74: "Trying to read unreadable message", |
| 75: "Value too large for defined data type", |
| 76: "Given log. name not unique", |
| 77: "f.d. invalid for this operation", |
| 78: "Remote address changed", |
| 79: "Can access a needed shared lib", |
| 80: "Accessing a corrupted shared lib", |
| 81: ".lib section in a.out corrupted", |
| 82: "Attempting to link in too many libs", |
| 83: "Attempting to exec a shared library", |
| 84: "Illegal byte sequence", |
| 86: "Streams pipe error", |
| 87: "Too many users", |
| 88: "Socket operation on non-socket", |
| 89: "Destination address required", |
| 90: "Message too long", |
| 91: "Protocol wrong type for socket", |
| 92: "Protocol not available", |
| 93: "Unknown protocol", |
| 94: "Socket type not supported", |
| 95: "Not supported", |
| 96: "Protocol family not supported", |
| 97: "Address family not supported by protocol family", |
| 98: "Address already in use", |
| 99: "Address not available", |
| 100: "Network interface is not configured", |
| 101: "Network is unreachable", |
| 102: "Connection reset by network", |
| 103: "Connection aborted", |
| 104: "Connection reset by peer", |
| 105: "No buffer space available", |
| 106: "Socket is already connected", |
| 107: "Socket is not connected", |
| 108: "Can't send after socket shutdown", |
| 109: "Too many references", |
| 110: "Connection timed out", |
| 111: "Connection refused", |
| 112: "Host is down", |
| 113: "Host is unreachable", |
| 114: "Socket already connected", |
| 115: "Connection already in progress", |
| 116: "Stale file handle", |
| 122: "Quota exceeded", |
| 123: "No medium (in tape drive)", |
| 125: "Operation canceled", |
| 130: "Previous owner died", |
| 131: "State not recoverable" |
| }; |
| var PATH = { |
| splitPath: (function(filename) { |
| var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/; |
| return splitPathRe.exec(filename).slice(1); |
| }), |
| normalizeArray: (function(parts, allowAboveRoot) { |
| var up = 0; |
| for (var i = parts.length - 1; i >= 0; i--) { |
| var last = parts[i]; |
| if (last === ".") { |
| parts.splice(i, 1); |
| } else if (last === "..") { |
| parts.splice(i, 1); |
| up++; |
| } else if (up) { |
| parts.splice(i, 1); |
| up--; |
| } |
| } |
| if (allowAboveRoot) { |
| for (; up; up--) { |
| parts.unshift(".."); |
| } |
| } |
| return parts; |
| }), |
| normalize: (function(path) { |
| var isAbsolute = path.charAt(0) === "/", trailingSlash = path.substr(-1) === "/"; |
| path = PATH.normalizeArray(path.split("/").filter((function(p) { |
| return !!p; |
| })), !isAbsolute).join("/"); |
| if (!path && !isAbsolute) { |
| path = "."; |
| } |
| if (path && trailingSlash) { |
| path += "/"; |
| } |
| return (isAbsolute ? "/" : "") + path; |
| }), |
| dirname: (function(path) { |
| var result = PATH.splitPath(path), root = result[0], dir = result[1]; |
| if (!root && !dir) { |
| return "."; |
| } |
| if (dir) { |
| dir = dir.substr(0, dir.length - 1); |
| } |
| return root + dir; |
| }), |
| basename: (function(path) { |
| if (path === "/") return "/"; |
| var lastSlash = path.lastIndexOf("/"); |
| if (lastSlash === -1) return path; |
| return path.substr(lastSlash + 1); |
| }), |
| extname: (function(path) { |
| return PATH.splitPath(path)[3]; |
| }), |
| join: (function() { |
| var paths = Array.prototype.slice.call(arguments, 0); |
| return PATH.normalize(paths.join("/")); |
| }), |
| join2: (function(l, r) { |
| return PATH.normalize(l + "/" + r); |
| }), |
| resolve: (function() { |
| var resolvedPath = "", resolvedAbsolute = false; |
| for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) { |
| var path = i >= 0 ? arguments[i] : FS.cwd(); |
| if (typeof path !== "string") { |
| throw new TypeError("Arguments to path.resolve must be strings"); |
| } else if (!path) { |
| return ""; |
| } |
| resolvedPath = path + "/" + resolvedPath; |
| resolvedAbsolute = path.charAt(0) === "/"; |
| } |
| resolvedPath = PATH.normalizeArray(resolvedPath.split("/").filter((function(p) { |
| return !!p; |
| })), !resolvedAbsolute).join("/"); |
| return (resolvedAbsolute ? "/" : "") + resolvedPath || "."; |
| }), |
| relative: (function(from, to) { |
| from = PATH.resolve(from).substr(1); |
| to = PATH.resolve(to).substr(1); |
| function trim(arr) { |
| var start = 0; |
| for (; start < arr.length; start++) { |
| if (arr[start] !== "") break; |
| } |
| var end = arr.length - 1; |
| for (; end >= 0; end--) { |
| if (arr[end] !== "") break; |
| } |
| if (start > end) return []; |
| return arr.slice(start, end - start + 1); |
| } |
| var fromParts = trim(from.split("/")); |
| var toParts = trim(to.split("/")); |
| var length = Math.min(fromParts.length, toParts.length); |
| var samePartsLength = length; |
| for (var i = 0; i < length; i++) { |
| if (fromParts[i] !== toParts[i]) { |
| samePartsLength = i; |
| break; |
| } |
| } |
| var outputParts = []; |
| for (var i = samePartsLength; i < fromParts.length; i++) { |
| outputParts.push(".."); |
| } |
| outputParts = outputParts.concat(toParts.slice(samePartsLength)); |
| return outputParts.join("/"); |
| }) |
| }; |
| var TTY = { |
| ttys: [], |
| init: (function() {}), |
| shutdown: (function() {}), |
| register: (function(dev, ops) { |
| TTY.ttys[dev] = { |
| input: [], |
| output: [], |
| ops: ops |
| }; |
| FS.registerDevice(dev, TTY.stream_ops); |
| }), |
| stream_ops: { |
| open: (function(stream) { |
| var tty = TTY.ttys[stream.node.rdev]; |
| if (!tty) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENODEV); |
| } |
| stream.tty = tty; |
| stream.seekable = false; |
| }), |
| close: (function(stream) { |
| stream.tty.ops.flush(stream.tty); |
| }), |
| flush: (function(stream) { |
| stream.tty.ops.flush(stream.tty); |
| }), |
| read: (function(stream, buffer, offset, length, pos) { |
| if (!stream.tty || !stream.tty.ops.get_char) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENXIO); |
| } |
| var bytesRead = 0; |
| for (var i = 0; i < length; i++) { |
| var result; |
| try { |
| result = stream.tty.ops.get_char(stream.tty); |
| } catch (e) { |
| throw new FS.ErrnoError(ERRNO_CODES.EIO); |
| } |
| if (result === undefined && bytesRead === 0) { |
| throw new FS.ErrnoError(ERRNO_CODES.EAGAIN); |
| } |
| if (result === null || result === undefined) break; |
| bytesRead++; |
| buffer[offset + i] = result; |
| } |
| if (bytesRead) { |
| stream.node.timestamp = Date.now(); |
| } |
| return bytesRead; |
| }), |
| write: (function(stream, buffer, offset, length, pos) { |
| if (!stream.tty || !stream.tty.ops.put_char) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENXIO); |
| } |
| for (var i = 0; i < length; i++) { |
| try { |
| stream.tty.ops.put_char(stream.tty, buffer[offset + i]); |
| } catch (e) { |
| throw new FS.ErrnoError(ERRNO_CODES.EIO); |
| } |
| } |
| if (length) { |
| stream.node.timestamp = Date.now(); |
| } |
| return i; |
| }) |
| }, |
| default_tty_ops: { |
| get_char: (function(tty) { |
| if (!tty.input.length) { |
| var result = null; |
| if (ENVIRONMENT_IS_NODE) { |
| var BUFSIZE = 256; |
| var buf = new Buffer(BUFSIZE); |
| var bytesRead = 0; |
| var isPosixPlatform = process.platform != "win32"; |
| var fd = process.stdin.fd; |
| if (isPosixPlatform) { |
| var usingDevice = false; |
| try { |
| fd = fs.openSync("/dev/stdin", "r"); |
| usingDevice = true; |
| } catch (e) {} |
| } |
| try { |
| bytesRead = fs.readSync(fd, buf, 0, BUFSIZE, null); |
| } catch (e) { |
| if (e.toString().indexOf("EOF") != -1) bytesRead = 0; else throw e; |
| } |
| if (usingDevice) { |
| fs.closeSync(fd); |
| } |
| if (bytesRead > 0) { |
| result = buf.slice(0, bytesRead).toString("utf-8"); |
| } else { |
| result = null; |
| } |
| } else if (typeof window != "undefined" && typeof window.prompt == "function") { |
| result = window.prompt("Input: "); |
| if (result !== null) { |
| result += "\n"; |
| } |
| } else if (typeof readline == "function") { |
| result = readline(); |
| if (result !== null) { |
| result += "\n"; |
| } |
| } |
| if (!result) { |
| return null; |
| } |
| tty.input = intArrayFromString(result, true); |
| } |
| return tty.input.shift(); |
| }), |
| put_char: (function(tty, val) { |
| if (val === null || val === 10) { |
| Module["print"](UTF8ArrayToString(tty.output, 0)); |
| tty.output = []; |
| } else { |
| if (val != 0) tty.output.push(val); |
| } |
| }), |
| flush: (function(tty) { |
| if (tty.output && tty.output.length > 0) { |
| Module["print"](UTF8ArrayToString(tty.output, 0)); |
| tty.output = []; |
| } |
| }) |
| }, |
| default_tty1_ops: { |
| put_char: (function(tty, val) { |
| if (val === null || val === 10) { |
| Module["printErr"](UTF8ArrayToString(tty.output, 0)); |
| tty.output = []; |
| } else { |
| if (val != 0) tty.output.push(val); |
| } |
| }), |
| flush: (function(tty) { |
| if (tty.output && tty.output.length > 0) { |
| Module["printErr"](UTF8ArrayToString(tty.output, 0)); |
| tty.output = []; |
| } |
| }) |
| } |
| }; |
| var MEMFS = { |
| ops_table: null, |
| mount: (function(mount) { |
| return MEMFS.createNode(null, "/", 16384 | 511, 0); |
| }), |
| createNode: (function(parent, name, mode, dev) { |
| if (FS.isBlkdev(mode) || FS.isFIFO(mode)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| } |
| if (!MEMFS.ops_table) { |
| MEMFS.ops_table = { |
| dir: { |
| node: { |
| getattr: MEMFS.node_ops.getattr, |
| setattr: MEMFS.node_ops.setattr, |
| lookup: MEMFS.node_ops.lookup, |
| mknod: MEMFS.node_ops.mknod, |
| rename: MEMFS.node_ops.rename, |
| unlink: MEMFS.node_ops.unlink, |
| rmdir: MEMFS.node_ops.rmdir, |
| readdir: MEMFS.node_ops.readdir, |
| symlink: MEMFS.node_ops.symlink |
| }, |
| stream: { |
| llseek: MEMFS.stream_ops.llseek |
| } |
| }, |
| file: { |
| node: { |
| getattr: MEMFS.node_ops.getattr, |
| setattr: MEMFS.node_ops.setattr |
| }, |
| stream: { |
| llseek: MEMFS.stream_ops.llseek, |
| read: MEMFS.stream_ops.read, |
| write: MEMFS.stream_ops.write, |
| allocate: MEMFS.stream_ops.allocate, |
| mmap: MEMFS.stream_ops.mmap, |
| msync: MEMFS.stream_ops.msync |
| } |
| }, |
| link: { |
| node: { |
| getattr: MEMFS.node_ops.getattr, |
| setattr: MEMFS.node_ops.setattr, |
| readlink: MEMFS.node_ops.readlink |
| }, |
| stream: {} |
| }, |
| chrdev: { |
| node: { |
| getattr: MEMFS.node_ops.getattr, |
| setattr: MEMFS.node_ops.setattr |
| }, |
| stream: FS.chrdev_stream_ops |
| } |
| }; |
| } |
| var node = FS.createNode(parent, name, mode, dev); |
| if (FS.isDir(node.mode)) { |
| node.node_ops = MEMFS.ops_table.dir.node; |
| node.stream_ops = MEMFS.ops_table.dir.stream; |
| node.contents = {}; |
| } else if (FS.isFile(node.mode)) { |
| node.node_ops = MEMFS.ops_table.file.node; |
| node.stream_ops = MEMFS.ops_table.file.stream; |
| node.usedBytes = 0; |
| node.contents = null; |
| } else if (FS.isLink(node.mode)) { |
| node.node_ops = MEMFS.ops_table.link.node; |
| node.stream_ops = MEMFS.ops_table.link.stream; |
| } else if (FS.isChrdev(node.mode)) { |
| node.node_ops = MEMFS.ops_table.chrdev.node; |
| node.stream_ops = MEMFS.ops_table.chrdev.stream; |
| } |
| node.timestamp = Date.now(); |
| if (parent) { |
| parent.contents[name] = node; |
| } |
| return node; |
| }), |
| getFileDataAsRegularArray: (function(node) { |
| if (node.contents && node.contents.subarray) { |
| var arr = []; |
| for (var i = 0; i < node.usedBytes; ++i) arr.push(node.contents[i]); |
| return arr; |
| } |
| return node.contents; |
| }), |
| getFileDataAsTypedArray: (function(node) { |
| if (!node.contents) return new Uint8Array; |
| if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); |
| return new Uint8Array(node.contents); |
| }), |
| expandFileStorage: (function(node, newCapacity) { |
| if (node.contents && node.contents.subarray && newCapacity > node.contents.length) { |
| node.contents = MEMFS.getFileDataAsRegularArray(node); |
| node.usedBytes = node.contents.length; |
| } |
| if (!node.contents || node.contents.subarray) { |
| var prevCapacity = node.contents ? node.contents.length : 0; |
| if (prevCapacity >= newCapacity) return; |
| var CAPACITY_DOUBLING_MAX = 1024 * 1024; |
| newCapacity = Math.max(newCapacity, prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2 : 1.125) | 0); |
| if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); |
| var oldContents = node.contents; |
| node.contents = new Uint8Array(newCapacity); |
| if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); |
| return; |
| } |
| if (!node.contents && newCapacity > 0) node.contents = []; |
| while (node.contents.length < newCapacity) node.contents.push(0); |
| }), |
| resizeFileStorage: (function(node, newSize) { |
| if (node.usedBytes == newSize) return; |
| if (newSize == 0) { |
| node.contents = null; |
| node.usedBytes = 0; |
| return; |
| } |
| if (!node.contents || node.contents.subarray) { |
| var oldContents = node.contents; |
| node.contents = new Uint8Array(new ArrayBuffer(newSize)); |
| if (oldContents) { |
| node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); |
| } |
| node.usedBytes = newSize; |
| return; |
| } |
| if (!node.contents) node.contents = []; |
| if (node.contents.length > newSize) node.contents.length = newSize; else while (node.contents.length < newSize) node.contents.push(0); |
| node.usedBytes = newSize; |
| }), |
| node_ops: { |
| getattr: (function(node) { |
| var attr = {}; |
| attr.dev = FS.isChrdev(node.mode) ? node.id : 1; |
| attr.ino = node.id; |
| attr.mode = node.mode; |
| attr.nlink = 1; |
| attr.uid = 0; |
| attr.gid = 0; |
| attr.rdev = node.rdev; |
| if (FS.isDir(node.mode)) { |
| attr.size = 4096; |
| } else if (FS.isFile(node.mode)) { |
| attr.size = node.usedBytes; |
| } else if (FS.isLink(node.mode)) { |
| attr.size = node.link.length; |
| } else { |
| attr.size = 0; |
| } |
| attr.atime = new Date(node.timestamp); |
| attr.mtime = new Date(node.timestamp); |
| attr.ctime = new Date(node.timestamp); |
| attr.blksize = 4096; |
| attr.blocks = Math.ceil(attr.size / attr.blksize); |
| return attr; |
| }), |
| setattr: (function(node, attr) { |
| if (attr.mode !== undefined) { |
| node.mode = attr.mode; |
| } |
| if (attr.timestamp !== undefined) { |
| node.timestamp = attr.timestamp; |
| } |
| if (attr.size !== undefined) { |
| MEMFS.resizeFileStorage(node, attr.size); |
| } |
| }), |
| lookup: (function(parent, name) { |
| throw FS.genericErrors[ERRNO_CODES.ENOENT]; |
| }), |
| mknod: (function(parent, name, mode, dev) { |
| return MEMFS.createNode(parent, name, mode, dev); |
| }), |
| rename: (function(old_node, new_dir, new_name) { |
| if (FS.isDir(old_node.mode)) { |
| var new_node; |
| try { |
| new_node = FS.lookupNode(new_dir, new_name); |
| } catch (e) {} |
| if (new_node) { |
| for (var i in new_node.contents) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY); |
| } |
| } |
| } |
| delete old_node.parent.contents[old_node.name]; |
| old_node.name = new_name; |
| new_dir.contents[new_name] = old_node; |
| old_node.parent = new_dir; |
| }), |
| unlink: (function(parent, name) { |
| delete parent.contents[name]; |
| }), |
| rmdir: (function(parent, name) { |
| var node = FS.lookupNode(parent, name); |
| for (var i in node.contents) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY); |
| } |
| delete parent.contents[name]; |
| }), |
| readdir: (function(node) { |
| var entries = [ ".", ".." ]; |
| for (var key in node.contents) { |
| if (!node.contents.hasOwnProperty(key)) { |
| continue; |
| } |
| entries.push(key); |
| } |
| return entries; |
| }), |
| symlink: (function(parent, newname, oldpath) { |
| var node = MEMFS.createNode(parent, newname, 511 | 40960, 0); |
| node.link = oldpath; |
| return node; |
| }), |
| readlink: (function(node) { |
| if (!FS.isLink(node.mode)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| return node.link; |
| }) |
| }, |
| stream_ops: { |
| read: (function(stream, buffer, offset, length, position) { |
| var contents = stream.node.contents; |
| if (position >= stream.node.usedBytes) return 0; |
| var size = Math.min(stream.node.usedBytes - position, length); |
| assert(size >= 0); |
| if (size > 8 && contents.subarray) { |
| buffer.set(contents.subarray(position, position + size), offset); |
| } else { |
| for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i]; |
| } |
| return size; |
| }), |
| write: (function(stream, buffer, offset, length, position, canOwn) { |
| if (!length) return 0; |
| var node = stream.node; |
| node.timestamp = Date.now(); |
| if (buffer.subarray && (!node.contents || node.contents.subarray)) { |
| if (canOwn) { |
| node.contents = buffer.subarray(offset, offset + length); |
| node.usedBytes = length; |
| return length; |
| } else if (node.usedBytes === 0 && position === 0) { |
| node.contents = new Uint8Array(buffer.subarray(offset, offset + length)); |
| node.usedBytes = length; |
| return length; |
| } else if (position + length <= node.usedBytes) { |
| node.contents.set(buffer.subarray(offset, offset + length), position); |
| return length; |
| } |
| } |
| MEMFS.expandFileStorage(node, position + length); |
| if (node.contents.subarray && buffer.subarray) node.contents.set(buffer.subarray(offset, offset + length), position); else { |
| for (var i = 0; i < length; i++) { |
| node.contents[position + i] = buffer[offset + i]; |
| } |
| } |
| node.usedBytes = Math.max(node.usedBytes, position + length); |
| return length; |
| }), |
| llseek: (function(stream, offset, whence) { |
| var position = offset; |
| if (whence === 1) { |
| position += stream.position; |
| } else if (whence === 2) { |
| if (FS.isFile(stream.node.mode)) { |
| position += stream.node.usedBytes; |
| } |
| } |
| if (position < 0) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| return position; |
| }), |
| allocate: (function(stream, offset, length) { |
| MEMFS.expandFileStorage(stream.node, offset + length); |
| stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length); |
| }), |
| mmap: (function(stream, buffer, offset, length, position, prot, flags) { |
| if (!FS.isFile(stream.node.mode)) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENODEV); |
| } |
| var ptr; |
| var allocated; |
| var contents = stream.node.contents; |
| if (!(flags & 2) && (contents.buffer === buffer || contents.buffer === buffer.buffer)) { |
| allocated = false; |
| ptr = contents.byteOffset; |
| } else { |
| if (position > 0 || position + length < stream.node.usedBytes) { |
| if (contents.subarray) { |
| contents = contents.subarray(position, position + length); |
| } else { |
| contents = Array.prototype.slice.call(contents, position, position + length); |
| } |
| } |
| allocated = true; |
| ptr = _malloc(length); |
| if (!ptr) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOMEM); |
| } |
| buffer.set(contents, ptr); |
| } |
| return { |
| ptr: ptr, |
| allocated: allocated |
| }; |
| }), |
| msync: (function(stream, buffer, offset, length, mmapFlags) { |
| if (!FS.isFile(stream.node.mode)) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENODEV); |
| } |
| if (mmapFlags & 2) { |
| return 0; |
| } |
| var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false); |
| return 0; |
| }) |
| } |
| }; |
| var IDBFS = { |
| dbs: {}, |
| indexedDB: (function() { |
| if (typeof indexedDB !== "undefined") return indexedDB; |
| var ret = null; |
| if (typeof window === "object") ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB; |
| assert(ret, "IDBFS used, but indexedDB not supported"); |
| return ret; |
| }), |
| DB_VERSION: 21, |
| DB_STORE_NAME: "FILE_DATA", |
| mount: (function(mount) { |
| return MEMFS.mount.apply(null, arguments); |
| }), |
| syncfs: (function(mount, populate, callback) { |
| IDBFS.getLocalSet(mount, (function(err, local) { |
| if (err) return callback(err); |
| IDBFS.getRemoteSet(mount, (function(err, remote) { |
| if (err) return callback(err); |
| var src = populate ? remote : local; |
| var dst = populate ? local : remote; |
| IDBFS.reconcile(src, dst, callback); |
| })); |
| })); |
| }), |
| getDB: (function(name, callback) { |
| var db = IDBFS.dbs[name]; |
| if (db) { |
| return callback(null, db); |
| } |
| var req; |
| try { |
| req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION); |
| } catch (e) { |
| return callback(e); |
| } |
| if (!req) { |
| return callback("Unable to connect to IndexedDB"); |
| } |
| req.onupgradeneeded = (function(e) { |
| var db = e.target.result; |
| var transaction = e.target.transaction; |
| var fileStore; |
| if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) { |
| fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME); |
| } else { |
| fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME); |
| } |
| if (!fileStore.indexNames.contains("timestamp")) { |
| fileStore.createIndex("timestamp", "timestamp", { |
| unique: false |
| }); |
| } |
| }); |
| req.onsuccess = (function() { |
| db = req.result; |
| IDBFS.dbs[name] = db; |
| callback(null, db); |
| }); |
| req.onerror = (function(e) { |
| callback(this.error); |
| e.preventDefault(); |
| }); |
| }), |
| getLocalSet: (function(mount, callback) { |
| var entries = {}; |
| function isRealDir(p) { |
| return p !== "." && p !== ".."; |
| } |
| function toAbsolute(root) { |
| return (function(p) { |
| return PATH.join2(root, p); |
| }); |
| } |
| var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint)); |
| while (check.length) { |
| var path = check.pop(); |
| var stat; |
| try { |
| stat = FS.stat(path); |
| } catch (e) { |
| return callback(e); |
| } |
| if (FS.isDir(stat.mode)) { |
| check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path))); |
| } |
| entries[path] = { |
| timestamp: stat.mtime |
| }; |
| } |
| return callback(null, { |
| type: "local", |
| entries: entries |
| }); |
| }), |
| getRemoteSet: (function(mount, callback) { |
| var entries = {}; |
| IDBFS.getDB(mount.mountpoint, (function(err, db) { |
| if (err) return callback(err); |
| try { |
| var transaction = db.transaction([ IDBFS.DB_STORE_NAME ], "readonly"); |
| transaction.onerror = (function(e) { |
| callback(this.error); |
| e.preventDefault(); |
| }); |
| var store = transaction.objectStore(IDBFS.DB_STORE_NAME); |
| var index = store.index("timestamp"); |
| index.openKeyCursor().onsuccess = (function(event) { |
| var cursor = event.target.result; |
| if (!cursor) { |
| return callback(null, { |
| type: "remote", |
| db: db, |
| entries: entries |
| }); |
| } |
| entries[cursor.primaryKey] = { |
| timestamp: cursor.key |
| }; |
| cursor.continue(); |
| }); |
| } catch (e) { |
| return callback(e); |
| } |
| })); |
| }), |
| loadLocalEntry: (function(path, callback) { |
| var stat, node; |
| try { |
| var lookup = FS.lookupPath(path); |
| node = lookup.node; |
| stat = FS.stat(path); |
| } catch (e) { |
| return callback(e); |
| } |
| if (FS.isDir(stat.mode)) { |
| return callback(null, { |
| timestamp: stat.mtime, |
| mode: stat.mode |
| }); |
| } else if (FS.isFile(stat.mode)) { |
| node.contents = MEMFS.getFileDataAsTypedArray(node); |
| return callback(null, { |
| timestamp: stat.mtime, |
| mode: stat.mode, |
| contents: node.contents |
| }); |
| } else { |
| return callback(new Error("node type not supported")); |
| } |
| }), |
| storeLocalEntry: (function(path, entry, callback) { |
| try { |
| if (FS.isDir(entry.mode)) { |
| FS.mkdir(path, entry.mode); |
| } else if (FS.isFile(entry.mode)) { |
| FS.writeFile(path, entry.contents, { |
| canOwn: true |
| }); |
| } else { |
| return callback(new Error("node type not supported")); |
| } |
| FS.chmod(path, entry.mode); |
| FS.utime(path, entry.timestamp, entry.timestamp); |
| } catch (e) { |
| return callback(e); |
| } |
| callback(null); |
| }), |
| removeLocalEntry: (function(path, callback) { |
| try { |
| var lookup = FS.lookupPath(path); |
| var stat = FS.stat(path); |
| if (FS.isDir(stat.mode)) { |
| FS.rmdir(path); |
| } else if (FS.isFile(stat.mode)) { |
| FS.unlink(path); |
| } |
| } catch (e) { |
| return callback(e); |
| } |
| callback(null); |
| }), |
| loadRemoteEntry: (function(store, path, callback) { |
| var req = store.get(path); |
| req.onsuccess = (function(event) { |
| callback(null, event.target.result); |
| }); |
| req.onerror = (function(e) { |
| callback(this.error); |
| e.preventDefault(); |
| }); |
| }), |
| storeRemoteEntry: (function(store, path, entry, callback) { |
| var req = store.put(entry, path); |
| req.onsuccess = (function() { |
| callback(null); |
| }); |
| req.onerror = (function(e) { |
| callback(this.error); |
| e.preventDefault(); |
| }); |
| }), |
| removeRemoteEntry: (function(store, path, callback) { |
| var req = store.delete(path); |
| req.onsuccess = (function() { |
| callback(null); |
| }); |
| req.onerror = (function(e) { |
| callback(this.error); |
| e.preventDefault(); |
| }); |
| }), |
| reconcile: (function(src, dst, callback) { |
| var total = 0; |
| var create = []; |
| Object.keys(src.entries).forEach((function(key) { |
| var e = src.entries[key]; |
| var e2 = dst.entries[key]; |
| if (!e2 || e.timestamp > e2.timestamp) { |
| create.push(key); |
| total++; |
| } |
| })); |
| var remove = []; |
| Object.keys(dst.entries).forEach((function(key) { |
| var e = dst.entries[key]; |
| var e2 = src.entries[key]; |
| if (!e2) { |
| remove.push(key); |
| total++; |
| } |
| })); |
| if (!total) { |
| return callback(null); |
| } |
| var completed = 0; |
| var db = src.type === "remote" ? src.db : dst.db; |
| var transaction = db.transaction([ IDBFS.DB_STORE_NAME ], "readwrite"); |
| var store = transaction.objectStore(IDBFS.DB_STORE_NAME); |
| function done(err) { |
| if (err) { |
| if (!done.errored) { |
| done.errored = true; |
| return callback(err); |
| } |
| return; |
| } |
| if (++completed >= total) { |
| return callback(null); |
| } |
| } |
| transaction.onerror = (function(e) { |
| done(this.error); |
| e.preventDefault(); |
| }); |
| create.sort().forEach((function(path) { |
| if (dst.type === "local") { |
| IDBFS.loadRemoteEntry(store, path, (function(err, entry) { |
| if (err) return done(err); |
| IDBFS.storeLocalEntry(path, entry, done); |
| })); |
| } else { |
| IDBFS.loadLocalEntry(path, (function(err, entry) { |
| if (err) return done(err); |
| IDBFS.storeRemoteEntry(store, path, entry, done); |
| })); |
| } |
| })); |
| remove.sort().reverse().forEach((function(path) { |
| if (dst.type === "local") { |
| IDBFS.removeLocalEntry(path, done); |
| } else { |
| IDBFS.removeRemoteEntry(store, path, done); |
| } |
| })); |
| }) |
| }; |
| var NODEFS = { |
| isWindows: false, |
| staticInit: (function() { |
| NODEFS.isWindows = !!process.platform.match(/^win/); |
| var flags = process["binding"]("constants"); |
| if (flags["fs"]) { |
| flags = flags["fs"]; |
| } |
| NODEFS.flagsForNodeMap = { |
| "1024": flags["O_APPEND"], |
| "64": flags["O_CREAT"], |
| "128": flags["O_EXCL"], |
| "0": flags["O_RDONLY"], |
| "2": flags["O_RDWR"], |
| "4096": flags["O_SYNC"], |
| "512": flags["O_TRUNC"], |
| "1": flags["O_WRONLY"] |
| }; |
| }), |
| bufferFrom: (function(arrayBuffer) { |
| return Buffer.alloc ? Buffer.from(arrayBuffer) : new Buffer(arrayBuffer); |
| }), |
| mount: (function(mount) { |
| assert(ENVIRONMENT_IS_NODE); |
| return NODEFS.createNode(null, "/", NODEFS.getMode(mount.opts.root), 0); |
| }), |
| createNode: (function(parent, name, mode, dev) { |
| if (!FS.isDir(mode) && !FS.isFile(mode) && !FS.isLink(mode)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| var node = FS.createNode(parent, name, mode); |
| node.node_ops = NODEFS.node_ops; |
| node.stream_ops = NODEFS.stream_ops; |
| return node; |
| }), |
| getMode: (function(path) { |
| var stat; |
| try { |
| stat = fs.lstatSync(path); |
| if (NODEFS.isWindows) { |
| stat.mode = stat.mode | (stat.mode & 292) >> 2; |
| } |
| } catch (e) { |
| if (!e.code) throw e; |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| return stat.mode; |
| }), |
| realPath: (function(node) { |
| var parts = []; |
| while (node.parent !== node) { |
| parts.push(node.name); |
| node = node.parent; |
| } |
| parts.push(node.mount.opts.root); |
| parts.reverse(); |
| return PATH.join.apply(null, parts); |
| }), |
| flagsForNode: (function(flags) { |
| flags &= ~2097152; |
| flags &= ~2048; |
| flags &= ~32768; |
| flags &= ~524288; |
| var newFlags = 0; |
| for (var k in NODEFS.flagsForNodeMap) { |
| if (flags & k) { |
| newFlags |= NODEFS.flagsForNodeMap[k]; |
| flags ^= k; |
| } |
| } |
| if (!flags) { |
| return newFlags; |
| } else { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| }), |
| node_ops: { |
| getattr: (function(node) { |
| var path = NODEFS.realPath(node); |
| var stat; |
| try { |
| stat = fs.lstatSync(path); |
| } catch (e) { |
| if (!e.code) throw e; |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| if (NODEFS.isWindows && !stat.blksize) { |
| stat.blksize = 4096; |
| } |
| if (NODEFS.isWindows && !stat.blocks) { |
| stat.blocks = (stat.size + stat.blksize - 1) / stat.blksize | 0; |
| } |
| return { |
| dev: stat.dev, |
| ino: stat.ino, |
| mode: stat.mode, |
| nlink: stat.nlink, |
| uid: stat.uid, |
| gid: stat.gid, |
| rdev: stat.rdev, |
| size: stat.size, |
| atime: stat.atime, |
| mtime: stat.mtime, |
| ctime: stat.ctime, |
| blksize: stat.blksize, |
| blocks: stat.blocks |
| }; |
| }), |
| setattr: (function(node, attr) { |
| var path = NODEFS.realPath(node); |
| try { |
| if (attr.mode !== undefined) { |
| fs.chmodSync(path, attr.mode); |
| node.mode = attr.mode; |
| } |
| if (attr.timestamp !== undefined) { |
| var date = new Date(attr.timestamp); |
| fs.utimesSync(path, date, date); |
| } |
| if (attr.size !== undefined) { |
| fs.truncateSync(path, attr.size); |
| } |
| } catch (e) { |
| if (!e.code) throw e; |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| }), |
| lookup: (function(parent, name) { |
| var path = PATH.join2(NODEFS.realPath(parent), name); |
| var mode = NODEFS.getMode(path); |
| return NODEFS.createNode(parent, name, mode); |
| }), |
| mknod: (function(parent, name, mode, dev) { |
| var node = NODEFS.createNode(parent, name, mode, dev); |
| var path = NODEFS.realPath(node); |
| try { |
| if (FS.isDir(node.mode)) { |
| fs.mkdirSync(path, node.mode); |
| } else { |
| fs.writeFileSync(path, "", { |
| mode: node.mode |
| }); |
| } |
| } catch (e) { |
| if (!e.code) throw e; |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| return node; |
| }), |
| rename: (function(oldNode, newDir, newName) { |
| var oldPath = NODEFS.realPath(oldNode); |
| var newPath = PATH.join2(NODEFS.realPath(newDir), newName); |
| try { |
| fs.renameSync(oldPath, newPath); |
| } catch (e) { |
| if (!e.code) throw e; |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| }), |
| unlink: (function(parent, name) { |
| var path = PATH.join2(NODEFS.realPath(parent), name); |
| try { |
| fs.unlinkSync(path); |
| } catch (e) { |
| if (!e.code) throw e; |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| }), |
| rmdir: (function(parent, name) { |
| var path = PATH.join2(NODEFS.realPath(parent), name); |
| try { |
| fs.rmdirSync(path); |
| } catch (e) { |
| if (!e.code) throw e; |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| }), |
| readdir: (function(node) { |
| var path = NODEFS.realPath(node); |
| try { |
| return fs.readdirSync(path); |
| } catch (e) { |
| if (!e.code) throw e; |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| }), |
| symlink: (function(parent, newName, oldPath) { |
| var newPath = PATH.join2(NODEFS.realPath(parent), newName); |
| try { |
| fs.symlinkSync(oldPath, newPath); |
| } catch (e) { |
| if (!e.code) throw e; |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| }), |
| readlink: (function(node) { |
| var path = NODEFS.realPath(node); |
| try { |
| path = fs.readlinkSync(path); |
| path = NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root), path); |
| return path; |
| } catch (e) { |
| if (!e.code) throw e; |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| }) |
| }, |
| stream_ops: { |
| open: (function(stream) { |
| var path = NODEFS.realPath(stream.node); |
| try { |
| if (FS.isFile(stream.node.mode)) { |
| stream.nfd = fs.openSync(path, NODEFS.flagsForNode(stream.flags)); |
| } |
| } catch (e) { |
| if (!e.code) throw e; |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| }), |
| close: (function(stream) { |
| try { |
| if (FS.isFile(stream.node.mode) && stream.nfd) { |
| fs.closeSync(stream.nfd); |
| } |
| } catch (e) { |
| if (!e.code) throw e; |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| }), |
| read: (function(stream, buffer, offset, length, position) { |
| if (length === 0) return 0; |
| try { |
| return fs.readSync(stream.nfd, NODEFS.bufferFrom(buffer.buffer), offset, length, position); |
| } catch (e) { |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| }), |
| write: (function(stream, buffer, offset, length, position) { |
| try { |
| return fs.writeSync(stream.nfd, NODEFS.bufferFrom(buffer.buffer), offset, length, position); |
| } catch (e) { |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| }), |
| llseek: (function(stream, offset, whence) { |
| var position = offset; |
| if (whence === 1) { |
| position += stream.position; |
| } else if (whence === 2) { |
| if (FS.isFile(stream.node.mode)) { |
| try { |
| var stat = fs.fstatSync(stream.nfd); |
| position += stat.size; |
| } catch (e) { |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| } |
| } |
| if (position < 0) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| return position; |
| }) |
| } |
| }; |
| var WORKERFS = { |
| DIR_MODE: 16895, |
| FILE_MODE: 33279, |
| reader: null, |
| mount: (function(mount) { |
| assert(ENVIRONMENT_IS_WORKER); |
| if (!WORKERFS.reader) WORKERFS.reader = new FileReaderSync; |
| var root = WORKERFS.createNode(null, "/", WORKERFS.DIR_MODE, 0); |
| var createdParents = {}; |
| function ensureParent(path) { |
| var parts = path.split("/"); |
| var parent = root; |
| for (var i = 0; i < parts.length - 1; i++) { |
| var curr = parts.slice(0, i + 1).join("/"); |
| if (!createdParents[curr]) { |
| createdParents[curr] = WORKERFS.createNode(parent, parts[i], WORKERFS.DIR_MODE, 0); |
| } |
| parent = createdParents[curr]; |
| } |
| return parent; |
| } |
| function base(path) { |
| var parts = path.split("/"); |
| return parts[parts.length - 1]; |
| } |
| Array.prototype.forEach.call(mount.opts["files"] || [], (function(file) { |
| WORKERFS.createNode(ensureParent(file.name), base(file.name), WORKERFS.FILE_MODE, 0, file, file.lastModifiedDate); |
| })); |
| (mount.opts["blobs"] || []).forEach((function(obj) { |
| WORKERFS.createNode(ensureParent(obj["name"]), base(obj["name"]), WORKERFS.FILE_MODE, 0, obj["data"]); |
| })); |
| (mount.opts["packages"] || []).forEach((function(pack) { |
| pack["metadata"].files.forEach((function(file) { |
| var name = file.filename.substr(1); |
| WORKERFS.createNode(ensureParent(name), base(name), WORKERFS.FILE_MODE, 0, pack["blob"].slice(file.start, file.end)); |
| })); |
| })); |
| return root; |
| }), |
| createNode: (function(parent, name, mode, dev, contents, mtime) { |
| var node = FS.createNode(parent, name, mode); |
| node.mode = mode; |
| node.node_ops = WORKERFS.node_ops; |
| node.stream_ops = WORKERFS.stream_ops; |
| node.timestamp = (mtime || new Date).getTime(); |
| assert(WORKERFS.FILE_MODE !== WORKERFS.DIR_MODE); |
| if (mode === WORKERFS.FILE_MODE) { |
| node.size = contents.size; |
| node.contents = contents; |
| } else { |
| node.size = 4096; |
| node.contents = {}; |
| } |
| if (parent) { |
| parent.contents[name] = node; |
| } |
| return node; |
| }), |
| node_ops: { |
| getattr: (function(node) { |
| return { |
| dev: 1, |
| ino: undefined, |
| mode: node.mode, |
| nlink: 1, |
| uid: 0, |
| gid: 0, |
| rdev: undefined, |
| size: node.size, |
| atime: new Date(node.timestamp), |
| mtime: new Date(node.timestamp), |
| ctime: new Date(node.timestamp), |
| blksize: 4096, |
| blocks: Math.ceil(node.size / 4096) |
| }; |
| }), |
| setattr: (function(node, attr) { |
| if (attr.mode !== undefined) { |
| node.mode = attr.mode; |
| } |
| if (attr.timestamp !== undefined) { |
| node.timestamp = attr.timestamp; |
| } |
| }), |
| lookup: (function(parent, name) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
| }), |
| mknod: (function(parent, name, mode, dev) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| }), |
| rename: (function(oldNode, newDir, newName) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| }), |
| unlink: (function(parent, name) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| }), |
| rmdir: (function(parent, name) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| }), |
| readdir: (function(node) { |
| var entries = [ ".", ".." ]; |
| for (var key in node.contents) { |
| if (!node.contents.hasOwnProperty(key)) { |
| continue; |
| } |
| entries.push(key); |
| } |
| return entries; |
| }), |
| symlink: (function(parent, newName, oldPath) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| }), |
| readlink: (function(node) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| }) |
| }, |
| stream_ops: { |
| read: (function(stream, buffer, offset, length, position) { |
| if (position >= stream.node.size) return 0; |
| var chunk = stream.node.contents.slice(position, position + length); |
| var ab = WORKERFS.reader.readAsArrayBuffer(chunk); |
| buffer.set(new Uint8Array(ab), offset); |
| return chunk.size; |
| }), |
| write: (function(stream, buffer, offset, length, position) { |
| throw new FS.ErrnoError(ERRNO_CODES.EIO); |
| }), |
| llseek: (function(stream, offset, whence) { |
| var position = offset; |
| if (whence === 1) { |
| position += stream.position; |
| } else if (whence === 2) { |
| if (FS.isFile(stream.node.mode)) { |
| position += stream.node.size; |
| } |
| } |
| if (position < 0) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| return position; |
| }) |
| } |
| }; |
| STATICTOP += 16; |
| STATICTOP += 16; |
| STATICTOP += 16; |
| var FS = { |
| root: null, |
| mounts: [], |
| devices: {}, |
| streams: [], |
| nextInode: 1, |
| nameTable: null, |
| currentPath: "/", |
| initialized: false, |
| ignorePermissions: true, |
| trackingDelegate: {}, |
| tracking: { |
| openFlags: { |
| READ: 1, |
| WRITE: 2 |
| } |
| }, |
| ErrnoError: null, |
| genericErrors: {}, |
| filesystems: null, |
| syncFSRequests: 0, |
| handleFSError: (function(e) { |
| if (!(e instanceof FS.ErrnoError)) throw e + " : " + stackTrace(); |
| return ___setErrNo(e.errno); |
| }), |
| lookupPath: (function(path, opts) { |
| path = PATH.resolve(FS.cwd(), path); |
| opts = opts || {}; |
| if (!path) return { |
| path: "", |
| node: null |
| }; |
| var defaults = { |
| follow_mount: true, |
| recurse_count: 0 |
| }; |
| for (var key in defaults) { |
| if (opts[key] === undefined) { |
| opts[key] = defaults[key]; |
| } |
| } |
| if (opts.recurse_count > 8) { |
| throw new FS.ErrnoError(ERRNO_CODES.ELOOP); |
| } |
| var parts = PATH.normalizeArray(path.split("/").filter((function(p) { |
| return !!p; |
| })), false); |
| var current = FS.root; |
| var current_path = "/"; |
| for (var i = 0; i < parts.length; i++) { |
| var islast = i === parts.length - 1; |
| if (islast && opts.parent) { |
| break; |
| } |
| current = FS.lookupNode(current, parts[i]); |
| current_path = PATH.join2(current_path, parts[i]); |
| if (FS.isMountpoint(current)) { |
| if (!islast || islast && opts.follow_mount) { |
| current = current.mounted.root; |
| } |
| } |
| if (!islast || opts.follow) { |
| var count = 0; |
| while (FS.isLink(current.mode)) { |
| var link = FS.readlink(current_path); |
| current_path = PATH.resolve(PATH.dirname(current_path), link); |
| var lookup = FS.lookupPath(current_path, { |
| recurse_count: opts.recurse_count |
| }); |
| current = lookup.node; |
| if (count++ > 40) { |
| throw new FS.ErrnoError(ERRNO_CODES.ELOOP); |
| } |
| } |
| } |
| } |
| return { |
| path: current_path, |
| node: current |
| }; |
| }), |
| getPath: (function(node) { |
| var path; |
| while (true) { |
| if (FS.isRoot(node)) { |
| var mount = node.mount.mountpoint; |
| if (!path) return mount; |
| return mount[mount.length - 1] !== "/" ? mount + "/" + path : mount + path; |
| } |
| path = path ? node.name + "/" + path : node.name; |
| node = node.parent; |
| } |
| }), |
| hashName: (function(parentid, name) { |
| var hash = 0; |
| for (var i = 0; i < name.length; i++) { |
| hash = (hash << 5) - hash + name.charCodeAt(i) | 0; |
| } |
| return (parentid + hash >>> 0) % FS.nameTable.length; |
| }), |
| hashAddNode: (function(node) { |
| var hash = FS.hashName(node.parent.id, node.name); |
| node.name_next = FS.nameTable[hash]; |
| FS.nameTable[hash] = node; |
| }), |
| hashRemoveNode: (function(node) { |
| var hash = FS.hashName(node.parent.id, node.name); |
| if (FS.nameTable[hash] === node) { |
| FS.nameTable[hash] = node.name_next; |
| } else { |
| var current = FS.nameTable[hash]; |
| while (current) { |
| if (current.name_next === node) { |
| current.name_next = node.name_next; |
| break; |
| } |
| current = current.name_next; |
| } |
| } |
| }), |
| lookupNode: (function(parent, name) { |
| var err = FS.mayLookup(parent); |
| if (err) { |
| throw new FS.ErrnoError(err, parent); |
| } |
| var hash = FS.hashName(parent.id, name); |
| for (var node = FS.nameTable[hash]; node; node = node.name_next) { |
| var nodeName = node.name; |
| if (node.parent.id === parent.id && nodeName === name) { |
| return node; |
| } |
| } |
| return FS.lookup(parent, name); |
| }), |
| createNode: (function(parent, name, mode, rdev) { |
| if (!FS.FSNode) { |
| FS.FSNode = (function(parent, name, mode, rdev) { |
| if (!parent) { |
| parent = this; |
| } |
| this.parent = parent; |
| this.mount = parent.mount; |
| this.mounted = null; |
| this.id = FS.nextInode++; |
| this.name = name; |
| this.mode = mode; |
| this.node_ops = {}; |
| this.stream_ops = {}; |
| this.rdev = rdev; |
| }); |
| FS.FSNode.prototype = {}; |
| var readMode = 292 | 73; |
| var writeMode = 146; |
| Object.defineProperties(FS.FSNode.prototype, { |
| read: { |
| get: (function() { |
| return (this.mode & readMode) === readMode; |
| }), |
| set: (function(val) { |
| val ? this.mode |= readMode : this.mode &= ~readMode; |
| }) |
| }, |
| write: { |
| get: (function() { |
| return (this.mode & writeMode) === writeMode; |
| }), |
| set: (function(val) { |
| val ? this.mode |= writeMode : this.mode &= ~writeMode; |
| }) |
| }, |
| isFolder: { |
| get: (function() { |
| return FS.isDir(this.mode); |
| }) |
| }, |
| isDevice: { |
| get: (function() { |
| return FS.isChrdev(this.mode); |
| }) |
| } |
| }); |
| } |
| var node = new FS.FSNode(parent, name, mode, rdev); |
| FS.hashAddNode(node); |
| return node; |
| }), |
| destroyNode: (function(node) { |
| FS.hashRemoveNode(node); |
| }), |
| isRoot: (function(node) { |
| return node === node.parent; |
| }), |
| isMountpoint: (function(node) { |
| return !!node.mounted; |
| }), |
| isFile: (function(mode) { |
| return (mode & 61440) === 32768; |
| }), |
| isDir: (function(mode) { |
| return (mode & 61440) === 16384; |
| }), |
| isLink: (function(mode) { |
| return (mode & 61440) === 40960; |
| }), |
| isChrdev: (function(mode) { |
| return (mode & 61440) === 8192; |
| }), |
| isBlkdev: (function(mode) { |
| return (mode & 61440) === 24576; |
| }), |
| isFIFO: (function(mode) { |
| return (mode & 61440) === 4096; |
| }), |
| isSocket: (function(mode) { |
| return (mode & 49152) === 49152; |
| }), |
| flagModes: { |
| "r": 0, |
| "rs": 1052672, |
| "r+": 2, |
| "w": 577, |
| "wx": 705, |
| "xw": 705, |
| "w+": 578, |
| "wx+": 706, |
| "xw+": 706, |
| "a": 1089, |
| "ax": 1217, |
| "xa": 1217, |
| "a+": 1090, |
| "ax+": 1218, |
| "xa+": 1218 |
| }, |
| modeStringToFlags: (function(str) { |
| var flags = FS.flagModes[str]; |
| if (typeof flags === "undefined") { |
| throw new Error("Unknown file open mode: " + str); |
| } |
| return flags; |
| }), |
| flagsToPermissionString: (function(flag) { |
| var perms = [ "r", "w", "rw" ][flag & 3]; |
| if (flag & 512) { |
| perms += "w"; |
| } |
| return perms; |
| }), |
| nodePermissions: (function(node, perms) { |
| if (FS.ignorePermissions) { |
| return 0; |
| } |
| if (perms.indexOf("r") !== -1 && !(node.mode & 292)) { |
| return ERRNO_CODES.EACCES; |
| } else if (perms.indexOf("w") !== -1 && !(node.mode & 146)) { |
| return ERRNO_CODES.EACCES; |
| } else if (perms.indexOf("x") !== -1 && !(node.mode & 73)) { |
| return ERRNO_CODES.EACCES; |
| } |
| return 0; |
| }), |
| mayLookup: (function(dir) { |
| var err = FS.nodePermissions(dir, "x"); |
| if (err) return err; |
| if (!dir.node_ops.lookup) return ERRNO_CODES.EACCES; |
| return 0; |
| }), |
| mayCreate: (function(dir, name) { |
| try { |
| var node = FS.lookupNode(dir, name); |
| return ERRNO_CODES.EEXIST; |
| } catch (e) {} |
| return FS.nodePermissions(dir, "wx"); |
| }), |
| mayDelete: (function(dir, name, isdir) { |
| var node; |
| try { |
| node = FS.lookupNode(dir, name); |
| } catch (e) { |
| return e.errno; |
| } |
| var err = FS.nodePermissions(dir, "wx"); |
| if (err) { |
| return err; |
| } |
| if (isdir) { |
| if (!FS.isDir(node.mode)) { |
| return ERRNO_CODES.ENOTDIR; |
| } |
| if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) { |
| return ERRNO_CODES.EBUSY; |
| } |
| } else { |
| if (FS.isDir(node.mode)) { |
| return ERRNO_CODES.EISDIR; |
| } |
| } |
| return 0; |
| }), |
| mayOpen: (function(node, flags) { |
| if (!node) { |
| return ERRNO_CODES.ENOENT; |
| } |
| if (FS.isLink(node.mode)) { |
| return ERRNO_CODES.ELOOP; |
| } else if (FS.isDir(node.mode)) { |
| if (FS.flagsToPermissionString(flags) !== "r" || flags & 512) { |
| return ERRNO_CODES.EISDIR; |
| } |
| } |
| return FS.nodePermissions(node, FS.flagsToPermissionString(flags)); |
| }), |
| MAX_OPEN_FDS: 4096, |
| nextfd: (function(fd_start, fd_end) { |
| fd_start = fd_start || 0; |
| fd_end = fd_end || FS.MAX_OPEN_FDS; |
| for (var fd = fd_start; fd <= fd_end; fd++) { |
| if (!FS.streams[fd]) { |
| return fd; |
| } |
| } |
| throw new FS.ErrnoError(ERRNO_CODES.EMFILE); |
| }), |
| getStream: (function(fd) { |
| return FS.streams[fd]; |
| }), |
| createStream: (function(stream, fd_start, fd_end) { |
| if (!FS.FSStream) { |
| FS.FSStream = (function() {}); |
| FS.FSStream.prototype = {}; |
| Object.defineProperties(FS.FSStream.prototype, { |
| object: { |
| get: (function() { |
| return this.node; |
| }), |
| set: (function(val) { |
| this.node = val; |
| }) |
| }, |
| isRead: { |
| get: (function() { |
| return (this.flags & 2097155) !== 1; |
| }) |
| }, |
| isWrite: { |
| get: (function() { |
| return (this.flags & 2097155) !== 0; |
| }) |
| }, |
| isAppend: { |
| get: (function() { |
| return this.flags & 1024; |
| }) |
| } |
| }); |
| } |
| var newStream = new FS.FSStream; |
| for (var p in stream) { |
| newStream[p] = stream[p]; |
| } |
| stream = newStream; |
| var fd = FS.nextfd(fd_start, fd_end); |
| stream.fd = fd; |
| FS.streams[fd] = stream; |
| return stream; |
| }), |
| closeStream: (function(fd) { |
| FS.streams[fd] = null; |
| }), |
| chrdev_stream_ops: { |
| open: (function(stream) { |
| var device = FS.getDevice(stream.node.rdev); |
| stream.stream_ops = device.stream_ops; |
| if (stream.stream_ops.open) { |
| stream.stream_ops.open(stream); |
| } |
| }), |
| llseek: (function() { |
| throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); |
| }) |
| }, |
| major: (function(dev) { |
| return dev >> 8; |
| }), |
| minor: (function(dev) { |
| return dev & 255; |
| }), |
| makedev: (function(ma, mi) { |
| return ma << 8 | mi; |
| }), |
| registerDevice: (function(dev, ops) { |
| FS.devices[dev] = { |
| stream_ops: ops |
| }; |
| }), |
| getDevice: (function(dev) { |
| return FS.devices[dev]; |
| }), |
| getMounts: (function(mount) { |
| var mounts = []; |
| var check = [ mount ]; |
| while (check.length) { |
| var m = check.pop(); |
| mounts.push(m); |
| check.push.apply(check, m.mounts); |
| } |
| return mounts; |
| }), |
| syncfs: (function(populate, callback) { |
| if (typeof populate === "function") { |
| callback = populate; |
| populate = false; |
| } |
| FS.syncFSRequests++; |
| if (FS.syncFSRequests > 1) { |
| console.log("warning: " + FS.syncFSRequests + " FS.syncfs operations in flight at once, probably just doing extra work"); |
| } |
| var mounts = FS.getMounts(FS.root.mount); |
| var completed = 0; |
| function doCallback(err) { |
| assert(FS.syncFSRequests > 0); |
| FS.syncFSRequests--; |
| return callback(err); |
| } |
| function done(err) { |
| if (err) { |
| if (!done.errored) { |
| done.errored = true; |
| return doCallback(err); |
| } |
| return; |
| } |
| if (++completed >= mounts.length) { |
| doCallback(null); |
| } |
| } |
| mounts.forEach((function(mount) { |
| if (!mount.type.syncfs) { |
| return done(null); |
| } |
| mount.type.syncfs(mount, populate, done); |
| })); |
| }), |
| mount: (function(type, opts, mountpoint) { |
| var root = mountpoint === "/"; |
| var pseudo = !mountpoint; |
| var node; |
| if (root && FS.root) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBUSY); |
| } else if (!root && !pseudo) { |
| var lookup = FS.lookupPath(mountpoint, { |
| follow_mount: false |
| }); |
| mountpoint = lookup.path; |
| node = lookup.node; |
| if (FS.isMountpoint(node)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBUSY); |
| } |
| if (!FS.isDir(node.mode)) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); |
| } |
| } |
| var mount = { |
| type: type, |
| opts: opts, |
| mountpoint: mountpoint, |
| mounts: [] |
| }; |
| var mountRoot = type.mount(mount); |
| mountRoot.mount = mount; |
| mount.root = mountRoot; |
| if (root) { |
| FS.root = mountRoot; |
| } else if (node) { |
| node.mounted = mount; |
| if (node.mount) { |
| node.mount.mounts.push(mount); |
| } |
| } |
| return mountRoot; |
| }), |
| unmount: (function(mountpoint) { |
| var lookup = FS.lookupPath(mountpoint, { |
| follow_mount: false |
| }); |
| if (!FS.isMountpoint(lookup.node)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| var node = lookup.node; |
| var mount = node.mounted; |
| var mounts = FS.getMounts(mount); |
| Object.keys(FS.nameTable).forEach((function(hash) { |
| var current = FS.nameTable[hash]; |
| while (current) { |
| var next = current.name_next; |
| if (mounts.indexOf(current.mount) !== -1) { |
| FS.destroyNode(current); |
| } |
| current = next; |
| } |
| })); |
| node.mounted = null; |
| var idx = node.mount.mounts.indexOf(mount); |
| assert(idx !== -1); |
| node.mount.mounts.splice(idx, 1); |
| }), |
| lookup: (function(parent, name) { |
| return parent.node_ops.lookup(parent, name); |
| }), |
| mknod: (function(path, mode, dev) { |
| var lookup = FS.lookupPath(path, { |
| parent: true |
| }); |
| var parent = lookup.node; |
| var name = PATH.basename(path); |
| if (!name || name === "." || name === "..") { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| var err = FS.mayCreate(parent, name); |
| if (err) { |
| throw new FS.ErrnoError(err); |
| } |
| if (!parent.node_ops.mknod) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| } |
| return parent.node_ops.mknod(parent, name, mode, dev); |
| }), |
| create: (function(path, mode) { |
| mode = mode !== undefined ? mode : 438; |
| mode &= 4095; |
| mode |= 32768; |
| return FS.mknod(path, mode, 0); |
| }), |
| mkdir: (function(path, mode) { |
| mode = mode !== undefined ? mode : 511; |
| mode &= 511 | 512; |
| mode |= 16384; |
| return FS.mknod(path, mode, 0); |
| }), |
| mkdirTree: (function(path, mode) { |
| var dirs = path.split("/"); |
| var d = ""; |
| for (var i = 0; i < dirs.length; ++i) { |
| if (!dirs[i]) continue; |
| d += "/" + dirs[i]; |
| try { |
| FS.mkdir(d, mode); |
| } catch (e) { |
| if (e.errno != ERRNO_CODES.EEXIST) throw e; |
| } |
| } |
| }), |
| mkdev: (function(path, mode, dev) { |
| if (typeof dev === "undefined") { |
| dev = mode; |
| mode = 438; |
| } |
| mode |= 8192; |
| return FS.mknod(path, mode, dev); |
| }), |
| symlink: (function(oldpath, newpath) { |
| if (!PATH.resolve(oldpath)) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
| } |
| var lookup = FS.lookupPath(newpath, { |
| parent: true |
| }); |
| var parent = lookup.node; |
| if (!parent) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
| } |
| var newname = PATH.basename(newpath); |
| var err = FS.mayCreate(parent, newname); |
| if (err) { |
| throw new FS.ErrnoError(err); |
| } |
| if (!parent.node_ops.symlink) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| } |
| return parent.node_ops.symlink(parent, newname, oldpath); |
| }), |
| rename: (function(old_path, new_path) { |
| var old_dirname = PATH.dirname(old_path); |
| var new_dirname = PATH.dirname(new_path); |
| var old_name = PATH.basename(old_path); |
| var new_name = PATH.basename(new_path); |
| var lookup, old_dir, new_dir; |
| try { |
| lookup = FS.lookupPath(old_path, { |
| parent: true |
| }); |
| old_dir = lookup.node; |
| lookup = FS.lookupPath(new_path, { |
| parent: true |
| }); |
| new_dir = lookup.node; |
| } catch (e) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBUSY); |
| } |
| if (!old_dir || !new_dir) throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
| if (old_dir.mount !== new_dir.mount) { |
| throw new FS.ErrnoError(ERRNO_CODES.EXDEV); |
| } |
| var old_node = FS.lookupNode(old_dir, old_name); |
| var relative = PATH.relative(old_path, new_dirname); |
| if (relative.charAt(0) !== ".") { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| relative = PATH.relative(new_path, old_dirname); |
| if (relative.charAt(0) !== ".") { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY); |
| } |
| var new_node; |
| try { |
| new_node = FS.lookupNode(new_dir, new_name); |
| } catch (e) {} |
| if (old_node === new_node) { |
| return; |
| } |
| var isdir = FS.isDir(old_node.mode); |
| var err = FS.mayDelete(old_dir, old_name, isdir); |
| if (err) { |
| throw new FS.ErrnoError(err); |
| } |
| err = new_node ? FS.mayDelete(new_dir, new_name, isdir) : FS.mayCreate(new_dir, new_name); |
| if (err) { |
| throw new FS.ErrnoError(err); |
| } |
| if (!old_dir.node_ops.rename) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| } |
| if (FS.isMountpoint(old_node) || new_node && FS.isMountpoint(new_node)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBUSY); |
| } |
| if (new_dir !== old_dir) { |
| err = FS.nodePermissions(old_dir, "w"); |
| if (err) { |
| throw new FS.ErrnoError(err); |
| } |
| } |
| try { |
| if (FS.trackingDelegate["willMovePath"]) { |
| FS.trackingDelegate["willMovePath"](old_path, new_path); |
| } |
| } catch (e) { |
| console.log("FS.trackingDelegate['willMovePath']('" + old_path + "', '" + new_path + "') threw an exception: " + e.message); |
| } |
| FS.hashRemoveNode(old_node); |
| try { |
| old_dir.node_ops.rename(old_node, new_dir, new_name); |
| } catch (e) { |
| throw e; |
| } finally { |
| FS.hashAddNode(old_node); |
| } |
| try { |
| if (FS.trackingDelegate["onMovePath"]) FS.trackingDelegate["onMovePath"](old_path, new_path); |
| } catch (e) { |
| console.log("FS.trackingDelegate['onMovePath']('" + old_path + "', '" + new_path + "') threw an exception: " + e.message); |
| } |
| }), |
| rmdir: (function(path) { |
| var lookup = FS.lookupPath(path, { |
| parent: true |
| }); |
| var parent = lookup.node; |
| var name = PATH.basename(path); |
| var node = FS.lookupNode(parent, name); |
| var err = FS.mayDelete(parent, name, true); |
| if (err) { |
| throw new FS.ErrnoError(err); |
| } |
| if (!parent.node_ops.rmdir) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| } |
| if (FS.isMountpoint(node)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBUSY); |
| } |
| try { |
| if (FS.trackingDelegate["willDeletePath"]) { |
| FS.trackingDelegate["willDeletePath"](path); |
| } |
| } catch (e) { |
| console.log("FS.trackingDelegate['willDeletePath']('" + path + "') threw an exception: " + e.message); |
| } |
| parent.node_ops.rmdir(parent, name); |
| FS.destroyNode(node); |
| try { |
| if (FS.trackingDelegate["onDeletePath"]) FS.trackingDelegate["onDeletePath"](path); |
| } catch (e) { |
| console.log("FS.trackingDelegate['onDeletePath']('" + path + "') threw an exception: " + e.message); |
| } |
| }), |
| readdir: (function(path) { |
| var lookup = FS.lookupPath(path, { |
| follow: true |
| }); |
| var node = lookup.node; |
| if (!node.node_ops.readdir) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); |
| } |
| return node.node_ops.readdir(node); |
| }), |
| unlink: (function(path) { |
| var lookup = FS.lookupPath(path, { |
| parent: true |
| }); |
| var parent = lookup.node; |
| var name = PATH.basename(path); |
| var node = FS.lookupNode(parent, name); |
| var err = FS.mayDelete(parent, name, false); |
| if (err) { |
| throw new FS.ErrnoError(err); |
| } |
| if (!parent.node_ops.unlink) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| } |
| if (FS.isMountpoint(node)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBUSY); |
| } |
| try { |
| if (FS.trackingDelegate["willDeletePath"]) { |
| FS.trackingDelegate["willDeletePath"](path); |
| } |
| } catch (e) { |
| console.log("FS.trackingDelegate['willDeletePath']('" + path + "') threw an exception: " + e.message); |
| } |
| parent.node_ops.unlink(parent, name); |
| FS.destroyNode(node); |
| try { |
| if (FS.trackingDelegate["onDeletePath"]) FS.trackingDelegate["onDeletePath"](path); |
| } catch (e) { |
| console.log("FS.trackingDelegate['onDeletePath']('" + path + "') threw an exception: " + e.message); |
| } |
| }), |
| readlink: (function(path) { |
| var lookup = FS.lookupPath(path); |
| var link = lookup.node; |
| if (!link) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
| } |
| if (!link.node_ops.readlink) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| return PATH.resolve(FS.getPath(link.parent), link.node_ops.readlink(link)); |
| }), |
| stat: (function(path, dontFollow) { |
| var lookup = FS.lookupPath(path, { |
| follow: !dontFollow |
| }); |
| var node = lookup.node; |
| if (!node) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
| } |
| if (!node.node_ops.getattr) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| } |
| return node.node_ops.getattr(node); |
| }), |
| lstat: (function(path) { |
| return FS.stat(path, true); |
| }), |
| chmod: (function(path, mode, dontFollow) { |
| var node; |
| if (typeof path === "string") { |
| var lookup = FS.lookupPath(path, { |
| follow: !dontFollow |
| }); |
| node = lookup.node; |
| } else { |
| node = path; |
| } |
| if (!node.node_ops.setattr) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| } |
| node.node_ops.setattr(node, { |
| mode: mode & 4095 | node.mode & ~4095, |
| timestamp: Date.now() |
| }); |
| }), |
| lchmod: (function(path, mode) { |
| FS.chmod(path, mode, true); |
| }), |
| fchmod: (function(fd, mode) { |
| var stream = FS.getStream(fd); |
| if (!stream) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
| } |
| FS.chmod(stream.node, mode); |
| }), |
| chown: (function(path, uid, gid, dontFollow) { |
| var node; |
| if (typeof path === "string") { |
| var lookup = FS.lookupPath(path, { |
| follow: !dontFollow |
| }); |
| node = lookup.node; |
| } else { |
| node = path; |
| } |
| if (!node.node_ops.setattr) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| } |
| node.node_ops.setattr(node, { |
| timestamp: Date.now() |
| }); |
| }), |
| lchown: (function(path, uid, gid) { |
| FS.chown(path, uid, gid, true); |
| }), |
| fchown: (function(fd, uid, gid) { |
| var stream = FS.getStream(fd); |
| if (!stream) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
| } |
| FS.chown(stream.node, uid, gid); |
| }), |
| truncate: (function(path, len) { |
| if (len < 0) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| var node; |
| if (typeof path === "string") { |
| var lookup = FS.lookupPath(path, { |
| follow: true |
| }); |
| node = lookup.node; |
| } else { |
| node = path; |
| } |
| if (!node.node_ops.setattr) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| } |
| if (FS.isDir(node.mode)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EISDIR); |
| } |
| if (!FS.isFile(node.mode)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| var err = FS.nodePermissions(node, "w"); |
| if (err) { |
| throw new FS.ErrnoError(err); |
| } |
| node.node_ops.setattr(node, { |
| size: len, |
| timestamp: Date.now() |
| }); |
| }), |
| ftruncate: (function(fd, len) { |
| var stream = FS.getStream(fd); |
| if (!stream) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
| } |
| if ((stream.flags & 2097155) === 0) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| FS.truncate(stream.node, len); |
| }), |
| utime: (function(path, atime, mtime) { |
| var lookup = FS.lookupPath(path, { |
| follow: true |
| }); |
| var node = lookup.node; |
| node.node_ops.setattr(node, { |
| timestamp: Math.max(atime, mtime) |
| }); |
| }), |
| open: (function(path, flags, mode, fd_start, fd_end) { |
| if (path === "") { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
| } |
| flags = typeof flags === "string" ? FS.modeStringToFlags(flags) : flags; |
| mode = typeof mode === "undefined" ? 438 : mode; |
| if (flags & 64) { |
| mode = mode & 4095 | 32768; |
| } else { |
| mode = 0; |
| } |
| var node; |
| if (typeof path === "object") { |
| node = path; |
| } else { |
| path = PATH.normalize(path); |
| try { |
| var lookup = FS.lookupPath(path, { |
| follow: !(flags & 131072) |
| }); |
| node = lookup.node; |
| } catch (e) {} |
| } |
| var created = false; |
| if (flags & 64) { |
| if (node) { |
| if (flags & 128) { |
| throw new FS.ErrnoError(ERRNO_CODES.EEXIST); |
| } |
| } else { |
| node = FS.mknod(path, mode, 0); |
| created = true; |
| } |
| } |
| if (!node) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
| } |
| if (FS.isChrdev(node.mode)) { |
| flags &= ~512; |
| } |
| if (flags & 65536 && !FS.isDir(node.mode)) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); |
| } |
| if (!created) { |
| var err = FS.mayOpen(node, flags); |
| if (err) { |
| throw new FS.ErrnoError(err); |
| } |
| } |
| if (flags & 512) { |
| FS.truncate(node, 0); |
| } |
| flags &= ~(128 | 512); |
| var stream = FS.createStream({ |
| node: node, |
| path: FS.getPath(node), |
| flags: flags, |
| seekable: true, |
| position: 0, |
| stream_ops: node.stream_ops, |
| ungotten: [], |
| error: false |
| }, fd_start, fd_end); |
| if (stream.stream_ops.open) { |
| stream.stream_ops.open(stream); |
| } |
| if (Module["logReadFiles"] && !(flags & 1)) { |
| if (!FS.readFiles) FS.readFiles = {}; |
| if (!(path in FS.readFiles)) { |
| FS.readFiles[path] = 1; |
| Module["printErr"]("read file: " + path); |
| } |
| } |
| try { |
| if (FS.trackingDelegate["onOpenFile"]) { |
| var trackingFlags = 0; |
| if ((flags & 2097155) !== 1) { |
| trackingFlags |= FS.tracking.openFlags.READ; |
| } |
| if ((flags & 2097155) !== 0) { |
| trackingFlags |= FS.tracking.openFlags.WRITE; |
| } |
| FS.trackingDelegate["onOpenFile"](path, trackingFlags); |
| } |
| } catch (e) { |
| console.log("FS.trackingDelegate['onOpenFile']('" + path + "', flags) threw an exception: " + e.message); |
| } |
| return stream; |
| }), |
| close: (function(stream) { |
| if (FS.isClosed(stream)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
| } |
| if (stream.getdents) stream.getdents = null; |
| try { |
| if (stream.stream_ops.close) { |
| stream.stream_ops.close(stream); |
| } |
| } catch (e) { |
| throw e; |
| } finally { |
| FS.closeStream(stream.fd); |
| } |
| stream.fd = null; |
| }), |
| isClosed: (function(stream) { |
| return stream.fd === null; |
| }), |
| llseek: (function(stream, offset, whence) { |
| if (FS.isClosed(stream)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
| } |
| if (!stream.seekable || !stream.stream_ops.llseek) { |
| throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); |
| } |
| stream.position = stream.stream_ops.llseek(stream, offset, whence); |
| stream.ungotten = []; |
| return stream.position; |
| }), |
| read: (function(stream, buffer, offset, length, position) { |
| if (length < 0 || position < 0) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| if (FS.isClosed(stream)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
| } |
| if ((stream.flags & 2097155) === 1) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
| } |
| if (FS.isDir(stream.node.mode)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EISDIR); |
| } |
| if (!stream.stream_ops.read) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| var seeking = typeof position !== "undefined"; |
| if (!seeking) { |
| position = stream.position; |
| } else if (!stream.seekable) { |
| throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); |
| } |
| var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position); |
| if (!seeking) stream.position += bytesRead; |
| return bytesRead; |
| }), |
| write: (function(stream, buffer, offset, length, position, canOwn) { |
| if (length < 0 || position < 0) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| if (FS.isClosed(stream)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
| } |
| if ((stream.flags & 2097155) === 0) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
| } |
| if (FS.isDir(stream.node.mode)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EISDIR); |
| } |
| if (!stream.stream_ops.write) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| if (stream.flags & 1024) { |
| FS.llseek(stream, 0, 2); |
| } |
| var seeking = typeof position !== "undefined"; |
| if (!seeking) { |
| position = stream.position; |
| } else if (!stream.seekable) { |
| throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); |
| } |
| var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn); |
| if (!seeking) stream.position += bytesWritten; |
| try { |
| if (stream.path && FS.trackingDelegate["onWriteToFile"]) FS.trackingDelegate["onWriteToFile"](stream.path); |
| } catch (e) { |
| console.log("FS.trackingDelegate['onWriteToFile']('" + path + "') threw an exception: " + e.message); |
| } |
| return bytesWritten; |
| }), |
| allocate: (function(stream, offset, length) { |
| if (FS.isClosed(stream)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
| } |
| if (offset < 0 || length <= 0) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| if ((stream.flags & 2097155) === 0) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
| } |
| if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENODEV); |
| } |
| if (!stream.stream_ops.allocate) { |
| throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP); |
| } |
| stream.stream_ops.allocate(stream, offset, length); |
| }), |
| mmap: (function(stream, buffer, offset, length, position, prot, flags) { |
| if ((stream.flags & 2097155) === 1) { |
| throw new FS.ErrnoError(ERRNO_CODES.EACCES); |
| } |
| if (!stream.stream_ops.mmap) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENODEV); |
| } |
| return stream.stream_ops.mmap(stream, buffer, offset, length, position, prot, flags); |
| }), |
| msync: (function(stream, buffer, offset, length, mmapFlags) { |
| if (!stream || !stream.stream_ops.msync) { |
| return 0; |
| } |
| return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags); |
| }), |
| munmap: (function(stream) { |
| return 0; |
| }), |
| ioctl: (function(stream, cmd, arg) { |
| if (!stream.stream_ops.ioctl) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOTTY); |
| } |
| return stream.stream_ops.ioctl(stream, cmd, arg); |
| }), |
| readFile: (function(path, opts) { |
| opts = opts || {}; |
| opts.flags = opts.flags || "r"; |
| opts.encoding = opts.encoding || "binary"; |
| if (opts.encoding !== "utf8" && opts.encoding !== "binary") { |
| throw new Error('Invalid encoding type "' + opts.encoding + '"'); |
| } |
| var ret; |
| var stream = FS.open(path, opts.flags); |
| var stat = FS.stat(path); |
| var length = stat.size; |
| var buf = new Uint8Array(length); |
| FS.read(stream, buf, 0, length, 0); |
| if (opts.encoding === "utf8") { |
| ret = UTF8ArrayToString(buf, 0); |
| } else if (opts.encoding === "binary") { |
| ret = buf; |
| } |
| FS.close(stream); |
| return ret; |
| }), |
| writeFile: (function(path, data, opts) { |
| opts = opts || {}; |
| opts.flags = opts.flags || "w"; |
| var stream = FS.open(path, opts.flags, opts.mode); |
| if (typeof data === "string") { |
| var buf = new Uint8Array(lengthBytesUTF8(data) + 1); |
| var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length); |
| FS.write(stream, buf, 0, actualNumBytes, undefined, opts.canOwn); |
| } else if (ArrayBuffer.isView(data)) { |
| FS.write(stream, data, 0, data.byteLength, undefined, opts.canOwn); |
| } else { |
| throw new Error("Unsupported data type"); |
| } |
| FS.close(stream); |
| }), |
| cwd: (function() { |
| return FS.currentPath; |
| }), |
| chdir: (function(path) { |
| var lookup = FS.lookupPath(path, { |
| follow: true |
| }); |
| if (lookup.node === null) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
| } |
| if (!FS.isDir(lookup.node.mode)) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); |
| } |
| var err = FS.nodePermissions(lookup.node, "x"); |
| if (err) { |
| throw new FS.ErrnoError(err); |
| } |
| FS.currentPath = lookup.path; |
| }), |
| createDefaultDirectories: (function() { |
| FS.mkdir("/tmp"); |
| FS.mkdir("/home"); |
| FS.mkdir("/home/web_user"); |
| }), |
| createDefaultDevices: (function() { |
| FS.mkdir("/dev"); |
| FS.registerDevice(FS.makedev(1, 3), { |
| read: (function() { |
| return 0; |
| }), |
| write: (function(stream, buffer, offset, length, pos) { |
| return length; |
| }) |
| }); |
| FS.mkdev("/dev/null", FS.makedev(1, 3)); |
| TTY.register(FS.makedev(5, 0), TTY.default_tty_ops); |
| TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops); |
| FS.mkdev("/dev/tty", FS.makedev(5, 0)); |
| FS.mkdev("/dev/tty1", FS.makedev(6, 0)); |
| var random_device; |
| if (typeof crypto !== "undefined") { |
| var randomBuffer = new Uint8Array(1); |
| random_device = (function() { |
| crypto.getRandomValues(randomBuffer); |
| return randomBuffer[0]; |
| }); |
| } else if (ENVIRONMENT_IS_NODE) { |
| random_device = (function() { |
| return require("crypto")["randomBytes"](1)[0]; |
| }); |
| } else { |
| random_device = (function() { |
| return Math.random() * 256 | 0; |
| }); |
| } |
| FS.createDevice("/dev", "random", random_device); |
| FS.createDevice("/dev", "urandom", random_device); |
| FS.mkdir("/dev/shm"); |
| FS.mkdir("/dev/shm/tmp"); |
| }), |
| createSpecialDirectories: (function() { |
| FS.mkdir("/proc"); |
| FS.mkdir("/proc/self"); |
| FS.mkdir("/proc/self/fd"); |
| FS.mount({ |
| mount: (function() { |
| var node = FS.createNode("/proc/self", "fd", 16384 | 511, 73); |
| node.node_ops = { |
| lookup: (function(parent, name) { |
| var fd = +name; |
| var stream = FS.getStream(fd); |
| if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
| var ret = { |
| parent: null, |
| mount: { |
| mountpoint: "fake" |
| }, |
| node_ops: { |
| readlink: (function() { |
| return stream.path; |
| }) |
| } |
| }; |
| ret.parent = ret; |
| return ret; |
| }) |
| }; |
| return node; |
| }) |
| }, {}, "/proc/self/fd"); |
| }), |
| createStandardStreams: (function() { |
| if (Module["stdin"]) { |
| FS.createDevice("/dev", "stdin", Module["stdin"]); |
| } else { |
| FS.symlink("/dev/tty", "/dev/stdin"); |
| } |
| if (Module["stdout"]) { |
| FS.createDevice("/dev", "stdout", null, Module["stdout"]); |
| } else { |
| FS.symlink("/dev/tty", "/dev/stdout"); |
| } |
| if (Module["stderr"]) { |
| FS.createDevice("/dev", "stderr", null, Module["stderr"]); |
| } else { |
| FS.symlink("/dev/tty1", "/dev/stderr"); |
| } |
| var stdin = FS.open("/dev/stdin", "r"); |
| assert(stdin.fd === 0, "invalid handle for stdin (" + stdin.fd + ")"); |
| var stdout = FS.open("/dev/stdout", "w"); |
| assert(stdout.fd === 1, "invalid handle for stdout (" + stdout.fd + ")"); |
| var stderr = FS.open("/dev/stderr", "w"); |
| assert(stderr.fd === 2, "invalid handle for stderr (" + stderr.fd + ")"); |
| }), |
| ensureErrnoError: (function() { |
| if (FS.ErrnoError) return; |
| FS.ErrnoError = function ErrnoError(errno, node) { |
| this.node = node; |
| this.setErrno = (function(errno) { |
| this.errno = errno; |
| for (var key in ERRNO_CODES) { |
| if (ERRNO_CODES[key] === errno) { |
| this.code = key; |
| break; |
| } |
| } |
| }); |
| this.setErrno(errno); |
| this.message = ERRNO_MESSAGES[errno]; |
| if (this.stack) Object.defineProperty(this, "stack", { |
| value: (new Error).stack, |
| writable: true |
| }); |
| }; |
| FS.ErrnoError.prototype = new Error; |
| FS.ErrnoError.prototype.constructor = FS.ErrnoError; |
| [ ERRNO_CODES.ENOENT ].forEach((function(code) { |
| FS.genericErrors[code] = new FS.ErrnoError(code); |
| FS.genericErrors[code].stack = "<generic error, no stack>"; |
| })); |
| }), |
| staticInit: (function() { |
| FS.ensureErrnoError(); |
| FS.nameTable = new Array(4096); |
| FS.mount(MEMFS, {}, "/"); |
| FS.createDefaultDirectories(); |
| FS.createDefaultDevices(); |
| FS.createSpecialDirectories(); |
| FS.filesystems = { |
| "MEMFS": MEMFS, |
| "IDBFS": IDBFS, |
| "NODEFS": NODEFS, |
| "WORKERFS": WORKERFS |
| }; |
| }), |
| init: (function(input, output, error) { |
| assert(!FS.init.initialized, "FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)"); |
| FS.init.initialized = true; |
| FS.ensureErrnoError(); |
| Module["stdin"] = input || Module["stdin"]; |
| Module["stdout"] = output || Module["stdout"]; |
| Module["stderr"] = error || Module["stderr"]; |
| FS.createStandardStreams(); |
| }), |
| quit: (function() { |
| FS.init.initialized = false; |
| var fflush = Module["_fflush"]; |
| if (fflush) fflush(0); |
| for (var i = 0; i < FS.streams.length; i++) { |
| var stream = FS.streams[i]; |
| if (!stream) { |
| continue; |
| } |
| FS.close(stream); |
| } |
| }), |
| getMode: (function(canRead, canWrite) { |
| var mode = 0; |
| if (canRead) mode |= 292 | 73; |
| if (canWrite) mode |= 146; |
| return mode; |
| }), |
| joinPath: (function(parts, forceRelative) { |
| var path = PATH.join.apply(null, parts); |
| if (forceRelative && path[0] == "/") path = path.substr(1); |
| return path; |
| }), |
| absolutePath: (function(relative, base) { |
| return PATH.resolve(base, relative); |
| }), |
| standardizePath: (function(path) { |
| return PATH.normalize(path); |
| }), |
| findObject: (function(path, dontResolveLastLink) { |
| var ret = FS.analyzePath(path, dontResolveLastLink); |
| if (ret.exists) { |
| return ret.object; |
| } else { |
| ___setErrNo(ret.error); |
| return null; |
| } |
| }), |
| analyzePath: (function(path, dontResolveLastLink) { |
| try { |
| var lookup = FS.lookupPath(path, { |
| follow: !dontResolveLastLink |
| }); |
| path = lookup.path; |
| } catch (e) {} |
| var ret = { |
| isRoot: false, |
| exists: false, |
| error: 0, |
| name: null, |
| path: null, |
| object: null, |
| parentExists: false, |
| parentPath: null, |
| parentObject: null |
| }; |
| try { |
| var lookup = FS.lookupPath(path, { |
| parent: true |
| }); |
| ret.parentExists = true; |
| ret.parentPath = lookup.path; |
| ret.parentObject = lookup.node; |
| ret.name = PATH.basename(path); |
| lookup = FS.lookupPath(path, { |
| follow: !dontResolveLastLink |
| }); |
| ret.exists = true; |
| ret.path = lookup.path; |
| ret.object = lookup.node; |
| ret.name = lookup.node.name; |
| ret.isRoot = lookup.path === "/"; |
| } catch (e) { |
| ret.error = e.errno; |
| } |
| return ret; |
| }), |
| createFolder: (function(parent, name, canRead, canWrite) { |
| var path = PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name); |
| var mode = FS.getMode(canRead, canWrite); |
| return FS.mkdir(path, mode); |
| }), |
| createPath: (function(parent, path, canRead, canWrite) { |
| parent = typeof parent === "string" ? parent : FS.getPath(parent); |
| var parts = path.split("/").reverse(); |
| while (parts.length) { |
| var part = parts.pop(); |
| if (!part) continue; |
| var current = PATH.join2(parent, part); |
| try { |
| FS.mkdir(current); |
| } catch (e) {} |
| parent = current; |
| } |
| return current; |
| }), |
| createFile: (function(parent, name, properties, canRead, canWrite) { |
| var path = PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name); |
| var mode = FS.getMode(canRead, canWrite); |
| return FS.create(path, mode); |
| }), |
| createDataFile: (function(parent, name, data, canRead, canWrite, canOwn) { |
| var path = name ? PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name) : parent; |
| var mode = FS.getMode(canRead, canWrite); |
| var node = FS.create(path, mode); |
| if (data) { |
| if (typeof data === "string") { |
| var arr = new Array(data.length); |
| for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i); |
| data = arr; |
| } |
| FS.chmod(node, mode | 146); |
| var stream = FS.open(node, "w"); |
| FS.write(stream, data, 0, data.length, 0, canOwn); |
| FS.close(stream); |
| FS.chmod(node, mode); |
| } |
| return node; |
| }), |
| createDevice: (function(parent, name, input, output) { |
| var path = PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name); |
| var mode = FS.getMode(!!input, !!output); |
| if (!FS.createDevice.major) FS.createDevice.major = 64; |
| var dev = FS.makedev(FS.createDevice.major++, 0); |
| FS.registerDevice(dev, { |
| open: (function(stream) { |
| stream.seekable = false; |
| }), |
| close: (function(stream) { |
| if (output && output.buffer && output.buffer.length) { |
| output(10); |
| } |
| }), |
| read: (function(stream, buffer, offset, length, pos) { |
| var bytesRead = 0; |
| for (var i = 0; i < length; i++) { |
| var result; |
| try { |
| result = input(); |
| } catch (e) { |
| throw new FS.ErrnoError(ERRNO_CODES.EIO); |
| } |
| if (result === undefined && bytesRead === 0) { |
| throw new FS.ErrnoError(ERRNO_CODES.EAGAIN); |
| } |
| if (result === null || result === undefined) break; |
| bytesRead++; |
| buffer[offset + i] = result; |
| } |
| if (bytesRead) { |
| stream.node.timestamp = Date.now(); |
| } |
| return bytesRead; |
| }), |
| write: (function(stream, buffer, offset, length, pos) { |
| for (var i = 0; i < length; i++) { |
| try { |
| output(buffer[offset + i]); |
| } catch (e) { |
| throw new FS.ErrnoError(ERRNO_CODES.EIO); |
| } |
| } |
| if (length) { |
| stream.node.timestamp = Date.now(); |
| } |
| return i; |
| }) |
| }); |
| return FS.mkdev(path, mode, dev); |
| }), |
| createLink: (function(parent, name, target, canRead, canWrite) { |
| var path = PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name); |
| return FS.symlink(target, path); |
| }), |
| forceLoadFile: (function(obj) { |
| if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true; |
| var success = true; |
| if (typeof XMLHttpRequest !== "undefined") { |
| throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread."); |
| } else if (Module["read"]) { |
| try { |
| obj.contents = intArrayFromString(Module["read"](obj.url), true); |
| obj.usedBytes = obj.contents.length; |
| } catch (e) { |
| success = false; |
| } |
| } else { |
| throw new Error("Cannot load without read() or XMLHttpRequest."); |
| } |
| if (!success) ___setErrNo(ERRNO_CODES.EIO); |
| return success; |
| }), |
| createLazyFile: (function(parent, name, url, canRead, canWrite) { |
| function LazyUint8Array() { |
| this.lengthKnown = false; |
| this.chunks = []; |
| } |
| LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) { |
| if (idx > this.length - 1 || idx < 0) { |
| return undefined; |
| } |
| var chunkOffset = idx % this.chunkSize; |
| var chunkNum = idx / this.chunkSize | 0; |
| return this.getter(chunkNum)[chunkOffset]; |
| }; |
| LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) { |
| this.getter = getter; |
| }; |
| LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() { |
| var xhr = new XMLHttpRequest; |
| xhr.open("HEAD", url, false); |
| xhr.send(null); |
| if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); |
| var datalength = Number(xhr.getResponseHeader("Content-length")); |
| var header; |
| var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes"; |
| var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip"; |
| var chunkSize = 1024 * 1024; |
| if (!hasByteServing) chunkSize = datalength; |
| var doXHR = (function(from, to) { |
| if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!"); |
| if (to > datalength - 1) throw new Error("only " + datalength + " bytes available! programmer error!"); |
| var xhr = new XMLHttpRequest; |
| xhr.open("GET", url, false); |
| if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to); |
| if (typeof Uint8Array != "undefined") xhr.responseType = "arraybuffer"; |
| if (xhr.overrideMimeType) { |
| xhr.overrideMimeType("text/plain; charset=x-user-defined"); |
| } |
| xhr.send(null); |
| if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); |
| if (xhr.response !== undefined) { |
| return new Uint8Array(xhr.response || []); |
| } else { |
| return intArrayFromString(xhr.responseText || "", true); |
| } |
| }); |
| var lazyArray = this; |
| lazyArray.setDataGetter((function(chunkNum) { |
| var start = chunkNum * chunkSize; |
| var end = (chunkNum + 1) * chunkSize - 1; |
| end = Math.min(end, datalength - 1); |
| if (typeof lazyArray.chunks[chunkNum] === "undefined") { |
| lazyArray.chunks[chunkNum] = doXHR(start, end); |
| } |
| if (typeof lazyArray.chunks[chunkNum] === "undefined") throw new Error("doXHR failed!"); |
| return lazyArray.chunks[chunkNum]; |
| })); |
| if (usesGzip || !datalength) { |
| chunkSize = datalength = 1; |
| datalength = this.getter(0).length; |
| chunkSize = datalength; |
| console.log("LazyFiles on gzip forces download of the whole file when length is accessed"); |
| } |
| this._length = datalength; |
| this._chunkSize = chunkSize; |
| this.lengthKnown = true; |
| }; |
| if (typeof XMLHttpRequest !== "undefined") { |
| if (!ENVIRONMENT_IS_WORKER) throw "Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc"; |
| var lazyArray = new LazyUint8Array; |
| Object.defineProperties(lazyArray, { |
| length: { |
| get: (function() { |
| if (!this.lengthKnown) { |
| this.cacheLength(); |
| } |
| return this._length; |
| }) |
| }, |
| chunkSize: { |
| get: (function() { |
| if (!this.lengthKnown) { |
| this.cacheLength(); |
| } |
| return this._chunkSize; |
| }) |
| } |
| }); |
| var properties = { |
| isDevice: false, |
| contents: lazyArray |
| }; |
| } else { |
| var properties = { |
| isDevice: false, |
| url: url |
| }; |
| } |
| var node = FS.createFile(parent, name, properties, canRead, canWrite); |
| if (properties.contents) { |
| node.contents = properties.contents; |
| } else if (properties.url) { |
| node.contents = null; |
| node.url = properties.url; |
| } |
| Object.defineProperties(node, { |
| usedBytes: { |
| get: (function() { |
| return this.contents.length; |
| }) |
| } |
| }); |
| var stream_ops = {}; |
| var keys = Object.keys(node.stream_ops); |
| keys.forEach((function(key) { |
| var fn = node.stream_ops[key]; |
| stream_ops[key] = function forceLoadLazyFile() { |
| if (!FS.forceLoadFile(node)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EIO); |
| } |
| return fn.apply(null, arguments); |
| }; |
| })); |
| stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) { |
| if (!FS.forceLoadFile(node)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EIO); |
| } |
| var contents = stream.node.contents; |
| if (position >= contents.length) return 0; |
| var size = Math.min(contents.length - position, length); |
| assert(size >= 0); |
| if (contents.slice) { |
| for (var i = 0; i < size; i++) { |
| buffer[offset + i] = contents[position + i]; |
| } |
| } else { |
| for (var i = 0; i < size; i++) { |
| buffer[offset + i] = contents.get(position + i); |
| } |
| } |
| return size; |
| }; |
| node.stream_ops = stream_ops; |
| return node; |
| }), |
| createPreloadedFile: (function(parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) { |
| Browser.init(); |
| var fullname = name ? PATH.resolve(PATH.join2(parent, name)) : parent; |
| var dep = getUniqueRunDependency("cp " + fullname); |
| function processData(byteArray) { |
| function finish(byteArray) { |
| if (preFinish) preFinish(); |
| if (!dontCreateFile) { |
| FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn); |
| } |
| if (onload) onload(); |
| removeRunDependency(dep); |
| } |
| var handled = false; |
| Module["preloadPlugins"].forEach((function(plugin) { |
| if (handled) return; |
| if (plugin["canHandle"](fullname)) { |
| plugin["handle"](byteArray, fullname, finish, (function() { |
| if (onerror) onerror(); |
| removeRunDependency(dep); |
| })); |
| handled = true; |
| } |
| })); |
| if (!handled) finish(byteArray); |
| } |
| addRunDependency(dep); |
| if (typeof url == "string") { |
| Browser.asyncLoad(url, (function(byteArray) { |
| processData(byteArray); |
| }), onerror); |
| } else { |
| processData(url); |
| } |
| }), |
| indexedDB: (function() { |
| return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB; |
| }), |
| DB_NAME: (function() { |
| return "EM_FS_" + window.location.pathname; |
| }), |
| DB_VERSION: 20, |
| DB_STORE_NAME: "FILE_DATA", |
| saveFilesToDB: (function(paths, onload, onerror) { |
| onload = onload || (function() {}); |
| onerror = onerror || (function() {}); |
| var indexedDB = FS.indexedDB(); |
| try { |
| var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION); |
| } catch (e) { |
| return onerror(e); |
| } |
| openRequest.onupgradeneeded = function openRequest_onupgradeneeded() { |
| console.log("creating db"); |
| var db = openRequest.result; |
| db.createObjectStore(FS.DB_STORE_NAME); |
| }; |
| openRequest.onsuccess = function openRequest_onsuccess() { |
| var db = openRequest.result; |
| var transaction = db.transaction([ FS.DB_STORE_NAME ], "readwrite"); |
| var files = transaction.objectStore(FS.DB_STORE_NAME); |
| var ok = 0, fail = 0, total = paths.length; |
| function finish() { |
| if (fail == 0) onload(); else onerror(); |
| } |
| paths.forEach((function(path) { |
| var putRequest = files.put(FS.analyzePath(path).object.contents, path); |
| putRequest.onsuccess = function putRequest_onsuccess() { |
| ok++; |
| if (ok + fail == total) finish(); |
| }; |
| putRequest.onerror = function putRequest_onerror() { |
| fail++; |
| if (ok + fail == total) finish(); |
| }; |
| })); |
| transaction.onerror = onerror; |
| }; |
| openRequest.onerror = onerror; |
| }), |
| loadFilesFromDB: (function(paths, onload, onerror) { |
| onload = onload || (function() {}); |
| onerror = onerror || (function() {}); |
| var indexedDB = FS.indexedDB(); |
| try { |
| var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION); |
| } catch (e) { |
| return onerror(e); |
| } |
| openRequest.onupgradeneeded = onerror; |
| openRequest.onsuccess = function openRequest_onsuccess() { |
| var db = openRequest.result; |
| try { |
| var transaction = db.transaction([ FS.DB_STORE_NAME ], "readonly"); |
| } catch (e) { |
| onerror(e); |
| return; |
| } |
| var files = transaction.objectStore(FS.DB_STORE_NAME); |
| var ok = 0, fail = 0, total = paths.length; |
| function finish() { |
| if (fail == 0) onload(); else onerror(); |
| } |
| paths.forEach((function(path) { |
| var getRequest = files.get(path); |
| getRequest.onsuccess = function getRequest_onsuccess() { |
| if (FS.analyzePath(path).exists) { |
| FS.unlink(path); |
| } |
| FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true); |
| ok++; |
| if (ok + fail == total) finish(); |
| }; |
| getRequest.onerror = function getRequest_onerror() { |
| fail++; |
| if (ok + fail == total) finish(); |
| }; |
| })); |
| transaction.onerror = onerror; |
| }; |
| openRequest.onerror = onerror; |
| }) |
| }; |
| var SYSCALLS = { |
| DEFAULT_POLLMASK: 5, |
| mappings: {}, |
| umask: 511, |
| calculateAt: (function(dirfd, path) { |
| if (path[0] !== "/") { |
| var dir; |
| if (dirfd === -100) { |
| dir = FS.cwd(); |
| } else { |
| var dirstream = FS.getStream(dirfd); |
| if (!dirstream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
| dir = dirstream.path; |
| } |
| path = PATH.join2(dir, path); |
| } |
| return path; |
| }), |
| doStat: (function(func, path, buf) { |
| try { |
| var stat = func(path); |
| } catch (e) { |
| if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) { |
| return -ERRNO_CODES.ENOTDIR; |
| } |
| throw e; |
| } |
| HEAP32[buf >> 2] = stat.dev; |
| HEAP32[buf + 4 >> 2] = 0; |
| HEAP32[buf + 8 >> 2] = stat.ino; |
| HEAP32[buf + 12 >> 2] = stat.mode; |
| HEAP32[buf + 16 >> 2] = stat.nlink; |
| HEAP32[buf + 20 >> 2] = stat.uid; |
| HEAP32[buf + 24 >> 2] = stat.gid; |
| HEAP32[buf + 28 >> 2] = stat.rdev; |
| HEAP32[buf + 32 >> 2] = 0; |
| HEAP32[buf + 36 >> 2] = stat.size; |
| HEAP32[buf + 40 >> 2] = 4096; |
| HEAP32[buf + 44 >> 2] = stat.blocks; |
| HEAP32[buf + 48 >> 2] = stat.atime.getTime() / 1e3 | 0; |
| HEAP32[buf + 52 >> 2] = 0; |
| HEAP32[buf + 56 >> 2] = stat.mtime.getTime() / 1e3 | 0; |
| HEAP32[buf + 60 >> 2] = 0; |
| HEAP32[buf + 64 >> 2] = stat.ctime.getTime() / 1e3 | 0; |
| HEAP32[buf + 68 >> 2] = 0; |
| HEAP32[buf + 72 >> 2] = stat.ino; |
| return 0; |
| }), |
| doMsync: (function(addr, stream, len, flags) { |
| var buffer = new Uint8Array(HEAPU8.subarray(addr, addr + len)); |
| FS.msync(stream, buffer, 0, len, flags); |
| }), |
| doMkdir: (function(path, mode) { |
| path = PATH.normalize(path); |
| if (path[path.length - 1] === "/") path = path.substr(0, path.length - 1); |
| FS.mkdir(path, mode, 0); |
| return 0; |
| }), |
| doMknod: (function(path, mode, dev) { |
| switch (mode & 61440) { |
| case 32768: |
| case 8192: |
| case 24576: |
| case 4096: |
| case 49152: |
| break; |
| default: |
| return -ERRNO_CODES.EINVAL; |
| } |
| FS.mknod(path, mode, dev); |
| return 0; |
| }), |
| doReadlink: (function(path, buf, bufsize) { |
| if (bufsize <= 0) return -ERRNO_CODES.EINVAL; |
| var ret = FS.readlink(path); |
| var len = Math.min(bufsize, lengthBytesUTF8(ret)); |
| var endChar = HEAP8[buf + len]; |
| stringToUTF8(ret, buf, bufsize + 1); |
| HEAP8[buf + len] = endChar; |
| return len; |
| }), |
| doAccess: (function(path, amode) { |
| if (amode & ~7) { |
| return -ERRNO_CODES.EINVAL; |
| } |
| var node; |
| var lookup = FS.lookupPath(path, { |
| follow: true |
| }); |
| node = lookup.node; |
| var perms = ""; |
| if (amode & 4) perms += "r"; |
| if (amode & 2) perms += "w"; |
| if (amode & 1) perms += "x"; |
| if (perms && FS.nodePermissions(node, perms)) { |
| return -ERRNO_CODES.EACCES; |
| } |
| return 0; |
| }), |
| doDup: (function(path, flags, suggestFD) { |
| var suggest = FS.getStream(suggestFD); |
| if (suggest) FS.close(suggest); |
| return FS.open(path, flags, 0, suggestFD, suggestFD).fd; |
| }), |
| doReadv: (function(stream, iov, iovcnt, offset) { |
| var ret = 0; |
| for (var i = 0; i < iovcnt; i++) { |
| var ptr = HEAP32[iov + i * 8 >> 2]; |
| var len = HEAP32[iov + (i * 8 + 4) >> 2]; |
| var curr = FS.read(stream, HEAP8, ptr, len, offset); |
| if (curr < 0) return -1; |
| ret += curr; |
| if (curr < len) break; |
| } |
| return ret; |
| }), |
| doWritev: (function(stream, iov, iovcnt, offset) { |
| var ret = 0; |
| for (var i = 0; i < iovcnt; i++) { |
| var ptr = HEAP32[iov + i * 8 >> 2]; |
| var len = HEAP32[iov + (i * 8 + 4) >> 2]; |
| var curr = FS.write(stream, HEAP8, ptr, len, offset); |
| if (curr < 0) return -1; |
| ret += curr; |
| } |
| return ret; |
| }), |
| varargs: 0, |
| get: (function(varargs) { |
| SYSCALLS.varargs += 4; |
| var ret = HEAP32[SYSCALLS.varargs - 4 >> 2]; |
| return ret; |
| }), |
| getStr: (function() { |
| var ret = Pointer_stringify(SYSCALLS.get()); |
| return ret; |
| }), |
| getStreamFromFD: (function() { |
| var stream = FS.getStream(SYSCALLS.get()); |
| if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
| return stream; |
| }), |
| getSocketFromFD: (function() { |
| var socket = SOCKFS.getSocket(SYSCALLS.get()); |
| if (!socket) throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
| return socket; |
| }), |
| getSocketAddress: (function(allowNull) { |
| var addrp = SYSCALLS.get(), addrlen = SYSCALLS.get(); |
| if (allowNull && addrp === 0) return null; |
| var info = __read_sockaddr(addrp, addrlen); |
| if (info.errno) throw new FS.ErrnoError(info.errno); |
| info.addr = DNS.lookup_addr(info.addr) || info.addr; |
| return info; |
| }), |
| get64: (function() { |
| var low = SYSCALLS.get(), high = SYSCALLS.get(); |
| if (low >= 0) assert(high === 0); else assert(high === -1); |
| return low; |
| }), |
| getZero: (function() { |
| assert(SYSCALLS.get() === 0); |
| }) |
| }; |
| function ___syscall140(which, varargs) { |
| SYSCALLS.varargs = varargs; |
| try { |
| var stream = SYSCALLS.getStreamFromFD(), offset_high = SYSCALLS.get(), offset_low = SYSCALLS.get(), result = SYSCALLS.get(), whence = SYSCALLS.get(); |
| var offset = offset_low; |
| FS.llseek(stream, offset, whence); |
| HEAP32[result >> 2] = stream.position; |
| if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; |
| return 0; |
| } catch (e) { |
| if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
| return -e.errno; |
| } |
| } |
| function ___syscall145(which, varargs) { |
| SYSCALLS.varargs = varargs; |
| try { |
| var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get(); |
| return SYSCALLS.doReadv(stream, iov, iovcnt); |
| } catch (e) { |
| if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
| return -e.errno; |
| } |
| } |
| function ___syscall146(which, varargs) { |
| SYSCALLS.varargs = varargs; |
| try { |
| var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get(); |
| return SYSCALLS.doWritev(stream, iov, iovcnt); |
| } catch (e) { |
| if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
| return -e.errno; |
| } |
| } |
| function ___syscall54(which, varargs) { |
| SYSCALLS.varargs = varargs; |
| try { |
| var stream = SYSCALLS.getStreamFromFD(), op = SYSCALLS.get(); |
| switch (op) { |
| case 21509: |
| case 21505: |
| { |
| if (!stream.tty) return -ERRNO_CODES.ENOTTY; |
| return 0; |
| } |
| case 21510: |
| case 21511: |
| case 21512: |
| case 21506: |
| case 21507: |
| case 21508: |
| { |
| if (!stream.tty) return -ERRNO_CODES.ENOTTY; |
| return 0; |
| } |
| case 21519: |
| { |
| if (!stream.tty) return -ERRNO_CODES.ENOTTY; |
| var argp = SYSCALLS.get(); |
| HEAP32[argp >> 2] = 0; |
| return 0; |
| } |
| case 21520: |
| { |
| if (!stream.tty) return -ERRNO_CODES.ENOTTY; |
| return -ERRNO_CODES.EINVAL; |
| } |
| case 21531: |
| { |
| var argp = SYSCALLS.get(); |
| return FS.ioctl(stream, op, argp); |
| } |
| case 21523: |
| { |
| if (!stream.tty) return -ERRNO_CODES.ENOTTY; |
| return 0; |
| } |
| case 21524: |
| { |
| if (!stream.tty) return -ERRNO_CODES.ENOTTY; |
| return 0; |
| } |
| default: |
| abort("bad ioctl syscall " + op); |
| } |
| } catch (e) { |
| if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
| return -e.errno; |
| } |
| } |
| function ___syscall6(which, varargs) { |
| SYSCALLS.varargs = varargs; |
| try { |
| var stream = SYSCALLS.getStreamFromFD(); |
| FS.close(stream); |
| return 0; |
| } catch (e) { |
| if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
| return -e.errno; |
| } |
| } |
| function ___syscall91(which, varargs) { |
| SYSCALLS.varargs = varargs; |
| try { |
| var addr = SYSCALLS.get(), len = SYSCALLS.get(); |
| var info = SYSCALLS.mappings[addr]; |
| if (!info) return 0; |
| if (len === info.len) { |
| var stream = FS.getStream(info.fd); |
| SYSCALLS.doMsync(addr, stream, len, info.flags); |
| FS.munmap(stream); |
| SYSCALLS.mappings[addr] = null; |
| if (info.allocated) { |
| _free(info.malloc); |
| } |
| } |
| return 0; |
| } catch (e) { |
| if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
| return -e.errno; |
| } |
| } |
| function ___unlock() {} |
| function _abort() { |
| Module["abort"](); |
| } |
| var _environ = STATICTOP; |
| STATICTOP += 16; |
| function ___buildEnvironment(env) { |
| var MAX_ENV_VALUES = 64; |
| var TOTAL_ENV_SIZE = 1024; |
| var poolPtr; |
| var envPtr; |
| if (!___buildEnvironment.called) { |
| ___buildEnvironment.called = true; |
| ENV["USER"] = ENV["LOGNAME"] = "web_user"; |
| ENV["PATH"] = "/"; |
| ENV["PWD"] = "/"; |
| ENV["HOME"] = "/home/web_user"; |
| ENV["LANG"] = "C.UTF-8"; |
| ENV["_"] = Module["thisProgram"]; |
| poolPtr = staticAlloc(TOTAL_ENV_SIZE); |
| envPtr = staticAlloc(MAX_ENV_VALUES * 4); |
| HEAP32[envPtr >> 2] = poolPtr; |
| HEAP32[_environ >> 2] = envPtr; |
| } else { |
| envPtr = HEAP32[_environ >> 2]; |
| poolPtr = HEAP32[envPtr >> 2]; |
| } |
| var strings = []; |
| var totalSize = 0; |
| for (var key in env) { |
| if (typeof env[key] === "string") { |
| var line = key + "=" + env[key]; |
| strings.push(line); |
| totalSize += line.length; |
| } |
| } |
| if (totalSize > TOTAL_ENV_SIZE) { |
| throw new Error("Environment size exceeded TOTAL_ENV_SIZE!"); |
| } |
| var ptrSize = 4; |
| for (var i = 0; i < strings.length; i++) { |
| var line = strings[i]; |
| writeAsciiToMemory(line, poolPtr); |
| HEAP32[envPtr + i * ptrSize >> 2] = poolPtr; |
| poolPtr += line.length + 1; |
| } |
| HEAP32[envPtr + strings.length * ptrSize >> 2] = 0; |
| } |
| var ENV = {}; |
| function _getenv(name) { |
| if (name === 0) return 0; |
| name = Pointer_stringify(name); |
| if (!ENV.hasOwnProperty(name)) return 0; |
| if (_getenv.ret) _free(_getenv.ret); |
| _getenv.ret = allocateUTF8(ENV[name]); |
| return _getenv.ret; |
| } |
| function _gettimeofday(ptr) { |
| var now = Date.now(); |
| HEAP32[ptr >> 2] = now / 1e3 | 0; |
| HEAP32[ptr + 4 >> 2] = now % 1e3 * 1e3 | 0; |
| return 0; |
| } |
| function _emscripten_memcpy_big(dest, src, num) { |
| HEAPU8.set(HEAPU8.subarray(src, src + num), dest); |
| return dest; |
| } |
| function _pthread_cond_wait() { |
| return 0; |
| } |
| var PTHREAD_SPECIFIC = {}; |
| function _pthread_getspecific(key) { |
| return PTHREAD_SPECIFIC[key] || 0; |
| } |
| var PTHREAD_SPECIFIC_NEXT_KEY = 1; |
| function _pthread_key_create(key, destructor) { |
| if (key == 0) { |
| return ERRNO_CODES.EINVAL; |
| } |
| HEAP32[key >> 2] = PTHREAD_SPECIFIC_NEXT_KEY; |
| PTHREAD_SPECIFIC[PTHREAD_SPECIFIC_NEXT_KEY] = 0; |
| PTHREAD_SPECIFIC_NEXT_KEY++; |
| return 0; |
| } |
| function _pthread_once(ptr, func) { |
| if (!_pthread_once.seen) _pthread_once.seen = {}; |
| if (ptr in _pthread_once.seen) return; |
| Module["dynCall_v"](func); |
| _pthread_once.seen[ptr] = 1; |
| } |
| function _pthread_setspecific(key, value) { |
| if (!(key in PTHREAD_SPECIFIC)) { |
| return ERRNO_CODES.EINVAL; |
| } |
| PTHREAD_SPECIFIC[key] = value; |
| return 0; |
| } |
| function __isLeapYear(year) { |
| return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0); |
| } |
| function __arraySum(array, index) { |
| var sum = 0; |
| for (var i = 0; i <= index; sum += array[i++]) ; |
| return sum; |
| } |
| var __MONTH_DAYS_LEAP = [ 31, 29, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31 ]; |
| var __MONTH_DAYS_REGULAR = [ 31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31 ]; |
| function __addDays(date, days) { |
| var newDate = new Date(date.getTime()); |
| while (days > 0) { |
| var leap = __isLeapYear(newDate.getFullYear()); |
| var currentMonth = newDate.getMonth(); |
| var daysInCurrentMonth = (leap ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR)[currentMonth]; |
| if (days > daysInCurrentMonth - newDate.getDate()) { |
| days -= daysInCurrentMonth - newDate.getDate() + 1; |
| newDate.setDate(1); |
| if (currentMonth < 11) { |
| newDate.setMonth(currentMonth + 1); |
| } else { |
| newDate.setMonth(0); |
| newDate.setFullYear(newDate.getFullYear() + 1); |
| } |
| } else { |
| newDate.setDate(newDate.getDate() + days); |
| return newDate; |
| } |
| } |
| return newDate; |
| } |
| function _strftime(s, maxsize, format, tm) { |
| var tm_zone = HEAP32[tm + 40 >> 2]; |
| var date = { |
| tm_sec: HEAP32[tm >> 2], |
| tm_min: HEAP32[tm + 4 >> 2], |
| tm_hour: HEAP32[tm + 8 >> 2], |
| tm_mday: HEAP32[tm + 12 >> 2], |
| tm_mon: HEAP32[tm + 16 >> 2], |
| tm_year: HEAP32[tm + 20 >> 2], |
| tm_wday: HEAP32[tm + 24 >> 2], |
| tm_yday: HEAP32[tm + 28 >> 2], |
| tm_isdst: HEAP32[tm + 32 >> 2], |
| tm_gmtoff: HEAP32[tm + 36 >> 2], |
| tm_zone: tm_zone ? Pointer_stringify(tm_zone) : "" |
| }; |
| var pattern = Pointer_stringify(format); |
| var EXPANSION_RULES_1 = { |
| "%c": "%a %b %d %H:%M:%S %Y", |
| "%D": "%m/%d/%y", |
| "%F": "%Y-%m-%d", |
| "%h": "%b", |
| "%r": "%I:%M:%S %p", |
| "%R": "%H:%M", |
| "%T": "%H:%M:%S", |
| "%x": "%m/%d/%y", |
| "%X": "%H:%M:%S" |
| }; |
| for (var rule in EXPANSION_RULES_1) { |
| pattern = pattern.replace(new RegExp(rule, "g"), EXPANSION_RULES_1[rule]); |
| } |
| var WEEKDAYS = [ "Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday" ]; |
| var MONTHS = [ "January", "February", "March", "April", "May", "June", "July", "August", "September", "October", "November", "December" ]; |
| function leadingSomething(value, digits, character) { |
| var str = typeof value === "number" ? value.toString() : value || ""; |
| while (str.length < digits) { |
| str = character[0] + str; |
| } |
| return str; |
| } |
| function leadingNulls(value, digits) { |
| return leadingSomething(value, digits, "0"); |
| } |
| function compareByDay(date1, date2) { |
| function sgn(value) { |
| return value < 0 ? -1 : value > 0 ? 1 : 0; |
| } |
| var compare; |
| if ((compare = sgn(date1.getFullYear() - date2.getFullYear())) === 0) { |
| if ((compare = sgn(date1.getMonth() - date2.getMonth())) === 0) { |
| compare = sgn(date1.getDate() - date2.getDate()); |
| } |
| } |
| return compare; |
| } |
| function getFirstWeekStartDate(janFourth) { |
| switch (janFourth.getDay()) { |
| case 0: |
| return new Date(janFourth.getFullYear() - 1, 11, 29); |
| case 1: |
| return janFourth; |
| case 2: |
| return new Date(janFourth.getFullYear(), 0, 3); |
| case 3: |
| return new Date(janFourth.getFullYear(), 0, 2); |
| case 4: |
| return new Date(janFourth.getFullYear(), 0, 1); |
| case 5: |
| return new Date(janFourth.getFullYear() - 1, 11, 31); |
| case 6: |
| return new Date(janFourth.getFullYear() - 1, 11, 30); |
| } |
| } |
| function getWeekBasedYear(date) { |
| var thisDate = __addDays(new Date(date.tm_year + 1900, 0, 1), date.tm_yday); |
| var janFourthThisYear = new Date(thisDate.getFullYear(), 0, 4); |
| var janFourthNextYear = new Date(thisDate.getFullYear() + 1, 0, 4); |
| var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear); |
| var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear); |
| if (compareByDay(firstWeekStartThisYear, thisDate) <= 0) { |
| if (compareByDay(firstWeekStartNextYear, thisDate) <= 0) { |
| return thisDate.getFullYear() + 1; |
| } else { |
| return thisDate.getFullYear(); |
| } |
| } else { |
| return thisDate.getFullYear() - 1; |
| } |
| } |
| var EXPANSION_RULES_2 = { |
| "%a": (function(date) { |
| return WEEKDAYS[date.tm_wday].substring(0, 3); |
| }), |
| "%A": (function(date) { |
| return WEEKDAYS[date.tm_wday]; |
| }), |
| "%b": (function(date) { |
| return MONTHS[date.tm_mon].substring(0, 3); |
| }), |
| "%B": (function(date) { |
| return MONTHS[date.tm_mon]; |
| }), |
| "%C": (function(date) { |
| var year = date.tm_year + 1900; |
| return leadingNulls(year / 100 | 0, 2); |
| }), |
| "%d": (function(date) { |
| return leadingNulls(date.tm_mday, 2); |
| }), |
| "%e": (function(date) { |
| return leadingSomething(date.tm_mday, 2, " "); |
| }), |
| "%g": (function(date) { |
| return getWeekBasedYear(date).toString().substring(2); |
| }), |
| "%G": (function(date) { |
| return getWeekBasedYear(date); |
| }), |
| "%H": (function(date) { |
| return leadingNulls(date.tm_hour, 2); |
| }), |
| "%I": (function(date) { |
| var twelveHour = date.tm_hour; |
| if (twelveHour == 0) twelveHour = 12; else if (twelveHour > 12) twelveHour -= 12; |
| return leadingNulls(twelveHour, 2); |
| }), |
| "%j": (function(date) { |
| return leadingNulls(date.tm_mday + __arraySum(__isLeapYear(date.tm_year + 1900) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, date.tm_mon - 1), 3); |
| }), |
| "%m": (function(date) { |
| return leadingNulls(date.tm_mon + 1, 2); |
| }), |
| "%M": (function(date) { |
| return leadingNulls(date.tm_min, 2); |
| }), |
| "%n": (function() { |
| return "\n"; |
| }), |
| "%p": (function(date) { |
| if (date.tm_hour >= 0 && date.tm_hour < 12) { |
| return "AM"; |
| } else { |
| return "PM"; |
| } |
| }), |
| "%S": (function(date) { |
| return leadingNulls(date.tm_sec, 2); |
| }), |
| "%t": (function() { |
| return "\t"; |
| }), |
| "%u": (function(date) { |
| var day = new Date(date.tm_year + 1900, date.tm_mon + 1, date.tm_mday, 0, 0, 0, 0); |
| return day.getDay() || 7; |
| }), |
| "%U": (function(date) { |
| var janFirst = new Date(date.tm_year + 1900, 0, 1); |
| var firstSunday = janFirst.getDay() === 0 ? janFirst : __addDays(janFirst, 7 - janFirst.getDay()); |
| var endDate = new Date(date.tm_year + 1900, date.tm_mon, date.tm_mday); |
| if (compareByDay(firstSunday, endDate) < 0) { |
| var februaryFirstUntilEndMonth = __arraySum(__isLeapYear(endDate.getFullYear()) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, endDate.getMonth() - 1) - 31; |
| var firstSundayUntilEndJanuary = 31 - firstSunday.getDate(); |
| var days = firstSundayUntilEndJanuary + februaryFirstUntilEndMonth + endDate.getDate(); |
| return leadingNulls(Math.ceil(days / 7), 2); |
| } |
| return compareByDay(firstSunday, janFirst) === 0 ? "01" : "00"; |
| }), |
| "%V": (function(date) { |
| var janFourthThisYear = new Date(date.tm_year + 1900, 0, 4); |
| var janFourthNextYear = new Date(date.tm_year + 1901, 0, 4); |
| var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear); |
| var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear); |
| var endDate = __addDays(new Date(date.tm_year + 1900, 0, 1), date.tm_yday); |
| if (compareByDay(endDate, firstWeekStartThisYear) < 0) { |
| return "53"; |
| } |
| if (compareByDay(firstWeekStartNextYear, endDate) <= 0) { |
| return "01"; |
| } |
| var daysDifference; |
| if (firstWeekStartThisYear.getFullYear() < date.tm_year + 1900) { |
| daysDifference = date.tm_yday + 32 - firstWeekStartThisYear.getDate(); |
| } else { |
| daysDifference = date.tm_yday + 1 - firstWeekStartThisYear.getDate(); |
| } |
| return leadingNulls(Math.ceil(daysDifference / 7), 2); |
| }), |
| "%w": (function(date) { |
| var day = new Date(date.tm_year + 1900, date.tm_mon + 1, date.tm_mday, 0, 0, 0, 0); |
| return day.getDay(); |
| }), |
| "%W": (function(date) { |
| var janFirst = new Date(date.tm_year, 0, 1); |
| var firstMonday = janFirst.getDay() === 1 ? janFirst : __addDays(janFirst, janFirst.getDay() === 0 ? 1 : 7 - janFirst.getDay() + 1); |
| var endDate = new Date(date.tm_year + 1900, date.tm_mon, date.tm_mday); |
| if (compareByDay(firstMonday, endDate) < 0) { |
| var februaryFirstUntilEndMonth = __arraySum(__isLeapYear(endDate.getFullYear()) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, endDate.getMonth() - 1) - 31; |
| var firstMondayUntilEndJanuary = 31 - firstMonday.getDate(); |
| var days = firstMondayUntilEndJanuary + februaryFirstUntilEndMonth + endDate.getDate(); |
| return leadingNulls(Math.ceil(days / 7), 2); |
| } |
| return compareByDay(firstMonday, janFirst) === 0 ? "01" : "00"; |
| }), |
| "%y": (function(date) { |
| return (date.tm_year + 1900).toString().substring(2); |
| }), |
| "%Y": (function(date) { |
| return date.tm_year + 1900; |
| }), |
| "%z": (function(date) { |
| var off = date.tm_gmtoff; |
| var ahead = off >= 0; |
| off = Math.abs(off) / 60; |
| off = off / 60 * 100 + off % 60; |
| return (ahead ? "+" : "-") + String("0000" + off).slice(-4); |
| }), |
| "%Z": (function(date) { |
| return date.tm_zone; |
| }), |
| "%%": (function() { |
| return "%"; |
| }) |
| }; |
| for (var rule in EXPANSION_RULES_2) { |
| if (pattern.indexOf(rule) >= 0) { |
| pattern = pattern.replace(new RegExp(rule, "g"), EXPANSION_RULES_2[rule](date)); |
| } |
| } |
| var bytes = intArrayFromString(pattern, false); |
| if (bytes.length > maxsize) { |
| return 0; |
| } |
| writeArrayToMemory(bytes, s); |
| return bytes.length - 1; |
| } |
| function _strftime_l(s, maxsize, format, tm) { |
| return _strftime(s, maxsize, format, tm); |
| } |
| FS.staticInit(); |
| __ATINIT__.unshift((function() { |
| if (!Module["noFSInit"] && !FS.init.initialized) FS.init(); |
| })); |
| __ATMAIN__.push((function() { |
| FS.ignorePermissions = false; |
| })); |
| __ATEXIT__.push((function() { |
| FS.quit(); |
| })); |
| __ATINIT__.unshift((function() { |
| TTY.init(); |
| })); |
| __ATEXIT__.push((function() { |
| TTY.shutdown(); |
| })); |
| if (ENVIRONMENT_IS_NODE) { |
| var fs = require("fs"); |
| var NODEJS_PATH = require("path"); |
| NODEFS.staticInit(); |
| } |
| ___buildEnvironment(ENV); |
| DYNAMICTOP_PTR = staticAlloc(4); |
| STACK_BASE = STACKTOP = alignMemory(STATICTOP); |
| STACK_MAX = STACK_BASE + TOTAL_STACK; |
| DYNAMIC_BASE = alignMemory(STACK_MAX); |
| HEAP32[DYNAMICTOP_PTR >> 2] = DYNAMIC_BASE; |
| staticSealed = true; |
| var ASSERTIONS = false; |
| function intArrayFromString(stringy, dontAddNull, length) { |
| var len = length > 0 ? length : lengthBytesUTF8(stringy) + 1; |
| var u8array = new Array(len); |
| var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length); |
| if (dontAddNull) u8array.length = numBytesWritten; |
| return u8array; |
| } |
| Module["wasmTableSize"] = 481; |
| Module["wasmMaxTableSize"] = 481; |
| function invoke_ii(index, a1) { |
| try { |
| return Module["dynCall_ii"](index, a1); |
| } catch (e) { |
| if (typeof e !== "number" && e !== "longjmp") throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| function invoke_iii(index, a1, a2) { |
| try { |
| return Module["dynCall_iii"](index, a1, a2); |
| } catch (e) { |
| if (typeof e !== "number" && e !== "longjmp") throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| function invoke_iiii(index, a1, a2, a3) { |
| try { |
| return Module["dynCall_iiii"](index, a1, a2, a3); |
| } catch (e) { |
| if (typeof e !== "number" && e !== "longjmp") throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| function invoke_iiiii(index, a1, a2, a3, a4) { |
| try { |
| return Module["dynCall_iiiii"](index, a1, a2, a3, a4); |
| } catch (e) { |
| if (typeof e !== "number" && e !== "longjmp") throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| function invoke_iiiiid(index, a1, a2, a3, a4, a5) { |
| try { |
| return Module["dynCall_iiiiid"](index, a1, a2, a3, a4, a5); |
| } catch (e) { |
| if (typeof e !== "number" && e !== "longjmp") throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| function invoke_iiiiii(index, a1, a2, a3, a4, a5) { |
| try { |
| return Module["dynCall_iiiiii"](index, a1, a2, a3, a4, a5); |
| } catch (e) { |
| if (typeof e !== "number" && e !== "longjmp") throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| function invoke_iiiiiid(index, a1, a2, a3, a4, a5, a6) { |
| try { |
| return Module["dynCall_iiiiiid"](index, a1, a2, a3, a4, a5, a6); |
| } catch (e) { |
| if (typeof e !== "number" && e !== "longjmp") throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| function invoke_iiiiiii(index, a1, a2, a3, a4, a5, a6) { |
| try { |
| return Module["dynCall_iiiiiii"](index, a1, a2, a3, a4, a5, a6); |
| } catch (e) { |
| if (typeof e !== "number" && e !== "longjmp") throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| function invoke_iiiiiiii(index, a1, a2, a3, a4, a5, a6, a7) { |
| try { |
| return Module["dynCall_iiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7); |
| } catch (e) { |
| if (typeof e !== "number" && e !== "longjmp") throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| function invoke_iiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8) { |
| try { |
| return Module["dynCall_iiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8); |
| } catch (e) { |
| if (typeof e !== "number" && e !== "longjmp") throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| function invoke_iiiiij(index, a1, a2, a3, a4, a5, a6) { |
| try { |
| return Module["dynCall_iiiiij"](index, a1, a2, a3, a4, a5, a6); |
| } catch (e) { |
| if (typeof e !== "number" && e !== "longjmp") throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| function invoke_v(index) { |
| try { |
| Module["dynCall_v"](index); |
| } catch (e) { |
| if (typeof e !== "number" && e !== "longjmp") throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| function invoke_vi(index, a1) { |
| try { |
| Module["dynCall_vi"](index, a1); |
| } catch (e) { |
| if (typeof e !== "number" && e !== "longjmp") throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| function invoke_vii(index, a1, a2) { |
| try { |
| Module["dynCall_vii"](index, a1, a2); |
| } catch (e) { |
| if (typeof e !== "number" && e !== "longjmp") throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| function invoke_viii(index, a1, a2, a3) { |
| try { |
| Module["dynCall_viii"](index, a1, a2, a3); |
| } catch (e) { |
| if (typeof e !== "number" && e !== "longjmp") throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| function invoke_viiii(index, a1, a2, a3, a4) { |
| try { |
| Module["dynCall_viiii"](index, a1, a2, a3, a4); |
| } catch (e) { |
| if (typeof e !== "number" && e !== "longjmp") throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| function invoke_viiiii(index, a1, a2, a3, a4, a5) { |
| try { |
| Module["dynCall_viiiii"](index, a1, a2, a3, a4, a5); |
| } catch (e) { |
| if (typeof e !== "number" && e !== "longjmp") throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| function invoke_viiiiii(index, a1, a2, a3, a4, a5, a6) { |
| try { |
| Module["dynCall_viiiiii"](index, a1, a2, a3, a4, a5, a6); |
| } catch (e) { |
| if (typeof e !== "number" && e !== "longjmp") throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| function invoke_viijii(index, a1, a2, a3, a4, a5, a6) { |
| try { |
| Module["dynCall_viijii"](index, a1, a2, a3, a4, a5, a6); |
| } catch (e) { |
| if (typeof e !== "number" && e !== "longjmp") throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| Module.asmGlobalArg = {}; |
| Module.asmLibraryArg = { |
| "abort": abort, |
| "assert": assert, |
| "enlargeMemory": enlargeMemory, |
| "getTotalMemory": getTotalMemory, |
| "abortOnCannotGrowMemory": abortOnCannotGrowMemory, |
| "invoke_ii": invoke_ii, |
| "invoke_iii": invoke_iii, |
| "invoke_iiii": invoke_iiii, |
| "invoke_iiiii": invoke_iiiii, |
| "invoke_iiiiid": invoke_iiiiid, |
| "invoke_iiiiii": invoke_iiiiii, |
| "invoke_iiiiiid": invoke_iiiiiid, |
| "invoke_iiiiiii": invoke_iiiiiii, |
| "invoke_iiiiiiii": invoke_iiiiiiii, |
| "invoke_iiiiiiiii": invoke_iiiiiiiii, |
| "invoke_iiiiij": invoke_iiiiij, |
| "invoke_v": invoke_v, |
| "invoke_vi": invoke_vi, |
| "invoke_vii": invoke_vii, |
| "invoke_viii": invoke_viii, |
| "invoke_viiii": invoke_viiii, |
| "invoke_viiiii": invoke_viiiii, |
| "invoke_viiiiii": invoke_viiiiii, |
| "invoke_viijii": invoke_viijii, |
| "__ZSt18uncaught_exceptionv": __ZSt18uncaught_exceptionv, |
| "___buildEnvironment": ___buildEnvironment, |
| "___cxa_allocate_exception": ___cxa_allocate_exception, |
| "___cxa_begin_catch": ___cxa_begin_catch, |
| "___cxa_find_matching_catch": ___cxa_find_matching_catch, |
| "___cxa_throw": ___cxa_throw, |
| "___gxx_personality_v0": ___gxx_personality_v0, |
| "___lock": ___lock, |
| "___map_file": ___map_file, |
| "___resumeException": ___resumeException, |
| "___setErrNo": ___setErrNo, |
| "___syscall140": ___syscall140, |
| "___syscall145": ___syscall145, |
| "___syscall146": ___syscall146, |
| "___syscall54": ___syscall54, |
| "___syscall6": ___syscall6, |
| "___syscall91": ___syscall91, |
| "___unlock": ___unlock, |
| "__addDays": __addDays, |
| "__arraySum": __arraySum, |
| "__isLeapYear": __isLeapYear, |
| "_abort": _abort, |
| "_emscripten_memcpy_big": _emscripten_memcpy_big, |
| "_getenv": _getenv, |
| "_gettimeofday": _gettimeofday, |
| "_pthread_cond_wait": _pthread_cond_wait, |
| "_pthread_getspecific": _pthread_getspecific, |
| "_pthread_key_create": _pthread_key_create, |
| "_pthread_once": _pthread_once, |
| "_pthread_setspecific": _pthread_setspecific, |
| "_strftime": _strftime, |
| "_strftime_l": _strftime_l, |
| "DYNAMICTOP_PTR": DYNAMICTOP_PTR, |
| "tempDoublePtr": tempDoublePtr, |
| "ABORT": ABORT, |
| "STACKTOP": STACKTOP, |
| "STACK_MAX": STACK_MAX |
| }; |
| var asm = Module["asm"](Module.asmGlobalArg, Module.asmLibraryArg, buffer); |
| Module["asm"] = asm; |
| var __GLOBAL__I_000101 = Module["__GLOBAL__I_000101"] = (function() { |
| return Module["asm"]["__GLOBAL__I_000101"].apply(null, arguments); |
| }); |
| var __GLOBAL__sub_I_iostream_cpp = Module["__GLOBAL__sub_I_iostream_cpp"] = (function() { |
| return Module["asm"]["__GLOBAL__sub_I_iostream_cpp"].apply(null, arguments); |
| }); |
| var ___cxa_can_catch = Module["___cxa_can_catch"] = (function() { |
| return Module["asm"]["___cxa_can_catch"].apply(null, arguments); |
| }); |
| var ___cxa_is_pointer_type = Module["___cxa_is_pointer_type"] = (function() { |
| return Module["asm"]["___cxa_is_pointer_type"].apply(null, arguments); |
| }); |
| var ___errno_location = Module["___errno_location"] = (function() { |
| return Module["asm"]["___errno_location"].apply(null, arguments); |
| }); |
| var _free = Module["_free"] = (function() { |
| return Module["asm"]["_free"].apply(null, arguments); |
| }); |
| var _llvm_bswap_i32 = Module["_llvm_bswap_i32"] = (function() { |
| return Module["asm"]["_llvm_bswap_i32"].apply(null, arguments); |
| }); |
| var _main = Module["_main"] = (function() { |
| let performanceMark = performance.mark("gcc-loops-wasm-runtime"); |
| let start = benchmarkTime(); |
| let ret = Module["asm"]["_main"].apply(null, arguments); |
| reportRunTime(benchmarkTime() - start); |
| performanceMeasure("gcc-loops-wasm-runtime", performanceMark); |
| return ret; |
| }); |
| var _malloc = Module["_malloc"] = (function() { |
| return Module["asm"]["_malloc"].apply(null, arguments); |
| }); |
| var _memcpy = Module["_memcpy"] = (function() { |
| return Module["asm"]["_memcpy"].apply(null, arguments); |
| }); |
| var _memmove = Module["_memmove"] = (function() { |
| return Module["asm"]["_memmove"].apply(null, arguments); |
| }); |
| var _memset = Module["_memset"] = (function() { |
| return Module["asm"]["_memset"].apply(null, arguments); |
| }); |
| var _pthread_cond_broadcast = Module["_pthread_cond_broadcast"] = (function() { |
| return Module["asm"]["_pthread_cond_broadcast"].apply(null, arguments); |
| }); |
| var _pthread_mutex_lock = Module["_pthread_mutex_lock"] = (function() { |
| return Module["asm"]["_pthread_mutex_lock"].apply(null, arguments); |
| }); |
| var _pthread_mutex_unlock = Module["_pthread_mutex_unlock"] = (function() { |
| return Module["asm"]["_pthread_mutex_unlock"].apply(null, arguments); |
| }); |
| var _sbrk = Module["_sbrk"] = (function() { |
| return Module["asm"]["_sbrk"].apply(null, arguments); |
| }); |
| var establishStackSpace = Module["establishStackSpace"] = (function() { |
| return Module["asm"]["establishStackSpace"].apply(null, arguments); |
| }); |
| var getTempRet0 = Module["getTempRet0"] = (function() { |
| return Module["asm"]["getTempRet0"].apply(null, arguments); |
| }); |
| var runPostSets = Module["runPostSets"] = (function() { |
| return Module["asm"]["runPostSets"].apply(null, arguments); |
| }); |
| var setTempRet0 = Module["setTempRet0"] = (function() { |
| return Module["asm"]["setTempRet0"].apply(null, arguments); |
| }); |
| var setThrew = Module["setThrew"] = (function() { |
| return Module["asm"]["setThrew"].apply(null, arguments); |
| }); |
| var stackAlloc = Module["stackAlloc"] = (function() { |
| return Module["asm"]["stackAlloc"].apply(null, arguments); |
| }); |
| var stackRestore = Module["stackRestore"] = (function() { |
| return Module["asm"]["stackRestore"].apply(null, arguments); |
| }); |
| var stackSave = Module["stackSave"] = (function() { |
| return Module["asm"]["stackSave"].apply(null, arguments); |
| }); |
| var dynCall_ii = Module["dynCall_ii"] = (function() { |
| return Module["asm"]["dynCall_ii"].apply(null, arguments); |
| }); |
| var dynCall_iii = Module["dynCall_iii"] = (function() { |
| return Module["asm"]["dynCall_iii"].apply(null, arguments); |
| }); |
| var dynCall_iiii = Module["dynCall_iiii"] = (function() { |
| return Module["asm"]["dynCall_iiii"].apply(null, arguments); |
| }); |
| var dynCall_iiiii = Module["dynCall_iiiii"] = (function() { |
| return Module["asm"]["dynCall_iiiii"].apply(null, arguments); |
| }); |
| var dynCall_iiiiid = Module["dynCall_iiiiid"] = (function() { |
| return Module["asm"]["dynCall_iiiiid"].apply(null, arguments); |
| }); |
| var dynCall_iiiiii = Module["dynCall_iiiiii"] = (function() { |
| return Module["asm"]["dynCall_iiiiii"].apply(null, arguments); |
| }); |
| var dynCall_iiiiiid = Module["dynCall_iiiiiid"] = (function() { |
| return Module["asm"]["dynCall_iiiiiid"].apply(null, arguments); |
| }); |
| var dynCall_iiiiiii = Module["dynCall_iiiiiii"] = (function() { |
| return Module["asm"]["dynCall_iiiiiii"].apply(null, arguments); |
| }); |
| var dynCall_iiiiiiii = Module["dynCall_iiiiiiii"] = (function() { |
| return Module["asm"]["dynCall_iiiiiiii"].apply(null, arguments); |
| }); |
| var dynCall_iiiiiiiii = Module["dynCall_iiiiiiiii"] = (function() { |
| return Module["asm"]["dynCall_iiiiiiiii"].apply(null, arguments); |
| }); |
| var dynCall_iiiiij = Module["dynCall_iiiiij"] = (function() { |
| return Module["asm"]["dynCall_iiiiij"].apply(null, arguments); |
| }); |
| var dynCall_v = Module["dynCall_v"] = (function() { |
| return Module["asm"]["dynCall_v"].apply(null, arguments); |
| }); |
| var dynCall_vi = Module["dynCall_vi"] = (function() { |
| return Module["asm"]["dynCall_vi"].apply(null, arguments); |
| }); |
| var dynCall_vii = Module["dynCall_vii"] = (function() { |
| return Module["asm"]["dynCall_vii"].apply(null, arguments); |
| }); |
| var dynCall_viii = Module["dynCall_viii"] = (function() { |
| return Module["asm"]["dynCall_viii"].apply(null, arguments); |
| }); |
| var dynCall_viiii = Module["dynCall_viiii"] = (function() { |
| return Module["asm"]["dynCall_viiii"].apply(null, arguments); |
| }); |
| var dynCall_viiiii = Module["dynCall_viiiii"] = (function() { |
| return Module["asm"]["dynCall_viiiii"].apply(null, arguments); |
| }); |
| var dynCall_viiiiii = Module["dynCall_viiiiii"] = (function() { |
| return Module["asm"]["dynCall_viiiiii"].apply(null, arguments); |
| }); |
| var dynCall_viijii = Module["dynCall_viijii"] = (function() { |
| return Module["asm"]["dynCall_viijii"].apply(null, arguments); |
| }); |
| Module["asm"] = asm; |
| function ExitStatus(status) { |
| this.name = "ExitStatus"; |
| this.message = "Program terminated with exit(" + status + ")"; |
| this.status = status; |
| } |
| ExitStatus.prototype = new Error; |
| ExitStatus.prototype.constructor = ExitStatus; |
| var initialStackTop; |
| var calledMain = false; |
| dependenciesFulfilled = function runCaller() { |
| if (!Module["calledRun"]) run(); |
| if (!Module["calledRun"]) dependenciesFulfilled = runCaller; |
| }; |
| Module["callMain"] = function callMain(args) { |
| args = args || []; |
| ensureInitRuntime(); |
| var argc = args.length + 1; |
| var argv = stackAlloc((argc + 1) * 4); |
| HEAP32[argv >> 2] = allocateUTF8OnStack(Module["thisProgram"]); |
| for (var i = 1; i < argc; i++) { |
| HEAP32[(argv >> 2) + i] = allocateUTF8OnStack(args[i - 1]); |
| } |
| HEAP32[(argv >> 2) + argc] = 0; |
| try { |
| var ret = Module["_main"](argc, argv, 0); |
| exit(ret, true); |
| } catch (e) { |
| if (e instanceof ExitStatus) { |
| return; |
| } else if (e == "SimulateInfiniteLoop") { |
| Module["noExitRuntime"] = true; |
| return; |
| } else { |
| var toLog = e; |
| if (e && typeof e === "object" && e.stack) { |
| toLog = [ e, e.stack ]; |
| } |
| Module.printErr("exception thrown: " + toLog); |
| Module["quit"](1, e); |
| } |
| } finally { |
| calledMain = true; |
| } |
| }; |
| function run(args) { |
| args = args || Module["arguments"]; |
| if (runDependencies > 0) { |
| return; |
| } |
| preRun(); |
| if (runDependencies > 0) return; |
| if (Module["calledRun"]) return; |
| function doRun() { |
| if (Module["calledRun"]) return; |
| Module["calledRun"] = true; |
| if (ABORT) return; |
| ensureInitRuntime(); |
| preMain(); |
| if (Module["onRuntimeInitialized"]) Module["onRuntimeInitialized"](); |
| if (Module["_main"] && shouldRunNow) Module["callMain"](args); |
| postRun(); |
| } |
| if (Module["setStatus"]) { |
| Module["setStatus"]("Running..."); |
| setTimeout((function() { |
| setTimeout((function() { |
| Module["setStatus"](""); |
| }), 1); |
| doRun(); |
| }), 1); |
| } else { |
| doRun(); |
| } |
| } |
| Module["run"] = run; |
| function exit(status, implicit) { |
| if (implicit && Module["noExitRuntime"] && status === 0) { |
| return; |
| } |
| if (Module["noExitRuntime"]) {} else { |
| ABORT = true; |
| EXITSTATUS = status; |
| STACKTOP = initialStackTop; |
| exitRuntime(); |
| if (Module["onExit"]) Module["onExit"](status); |
| } |
| if (ENVIRONMENT_IS_NODE) { |
| process["exit"](status); |
| } |
| Module["quit"](status, new ExitStatus(status)); |
| } |
| Module["exit"] = exit; |
| function abort(what) { |
| if (Module["onAbort"]) { |
| Module["onAbort"](what); |
| } |
| if (what !== undefined) { |
| Module.print(what); |
| Module.printErr(what); |
| what = JSON.stringify(what); |
| } else { |
| what = ""; |
| } |
| ABORT = true; |
| EXITSTATUS = 1; |
| throw "abort(" + what + "). Build with -s ASSERTIONS=1 for more info."; |
| } |
| Module["abort"] = abort; |
| if (Module["preInit"]) { |
| if (typeof Module["preInit"] == "function") Module["preInit"] = [ Module["preInit"] ]; |
| while (Module["preInit"].length > 0) { |
| Module["preInit"].pop()(); |
| } |
| } |
| var shouldRunNow = true; |
| if (Module["noInitialRun"]) { |
| shouldRunNow = false; |
| } |
| Module["noExitRuntime"] = true; |
| run(); |
| } |