| // The Module object: Our interface to the outside world. We import |
| // and export values on it, and do the work to get that through |
| // closure compiler if necessary. There are various ways Module can be used: |
| // 1. Not defined. We create it here |
| // 2. A function parameter, function(Module) { ..generated code.. } |
| // 3. pre-run appended it, var Module = {}; ..generated code.. |
| // 4. External script tag defines var Module. |
| // We need to do an eval in order to handle the closure compiler |
| // case, where this code here is minified but Module was defined |
| // elsewhere (e.g. case 4 above). We also need to check if Module |
| // already exists (e.g. case 3 above). |
| // Note that if you want to run closure, and also to use Module |
| // after the generated code, you will need to define var Module = {}; |
| // before the code. Then that object will be used in the code, and you |
| // can continue to use Module afterwards as well. |
| var Module; |
| if (!Module) Module = (typeof Module !== 'undefined' ? Module : null) || {}; |
| |
| // Sometimes an existing Module object exists with properties |
| // meant to overwrite the default module functionality. Here |
| // we collect those properties and reapply _after_ we configure |
| // the current environment's defaults to avoid having to be so |
| // defensive during initialization. |
| var moduleOverrides = {}; |
| for (var key in Module) { |
| if (Module.hasOwnProperty(key)) { |
| moduleOverrides[key] = Module[key]; |
| } |
| } |
| |
| // The environment setup code below is customized to use Module. |
| // *** Environment setup code *** |
| var ENVIRONMENT_IS_WEB = false; |
| var ENVIRONMENT_IS_WORKER = false; |
| var ENVIRONMENT_IS_NODE = false; |
| var ENVIRONMENT_IS_SHELL = false; |
| |
| // Three configurations we can be running in: |
| // 1) We could be the application main() thread running in the main JS UI thread. (ENVIRONMENT_IS_WORKER == false and ENVIRONMENT_IS_PTHREAD == false) |
| // 2) We could be the application main() thread proxied to worker. (with Emscripten -s PROXY_TO_WORKER=1) (ENVIRONMENT_IS_WORKER == true, ENVIRONMENT_IS_PTHREAD == false) |
| // 3) We could be an application pthread running in a worker. (ENVIRONMENT_IS_WORKER == true and ENVIRONMENT_IS_PTHREAD == true) |
| |
| if (Module['ENVIRONMENT']) { |
| if (Module['ENVIRONMENT'] === 'WEB') { |
| ENVIRONMENT_IS_WEB = true; |
| } else if (Module['ENVIRONMENT'] === 'WORKER') { |
| ENVIRONMENT_IS_WORKER = true; |
| } else if (Module['ENVIRONMENT'] === 'NODE') { |
| ENVIRONMENT_IS_NODE = true; |
| } else if (Module['ENVIRONMENT'] === 'SHELL') { |
| ENVIRONMENT_IS_SHELL = true; |
| } else { |
| throw new Error('The provided Module[\'ENVIRONMENT\'] value is not valid. It must be one of: WEB|WORKER|NODE|SHELL.'); |
| } |
| } else { |
| ENVIRONMENT_IS_WEB = typeof window === 'object'; |
| ENVIRONMENT_IS_WORKER = typeof importScripts === 'function'; |
| ENVIRONMENT_IS_NODE = typeof process === 'object' && typeof require === 'function' && !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_WORKER; |
| ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER; |
| } |
| |
| |
| if (ENVIRONMENT_IS_NODE) { |
| // Expose functionality in the same simple way that the shells work |
| // Note that we pollute the global namespace here, otherwise we break in node |
| if (!Module['print']) Module['print'] = console.log; |
| if (!Module['printErr']) Module['printErr'] = console.warn; |
| |
| var nodeFS; |
| var nodePath; |
| |
| Module['read'] = function read(filename, binary) { |
| if (!nodeFS) nodeFS = require('fs'); |
| if (!nodePath) nodePath = require('path'); |
| filename = nodePath['normalize'](filename); |
| var ret = nodeFS['readFileSync'](filename); |
| return binary ? ret : ret.toString(); |
| }; |
| |
| Module['readBinary'] = function readBinary(filename) { |
| var ret = Module['read'](filename, true); |
| if (!ret.buffer) { |
| ret = new Uint8Array(ret); |
| } |
| assert(ret.buffer); |
| return ret; |
| }; |
| |
| Module['load'] = function load(f) { |
| globalEval(read(f)); |
| }; |
| |
| if (!Module['thisProgram']) { |
| if (process['argv'].length > 1) { |
| Module['thisProgram'] = process['argv'][1].replace(/\\/g, '/'); |
| } else { |
| Module['thisProgram'] = 'unknown-program'; |
| } |
| } |
| |
| Module['arguments'] = process['argv'].slice(2); |
| |
| if (typeof module !== 'undefined') { |
| module['exports'] = Module; |
| } |
| |
| process['on']('uncaughtException', function(ex) { |
| // suppress ExitStatus exceptions from showing an error |
| if (!(ex instanceof ExitStatus)) { |
| throw ex; |
| } |
| }); |
| |
| Module['inspect'] = function () { return '[Emscripten Module object]'; }; |
| } |
| else if (ENVIRONMENT_IS_SHELL) { |
| if (!Module['print']) Module['print'] = print; |
| if (typeof printErr != 'undefined') Module['printErr'] = printErr; // not present in v8 or older sm |
| |
| if (typeof read != 'undefined') { |
| Module['read'] = read; |
| } else { |
| Module['read'] = function read() { throw 'no read() available' }; |
| } |
| |
| Module['readBinary'] = function readBinary(f) { |
| if (typeof readbuffer === 'function') { |
| return new Uint8Array(readbuffer(f)); |
| } |
| var data = read(f, 'binary'); |
| assert(typeof data === 'object'); |
| return data; |
| }; |
| |
| if (typeof scriptArgs != 'undefined') { |
| Module['arguments'] = scriptArgs; |
| } else if (typeof arguments != 'undefined') { |
| Module['arguments'] = arguments; |
| } |
| |
| } |
| else if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) { |
| Module['read'] = function read(url) { |
| var xhr = new XMLHttpRequest(); |
| xhr.open('GET', url, false); |
| xhr.send(null); |
| return xhr.responseText; |
| }; |
| |
| Module['readAsync'] = function readAsync(url, onload, onerror) { |
| var xhr = new XMLHttpRequest(); |
| xhr.open('GET', url, true); |
| xhr.responseType = 'arraybuffer'; |
| xhr.onload = function xhr_onload() { |
| if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0 |
| onload(xhr.response); |
| } else { |
| onerror(); |
| } |
| }; |
| xhr.onerror = onerror; |
| xhr.send(null); |
| }; |
| |
| if (typeof arguments != 'undefined') { |
| Module['arguments'] = arguments; |
| } |
| |
| if (typeof console !== 'undefined') { |
| if (!Module['print']) Module['print'] = function print(x) { |
| console.log(x); |
| }; |
| if (!Module['printErr']) Module['printErr'] = function printErr(x) { |
| console.warn(x); |
| }; |
| } else { |
| // Probably a worker, and without console.log. We can do very little here... |
| var TRY_USE_DUMP = false; |
| if (!Module['print']) Module['print'] = (TRY_USE_DUMP && (typeof(dump) !== "undefined") ? (function(x) { |
| dump(x); |
| }) : (function(x) { |
| // self.postMessage(x); // enable this if you want stdout to be sent as messages |
| })); |
| } |
| |
| if (ENVIRONMENT_IS_WORKER) { |
| Module['load'] = importScripts; |
| } |
| |
| if (typeof Module['setWindowTitle'] === 'undefined') { |
| Module['setWindowTitle'] = function(title) { document.title = title }; |
| } |
| } |
| else { |
| // Unreachable because SHELL is dependant on the others |
| throw 'Unknown runtime environment. Where are we?'; |
| } |
| |
| function globalEval(x) { |
| eval.call(null, x); |
| } |
| if (!Module['load'] && Module['read']) { |
| Module['load'] = function load(f) { |
| globalEval(Module['read'](f)); |
| }; |
| } |
| if (!Module['print']) { |
| Module['print'] = function(){}; |
| } |
| if (!Module['printErr']) { |
| Module['printErr'] = Module['print']; |
| } |
| if (!Module['arguments']) { |
| Module['arguments'] = []; |
| } |
| if (!Module['thisProgram']) { |
| Module['thisProgram'] = './this.program'; |
| } |
| |
| // *** Environment setup code *** |
| |
| // Closure helpers |
| Module.print = Module['print']; |
| Module.printErr = Module['printErr']; |
| |
| // Callbacks |
| Module['preRun'] = []; |
| Module['postRun'] = []; |
| |
| // Merge back in the overrides |
| for (var key in moduleOverrides) { |
| if (moduleOverrides.hasOwnProperty(key)) { |
| Module[key] = moduleOverrides[key]; |
| } |
| } |
| // Free the object hierarchy contained in the overrides, this lets the GC |
| // reclaim data used e.g. in memoryInitializerRequest, which is a large typed array. |
| moduleOverrides = undefined; |
| |
| |
| |
| // {{PREAMBLE_ADDITIONS}} |
| |
| // === Preamble library stuff === |
| |
| // Documentation for the public APIs defined in this file must be updated in: |
| // site/source/docs/api_reference/preamble.js.rst |
| // A prebuilt local version of the documentation is available at: |
| // site/build/text/docs/api_reference/preamble.js.txt |
| // You can also build docs locally as HTML or other formats in site/ |
| // An online HTML version (which may be of a different version of Emscripten) |
| // is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html |
| |
| //======================================== |
| // Runtime code shared with compiler |
| //======================================== |
| |
| var Runtime = { |
| setTempRet0: function (value) { |
| tempRet0 = value; |
| return value; |
| }, |
| getTempRet0: function () { |
| return tempRet0; |
| }, |
| stackSave: function () { |
| return STACKTOP; |
| }, |
| stackRestore: function (stackTop) { |
| STACKTOP = stackTop; |
| }, |
| getNativeTypeSize: function (type) { |
| switch (type) { |
| case 'i1': case 'i8': return 1; |
| case 'i16': return 2; |
| case 'i32': return 4; |
| case 'i64': return 8; |
| case 'float': return 4; |
| case 'double': return 8; |
| default: { |
| if (type[type.length-1] === '*') { |
| return Runtime.QUANTUM_SIZE; // A pointer |
| } else if (type[0] === 'i') { |
| var bits = parseInt(type.substr(1)); |
| assert(bits % 8 === 0); |
| return bits/8; |
| } else { |
| return 0; |
| } |
| } |
| } |
| }, |
| getNativeFieldSize: function (type) { |
| return Math.max(Runtime.getNativeTypeSize(type), Runtime.QUANTUM_SIZE); |
| }, |
| STACK_ALIGN: 16, |
| prepVararg: function (ptr, type) { |
| if (type === 'double' || type === 'i64') { |
| // move so the load is aligned |
| if (ptr & 7) { |
| assert((ptr & 7) === 4); |
| ptr += 4; |
| } |
| } else { |
| assert((ptr & 3) === 0); |
| } |
| return ptr; |
| }, |
| getAlignSize: function (type, size, vararg) { |
| // we align i64s and doubles on 64-bit boundaries, unlike x86 |
| if (!vararg && (type == 'i64' || type == 'double')) return 8; |
| if (!type) return Math.min(size, 8); // align structures internally to 64 bits |
| return Math.min(size || (type ? Runtime.getNativeFieldSize(type) : 0), Runtime.QUANTUM_SIZE); |
| }, |
| dynCall: function (sig, ptr, args) { |
| if (args && args.length) { |
| return Module['dynCall_' + sig].apply(null, [ptr].concat(args)); |
| } else { |
| return Module['dynCall_' + sig].call(null, ptr); |
| } |
| }, |
| functionPointers: [], |
| addFunction: function (func) { |
| for (var i = 0; i < Runtime.functionPointers.length; i++) { |
| if (!Runtime.functionPointers[i]) { |
| Runtime.functionPointers[i] = func; |
| return 2*(1 + i); |
| } |
| } |
| throw 'Finished up all reserved function pointers. Use a higher value for RESERVED_FUNCTION_POINTERS.'; |
| }, |
| removeFunction: function (index) { |
| Runtime.functionPointers[(index-2)/2] = null; |
| }, |
| warnOnce: function (text) { |
| if (!Runtime.warnOnce.shown) Runtime.warnOnce.shown = {}; |
| if (!Runtime.warnOnce.shown[text]) { |
| Runtime.warnOnce.shown[text] = 1; |
| Module.printErr(text); |
| } |
| }, |
| funcWrappers: {}, |
| getFuncWrapper: function (func, sig) { |
| assert(sig); |
| if (!Runtime.funcWrappers[sig]) { |
| Runtime.funcWrappers[sig] = {}; |
| } |
| var sigCache = Runtime.funcWrappers[sig]; |
| if (!sigCache[func]) { |
| // optimize away arguments usage in common cases |
| if (sig.length === 1) { |
| sigCache[func] = function dynCall_wrapper() { |
| return Runtime.dynCall(sig, func); |
| }; |
| } else if (sig.length === 2) { |
| sigCache[func] = function dynCall_wrapper(arg) { |
| return Runtime.dynCall(sig, func, [arg]); |
| }; |
| } else { |
| // general case |
| sigCache[func] = function dynCall_wrapper() { |
| return Runtime.dynCall(sig, func, Array.prototype.slice.call(arguments)); |
| }; |
| } |
| } |
| return sigCache[func]; |
| }, |
| getCompilerSetting: function (name) { |
| throw 'You must build with -s RETAIN_COMPILER_SETTINGS=1 for Runtime.getCompilerSetting or emscripten_get_compiler_setting to work'; |
| }, |
| stackAlloc: function (size) { var ret = STACKTOP;STACKTOP = (STACKTOP + size)|0;STACKTOP = (((STACKTOP)+15)&-16); return ret; }, |
| staticAlloc: function (size) { var ret = STATICTOP;STATICTOP = (STATICTOP + size)|0;STATICTOP = (((STATICTOP)+15)&-16); return ret; }, |
| dynamicAlloc: function (size) { var ret = HEAP32[DYNAMICTOP_PTR>>2];var end = (((ret + size + 15)|0) & -16);HEAP32[DYNAMICTOP_PTR>>2] = end;if (end >= TOTAL_MEMORY) {var success = enlargeMemory();if (!success) {HEAP32[DYNAMICTOP_PTR>>2] = ret;return 0;}}return ret;}, |
| alignMemory: function (size,quantum) { var ret = size = Math.ceil((size)/(quantum ? quantum : 16))*(quantum ? quantum : 16); return ret; }, |
| makeBigInt: function (low,high,unsigned) { var ret = (unsigned ? ((+((low>>>0)))+((+((high>>>0)))*4294967296.0)) : ((+((low>>>0)))+((+((high|0)))*4294967296.0))); return ret; }, |
| GLOBAL_BASE: 1024, |
| QUANTUM_SIZE: 4, |
| __dummy__: 0 |
| } |
| |
| |
| |
| Module["Runtime"] = Runtime; |
| |
| |
| |
| //======================================== |
| // Runtime essentials |
| //======================================== |
| |
| var ABORT = 0; // whether we are quitting the application. no code should run after this. set in exit() and abort() |
| var EXITSTATUS = 0; |
| |
| function assert(condition, text) { |
| if (!condition) { |
| abort('Assertion failed: ' + text); |
| } |
| } |
| |
| var globalScope = this; |
| |
| // Returns the C function with a specified identifier (for C++, you need to do manual name mangling) |
| function getCFunc(ident) { |
| var func = Module['_' + ident]; // closure exported function |
| if (!func) { |
| try { func = eval('_' + ident); } catch(e) {} |
| } |
| assert(func, 'Cannot call unknown function ' + ident + ' (perhaps LLVM optimizations or closure removed it?)'); |
| return func; |
| } |
| |
| var cwrap, ccall; |
| (function(){ |
| var JSfuncs = { |
| // Helpers for cwrap -- it can't refer to Runtime directly because it might |
| // be renamed by closure, instead it calls JSfuncs['stackSave'].body to find |
| // out what the minified function name is. |
| 'stackSave': function() { |
| Runtime.stackSave() |
| }, |
| 'stackRestore': function() { |
| Runtime.stackRestore() |
| }, |
| // type conversion from js to c |
| 'arrayToC' : function(arr) { |
| var ret = Runtime.stackAlloc(arr.length); |
| writeArrayToMemory(arr, ret); |
| return ret; |
| }, |
| 'stringToC' : function(str) { |
| var ret = 0; |
| if (str !== null && str !== undefined && str !== 0) { // null string |
| // at most 4 bytes per UTF-8 code point, +1 for the trailing '\0' |
| var len = (str.length << 2) + 1; |
| ret = Runtime.stackAlloc(len); |
| stringToUTF8(str, ret, len); |
| } |
| return ret; |
| } |
| }; |
| // For fast lookup of conversion functions |
| var toC = {'string' : JSfuncs['stringToC'], 'array' : JSfuncs['arrayToC']}; |
| |
| // C calling interface. |
| ccall = function ccallFunc(ident, returnType, argTypes, args, opts) { |
| var func = getCFunc(ident); |
| var cArgs = []; |
| var stack = 0; |
| if (args) { |
| for (var i = 0; i < args.length; i++) { |
| var converter = toC[argTypes[i]]; |
| if (converter) { |
| if (stack === 0) stack = Runtime.stackSave(); |
| cArgs[i] = converter(args[i]); |
| } else { |
| cArgs[i] = args[i]; |
| } |
| } |
| } |
| var ret = func.apply(null, cArgs); |
| if (returnType === 'string') ret = Pointer_stringify(ret); |
| if (stack !== 0) { |
| if (opts && opts.async) { |
| EmterpreterAsync.asyncFinalizers.push(function() { |
| Runtime.stackRestore(stack); |
| }); |
| return; |
| } |
| Runtime.stackRestore(stack); |
| } |
| return ret; |
| } |
| |
| var sourceRegex = /^function\s*[a-zA-Z$_0-9]*\s*\(([^)]*)\)\s*{\s*([^*]*?)[\s;]*(?:return\s*(.*?)[;\s]*)?}$/; |
| function parseJSFunc(jsfunc) { |
| // Match the body and the return value of a javascript function source |
| var parsed = jsfunc.toString().match(sourceRegex).slice(1); |
| return {arguments : parsed[0], body : parsed[1], returnValue: parsed[2]} |
| } |
| |
| // sources of useful functions. we create this lazily as it can trigger a source decompression on this entire file |
| var JSsource = null; |
| function ensureJSsource() { |
| if (!JSsource) { |
| JSsource = {}; |
| for (var fun in JSfuncs) { |
| if (JSfuncs.hasOwnProperty(fun)) { |
| // Elements of toCsource are arrays of three items: |
| // the code, and the return value |
| JSsource[fun] = parseJSFunc(JSfuncs[fun]); |
| } |
| } |
| } |
| } |
| |
| cwrap = function cwrap(ident, returnType, argTypes) { |
| argTypes = argTypes || []; |
| var cfunc = getCFunc(ident); |
| // When the function takes numbers and returns a number, we can just return |
| // the original function |
| var numericArgs = argTypes.every(function(type){ return type === 'number'}); |
| var numericRet = (returnType !== 'string'); |
| if ( numericRet && numericArgs) { |
| return cfunc; |
| } |
| // Creation of the arguments list (["$1","$2",...,"$nargs"]) |
| var argNames = argTypes.map(function(x,i){return '$'+i}); |
| var funcstr = "(function(" + argNames.join(',') + ") {"; |
| var nargs = argTypes.length; |
| if (!numericArgs) { |
| // Generate the code needed to convert the arguments from javascript |
| // values to pointers |
| ensureJSsource(); |
| funcstr += 'var stack = ' + JSsource['stackSave'].body + ';'; |
| for (var i = 0; i < nargs; i++) { |
| var arg = argNames[i], type = argTypes[i]; |
| if (type === 'number') continue; |
| var convertCode = JSsource[type + 'ToC']; // [code, return] |
| funcstr += 'var ' + convertCode.arguments + ' = ' + arg + ';'; |
| funcstr += convertCode.body + ';'; |
| funcstr += arg + '=(' + convertCode.returnValue + ');'; |
| } |
| } |
| |
| // When the code is compressed, the name of cfunc is not literally 'cfunc' anymore |
| var cfuncname = parseJSFunc(function(){return cfunc}).returnValue; |
| // Call the function |
| funcstr += 'var ret = ' + cfuncname + '(' + argNames.join(',') + ');'; |
| if (!numericRet) { // Return type can only by 'string' or 'number' |
| // Convert the result to a string |
| var strgfy = parseJSFunc(function(){return Pointer_stringify}).returnValue; |
| funcstr += 'ret = ' + strgfy + '(ret);'; |
| } |
| if (!numericArgs) { |
| // If we had a stack, restore it |
| ensureJSsource(); |
| funcstr += JSsource['stackRestore'].body.replace('()', '(stack)') + ';'; |
| } |
| funcstr += 'return ret})'; |
| return eval(funcstr); |
| }; |
| })(); |
| Module["ccall"] = ccall; |
| Module["cwrap"] = cwrap; |
| |
| function setValue(ptr, value, type, noSafe) { |
| type = type || 'i8'; |
| if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit |
| switch(type) { |
| case 'i1': HEAP8[((ptr)>>0)]=value; break; |
| case 'i8': HEAP8[((ptr)>>0)]=value; break; |
| case 'i16': HEAP16[((ptr)>>1)]=value; break; |
| case 'i32': HEAP32[((ptr)>>2)]=value; break; |
| case 'i64': (tempI64 = [value>>>0,(tempDouble=value,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((ptr)>>2)]=tempI64[0],HEAP32[(((ptr)+(4))>>2)]=tempI64[1]); break; |
| case 'float': HEAPF32[((ptr)>>2)]=value; break; |
| case 'double': HEAPF64[((ptr)>>3)]=value; break; |
| default: abort('invalid type for setValue: ' + type); |
| } |
| } |
| Module["setValue"] = setValue; |
| |
| |
| function getValue(ptr, type, noSafe) { |
| type = type || 'i8'; |
| if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit |
| switch(type) { |
| case 'i1': return HEAP8[((ptr)>>0)]; |
| case 'i8': return HEAP8[((ptr)>>0)]; |
| case 'i16': return HEAP16[((ptr)>>1)]; |
| case 'i32': return HEAP32[((ptr)>>2)]; |
| case 'i64': return HEAP32[((ptr)>>2)]; |
| case 'float': return HEAPF32[((ptr)>>2)]; |
| case 'double': return HEAPF64[((ptr)>>3)]; |
| default: abort('invalid type for setValue: ' + type); |
| } |
| return null; |
| } |
| Module["getValue"] = getValue; |
| |
| var ALLOC_NORMAL = 0; // Tries to use _malloc() |
| var ALLOC_STACK = 1; // Lives for the duration of the current function call |
| var ALLOC_STATIC = 2; // Cannot be freed |
| var ALLOC_DYNAMIC = 3; // Cannot be freed except through sbrk |
| var ALLOC_NONE = 4; // Do not allocate |
| Module["ALLOC_NORMAL"] = ALLOC_NORMAL; |
| Module["ALLOC_STACK"] = ALLOC_STACK; |
| Module["ALLOC_STATIC"] = ALLOC_STATIC; |
| Module["ALLOC_DYNAMIC"] = ALLOC_DYNAMIC; |
| Module["ALLOC_NONE"] = ALLOC_NONE; |
| |
| // allocate(): This is for internal use. You can use it yourself as well, but the interface |
| // is a little tricky (see docs right below). The reason is that it is optimized |
| // for multiple syntaxes to save space in generated code. So you should |
| // normally not use allocate(), and instead allocate memory using _malloc(), |
| // initialize it with setValue(), and so forth. |
| // @slab: An array of data, or a number. If a number, then the size of the block to allocate, |
| // in *bytes* (note that this is sometimes confusing: the next parameter does not |
| // affect this!) |
| // @types: Either an array of types, one for each byte (or 0 if no type at that position), |
| // or a single type which is used for the entire block. This only matters if there |
| // is initial data - if @slab is a number, then this does not matter at all and is |
| // ignored. |
| // @allocator: How to allocate memory, see ALLOC_* |
| function allocate(slab, types, allocator, ptr) { |
| var zeroinit, size; |
| if (typeof slab === 'number') { |
| zeroinit = true; |
| size = slab; |
| } else { |
| zeroinit = false; |
| size = slab.length; |
| } |
| |
| var singleType = typeof types === 'string' ? types : null; |
| |
| var ret; |
| if (allocator == ALLOC_NONE) { |
| ret = ptr; |
| } else { |
| ret = [typeof _malloc === 'function' ? _malloc : Runtime.staticAlloc, Runtime.stackAlloc, Runtime.staticAlloc, Runtime.dynamicAlloc][allocator === undefined ? ALLOC_STATIC : allocator](Math.max(size, singleType ? 1 : types.length)); |
| } |
| |
| if (zeroinit) { |
| var ptr = ret, stop; |
| assert((ret & 3) == 0); |
| stop = ret + (size & ~3); |
| for (; ptr < stop; ptr += 4) { |
| HEAP32[((ptr)>>2)]=0; |
| } |
| stop = ret + size; |
| while (ptr < stop) { |
| HEAP8[((ptr++)>>0)]=0; |
| } |
| return ret; |
| } |
| |
| if (singleType === 'i8') { |
| if (slab.subarray || slab.slice) { |
| HEAPU8.set(slab, ret); |
| } else { |
| HEAPU8.set(new Uint8Array(slab), ret); |
| } |
| return ret; |
| } |
| |
| var i = 0, type, typeSize, previousType; |
| while (i < size) { |
| var curr = slab[i]; |
| |
| if (typeof curr === 'function') { |
| curr = Runtime.getFunctionIndex(curr); |
| } |
| |
| type = singleType || types[i]; |
| if (type === 0) { |
| i++; |
| continue; |
| } |
| |
| if (type == 'i64') type = 'i32'; // special case: we have one i32 here, and one i32 later |
| |
| setValue(ret+i, curr, type); |
| |
| // no need to look up size unless type changes, so cache it |
| if (previousType !== type) { |
| typeSize = Runtime.getNativeTypeSize(type); |
| previousType = type; |
| } |
| i += typeSize; |
| } |
| |
| return ret; |
| } |
| Module["allocate"] = allocate; |
| |
| // Allocate memory during any stage of startup - static memory early on, dynamic memory later, malloc when ready |
| function getMemory(size) { |
| if (!staticSealed) return Runtime.staticAlloc(size); |
| if (!runtimeInitialized) return Runtime.dynamicAlloc(size); |
| return _malloc(size); |
| } |
| Module["getMemory"] = getMemory; |
| |
| function Pointer_stringify(ptr, /* optional */ length) { |
| if (length === 0 || !ptr) return ''; |
| // TODO: use TextDecoder |
| // Find the length, and check for UTF while doing so |
| var hasUtf = 0; |
| var t; |
| var i = 0; |
| while (1) { |
| t = HEAPU8[(((ptr)+(i))>>0)]; |
| hasUtf |= t; |
| if (t == 0 && !length) break; |
| i++; |
| if (length && i == length) break; |
| } |
| if (!length) length = i; |
| |
| var ret = ''; |
| |
| if (hasUtf < 128) { |
| var MAX_CHUNK = 1024; // split up into chunks, because .apply on a huge string can overflow the stack |
| var curr; |
| while (length > 0) { |
| curr = String.fromCharCode.apply(String, HEAPU8.subarray(ptr, ptr + Math.min(length, MAX_CHUNK))); |
| ret = ret ? ret + curr : curr; |
| ptr += MAX_CHUNK; |
| length -= MAX_CHUNK; |
| } |
| return ret; |
| } |
| return Module['UTF8ToString'](ptr); |
| } |
| Module["Pointer_stringify"] = Pointer_stringify; |
| |
| // Given a pointer 'ptr' to a null-terminated ASCII-encoded string in the emscripten HEAP, returns |
| // a copy of that string as a Javascript String object. |
| |
| function AsciiToString(ptr) { |
| var str = ''; |
| while (1) { |
| var ch = HEAP8[((ptr++)>>0)]; |
| if (!ch) return str; |
| str += String.fromCharCode(ch); |
| } |
| } |
| Module["AsciiToString"] = AsciiToString; |
| |
| // Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', |
| // null-terminated and encoded in ASCII form. The copy will require at most str.length+1 bytes of space in the HEAP. |
| |
| function stringToAscii(str, outPtr) { |
| return writeAsciiToMemory(str, outPtr, false); |
| } |
| Module["stringToAscii"] = stringToAscii; |
| |
| // Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the given array that contains uint8 values, returns |
| // a copy of that string as a Javascript String object. |
| |
| var UTF8Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf8') : undefined; |
| function UTF8ArrayToString(u8Array, idx) { |
| var endPtr = idx; |
| // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself. |
| // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage. |
| while (u8Array[endPtr]) ++endPtr; |
| |
| if (endPtr - idx > 16 && u8Array.subarray && UTF8Decoder) { |
| return UTF8Decoder.decode(u8Array.subarray(idx, endPtr)); |
| } else { |
| var u0, u1, u2, u3, u4, u5; |
| |
| var str = ''; |
| while (1) { |
| // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629 |
| u0 = u8Array[idx++]; |
| if (!u0) return str; |
| if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; } |
| u1 = u8Array[idx++] & 63; |
| if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; } |
| u2 = u8Array[idx++] & 63; |
| if ((u0 & 0xF0) == 0xE0) { |
| u0 = ((u0 & 15) << 12) | (u1 << 6) | u2; |
| } else { |
| u3 = u8Array[idx++] & 63; |
| if ((u0 & 0xF8) == 0xF0) { |
| u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | u3; |
| } else { |
| u4 = u8Array[idx++] & 63; |
| if ((u0 & 0xFC) == 0xF8) { |
| u0 = ((u0 & 3) << 24) | (u1 << 18) | (u2 << 12) | (u3 << 6) | u4; |
| } else { |
| u5 = u8Array[idx++] & 63; |
| u0 = ((u0 & 1) << 30) | (u1 << 24) | (u2 << 18) | (u3 << 12) | (u4 << 6) | u5; |
| } |
| } |
| } |
| if (u0 < 0x10000) { |
| str += String.fromCharCode(u0); |
| } else { |
| var ch = u0 - 0x10000; |
| str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF)); |
| } |
| } |
| } |
| } |
| Module["UTF8ArrayToString"] = UTF8ArrayToString; |
| |
| // Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the emscripten HEAP, returns |
| // a copy of that string as a Javascript String object. |
| |
| function UTF8ToString(ptr) { |
| return UTF8ArrayToString(HEAPU8,ptr); |
| } |
| Module["UTF8ToString"] = UTF8ToString; |
| |
| // Copies the given Javascript String object 'str' to the given byte array at address 'outIdx', |
| // encoded in UTF8 form and null-terminated. The copy will require at most str.length*4+1 bytes of space in the HEAP. |
| // Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write. |
| // Parameters: |
| // str: the Javascript string to copy. |
| // outU8Array: the array to copy to. Each index in this array is assumed to be one 8-byte element. |
| // outIdx: The starting offset in the array to begin the copying. |
| // maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null |
| // terminator, i.e. if maxBytesToWrite=1, only the null terminator will be written and nothing else. |
| // maxBytesToWrite=0 does not write any bytes to the output, not even the null terminator. |
| // Returns the number of bytes written, EXCLUDING the null terminator. |
| |
| function stringToUTF8Array(str, outU8Array, outIdx, maxBytesToWrite) { |
| if (!(maxBytesToWrite > 0)) // Parameter maxBytesToWrite is not optional. Negative values, 0, null, undefined and false each don't write out any bytes. |
| return 0; |
| |
| var startIdx = outIdx; |
| var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator. |
| for (var i = 0; i < str.length; ++i) { |
| // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8. |
| // See http://unicode.org/faq/utf_bom.html#utf16-3 |
| // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629 |
| var u = str.charCodeAt(i); // possibly a lead surrogate |
| if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF); |
| if (u <= 0x7F) { |
| if (outIdx >= endIdx) break; |
| outU8Array[outIdx++] = u; |
| } else if (u <= 0x7FF) { |
| if (outIdx + 1 >= endIdx) break; |
| outU8Array[outIdx++] = 0xC0 | (u >> 6); |
| outU8Array[outIdx++] = 0x80 | (u & 63); |
| } else if (u <= 0xFFFF) { |
| if (outIdx + 2 >= endIdx) break; |
| outU8Array[outIdx++] = 0xE0 | (u >> 12); |
| outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); |
| outU8Array[outIdx++] = 0x80 | (u & 63); |
| } else if (u <= 0x1FFFFF) { |
| if (outIdx + 3 >= endIdx) break; |
| outU8Array[outIdx++] = 0xF0 | (u >> 18); |
| outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63); |
| outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); |
| outU8Array[outIdx++] = 0x80 | (u & 63); |
| } else if (u <= 0x3FFFFFF) { |
| if (outIdx + 4 >= endIdx) break; |
| outU8Array[outIdx++] = 0xF8 | (u >> 24); |
| outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63); |
| outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63); |
| outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); |
| outU8Array[outIdx++] = 0x80 | (u & 63); |
| } else { |
| if (outIdx + 5 >= endIdx) break; |
| outU8Array[outIdx++] = 0xFC | (u >> 30); |
| outU8Array[outIdx++] = 0x80 | ((u >> 24) & 63); |
| outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63); |
| outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63); |
| outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); |
| outU8Array[outIdx++] = 0x80 | (u & 63); |
| } |
| } |
| // Null-terminate the pointer to the buffer. |
| outU8Array[outIdx] = 0; |
| return outIdx - startIdx; |
| } |
| Module["stringToUTF8Array"] = stringToUTF8Array; |
| |
| // Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', |
| // null-terminated and encoded in UTF8 form. The copy will require at most str.length*4+1 bytes of space in the HEAP. |
| // Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write. |
| // Returns the number of bytes written, EXCLUDING the null terminator. |
| |
| function stringToUTF8(str, outPtr, maxBytesToWrite) { |
| return stringToUTF8Array(str, HEAPU8,outPtr, maxBytesToWrite); |
| } |
| Module["stringToUTF8"] = stringToUTF8; |
| |
| // Returns the number of bytes the given Javascript string takes if encoded as a UTF8 byte array, EXCLUDING the null terminator byte. |
| |
| function lengthBytesUTF8(str) { |
| var len = 0; |
| for (var i = 0; i < str.length; ++i) { |
| // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8. |
| // See http://unicode.org/faq/utf_bom.html#utf16-3 |
| var u = str.charCodeAt(i); // possibly a lead surrogate |
| if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF); |
| if (u <= 0x7F) { |
| ++len; |
| } else if (u <= 0x7FF) { |
| len += 2; |
| } else if (u <= 0xFFFF) { |
| len += 3; |
| } else if (u <= 0x1FFFFF) { |
| len += 4; |
| } else if (u <= 0x3FFFFFF) { |
| len += 5; |
| } else { |
| len += 6; |
| } |
| } |
| return len; |
| } |
| Module["lengthBytesUTF8"] = lengthBytesUTF8; |
| |
| // Given a pointer 'ptr' to a null-terminated UTF16LE-encoded string in the emscripten HEAP, returns |
| // a copy of that string as a Javascript String object. |
| |
| var UTF16Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf-16le') : undefined; |
| function UTF16ToString(ptr) { |
| var endPtr = ptr; |
| // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself. |
| // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage. |
| var idx = endPtr >> 1; |
| while (HEAP16[idx]) ++idx; |
| endPtr = idx << 1; |
| |
| if (endPtr - ptr > 32 && UTF16Decoder) { |
| return UTF16Decoder.decode(HEAPU8.subarray(ptr, endPtr)); |
| } else { |
| var i = 0; |
| |
| var str = ''; |
| while (1) { |
| var codeUnit = HEAP16[(((ptr)+(i*2))>>1)]; |
| if (codeUnit == 0) return str; |
| ++i; |
| // fromCharCode constructs a character from a UTF-16 code unit, so we can pass the UTF16 string right through. |
| str += String.fromCharCode(codeUnit); |
| } |
| } |
| } |
| |
| |
| // Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', |
| // null-terminated and encoded in UTF16 form. The copy will require at most str.length*4+2 bytes of space in the HEAP. |
| // Use the function lengthBytesUTF16() to compute the exact number of bytes (excluding null terminator) that this function will write. |
| // Parameters: |
| // str: the Javascript string to copy. |
| // outPtr: Byte address in Emscripten HEAP where to write the string to. |
| // maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null |
| // terminator, i.e. if maxBytesToWrite=2, only the null terminator will be written and nothing else. |
| // maxBytesToWrite<2 does not write any bytes to the output, not even the null terminator. |
| // Returns the number of bytes written, EXCLUDING the null terminator. |
| |
| function stringToUTF16(str, outPtr, maxBytesToWrite) { |
| // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed. |
| if (maxBytesToWrite === undefined) { |
| maxBytesToWrite = 0x7FFFFFFF; |
| } |
| if (maxBytesToWrite < 2) return 0; |
| maxBytesToWrite -= 2; // Null terminator. |
| var startPtr = outPtr; |
| var numCharsToWrite = (maxBytesToWrite < str.length*2) ? (maxBytesToWrite / 2) : str.length; |
| for (var i = 0; i < numCharsToWrite; ++i) { |
| // charCodeAt returns a UTF-16 encoded code unit, so it can be directly written to the HEAP. |
| var codeUnit = str.charCodeAt(i); // possibly a lead surrogate |
| HEAP16[((outPtr)>>1)]=codeUnit; |
| outPtr += 2; |
| } |
| // Null-terminate the pointer to the HEAP. |
| HEAP16[((outPtr)>>1)]=0; |
| return outPtr - startPtr; |
| } |
| |
| |
| // Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte. |
| |
| function lengthBytesUTF16(str) { |
| return str.length*2; |
| } |
| |
| |
| function UTF32ToString(ptr) { |
| var i = 0; |
| |
| var str = ''; |
| while (1) { |
| var utf32 = HEAP32[(((ptr)+(i*4))>>2)]; |
| if (utf32 == 0) |
| return str; |
| ++i; |
| // Gotcha: fromCharCode constructs a character from a UTF-16 encoded code (pair), not from a Unicode code point! So encode the code point to UTF-16 for constructing. |
| // See http://unicode.org/faq/utf_bom.html#utf16-3 |
| if (utf32 >= 0x10000) { |
| var ch = utf32 - 0x10000; |
| str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF)); |
| } else { |
| str += String.fromCharCode(utf32); |
| } |
| } |
| } |
| |
| |
| // Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', |
| // null-terminated and encoded in UTF32 form. The copy will require at most str.length*4+4 bytes of space in the HEAP. |
| // Use the function lengthBytesUTF32() to compute the exact number of bytes (excluding null terminator) that this function will write. |
| // Parameters: |
| // str: the Javascript string to copy. |
| // outPtr: Byte address in Emscripten HEAP where to write the string to. |
| // maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null |
| // terminator, i.e. if maxBytesToWrite=4, only the null terminator will be written and nothing else. |
| // maxBytesToWrite<4 does not write any bytes to the output, not even the null terminator. |
| // Returns the number of bytes written, EXCLUDING the null terminator. |
| |
| function stringToUTF32(str, outPtr, maxBytesToWrite) { |
| // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed. |
| if (maxBytesToWrite === undefined) { |
| maxBytesToWrite = 0x7FFFFFFF; |
| } |
| if (maxBytesToWrite < 4) return 0; |
| var startPtr = outPtr; |
| var endPtr = startPtr + maxBytesToWrite - 4; |
| for (var i = 0; i < str.length; ++i) { |
| // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap. |
| // See http://unicode.org/faq/utf_bom.html#utf16-3 |
| var codeUnit = str.charCodeAt(i); // possibly a lead surrogate |
| if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) { |
| var trailSurrogate = str.charCodeAt(++i); |
| codeUnit = 0x10000 + ((codeUnit & 0x3FF) << 10) | (trailSurrogate & 0x3FF); |
| } |
| HEAP32[((outPtr)>>2)]=codeUnit; |
| outPtr += 4; |
| if (outPtr + 4 > endPtr) break; |
| } |
| // Null-terminate the pointer to the HEAP. |
| HEAP32[((outPtr)>>2)]=0; |
| return outPtr - startPtr; |
| } |
| |
| |
| // Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte. |
| |
| function lengthBytesUTF32(str) { |
| var len = 0; |
| for (var i = 0; i < str.length; ++i) { |
| // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap. |
| // See http://unicode.org/faq/utf_bom.html#utf16-3 |
| var codeUnit = str.charCodeAt(i); |
| if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) ++i; // possibly a lead surrogate, so skip over the tail surrogate. |
| len += 4; |
| } |
| |
| return len; |
| } |
| |
| |
| function demangle(func) { |
| var __cxa_demangle_func = Module['___cxa_demangle'] || Module['__cxa_demangle']; |
| if (__cxa_demangle_func) { |
| try { |
| var s = |
| func.substr(1); |
| var len = lengthBytesUTF8(s)+1; |
| var buf = _malloc(len); |
| stringToUTF8(s, buf, len); |
| var status = _malloc(4); |
| var ret = __cxa_demangle_func(buf, 0, 0, status); |
| if (getValue(status, 'i32') === 0 && ret) { |
| return Pointer_stringify(ret); |
| } |
| // otherwise, libcxxabi failed |
| } catch(e) { |
| // ignore problems here |
| } finally { |
| if (buf) _free(buf); |
| if (status) _free(status); |
| if (ret) _free(ret); |
| } |
| // failure when using libcxxabi, don't demangle |
| return func; |
| } |
| Runtime.warnOnce('warning: build with -s DEMANGLE_SUPPORT=1 to link in libcxxabi demangling'); |
| return func; |
| } |
| |
| function demangleAll(text) { |
| var regex = |
| /__Z[\w\d_]+/g; |
| return text.replace(regex, |
| function(x) { |
| var y = demangle(x); |
| return x === y ? x : (x + ' [' + y + ']'); |
| }); |
| } |
| |
| function jsStackTrace() { |
| var err = new Error(); |
| if (!err.stack) { |
| // IE10+ special cases: It does have callstack info, but it is only populated if an Error object is thrown, |
| // so try that as a special-case. |
| try { |
| throw new Error(0); |
| } catch(e) { |
| err = e; |
| } |
| if (!err.stack) { |
| return '(no stack trace available)'; |
| } |
| } |
| return err.stack.toString(); |
| } |
| |
| function stackTrace() { |
| var js = jsStackTrace(); |
| if (Module['extraStackTrace']) js += '\n' + Module['extraStackTrace'](); |
| return demangleAll(js); |
| } |
| Module["stackTrace"] = stackTrace; |
| |
| // Memory management |
| |
| var PAGE_SIZE = 16384; |
| var WASM_PAGE_SIZE = 65536; |
| var ASMJS_PAGE_SIZE = 16777216; |
| var MIN_TOTAL_MEMORY = 16777216; |
| |
| function alignUp(x, multiple) { |
| if (x % multiple > 0) { |
| x += multiple - (x % multiple); |
| } |
| return x; |
| } |
| |
| var HEAP; |
| var buffer; |
| var HEAP8, HEAPU8, HEAP16, HEAPU16, HEAP32, HEAPU32, HEAPF32, HEAPF64; |
| |
| function updateGlobalBuffer(buf) { |
| Module['buffer'] = buffer = buf; |
| } |
| |
| function updateGlobalBufferViews() { |
| Module['HEAP8'] = HEAP8 = new Int8Array(buffer); |
| Module['HEAP16'] = HEAP16 = new Int16Array(buffer); |
| Module['HEAP32'] = HEAP32 = new Int32Array(buffer); |
| Module['HEAPU8'] = HEAPU8 = new Uint8Array(buffer); |
| Module['HEAPU16'] = HEAPU16 = new Uint16Array(buffer); |
| Module['HEAPU32'] = HEAPU32 = new Uint32Array(buffer); |
| Module['HEAPF32'] = HEAPF32 = new Float32Array(buffer); |
| Module['HEAPF64'] = HEAPF64 = new Float64Array(buffer); |
| } |
| |
| var STATIC_BASE, STATICTOP, staticSealed; // static area |
| var STACK_BASE, STACKTOP, STACK_MAX; // stack area |
| var DYNAMIC_BASE, DYNAMICTOP_PTR; // dynamic area handled by sbrk |
| |
| STATIC_BASE = STATICTOP = STACK_BASE = STACKTOP = STACK_MAX = DYNAMIC_BASE = DYNAMICTOP_PTR = 0; |
| staticSealed = false; |
| |
| |
| |
| function abortOnCannotGrowMemory() { |
| abort('Cannot enlarge memory arrays. Either (1) compile with -s TOTAL_MEMORY=X with X higher than the current value ' + TOTAL_MEMORY + ', (2) compile with -s ALLOW_MEMORY_GROWTH=1 which adjusts the size at runtime but prevents some optimizations, (3) set Module.TOTAL_MEMORY to a higher value before the program runs, or if you want malloc to return NULL (0) instead of this abort, compile with -s ABORTING_MALLOC=0 '); |
| } |
| |
| |
| function enlargeMemory() { |
| abortOnCannotGrowMemory(); |
| } |
| |
| |
| var TOTAL_STACK = Module['TOTAL_STACK'] || 5242880; |
| var TOTAL_MEMORY = Module['TOTAL_MEMORY'] || 16777216; |
| if (TOTAL_MEMORY < TOTAL_STACK) Module.printErr('TOTAL_MEMORY should be larger than TOTAL_STACK, was ' + TOTAL_MEMORY + '! (TOTAL_STACK=' + TOTAL_STACK + ')'); |
| |
| // Initialize the runtime's memory |
| |
| |
| |
| // Use a provided buffer, if there is one, or else allocate a new one |
| if (Module['buffer']) { |
| buffer = Module['buffer']; |
| } else { |
| // Use a WebAssembly memory where available |
| if (typeof WebAssembly === 'object' && typeof WebAssembly.Memory === 'function') { |
| Module['wasmMemory'] = new WebAssembly.Memory({ initial: TOTAL_MEMORY / WASM_PAGE_SIZE, maximum: TOTAL_MEMORY / WASM_PAGE_SIZE }); |
| buffer = Module['wasmMemory'].buffer; |
| } else |
| { |
| buffer = new ArrayBuffer(TOTAL_MEMORY); |
| } |
| } |
| updateGlobalBufferViews(); |
| |
| |
| function getTotalMemory() { |
| return TOTAL_MEMORY; |
| } |
| |
| // Endianness check (note: assumes compiler arch was little-endian) |
| HEAP32[0] = 0x63736d65; /* 'emsc' */ |
| HEAP16[1] = 0x6373; |
| if (HEAPU8[2] !== 0x73 || HEAPU8[3] !== 0x63) throw 'Runtime error: expected the system to be little-endian!'; |
| |
| Module['HEAP'] = HEAP; |
| Module['buffer'] = buffer; |
| Module['HEAP8'] = HEAP8; |
| Module['HEAP16'] = HEAP16; |
| Module['HEAP32'] = HEAP32; |
| Module['HEAPU8'] = HEAPU8; |
| Module['HEAPU16'] = HEAPU16; |
| Module['HEAPU32'] = HEAPU32; |
| Module['HEAPF32'] = HEAPF32; |
| Module['HEAPF64'] = HEAPF64; |
| |
| function callRuntimeCallbacks(callbacks) { |
| while(callbacks.length > 0) { |
| var callback = callbacks.shift(); |
| if (typeof callback == 'function') { |
| callback(); |
| continue; |
| } |
| var func = callback.func; |
| if (typeof func === 'number') { |
| if (callback.arg === undefined) { |
| Module['dynCall_v'](func); |
| } else { |
| Module['dynCall_vi'](func, callback.arg); |
| } |
| } else { |
| func(callback.arg === undefined ? null : callback.arg); |
| } |
| } |
| } |
| |
| var __ATPRERUN__ = []; // functions called before the runtime is initialized |
| var __ATINIT__ = []; // functions called during startup |
| var __ATMAIN__ = []; // functions called when main() is to be run |
| var __ATEXIT__ = []; // functions called during shutdown |
| var __ATPOSTRUN__ = []; // functions called after the runtime has exited |
| |
| var runtimeInitialized = false; |
| var runtimeExited = false; |
| |
| |
| function preRun() { |
| // compatibility - merge in anything from Module['preRun'] at this time |
| if (Module['preRun']) { |
| if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']]; |
| while (Module['preRun'].length) { |
| addOnPreRun(Module['preRun'].shift()); |
| } |
| } |
| callRuntimeCallbacks(__ATPRERUN__); |
| } |
| |
| function ensureInitRuntime() { |
| if (runtimeInitialized) return; |
| runtimeInitialized = true; |
| callRuntimeCallbacks(__ATINIT__); |
| } |
| |
| function preMain() { |
| callRuntimeCallbacks(__ATMAIN__); |
| } |
| |
| function exitRuntime() { |
| callRuntimeCallbacks(__ATEXIT__); |
| runtimeExited = true; |
| } |
| |
| function postRun() { |
| // compatibility - merge in anything from Module['postRun'] at this time |
| if (Module['postRun']) { |
| if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']]; |
| while (Module['postRun'].length) { |
| addOnPostRun(Module['postRun'].shift()); |
| } |
| } |
| callRuntimeCallbacks(__ATPOSTRUN__); |
| } |
| |
| function addOnPreRun(cb) { |
| __ATPRERUN__.unshift(cb); |
| } |
| Module["addOnPreRun"] = addOnPreRun; |
| |
| function addOnInit(cb) { |
| __ATINIT__.unshift(cb); |
| } |
| Module["addOnInit"] = addOnInit; |
| |
| function addOnPreMain(cb) { |
| __ATMAIN__.unshift(cb); |
| } |
| Module["addOnPreMain"] = addOnPreMain; |
| |
| function addOnExit(cb) { |
| __ATEXIT__.unshift(cb); |
| } |
| Module["addOnExit"] = addOnExit; |
| |
| function addOnPostRun(cb) { |
| __ATPOSTRUN__.unshift(cb); |
| } |
| Module["addOnPostRun"] = addOnPostRun; |
| |
| // Tools |
| |
| |
| function intArrayFromString(stringy, dontAddNull, length /* optional */) { |
| var len = length > 0 ? length : lengthBytesUTF8(stringy)+1; |
| var u8array = new Array(len); |
| var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length); |
| if (dontAddNull) u8array.length = numBytesWritten; |
| return u8array; |
| } |
| Module["intArrayFromString"] = intArrayFromString; |
| |
| function intArrayToString(array) { |
| var ret = []; |
| for (var i = 0; i < array.length; i++) { |
| var chr = array[i]; |
| if (chr > 0xFF) { |
| chr &= 0xFF; |
| } |
| ret.push(String.fromCharCode(chr)); |
| } |
| return ret.join(''); |
| } |
| Module["intArrayToString"] = intArrayToString; |
| |
| // Deprecated: This function should not be called because it is unsafe and does not provide |
| // a maximum length limit of how many bytes it is allowed to write. Prefer calling the |
| // function stringToUTF8Array() instead, which takes in a maximum length that can be used |
| // to be secure from out of bounds writes. |
| function writeStringToMemory(string, buffer, dontAddNull) { |
| Runtime.warnOnce('writeStringToMemory is deprecated and should not be called! Use stringToUTF8() instead!'); |
| |
| var lastChar, end; |
| if (dontAddNull) { |
| // stringToUTF8Array always appends null. If we don't want to do that, remember the |
| // character that existed at the location where the null will be placed, and restore |
| // that after the write (below). |
| end = buffer + lengthBytesUTF8(string); |
| lastChar = HEAP8[end]; |
| } |
| stringToUTF8(string, buffer, Infinity); |
| if (dontAddNull) HEAP8[end] = lastChar; // Restore the value under the null character. |
| } |
| Module["writeStringToMemory"] = writeStringToMemory; |
| |
| function writeArrayToMemory(array, buffer) { |
| HEAP8.set(array, buffer); |
| } |
| Module["writeArrayToMemory"] = writeArrayToMemory; |
| |
| function writeAsciiToMemory(str, buffer, dontAddNull) { |
| for (var i = 0; i < str.length; ++i) { |
| HEAP8[((buffer++)>>0)]=str.charCodeAt(i); |
| } |
| // Null-terminate the pointer to the HEAP. |
| if (!dontAddNull) HEAP8[((buffer)>>0)]=0; |
| } |
| Module["writeAsciiToMemory"] = writeAsciiToMemory; |
| |
| function unSign(value, bits, ignore) { |
| if (value >= 0) { |
| return value; |
| } |
| return bits <= 32 ? 2*Math.abs(1 << (bits-1)) + value // Need some trickery, since if bits == 32, we are right at the limit of the bits JS uses in bitshifts |
| : Math.pow(2, bits) + value; |
| } |
| function reSign(value, bits, ignore) { |
| if (value <= 0) { |
| return value; |
| } |
| var half = bits <= 32 ? Math.abs(1 << (bits-1)) // abs is needed if bits == 32 |
| : Math.pow(2, bits-1); |
| if (value >= half && (bits <= 32 || value > half)) { // for huge values, we can hit the precision limit and always get true here. so don't do that |
| // but, in general there is no perfect solution here. With 64-bit ints, we get rounding and errors |
| // TODO: In i64 mode 1, resign the two parts separately and safely |
| value = -2*half + value; // Cannot bitshift half, as it may be at the limit of the bits JS uses in bitshifts |
| } |
| return value; |
| } |
| |
| |
| // check for imul support, and also for correctness ( https://bugs.webkit.org/show_bug.cgi?id=126345 ) |
| if (!Math['imul'] || Math['imul'](0xffffffff, 5) !== -5) Math['imul'] = function imul(a, b) { |
| var ah = a >>> 16; |
| var al = a & 0xffff; |
| var bh = b >>> 16; |
| var bl = b & 0xffff; |
| return (al*bl + ((ah*bl + al*bh) << 16))|0; |
| }; |
| Math.imul = Math['imul']; |
| |
| if (!Math['fround']) { |
| var froundBuffer = new Float32Array(1); |
| Math['fround'] = function(x) { froundBuffer[0] = x; return froundBuffer[0] }; |
| } |
| Math.fround = Math['fround']; |
| |
| if (!Math['clz32']) Math['clz32'] = function(x) { |
| x = x >>> 0; |
| for (var i = 0; i < 32; i++) { |
| if (x & (1 << (31 - i))) return i; |
| } |
| return 32; |
| }; |
| Math.clz32 = Math['clz32'] |
| |
| if (!Math['trunc']) Math['trunc'] = function(x) { |
| return x < 0 ? Math.ceil(x) : Math.floor(x); |
| }; |
| Math.trunc = Math['trunc']; |
| |
| var Math_abs = Math.abs; |
| var Math_cos = Math.cos; |
| var Math_sin = Math.sin; |
| var Math_tan = Math.tan; |
| var Math_acos = Math.acos; |
| var Math_asin = Math.asin; |
| var Math_atan = Math.atan; |
| var Math_atan2 = Math.atan2; |
| var Math_exp = Math.exp; |
| var Math_log = Math.log; |
| var Math_sqrt = Math.sqrt; |
| var Math_ceil = Math.ceil; |
| var Math_floor = Math.floor; |
| var Math_pow = Math.pow; |
| var Math_imul = Math.imul; |
| var Math_fround = Math.fround; |
| var Math_round = Math.round; |
| var Math_min = Math.min; |
| var Math_clz32 = Math.clz32; |
| var Math_trunc = Math.trunc; |
| |
| // A counter of dependencies for calling run(). If we need to |
| // do asynchronous work before running, increment this and |
| // decrement it. Incrementing must happen in a place like |
| // PRE_RUN_ADDITIONS (used by emcc to add file preloading). |
| // Note that you can add dependencies in preRun, even though |
| // it happens right before run - run will be postponed until |
| // the dependencies are met. |
| var runDependencies = 0; |
| var runDependencyWatcher = null; |
| var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled |
| |
| function getUniqueRunDependency(id) { |
| return id; |
| } |
| |
| function addRunDependency(id) { |
| runDependencies++; |
| if (Module['monitorRunDependencies']) { |
| Module['monitorRunDependencies'](runDependencies); |
| } |
| } |
| Module["addRunDependency"] = addRunDependency; |
| |
| function removeRunDependency(id) { |
| runDependencies--; |
| if (Module['monitorRunDependencies']) { |
| Module['monitorRunDependencies'](runDependencies); |
| } |
| if (runDependencies == 0) { |
| if (runDependencyWatcher !== null) { |
| clearInterval(runDependencyWatcher); |
| runDependencyWatcher = null; |
| } |
| if (dependenciesFulfilled) { |
| var callback = dependenciesFulfilled; |
| dependenciesFulfilled = null; |
| callback(); // can add another dependenciesFulfilled |
| } |
| } |
| } |
| Module["removeRunDependency"] = removeRunDependency; |
| |
| Module["preloadedImages"] = {}; // maps url to image data |
| Module["preloadedAudios"] = {}; // maps url to audio data |
| |
| |
| |
| var memoryInitializer = null; |
| |
| |
| |
| |
| |
| function integrateWasmJS(Module) { |
| // wasm.js has several methods for creating the compiled code module here: |
| // * 'native-wasm' : use native WebAssembly support in the browser |
| // * 'interpret-s-expr': load s-expression code from a .wast and interpret |
| // * 'interpret-binary': load binary wasm and interpret |
| // * 'interpret-asm2wasm': load asm.js code, translate to wasm, and interpret |
| // * 'asmjs': no wasm, just load the asm.js code and use that (good for testing) |
| // The method can be set at compile time (BINARYEN_METHOD), or runtime by setting Module['wasmJSMethod']. |
| // The method can be a comma-separated list, in which case, we will try the |
| // options one by one. Some of them can fail gracefully, and then we can try |
| // the next. |
| |
| // inputs |
| |
| var method = Module['wasmJSMethod'] || 'native-wasm'; |
| Module['wasmJSMethod'] = method; |
| |
| var wasmTextFile = Module['wasmTextFile'] || 'gcc-loops.wast'; |
| var wasmBinaryFile = Module['wasmBinaryFile'] || 'gcc-loops.wasm'; |
| var asmjsCodeFile = Module['asmjsCodeFile'] || 'gcc-loops.asm.js'; |
| |
| // utilities |
| |
| var wasmPageSize = 64*1024; |
| |
| var asm2wasmImports = { // special asm2wasm imports |
| "f64-rem": function(x, y) { |
| return x % y; |
| }, |
| "f64-to-int": function(x) { |
| return x | 0; |
| }, |
| "i32s-div": function(x, y) { |
| return ((x | 0) / (y | 0)) | 0; |
| }, |
| "i32u-div": function(x, y) { |
| return ((x >>> 0) / (y >>> 0)) >>> 0; |
| }, |
| "i32s-rem": function(x, y) { |
| return ((x | 0) % (y | 0)) | 0; |
| }, |
| "i32u-rem": function(x, y) { |
| return ((x >>> 0) % (y >>> 0)) >>> 0; |
| }, |
| "debugger": function() { |
| debugger; |
| }, |
| }; |
| |
| var info = { |
| 'global': null, |
| 'env': null, |
| 'asm2wasm': asm2wasmImports, |
| 'parent': Module // Module inside wasm-js.cpp refers to wasm-js.cpp; this allows access to the outside program. |
| }; |
| |
| var exports = null; |
| |
| function lookupImport(mod, base) { |
| var lookup = info; |
| if (mod.indexOf('.') < 0) { |
| lookup = (lookup || {})[mod]; |
| } else { |
| var parts = mod.split('.'); |
| lookup = (lookup || {})[parts[0]]; |
| lookup = (lookup || {})[parts[1]]; |
| } |
| if (base) { |
| lookup = (lookup || {})[base]; |
| } |
| if (lookup === undefined) { |
| abort('bad lookupImport to (' + mod + ').' + base); |
| } |
| return lookup; |
| } |
| |
| function mergeMemory(newBuffer) { |
| // The wasm instance creates its memory. But static init code might have written to |
| // buffer already, including the mem init file, and we must copy it over in a proper merge. |
| // TODO: avoid this copy, by avoiding such static init writes |
| // TODO: in shorter term, just copy up to the last static init write |
| var oldBuffer = Module['buffer']; |
| if (newBuffer.byteLength < oldBuffer.byteLength) { |
| Module['printErr']('the new buffer in mergeMemory is smaller than the previous one. in native wasm, we should grow memory here'); |
| } |
| var oldView = new Int8Array(oldBuffer); |
| var newView = new Int8Array(newBuffer); |
| |
| // If we have a mem init file, do not trample it |
| if (!memoryInitializer) { |
| oldView.set(newView.subarray(Module['STATIC_BASE'], Module['STATIC_BASE'] + Module['STATIC_BUMP']), Module['STATIC_BASE']); |
| } |
| |
| newView.set(oldView); |
| updateGlobalBuffer(newBuffer); |
| updateGlobalBufferViews(); |
| } |
| |
| var WasmTypes = { |
| none: 0, |
| i32: 1, |
| i64: 2, |
| f32: 3, |
| f64: 4 |
| }; |
| |
| function fixImports(imports) { |
| if (!0) return imports; |
| var ret = {}; |
| for (var i in imports) { |
| var fixed = i; |
| if (fixed[0] == '_') fixed = fixed.substr(1); |
| ret[fixed] = imports[i]; |
| } |
| return ret; |
| } |
| |
| function getBinary() { |
| var binary; |
| if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) { |
| binary = Module['wasmBinary']; |
| assert(binary, "on the web, we need the wasm binary to be preloaded and set on Module['wasmBinary']. emcc.py will do that for you when generating HTML (but not JS)"); |
| binary = new Uint8Array(binary); |
| } else { |
| binary = Module['readBinary'](wasmBinaryFile); |
| } |
| return binary; |
| } |
| |
| // do-method functions |
| |
| function doJustAsm(global, env, providedBuffer) { |
| // if no Module.asm, or it's the method handler helper (see below), then apply |
| // the asmjs |
| if (typeof Module['asm'] !== 'function' || Module['asm'] === methodHandler) { |
| if (!Module['asmPreload']) { |
| // you can load the .asm.js file before this, to avoid this sync xhr and eval |
| eval(Module['read'](asmjsCodeFile)); // set Module.asm |
| } else { |
| Module['asm'] = Module['asmPreload']; |
| } |
| } |
| if (typeof Module['asm'] !== 'function') { |
| Module['printErr']('asm evalling did not set the module properly'); |
| return false; |
| } |
| return Module['asm'](global, env, providedBuffer); |
| } |
| |
| function doNativeWasm(global, env, providedBuffer) { |
| if (typeof WebAssembly !== 'object') { |
| Module['printErr']('no native wasm support detected'); |
| return false; |
| } |
| // prepare memory import |
| if (!(Module['wasmMemory'] instanceof WebAssembly.Memory)) { |
| Module['printErr']('no native wasm Memory in use'); |
| return false; |
| } |
| env['memory'] = Module['wasmMemory']; |
| // Load the wasm module and create an instance of using native support in the JS engine. |
| info['global'] = { |
| 'NaN': NaN, |
| 'Infinity': Infinity |
| }; |
| info['global.Math'] = global.Math; |
| info['env'] = env; |
| // handle a generated wasm instance, receiving its exports and |
| // performing other necessary setup |
| function receiveInstance(instance) { |
| exports = instance.exports; |
| if (exports.memory) mergeMemory(exports.memory); |
| Module['asm'] = exports; |
| Module["usingWasm"] = true; |
| } |
| Module['printErr']('asynchronously preparing wasm'); |
| addRunDependency('wasm-instantiate'); // we can't run yet |
| WebAssembly.instantiate(getBinary(), info).then(function(output) { |
| // receiveInstance() will swap in the exports (to Module.asm) so they can be called |
| receiveInstance(output.instance); |
| removeRunDependency('wasm-instantiate'); |
| }).catch(function(reason) { |
| Module['printErr']('failed to asynchronously prepare wasm:\n ' + reason); |
| }); |
| return {}; // no exports yet; we'll fill them in later |
| var instance; |
| try { |
| instance = new WebAssembly.Instance(new WebAssembly.Module(getBinary()), info) |
| } catch (e) { |
| Module['printErr']('failed to compile wasm module: ' + e); |
| if (e.toString().indexOf('imported Memory with incompatible size') >= 0) { |
| Module['printErr']('Memory size incompatibility issues may be due to changing TOTAL_MEMORY at runtime to something too large. Use ALLOW_MEMORY_GROWTH to allow any size memory (and also make sure not to set TOTAL_MEMORY at runtime to something smaller than it was at compile time).'); |
| } |
| return false; |
| } |
| receiveInstance(instance); |
| return exports; |
| } |
| |
| function doWasmPolyfill(global, env, providedBuffer, method) { |
| if (typeof WasmJS !== 'function') { |
| Module['printErr']('WasmJS not detected - polyfill not bundled?'); |
| return false; |
| } |
| |
| // Use wasm.js to polyfill and execute code in a wasm interpreter. |
| var wasmJS = WasmJS({}); |
| |
| // XXX don't be confused. Module here is in the outside program. wasmJS is the inner wasm-js.cpp. |
| wasmJS['outside'] = Module; // Inside wasm-js.cpp, Module['outside'] reaches the outside module. |
| |
| // Information for the instance of the module. |
| wasmJS['info'] = info; |
| |
| wasmJS['lookupImport'] = lookupImport; |
| |
| assert(providedBuffer === Module['buffer']); // we should not even need to pass it as a 3rd arg for wasm, but that's the asm.js way. |
| |
| info.global = global; |
| info.env = env; |
| |
| // polyfill interpreter expects an ArrayBuffer |
| assert(providedBuffer === Module['buffer']); |
| env['memory'] = providedBuffer; |
| assert(env['memory'] instanceof ArrayBuffer); |
| |
| wasmJS['providedTotalMemory'] = Module['buffer'].byteLength; |
| |
| // Prepare to generate wasm, using either asm2wasm or s-exprs |
| var code; |
| if (method === 'interpret-binary') { |
| code = getBinary(); |
| } else { |
| code = Module['read'](method == 'interpret-asm2wasm' ? asmjsCodeFile : wasmTextFile); |
| } |
| var temp; |
| if (method == 'interpret-asm2wasm') { |
| temp = wasmJS['_malloc'](code.length + 1); |
| wasmJS['writeAsciiToMemory'](code, temp); |
| wasmJS['_load_asm2wasm'](temp); |
| } else if (method === 'interpret-s-expr') { |
| temp = wasmJS['_malloc'](code.length + 1); |
| wasmJS['writeAsciiToMemory'](code, temp); |
| wasmJS['_load_s_expr2wasm'](temp); |
| } else if (method === 'interpret-binary') { |
| temp = wasmJS['_malloc'](code.length); |
| wasmJS['HEAPU8'].set(code, temp); |
| wasmJS['_load_binary2wasm'](temp, code.length); |
| } else { |
| throw 'what? ' + method; |
| } |
| wasmJS['_free'](temp); |
| |
| wasmJS['_instantiate'](temp); |
| |
| if (Module['newBuffer']) { |
| mergeMemory(Module['newBuffer']); |
| Module['newBuffer'] = null; |
| } |
| |
| exports = wasmJS['asmExports']; |
| |
| return exports; |
| } |
| |
| // We may have a preloaded value in Module.asm, save it |
| Module['asmPreload'] = Module['asm']; |
| |
| // Memory growth integration code |
| Module['reallocBuffer'] = function(size) { |
| var PAGE_MULTIPLE = Module["usingWasm"] ? WASM_PAGE_SIZE : ASMJS_PAGE_SIZE; // In wasm, heap size must be a multiple of 64KB. In asm.js, they need to be multiples of 16MB. |
| size = alignUp(size, PAGE_MULTIPLE); // round up to wasm page size |
| var old = Module['buffer']; |
| var oldSize = old.byteLength; |
| if (Module["usingWasm"]) { |
| try { |
| var result = Module['wasmMemory'].grow((size - oldSize) / wasmPageSize); // .grow() takes a delta compared to the previous size |
| if (result !== (-1 | 0)) { |
| // success in native wasm memory growth, get the buffer from the memory |
| return Module['buffer'] = Module['wasmMemory'].buffer; |
| } else { |
| return null; |
| } |
| } catch(e) { |
| return null; |
| } |
| } else { |
| exports['__growWasmMemory']((size - oldSize) / wasmPageSize); // tiny wasm method that just does grow_memory |
| // in interpreter, we replace Module.buffer if we allocate |
| return Module['buffer'] !== old ? Module['buffer'] : null; // if it was reallocated, it changed |
| } |
| }; |
| |
| // Provide an "asm.js function" for the application, called to "link" the asm.js module. We instantiate |
| // the wasm module at that time, and it receives imports and provides exports and so forth, the app |
| // doesn't need to care that it is wasm or olyfilled wasm or asm.js. |
| |
| Module['asm'] = function(global, env, providedBuffer) { |
| global = fixImports(global); |
| env = fixImports(env); |
| |
| // import table |
| if (!env['table']) { |
| var TABLE_SIZE = Module['wasmTableSize']; |
| if (TABLE_SIZE === undefined) TABLE_SIZE = 1024; // works in binaryen interpreter at least |
| var MAX_TABLE_SIZE = Module['wasmMaxTableSize']; |
| if (typeof WebAssembly === 'object' && typeof WebAssembly.Table === 'function') { |
| if (MAX_TABLE_SIZE !== undefined) { |
| env['table'] = new WebAssembly.Table({ initial: TABLE_SIZE, maximum: MAX_TABLE_SIZE, element: 'anyfunc' }); |
| } else { |
| env['table'] = new WebAssembly.Table({ initial: TABLE_SIZE, element: 'anyfunc' }); |
| } |
| } else { |
| env['table'] = new Array(TABLE_SIZE); // works in binaryen interpreter at least |
| } |
| Module['wasmTable'] = env['table']; |
| } |
| |
| if (!env['memoryBase']) { |
| env['memoryBase'] = Module['STATIC_BASE']; // tell the memory segments where to place themselves |
| } |
| if (!env['tableBase']) { |
| env['tableBase'] = 0; // table starts at 0 by default, in dynamic linking this will change |
| } |
| |
| // try the methods. each should return the exports if it succeeded |
| |
| var exports; |
| var methods = method.split(','); |
| |
| for (var i = 0; i < methods.length; i++) { |
| var curr = methods[i]; |
| |
| Module['printErr']('trying binaryen method: ' + curr); |
| |
| if (curr === 'native-wasm') { |
| if (exports = doNativeWasm(global, env, providedBuffer)) break; |
| } else if (curr === 'asmjs') { |
| if (exports = doJustAsm(global, env, providedBuffer)) break; |
| } else if (curr === 'interpret-asm2wasm' || curr === 'interpret-s-expr' || curr === 'interpret-binary') { |
| if (exports = doWasmPolyfill(global, env, providedBuffer, curr)) break; |
| } else { |
| throw 'bad method: ' + curr; |
| } |
| } |
| |
| if (!exports) throw 'no binaryen method succeeded. consider enabling more options, like interpreting, if you want that: https://github.com/kripken/emscripten/wiki/WebAssembly#binaryen-methods'; |
| |
| Module['printErr']('binaryen method succeeded.'); |
| |
| return exports; |
| }; |
| |
| var methodHandler = Module['asm']; // note our method handler, as we may modify Module['asm'] later |
| } |
| |
| integrateWasmJS(Module); |
| |
| // === Body === |
| |
| var ASM_CONSTS = []; |
| |
| |
| |
| |
| STATIC_BASE = 1024; |
| |
| STATICTOP = STATIC_BASE + 248736; |
| /* global initializers */ __ATINIT__.push({ func: function() { __GLOBAL__I_000101() } }, { func: function() { __GLOBAL__sub_I_iostream_cpp() } }); |
| |
| |
| memoryInitializer = Module["wasmJSMethod"].indexOf("asmjs") >= 0 || Module["wasmJSMethod"].indexOf("interpret-asm2wasm") >= 0 ? "gcc-loops.js.mem" : null; |
| |
| |
| |
| |
| var STATIC_BUMP = 248736; |
| Module["STATIC_BASE"] = STATIC_BASE; |
| Module["STATIC_BUMP"] = STATIC_BUMP; |
| |
| /* no memory initializer */ |
| var tempDoublePtr = STATICTOP; STATICTOP += 16; |
| |
| function copyTempFloat(ptr) { // functions, because inlining this code increases code size too much |
| |
| HEAP8[tempDoublePtr] = HEAP8[ptr]; |
| |
| HEAP8[tempDoublePtr+1] = HEAP8[ptr+1]; |
| |
| HEAP8[tempDoublePtr+2] = HEAP8[ptr+2]; |
| |
| HEAP8[tempDoublePtr+3] = HEAP8[ptr+3]; |
| |
| } |
| |
| function copyTempDouble(ptr) { |
| |
| HEAP8[tempDoublePtr] = HEAP8[ptr]; |
| |
| HEAP8[tempDoublePtr+1] = HEAP8[ptr+1]; |
| |
| HEAP8[tempDoublePtr+2] = HEAP8[ptr+2]; |
| |
| HEAP8[tempDoublePtr+3] = HEAP8[ptr+3]; |
| |
| HEAP8[tempDoublePtr+4] = HEAP8[ptr+4]; |
| |
| HEAP8[tempDoublePtr+5] = HEAP8[ptr+5]; |
| |
| HEAP8[tempDoublePtr+6] = HEAP8[ptr+6]; |
| |
| HEAP8[tempDoublePtr+7] = HEAP8[ptr+7]; |
| |
| } |
| |
| // {{PRE_LIBRARY}} |
| |
| |
| |
| function _atexit(func, arg) { |
| __ATEXIT__.unshift({ func: func, arg: arg }); |
| }function ___cxa_atexit() { |
| return _atexit.apply(null, arguments) |
| } |
| |
| function ___assert_fail(condition, filename, line, func) { |
| ABORT = true; |
| throw 'Assertion failed: ' + Pointer_stringify(condition) + ', at: ' + [filename ? Pointer_stringify(filename) : 'unknown filename', line, func ? Pointer_stringify(func) : 'unknown function'] + ' at ' + stackTrace(); |
| } |
| |
| |
| function __ZSt18uncaught_exceptionv() { // std::uncaught_exception() |
| return !!__ZSt18uncaught_exceptionv.uncaught_exception; |
| } |
| |
| |
| |
| var EXCEPTIONS={last:0,caught:[],infos:{},deAdjust:function (adjusted) { |
| if (!adjusted || EXCEPTIONS.infos[adjusted]) return adjusted; |
| for (var ptr in EXCEPTIONS.infos) { |
| var info = EXCEPTIONS.infos[ptr]; |
| if (info.adjusted === adjusted) { |
| return ptr; |
| } |
| } |
| return adjusted; |
| },addRef:function (ptr) { |
| if (!ptr) return; |
| var info = EXCEPTIONS.infos[ptr]; |
| info.refcount++; |
| },decRef:function (ptr) { |
| if (!ptr) return; |
| var info = EXCEPTIONS.infos[ptr]; |
| assert(info.refcount > 0); |
| info.refcount--; |
| // A rethrown exception can reach refcount 0; it must not be discarded |
| // Its next handler will clear the rethrown flag and addRef it, prior to |
| // final decRef and destruction here |
| if (info.refcount === 0 && !info.rethrown) { |
| if (info.destructor) { |
| Module['dynCall_vi'](info.destructor, ptr); |
| } |
| delete EXCEPTIONS.infos[ptr]; |
| ___cxa_free_exception(ptr); |
| } |
| },clearRef:function (ptr) { |
| if (!ptr) return; |
| var info = EXCEPTIONS.infos[ptr]; |
| info.refcount = 0; |
| }}; |
| function ___resumeException(ptr) { |
| if (!EXCEPTIONS.last) { EXCEPTIONS.last = ptr; } |
| throw ptr + " - Exception catching is disabled, this exception cannot be caught. Compile with -s DISABLE_EXCEPTION_CATCHING=0 or DISABLE_EXCEPTION_CATCHING=2 to catch."; |
| }function ___cxa_find_matching_catch() { |
| var thrown = EXCEPTIONS.last; |
| if (!thrown) { |
| // just pass through the null ptr |
| return ((Runtime.setTempRet0(0),0)|0); |
| } |
| var info = EXCEPTIONS.infos[thrown]; |
| var throwntype = info.type; |
| if (!throwntype) { |
| // just pass through the thrown ptr |
| return ((Runtime.setTempRet0(0),thrown)|0); |
| } |
| var typeArray = Array.prototype.slice.call(arguments); |
| |
| var pointer = Module['___cxa_is_pointer_type'](throwntype); |
| // can_catch receives a **, add indirection |
| if (!___cxa_find_matching_catch.buffer) ___cxa_find_matching_catch.buffer = _malloc(4); |
| HEAP32[((___cxa_find_matching_catch.buffer)>>2)]=thrown; |
| thrown = ___cxa_find_matching_catch.buffer; |
| // The different catch blocks are denoted by different types. |
| // Due to inheritance, those types may not precisely match the |
| // type of the thrown object. Find one which matches, and |
| // return the type of the catch block which should be called. |
| for (var i = 0; i < typeArray.length; i++) { |
| if (typeArray[i] && Module['___cxa_can_catch'](typeArray[i], throwntype, thrown)) { |
| thrown = HEAP32[((thrown)>>2)]; // undo indirection |
| info.adjusted = thrown; |
| return ((Runtime.setTempRet0(typeArray[i]),thrown)|0); |
| } |
| } |
| // Shouldn't happen unless we have bogus data in typeArray |
| // or encounter a type for which emscripten doesn't have suitable |
| // typeinfo defined. Best-efforts match just in case. |
| thrown = HEAP32[((thrown)>>2)]; // undo indirection |
| return ((Runtime.setTempRet0(throwntype),thrown)|0); |
| }function ___cxa_throw(ptr, type, destructor) { |
| EXCEPTIONS.infos[ptr] = { |
| ptr: ptr, |
| adjusted: ptr, |
| type: type, |
| destructor: destructor, |
| refcount: 0, |
| caught: false, |
| rethrown: false |
| }; |
| EXCEPTIONS.last = ptr; |
| if (!("uncaught_exception" in __ZSt18uncaught_exceptionv)) { |
| __ZSt18uncaught_exceptionv.uncaught_exception = 1; |
| } else { |
| __ZSt18uncaught_exceptionv.uncaught_exception++; |
| } |
| throw ptr + " - Exception catching is disabled, this exception cannot be caught. Compile with -s DISABLE_EXCEPTION_CATCHING=0 or DISABLE_EXCEPTION_CATCHING=2 to catch."; |
| } |
| |
| |
| Module["_memset"] = _memset; |
| |
| function ___gxx_personality_v0() { |
| } |
| |
| |
| Module["_pthread_mutex_lock"] = _pthread_mutex_lock; |
| |
| |
| |
| function __isLeapYear(year) { |
| return year%4 === 0 && (year%100 !== 0 || year%400 === 0); |
| } |
| |
| function __arraySum(array, index) { |
| var sum = 0; |
| for (var i = 0; i <= index; sum += array[i++]); |
| return sum; |
| } |
| |
| |
| var __MONTH_DAYS_LEAP=[31,29,31,30,31,30,31,31,30,31,30,31]; |
| |
| var __MONTH_DAYS_REGULAR=[31,28,31,30,31,30,31,31,30,31,30,31];function __addDays(date, days) { |
| var newDate = new Date(date.getTime()); |
| while(days > 0) { |
| var leap = __isLeapYear(newDate.getFullYear()); |
| var currentMonth = newDate.getMonth(); |
| var daysInCurrentMonth = (leap ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR)[currentMonth]; |
| |
| if (days > daysInCurrentMonth-newDate.getDate()) { |
| // we spill over to next month |
| days -= (daysInCurrentMonth-newDate.getDate()+1); |
| newDate.setDate(1); |
| if (currentMonth < 11) { |
| newDate.setMonth(currentMonth+1) |
| } else { |
| newDate.setMonth(0); |
| newDate.setFullYear(newDate.getFullYear()+1); |
| } |
| } else { |
| // we stay in current month |
| newDate.setDate(newDate.getDate()+days); |
| return newDate; |
| } |
| } |
| |
| return newDate; |
| }function _strftime(s, maxsize, format, tm) { |
| // size_t strftime(char *restrict s, size_t maxsize, const char *restrict format, const struct tm *restrict timeptr); |
| // http://pubs.opengroup.org/onlinepubs/009695399/functions/strftime.html |
| |
| var tm_zone = HEAP32[(((tm)+(40))>>2)]; |
| |
| var date = { |
| tm_sec: HEAP32[((tm)>>2)], |
| tm_min: HEAP32[(((tm)+(4))>>2)], |
| tm_hour: HEAP32[(((tm)+(8))>>2)], |
| tm_mday: HEAP32[(((tm)+(12))>>2)], |
| tm_mon: HEAP32[(((tm)+(16))>>2)], |
| tm_year: HEAP32[(((tm)+(20))>>2)], |
| tm_wday: HEAP32[(((tm)+(24))>>2)], |
| tm_yday: HEAP32[(((tm)+(28))>>2)], |
| tm_isdst: HEAP32[(((tm)+(32))>>2)], |
| tm_gmtoff: HEAP32[(((tm)+(36))>>2)], |
| tm_zone: tm_zone ? Pointer_stringify(tm_zone) : '' |
| }; |
| |
| var pattern = Pointer_stringify(format); |
| |
| // expand format |
| var EXPANSION_RULES_1 = { |
| '%c': '%a %b %d %H:%M:%S %Y', // Replaced by the locale's appropriate date and time representation - e.g., Mon Aug 3 14:02:01 2013 |
| '%D': '%m/%d/%y', // Equivalent to %m / %d / %y |
| '%F': '%Y-%m-%d', // Equivalent to %Y - %m - %d |
| '%h': '%b', // Equivalent to %b |
| '%r': '%I:%M:%S %p', // Replaced by the time in a.m. and p.m. notation |
| '%R': '%H:%M', // Replaced by the time in 24-hour notation |
| '%T': '%H:%M:%S', // Replaced by the time |
| '%x': '%m/%d/%y', // Replaced by the locale's appropriate date representation |
| '%X': '%H:%M:%S' // Replaced by the locale's appropriate date representation |
| }; |
| for (var rule in EXPANSION_RULES_1) { |
| pattern = pattern.replace(new RegExp(rule, 'g'), EXPANSION_RULES_1[rule]); |
| } |
| |
| var WEEKDAYS = ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday']; |
| var MONTHS = ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December']; |
| |
| function leadingSomething(value, digits, character) { |
| var str = typeof value === 'number' ? value.toString() : (value || ''); |
| while (str.length < digits) { |
| str = character[0]+str; |
| } |
| return str; |
| }; |
| |
| function leadingNulls(value, digits) { |
| return leadingSomething(value, digits, '0'); |
| }; |
| |
| function compareByDay(date1, date2) { |
| function sgn(value) { |
| return value < 0 ? -1 : (value > 0 ? 1 : 0); |
| }; |
| |
| var compare; |
| if ((compare = sgn(date1.getFullYear()-date2.getFullYear())) === 0) { |
| if ((compare = sgn(date1.getMonth()-date2.getMonth())) === 0) { |
| compare = sgn(date1.getDate()-date2.getDate()); |
| } |
| } |
| return compare; |
| }; |
| |
| function getFirstWeekStartDate(janFourth) { |
| switch (janFourth.getDay()) { |
| case 0: // Sunday |
| return new Date(janFourth.getFullYear()-1, 11, 29); |
| case 1: // Monday |
| return janFourth; |
| case 2: // Tuesday |
| return new Date(janFourth.getFullYear(), 0, 3); |
| case 3: // Wednesday |
| return new Date(janFourth.getFullYear(), 0, 2); |
| case 4: // Thursday |
| return new Date(janFourth.getFullYear(), 0, 1); |
| case 5: // Friday |
| return new Date(janFourth.getFullYear()-1, 11, 31); |
| case 6: // Saturday |
| return new Date(janFourth.getFullYear()-1, 11, 30); |
| } |
| }; |
| |
| function getWeekBasedYear(date) { |
| var thisDate = __addDays(new Date(date.tm_year+1900, 0, 1), date.tm_yday); |
| |
| var janFourthThisYear = new Date(thisDate.getFullYear(), 0, 4); |
| var janFourthNextYear = new Date(thisDate.getFullYear()+1, 0, 4); |
| |
| var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear); |
| var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear); |
| |
| if (compareByDay(firstWeekStartThisYear, thisDate) <= 0) { |
| // this date is after the start of the first week of this year |
| if (compareByDay(firstWeekStartNextYear, thisDate) <= 0) { |
| return thisDate.getFullYear()+1; |
| } else { |
| return thisDate.getFullYear(); |
| } |
| } else { |
| return thisDate.getFullYear()-1; |
| } |
| }; |
| |
| var EXPANSION_RULES_2 = { |
| '%a': function(date) { |
| return WEEKDAYS[date.tm_wday].substring(0,3); |
| }, |
| '%A': function(date) { |
| return WEEKDAYS[date.tm_wday]; |
| }, |
| '%b': function(date) { |
| return MONTHS[date.tm_mon].substring(0,3); |
| }, |
| '%B': function(date) { |
| return MONTHS[date.tm_mon]; |
| }, |
| '%C': function(date) { |
| var year = date.tm_year+1900; |
| return leadingNulls((year/100)|0,2); |
| }, |
| '%d': function(date) { |
| return leadingNulls(date.tm_mday, 2); |
| }, |
| '%e': function(date) { |
| return leadingSomething(date.tm_mday, 2, ' '); |
| }, |
| '%g': function(date) { |
| // %g, %G, and %V give values according to the ISO 8601:2000 standard week-based year. |
| // In this system, weeks begin on a Monday and week 1 of the year is the week that includes |
| // January 4th, which is also the week that includes the first Thursday of the year, and |
| // is also the first week that contains at least four days in the year. |
| // If the first Monday of January is the 2nd, 3rd, or 4th, the preceding days are part of |
| // the last week of the preceding year; thus, for Saturday 2nd January 1999, |
| // %G is replaced by 1998 and %V is replaced by 53. If December 29th, 30th, |
| // or 31st is a Monday, it and any following days are part of week 1 of the following year. |
| // Thus, for Tuesday 30th December 1997, %G is replaced by 1998 and %V is replaced by 01. |
| |
| return getWeekBasedYear(date).toString().substring(2); |
| }, |
| '%G': function(date) { |
| return getWeekBasedYear(date); |
| }, |
| '%H': function(date) { |
| return leadingNulls(date.tm_hour, 2); |
| }, |
| '%I': function(date) { |
| var twelveHour = date.tm_hour; |
| if (twelveHour == 0) twelveHour = 12; |
| else if (twelveHour > 12) twelveHour -= 12; |
| return leadingNulls(twelveHour, 2); |
| }, |
| '%j': function(date) { |
| // Day of the year (001-366) |
| return leadingNulls(date.tm_mday+__arraySum(__isLeapYear(date.tm_year+1900) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, date.tm_mon-1), 3); |
| }, |
| '%m': function(date) { |
| return leadingNulls(date.tm_mon+1, 2); |
| }, |
| '%M': function(date) { |
| return leadingNulls(date.tm_min, 2); |
| }, |
| '%n': function() { |
| return '\n'; |
| }, |
| '%p': function(date) { |
| if (date.tm_hour >= 0 && date.tm_hour < 12) { |
| return 'AM'; |
| } else { |
| return 'PM'; |
| } |
| }, |
| '%S': function(date) { |
| return leadingNulls(date.tm_sec, 2); |
| }, |
| '%t': function() { |
| return '\t'; |
| }, |
| '%u': function(date) { |
| var day = new Date(date.tm_year+1900, date.tm_mon+1, date.tm_mday, 0, 0, 0, 0); |
| return day.getDay() || 7; |
| }, |
| '%U': function(date) { |
| // Replaced by the week number of the year as a decimal number [00,53]. |
| // The first Sunday of January is the first day of week 1; |
| // days in the new year before this are in week 0. [ tm_year, tm_wday, tm_yday] |
| var janFirst = new Date(date.tm_year+1900, 0, 1); |
| var firstSunday = janFirst.getDay() === 0 ? janFirst : __addDays(janFirst, 7-janFirst.getDay()); |
| var endDate = new Date(date.tm_year+1900, date.tm_mon, date.tm_mday); |
| |
| // is target date after the first Sunday? |
| if (compareByDay(firstSunday, endDate) < 0) { |
| // calculate difference in days between first Sunday and endDate |
| var februaryFirstUntilEndMonth = __arraySum(__isLeapYear(endDate.getFullYear()) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, endDate.getMonth()-1)-31; |
| var firstSundayUntilEndJanuary = 31-firstSunday.getDate(); |
| var days = firstSundayUntilEndJanuary+februaryFirstUntilEndMonth+endDate.getDate(); |
| return leadingNulls(Math.ceil(days/7), 2); |
| } |
| |
| return compareByDay(firstSunday, janFirst) === 0 ? '01': '00'; |
| }, |
| '%V': function(date) { |
| // Replaced by the week number of the year (Monday as the first day of the week) |
| // as a decimal number [01,53]. If the week containing 1 January has four |
| // or more days in the new year, then it is considered week 1. |
| // Otherwise, it is the last week of the previous year, and the next week is week 1. |
| // Both January 4th and the first Thursday of January are always in week 1. [ tm_year, tm_wday, tm_yday] |
| var janFourthThisYear = new Date(date.tm_year+1900, 0, 4); |
| var janFourthNextYear = new Date(date.tm_year+1901, 0, 4); |
| |
| var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear); |
| var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear); |
| |
| var endDate = __addDays(new Date(date.tm_year+1900, 0, 1), date.tm_yday); |
| |
| if (compareByDay(endDate, firstWeekStartThisYear) < 0) { |
| // if given date is before this years first week, then it belongs to the 53rd week of last year |
| return '53'; |
| } |
| |
| if (compareByDay(firstWeekStartNextYear, endDate) <= 0) { |
| // if given date is after next years first week, then it belongs to the 01th week of next year |
| return '01'; |
| } |
| |
| // given date is in between CW 01..53 of this calendar year |
| var daysDifference; |
| if (firstWeekStartThisYear.getFullYear() < date.tm_year+1900) { |
| // first CW of this year starts last year |
| daysDifference = date.tm_yday+32-firstWeekStartThisYear.getDate() |
| } else { |
| // first CW of this year starts this year |
| daysDifference = date.tm_yday+1-firstWeekStartThisYear.getDate(); |
| } |
| return leadingNulls(Math.ceil(daysDifference/7), 2); |
| }, |
| '%w': function(date) { |
| var day = new Date(date.tm_year+1900, date.tm_mon+1, date.tm_mday, 0, 0, 0, 0); |
| return day.getDay(); |
| }, |
| '%W': function(date) { |
| // Replaced by the week number of the year as a decimal number [00,53]. |
| // The first Monday of January is the first day of week 1; |
| // days in the new year before this are in week 0. [ tm_year, tm_wday, tm_yday] |
| var janFirst = new Date(date.tm_year, 0, 1); |
| var firstMonday = janFirst.getDay() === 1 ? janFirst : __addDays(janFirst, janFirst.getDay() === 0 ? 1 : 7-janFirst.getDay()+1); |
| var endDate = new Date(date.tm_year+1900, date.tm_mon, date.tm_mday); |
| |
| // is target date after the first Monday? |
| if (compareByDay(firstMonday, endDate) < 0) { |
| var februaryFirstUntilEndMonth = __arraySum(__isLeapYear(endDate.getFullYear()) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, endDate.getMonth()-1)-31; |
| var firstMondayUntilEndJanuary = 31-firstMonday.getDate(); |
| var days = firstMondayUntilEndJanuary+februaryFirstUntilEndMonth+endDate.getDate(); |
| return leadingNulls(Math.ceil(days/7), 2); |
| } |
| return compareByDay(firstMonday, janFirst) === 0 ? '01': '00'; |
| }, |
| '%y': function(date) { |
| // Replaced by the last two digits of the year as a decimal number [00,99]. [ tm_year] |
| return (date.tm_year+1900).toString().substring(2); |
| }, |
| '%Y': function(date) { |
| // Replaced by the year as a decimal number (for example, 1997). [ tm_year] |
| return date.tm_year+1900; |
| }, |
| '%z': function(date) { |
| // Replaced by the offset from UTC in the ISO 8601:2000 standard format ( +hhmm or -hhmm ). |
| // For example, "-0430" means 4 hours 30 minutes behind UTC (west of Greenwich). |
| var off = date.tm_gmtoff; |
| var ahead = off >= 0; |
| off = Math.abs(off) / 60; |
| // convert from minutes into hhmm format (which means 60 minutes = 100 units) |
| off = (off / 60)*100 + (off % 60); |
| return (ahead ? '+' : '-') + String("0000" + off).slice(-4); |
| }, |
| '%Z': function(date) { |
| return date.tm_zone; |
| }, |
| '%%': function() { |
| return '%'; |
| } |
| }; |
| for (var rule in EXPANSION_RULES_2) { |
| if (pattern.indexOf(rule) >= 0) { |
| pattern = pattern.replace(new RegExp(rule, 'g'), EXPANSION_RULES_2[rule](date)); |
| } |
| } |
| |
| var bytes = intArrayFromString(pattern, false); |
| if (bytes.length > maxsize) { |
| return 0; |
| } |
| |
| writeArrayToMemory(bytes, s); |
| return bytes.length-1; |
| }function _strftime_l(s, maxsize, format, tm) { |
| return _strftime(s, maxsize, format, tm); // no locale support yet |
| } |
| |
| function _abort() { |
| Module['abort'](); |
| } |
| |
| function _pthread_once(ptr, func) { |
| if (!_pthread_once.seen) _pthread_once.seen = {}; |
| if (ptr in _pthread_once.seen) return; |
| Module['dynCall_v'](func); |
| _pthread_once.seen[ptr] = 1; |
| } |
| |
| function ___lock() {} |
| |
| function ___unlock() {} |
| |
| |
| var PTHREAD_SPECIFIC={};function _pthread_getspecific(key) { |
| return PTHREAD_SPECIFIC[key] || 0; |
| } |
| |
| |
| var PTHREAD_SPECIFIC_NEXT_KEY=1; |
| |
| var ERRNO_CODES={EPERM:1,ENOENT:2,ESRCH:3,EINTR:4,EIO:5,ENXIO:6,E2BIG:7,ENOEXEC:8,EBADF:9,ECHILD:10,EAGAIN:11,EWOULDBLOCK:11,ENOMEM:12,EACCES:13,EFAULT:14,ENOTBLK:15,EBUSY:16,EEXIST:17,EXDEV:18,ENODEV:19,ENOTDIR:20,EISDIR:21,EINVAL:22,ENFILE:23,EMFILE:24,ENOTTY:25,ETXTBSY:26,EFBIG:27,ENOSPC:28,ESPIPE:29,EROFS:30,EMLINK:31,EPIPE:32,EDOM:33,ERANGE:34,ENOMSG:42,EIDRM:43,ECHRNG:44,EL2NSYNC:45,EL3HLT:46,EL3RST:47,ELNRNG:48,EUNATCH:49,ENOCSI:50,EL2HLT:51,EDEADLK:35,ENOLCK:37,EBADE:52,EBADR:53,EXFULL:54,ENOANO:55,EBADRQC:56,EBADSLT:57,EDEADLOCK:35,EBFONT:59,ENOSTR:60,ENODATA:61,ETIME:62,ENOSR:63,ENONET:64,ENOPKG:65,EREMOTE:66,ENOLINK:67,EADV:68,ESRMNT:69,ECOMM:70,EPROTO:71,EMULTIHOP:72,EDOTDOT:73,EBADMSG:74,ENOTUNIQ:76,EBADFD:77,EREMCHG:78,ELIBACC:79,ELIBBAD:80,ELIBSCN:81,ELIBMAX:82,ELIBEXEC:83,ENOSYS:38,ENOTEMPTY:39,ENAMETOOLONG:36,ELOOP:40,EOPNOTSUPP:95,EPFNOSUPPORT:96,ECONNRESET:104,ENOBUFS:105,EAFNOSUPPORT:97,EPROTOTYPE:91,ENOTSOCK:88,ENOPROTOOPT:92,ESHUTDOWN:108,ECONNREFUSED:111,EADDRINUSE:98,ECONNABORTED:103,ENETUNREACH:101,ENETDOWN:100,ETIMEDOUT:110,EHOSTDOWN:112,EHOSTUNREACH:113,EINPROGRESS:115,EALREADY:114,EDESTADDRREQ:89,EMSGSIZE:90,EPROTONOSUPPORT:93,ESOCKTNOSUPPORT:94,EADDRNOTAVAIL:99,ENETRESET:102,EISCONN:106,ENOTCONN:107,ETOOMANYREFS:109,EUSERS:87,EDQUOT:122,ESTALE:116,ENOTSUP:95,ENOMEDIUM:123,EILSEQ:84,EOVERFLOW:75,ECANCELED:125,ENOTRECOVERABLE:131,EOWNERDEAD:130,ESTRPIPE:86};function _pthread_key_create(key, destructor) { |
| if (key == 0) { |
| return ERRNO_CODES.EINVAL; |
| } |
| HEAP32[((key)>>2)]=PTHREAD_SPECIFIC_NEXT_KEY; |
| // values start at 0 |
| PTHREAD_SPECIFIC[PTHREAD_SPECIFIC_NEXT_KEY] = 0; |
| PTHREAD_SPECIFIC_NEXT_KEY++; |
| return 0; |
| } |
| |
| function _pthread_setspecific(key, value) { |
| if (!(key in PTHREAD_SPECIFIC)) { |
| return ERRNO_CODES.EINVAL; |
| } |
| PTHREAD_SPECIFIC[key] = value; |
| return 0; |
| } |
| |
| |
| function _malloc(bytes) { |
| /* Over-allocate to make sure it is byte-aligned by 8. |
| * This will leak memory, but this is only the dummy |
| * implementation (replaced by dlmalloc normally) so |
| * not an issue. |
| */ |
| var ptr = Runtime.dynamicAlloc(bytes + 8); |
| return (ptr+8) & 0xFFFFFFF8; |
| } |
| Module["_malloc"] = _malloc;function ___cxa_allocate_exception(size) { |
| return _malloc(size); |
| } |
| |
| |
| |
| |
| var ERRNO_MESSAGES={0:"Success",1:"Not super-user",2:"No such file or directory",3:"No such process",4:"Interrupted system call",5:"I/O error",6:"No such device or address",7:"Arg list too long",8:"Exec format error",9:"Bad file number",10:"No children",11:"No more processes",12:"Not enough core",13:"Permission denied",14:"Bad address",15:"Block device required",16:"Mount device busy",17:"File exists",18:"Cross-device link",19:"No such device",20:"Not a directory",21:"Is a directory",22:"Invalid argument",23:"Too many open files in system",24:"Too many open files",25:"Not a typewriter",26:"Text file busy",27:"File too large",28:"No space left on device",29:"Illegal seek",30:"Read only file system",31:"Too many links",32:"Broken pipe",33:"Math arg out of domain of func",34:"Math result not representable",35:"File locking deadlock error",36:"File or path name too long",37:"No record locks available",38:"Function not implemented",39:"Directory not empty",40:"Too many symbolic links",42:"No message of desired type",43:"Identifier removed",44:"Channel number out of range",45:"Level 2 not synchronized",46:"Level 3 halted",47:"Level 3 reset",48:"Link number out of range",49:"Protocol driver not attached",50:"No CSI structure available",51:"Level 2 halted",52:"Invalid exchange",53:"Invalid request descriptor",54:"Exchange full",55:"No anode",56:"Invalid request code",57:"Invalid slot",59:"Bad font file fmt",60:"Device not a stream",61:"No data (for no delay io)",62:"Timer expired",63:"Out of streams resources",64:"Machine is not on the network",65:"Package not installed",66:"The object is remote",67:"The link has been severed",68:"Advertise error",69:"Srmount error",70:"Communication error on send",71:"Protocol error",72:"Multihop attempted",73:"Cross mount point (not really error)",74:"Trying to read unreadable message",75:"Value too large for defined data type",76:"Given log. name not unique",77:"f.d. invalid for this operation",78:"Remote address changed",79:"Can access a needed shared lib",80:"Accessing a corrupted shared lib",81:".lib section in a.out corrupted",82:"Attempting to link in too many libs",83:"Attempting to exec a shared library",84:"Illegal byte sequence",86:"Streams pipe error",87:"Too many users",88:"Socket operation on non-socket",89:"Destination address required",90:"Message too long",91:"Protocol wrong type for socket",92:"Protocol not available",93:"Unknown protocol",94:"Socket type not supported",95:"Not supported",96:"Protocol family not supported",97:"Address family not supported by protocol family",98:"Address already in use",99:"Address not available",100:"Network interface is not configured",101:"Network is unreachable",102:"Connection reset by network",103:"Connection aborted",104:"Connection reset by peer",105:"No buffer space available",106:"Socket is already connected",107:"Socket is not connected",108:"Can't send after socket shutdown",109:"Too many references",110:"Connection timed out",111:"Connection refused",112:"Host is down",113:"Host is unreachable",114:"Socket already connected",115:"Connection already in progress",116:"Stale file handle",122:"Quota exceeded",123:"No medium (in tape drive)",125:"Operation canceled",130:"Previous owner died",131:"State not recoverable"}; |
| |
| function ___setErrNo(value) { |
| if (Module['___errno_location']) HEAP32[((Module['___errno_location']())>>2)]=value; |
| return value; |
| } |
| |
| var PATH={splitPath:function (filename) { |
| var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/; |
| return splitPathRe.exec(filename).slice(1); |
| },normalizeArray:function (parts, allowAboveRoot) { |
| // if the path tries to go above the root, `up` ends up > 0 |
| var up = 0; |
| for (var i = parts.length - 1; i >= 0; i--) { |
| var last = parts[i]; |
| if (last === '.') { |
| parts.splice(i, 1); |
| } else if (last === '..') { |
| parts.splice(i, 1); |
| up++; |
| } else if (up) { |
| parts.splice(i, 1); |
| up--; |
| } |
| } |
| // if the path is allowed to go above the root, restore leading ..s |
| if (allowAboveRoot) { |
| for (; up--; up) { |
| parts.unshift('..'); |
| } |
| } |
| return parts; |
| },normalize:function (path) { |
| var isAbsolute = path.charAt(0) === '/', |
| trailingSlash = path.substr(-1) === '/'; |
| // Normalize the path |
| path = PATH.normalizeArray(path.split('/').filter(function(p) { |
| return !!p; |
| }), !isAbsolute).join('/'); |
| if (!path && !isAbsolute) { |
| path = '.'; |
| } |
| if (path && trailingSlash) { |
| path += '/'; |
| } |
| return (isAbsolute ? '/' : '') + path; |
| },dirname:function (path) { |
| var result = PATH.splitPath(path), |
| root = result[0], |
| dir = result[1]; |
| if (!root && !dir) { |
| // No dirname whatsoever |
| return '.'; |
| } |
| if (dir) { |
| // It has a dirname, strip trailing slash |
| dir = dir.substr(0, dir.length - 1); |
| } |
| return root + dir; |
| },basename:function (path) { |
| // EMSCRIPTEN return '/'' for '/', not an empty string |
| if (path === '/') return '/'; |
| var lastSlash = path.lastIndexOf('/'); |
| if (lastSlash === -1) return path; |
| return path.substr(lastSlash+1); |
| },extname:function (path) { |
| return PATH.splitPath(path)[3]; |
| },join:function () { |
| var paths = Array.prototype.slice.call(arguments, 0); |
| return PATH.normalize(paths.join('/')); |
| },join2:function (l, r) { |
| return PATH.normalize(l + '/' + r); |
| },resolve:function () { |
| var resolvedPath = '', |
| resolvedAbsolute = false; |
| for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) { |
| var path = (i >= 0) ? arguments[i] : FS.cwd(); |
| // Skip empty and invalid entries |
| if (typeof path !== 'string') { |
| throw new TypeError('Arguments to path.resolve must be strings'); |
| } else if (!path) { |
| return ''; // an invalid portion invalidates the whole thing |
| } |
| resolvedPath = path + '/' + resolvedPath; |
| resolvedAbsolute = path.charAt(0) === '/'; |
| } |
| // At this point the path should be resolved to a full absolute path, but |
| // handle relative paths to be safe (might happen when process.cwd() fails) |
| resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter(function(p) { |
| return !!p; |
| }), !resolvedAbsolute).join('/'); |
| return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.'; |
| },relative:function (from, to) { |
| from = PATH.resolve(from).substr(1); |
| to = PATH.resolve(to).substr(1); |
| function trim(arr) { |
| var start = 0; |
| for (; start < arr.length; start++) { |
| if (arr[start] !== '') break; |
| } |
| var end = arr.length - 1; |
| for (; end >= 0; end--) { |
| if (arr[end] !== '') break; |
| } |
| if (start > end) return []; |
| return arr.slice(start, end - start + 1); |
| } |
| var fromParts = trim(from.split('/')); |
| var toParts = trim(to.split('/')); |
| var length = Math.min(fromParts.length, toParts.length); |
| var samePartsLength = length; |
| for (var i = 0; i < length; i++) { |
| if (fromParts[i] !== toParts[i]) { |
| samePartsLength = i; |
| break; |
| } |
| } |
| var outputParts = []; |
| for (var i = samePartsLength; i < fromParts.length; i++) { |
| outputParts.push('..'); |
| } |
| outputParts = outputParts.concat(toParts.slice(samePartsLength)); |
| return outputParts.join('/'); |
| }}; |
| |
| var TTY={ttys:[],init:function () { |
| // https://github.com/kripken/emscripten/pull/1555 |
| // if (ENVIRONMENT_IS_NODE) { |
| // // currently, FS.init does not distinguish if process.stdin is a file or TTY |
| // // device, it always assumes it's a TTY device. because of this, we're forcing |
| // // process.stdin to UTF8 encoding to at least make stdin reading compatible |
| // // with text files until FS.init can be refactored. |
| // process['stdin']['setEncoding']('utf8'); |
| // } |
| },shutdown:function () { |
| // https://github.com/kripken/emscripten/pull/1555 |
| // if (ENVIRONMENT_IS_NODE) { |
| // // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)? |
| // // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation |
| // // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists? |
| // // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle |
| // // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call |
| // process['stdin']['pause'](); |
| // } |
| },register:function (dev, ops) { |
| TTY.ttys[dev] = { input: [], output: [], ops: ops }; |
| FS.registerDevice(dev, TTY.stream_ops); |
| },stream_ops:{open:function (stream) { |
| var tty = TTY.ttys[stream.node.rdev]; |
| if (!tty) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENODEV); |
| } |
| stream.tty = tty; |
| stream.seekable = false; |
| },close:function (stream) { |
| // flush any pending line data |
| stream.tty.ops.flush(stream.tty); |
| },flush:function (stream) { |
| stream.tty.ops.flush(stream.tty); |
| },read:function (stream, buffer, offset, length, pos /* ignored */) { |
| if (!stream.tty || !stream.tty.ops.get_char) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENXIO); |
| } |
| var bytesRead = 0; |
| for (var i = 0; i < length; i++) { |
| var result; |
| try { |
| result = stream.tty.ops.get_char(stream.tty); |
| } catch (e) { |
| throw new FS.ErrnoError(ERRNO_CODES.EIO); |
| } |
| if (result === undefined && bytesRead === 0) { |
| throw new FS.ErrnoError(ERRNO_CODES.EAGAIN); |
| } |
| if (result === null || result === undefined) break; |
| bytesRead++; |
| buffer[offset+i] = result; |
| } |
| if (bytesRead) { |
| stream.node.timestamp = Date.now(); |
| } |
| return bytesRead; |
| },write:function (stream, buffer, offset, length, pos) { |
| if (!stream.tty || !stream.tty.ops.put_char) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENXIO); |
| } |
| for (var i = 0; i < length; i++) { |
| try { |
| stream.tty.ops.put_char(stream.tty, buffer[offset+i]); |
| } catch (e) { |
| throw new FS.ErrnoError(ERRNO_CODES.EIO); |
| } |
| } |
| if (length) { |
| stream.node.timestamp = Date.now(); |
| } |
| return i; |
| }},default_tty_ops:{get_char:function (tty) { |
| if (!tty.input.length) { |
| var result = null; |
| if (ENVIRONMENT_IS_NODE) { |
| // we will read data by chunks of BUFSIZE |
| var BUFSIZE = 256; |
| var buf = new Buffer(BUFSIZE); |
| var bytesRead = 0; |
| |
| var isPosixPlatform = (process.platform != 'win32'); // Node doesn't offer a direct check, so test by exclusion |
| |
| var fd = process.stdin.fd; |
| if (isPosixPlatform) { |
| // Linux and Mac cannot use process.stdin.fd (which isn't set up as sync) |
| var usingDevice = false; |
| try { |
| fd = fs.openSync('/dev/stdin', 'r'); |
| usingDevice = true; |
| } catch (e) {} |
| } |
| |
| try { |
| bytesRead = fs.readSync(fd, buf, 0, BUFSIZE, null); |
| } catch(e) { |
| // Cross-platform differences: on Windows, reading EOF throws an exception, but on other OSes, |
| // reading EOF returns 0. Uniformize behavior by treating the EOF exception to return 0. |
| if (e.toString().indexOf('EOF') != -1) bytesRead = 0; |
| else throw e; |
| } |
| |
| if (usingDevice) { fs.closeSync(fd); } |
| if (bytesRead > 0) { |
| result = buf.slice(0, bytesRead).toString('utf-8'); |
| } else { |
| result = null; |
| } |
| |
| } else if (typeof window != 'undefined' && |
| typeof window.prompt == 'function') { |
| // Browser. |
| result = window.prompt('Input: '); // returns null on cancel |
| if (result !== null) { |
| result += '\n'; |
| } |
| } else if (typeof readline == 'function') { |
| // Command line. |
| result = readline(); |
| if (result !== null) { |
| result += '\n'; |
| } |
| } |
| if (!result) { |
| return null; |
| } |
| tty.input = intArrayFromString(result, true); |
| } |
| return tty.input.shift(); |
| },put_char:function (tty, val) { |
| if (val === null || val === 10) { |
| Module['print'](UTF8ArrayToString(tty.output, 0)); |
| tty.output = []; |
| } else { |
| if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle. |
| } |
| },flush:function (tty) { |
| if (tty.output && tty.output.length > 0) { |
| Module['print'](UTF8ArrayToString(tty.output, 0)); |
| tty.output = []; |
| } |
| }},default_tty1_ops:{put_char:function (tty, val) { |
| if (val === null || val === 10) { |
| Module['printErr'](UTF8ArrayToString(tty.output, 0)); |
| tty.output = []; |
| } else { |
| if (val != 0) tty.output.push(val); |
| } |
| },flush:function (tty) { |
| if (tty.output && tty.output.length > 0) { |
| Module['printErr'](UTF8ArrayToString(tty.output, 0)); |
| tty.output = []; |
| } |
| }}}; |
| |
| var MEMFS={ops_table:null,mount:function (mount) { |
| return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0); |
| },createNode:function (parent, name, mode, dev) { |
| if (FS.isBlkdev(mode) || FS.isFIFO(mode)) { |
| // no supported |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| } |
| if (!MEMFS.ops_table) { |
| MEMFS.ops_table = { |
| dir: { |
| node: { |
| getattr: MEMFS.node_ops.getattr, |
| setattr: MEMFS.node_ops.setattr, |
| lookup: MEMFS.node_ops.lookup, |
| mknod: MEMFS.node_ops.mknod, |
| rename: MEMFS.node_ops.rename, |
| unlink: MEMFS.node_ops.unlink, |
| rmdir: MEMFS.node_ops.rmdir, |
| readdir: MEMFS.node_ops.readdir, |
| symlink: MEMFS.node_ops.symlink |
| }, |
| stream: { |
| llseek: MEMFS.stream_ops.llseek |
| } |
| }, |
| file: { |
| node: { |
| getattr: MEMFS.node_ops.getattr, |
| setattr: MEMFS.node_ops.setattr |
| }, |
| stream: { |
| llseek: MEMFS.stream_ops.llseek, |
| read: MEMFS.stream_ops.read, |
| write: MEMFS.stream_ops.write, |
| allocate: MEMFS.stream_ops.allocate, |
| mmap: MEMFS.stream_ops.mmap, |
| msync: MEMFS.stream_ops.msync |
| } |
| }, |
| link: { |
| node: { |
| getattr: MEMFS.node_ops.getattr, |
| setattr: MEMFS.node_ops.setattr, |
| readlink: MEMFS.node_ops.readlink |
| }, |
| stream: {} |
| }, |
| chrdev: { |
| node: { |
| getattr: MEMFS.node_ops.getattr, |
| setattr: MEMFS.node_ops.setattr |
| }, |
| stream: FS.chrdev_stream_ops |
| } |
| }; |
| } |
| var node = FS.createNode(parent, name, mode, dev); |
| if (FS.isDir(node.mode)) { |
| node.node_ops = MEMFS.ops_table.dir.node; |
| node.stream_ops = MEMFS.ops_table.dir.stream; |
| node.contents = {}; |
| } else if (FS.isFile(node.mode)) { |
| node.node_ops = MEMFS.ops_table.file.node; |
| node.stream_ops = MEMFS.ops_table.file.stream; |
| node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.length which gives the whole capacity. |
| // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred |
| // for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size |
| // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme. |
| node.contents = null; |
| } else if (FS.isLink(node.mode)) { |
| node.node_ops = MEMFS.ops_table.link.node; |
| node.stream_ops = MEMFS.ops_table.link.stream; |
| } else if (FS.isChrdev(node.mode)) { |
| node.node_ops = MEMFS.ops_table.chrdev.node; |
| node.stream_ops = MEMFS.ops_table.chrdev.stream; |
| } |
| node.timestamp = Date.now(); |
| // add the new node to the parent |
| if (parent) { |
| parent.contents[name] = node; |
| } |
| return node; |
| },getFileDataAsRegularArray:function (node) { |
| if (node.contents && node.contents.subarray) { |
| var arr = []; |
| for (var i = 0; i < node.usedBytes; ++i) arr.push(node.contents[i]); |
| return arr; // Returns a copy of the original data. |
| } |
| return node.contents; // No-op, the file contents are already in a JS array. Return as-is. |
| },getFileDataAsTypedArray:function (node) { |
| if (!node.contents) return new Uint8Array; |
| if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes. |
| return new Uint8Array(node.contents); |
| },expandFileStorage:function (node, newCapacity) { |
| // If we are asked to expand the size of a file that already exists, revert to using a standard JS array to store the file |
| // instead of a typed array. This makes resizing the array more flexible because we can just .push() elements at the back to |
| // increase the size. |
| if (node.contents && node.contents.subarray && newCapacity > node.contents.length) { |
| node.contents = MEMFS.getFileDataAsRegularArray(node); |
| node.usedBytes = node.contents.length; // We might be writing to a lazy-loaded file which had overridden this property, so force-reset it. |
| } |
| |
| if (!node.contents || node.contents.subarray) { // Keep using a typed array if creating a new storage, or if old one was a typed array as well. |
| var prevCapacity = node.contents ? node.contents.length : 0; |
| if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough. |
| // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity. |
| // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to |
| // avoid overshooting the allocation cap by a very large margin. |
| var CAPACITY_DOUBLING_MAX = 1024 * 1024; |
| newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) | 0); |
| if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding. |
| var oldContents = node.contents; |
| node.contents = new Uint8Array(newCapacity); // Allocate new storage. |
| if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage. |
| return; |
| } |
| // Not using a typed array to back the file storage. Use a standard JS array instead. |
| if (!node.contents && newCapacity > 0) node.contents = []; |
| while (node.contents.length < newCapacity) node.contents.push(0); |
| },resizeFileStorage:function (node, newSize) { |
| if (node.usedBytes == newSize) return; |
| if (newSize == 0) { |
| node.contents = null; // Fully decommit when requesting a resize to zero. |
| node.usedBytes = 0; |
| return; |
| } |
| if (!node.contents || node.contents.subarray) { // Resize a typed array if that is being used as the backing store. |
| var oldContents = node.contents; |
| node.contents = new Uint8Array(new ArrayBuffer(newSize)); // Allocate new storage. |
| if (oldContents) { |
| node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage. |
| } |
| node.usedBytes = newSize; |
| return; |
| } |
| // Backing with a JS array. |
| if (!node.contents) node.contents = []; |
| if (node.contents.length > newSize) node.contents.length = newSize; |
| else while (node.contents.length < newSize) node.contents.push(0); |
| node.usedBytes = newSize; |
| },node_ops:{getattr:function (node) { |
| var attr = {}; |
| // device numbers reuse inode numbers. |
| attr.dev = FS.isChrdev(node.mode) ? node.id : 1; |
| attr.ino = node.id; |
| attr.mode = node.mode; |
| attr.nlink = 1; |
| attr.uid = 0; |
| attr.gid = 0; |
| attr.rdev = node.rdev; |
| if (FS.isDir(node.mode)) { |
| attr.size = 4096; |
| } else if (FS.isFile(node.mode)) { |
| attr.size = node.usedBytes; |
| } else if (FS.isLink(node.mode)) { |
| attr.size = node.link.length; |
| } else { |
| attr.size = 0; |
| } |
| attr.atime = new Date(node.timestamp); |
| attr.mtime = new Date(node.timestamp); |
| attr.ctime = new Date(node.timestamp); |
| // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize), |
| // but this is not required by the standard. |
| attr.blksize = 4096; |
| attr.blocks = Math.ceil(attr.size / attr.blksize); |
| return attr; |
| },setattr:function (node, attr) { |
| if (attr.mode !== undefined) { |
| node.mode = attr.mode; |
| } |
| if (attr.timestamp !== undefined) { |
| node.timestamp = attr.timestamp; |
| } |
| if (attr.size !== undefined) { |
| MEMFS.resizeFileStorage(node, attr.size); |
| } |
| },lookup:function (parent, name) { |
| throw FS.genericErrors[ERRNO_CODES.ENOENT]; |
| },mknod:function (parent, name, mode, dev) { |
| return MEMFS.createNode(parent, name, mode, dev); |
| },rename:function (old_node, new_dir, new_name) { |
| // if we're overwriting a directory at new_name, make sure it's empty. |
| if (FS.isDir(old_node.mode)) { |
| var new_node; |
| try { |
| new_node = FS.lookupNode(new_dir, new_name); |
| } catch (e) { |
| } |
| if (new_node) { |
| for (var i in new_node.contents) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY); |
| } |
| } |
| } |
| // do the internal rewiring |
| delete old_node.parent.contents[old_node.name]; |
| old_node.name = new_name; |
| new_dir.contents[new_name] = old_node; |
| old_node.parent = new_dir; |
| },unlink:function (parent, name) { |
| delete parent.contents[name]; |
| },rmdir:function (parent, name) { |
| var node = FS.lookupNode(parent, name); |
| for (var i in node.contents) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY); |
| } |
| delete parent.contents[name]; |
| },readdir:function (node) { |
| var entries = ['.', '..'] |
| for (var key in node.contents) { |
| if (!node.contents.hasOwnProperty(key)) { |
| continue; |
| } |
| entries.push(key); |
| } |
| return entries; |
| },symlink:function (parent, newname, oldpath) { |
| var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0); |
| node.link = oldpath; |
| return node; |
| },readlink:function (node) { |
| if (!FS.isLink(node.mode)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| return node.link; |
| }},stream_ops:{read:function (stream, buffer, offset, length, position) { |
| var contents = stream.node.contents; |
| if (position >= stream.node.usedBytes) return 0; |
| var size = Math.min(stream.node.usedBytes - position, length); |
| assert(size >= 0); |
| if (size > 8 && contents.subarray) { // non-trivial, and typed array |
| buffer.set(contents.subarray(position, position + size), offset); |
| } else { |
| for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i]; |
| } |
| return size; |
| },write:function (stream, buffer, offset, length, position, canOwn) { |
| if (!length) return 0; |
| var node = stream.node; |
| node.timestamp = Date.now(); |
| |
| if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array? |
| if (canOwn) { |
| node.contents = buffer.subarray(offset, offset + length); |
| node.usedBytes = length; |
| return length; |
| } else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data. |
| node.contents = new Uint8Array(buffer.subarray(offset, offset + length)); |
| node.usedBytes = length; |
| return length; |
| } else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file? |
| node.contents.set(buffer.subarray(offset, offset + length), position); |
| return length; |
| } |
| } |
| |
| // Appending to an existing file and we need to reallocate, or source data did not come as a typed array. |
| MEMFS.expandFileStorage(node, position+length); |
| if (node.contents.subarray && buffer.subarray) node.contents.set(buffer.subarray(offset, offset + length), position); // Use typed array write if available. |
| else { |
| for (var i = 0; i < length; i++) { |
| node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not. |
| } |
| } |
| node.usedBytes = Math.max(node.usedBytes, position+length); |
| return length; |
| },llseek:function (stream, offset, whence) { |
| var position = offset; |
| if (whence === 1) { // SEEK_CUR. |
| position += stream.position; |
| } else if (whence === 2) { // SEEK_END. |
| if (FS.isFile(stream.node.mode)) { |
| position += stream.node.usedBytes; |
| } |
| } |
| if (position < 0) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| return position; |
| },allocate:function (stream, offset, length) { |
| MEMFS.expandFileStorage(stream.node, offset + length); |
| stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length); |
| },mmap:function (stream, buffer, offset, length, position, prot, flags) { |
| if (!FS.isFile(stream.node.mode)) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENODEV); |
| } |
| var ptr; |
| var allocated; |
| var contents = stream.node.contents; |
| // Only make a new copy when MAP_PRIVATE is specified. |
| if ( !(flags & 2) && |
| (contents.buffer === buffer || contents.buffer === buffer.buffer) ) { |
| // We can't emulate MAP_SHARED when the file is not backed by the buffer |
| // we're mapping to (e.g. the HEAP buffer). |
| allocated = false; |
| ptr = contents.byteOffset; |
| } else { |
| // Try to avoid unnecessary slices. |
| if (position > 0 || position + length < stream.node.usedBytes) { |
| if (contents.subarray) { |
| contents = contents.subarray(position, position + length); |
| } else { |
| contents = Array.prototype.slice.call(contents, position, position + length); |
| } |
| } |
| allocated = true; |
| ptr = _malloc(length); |
| if (!ptr) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOMEM); |
| } |
| buffer.set(contents, ptr); |
| } |
| return { ptr: ptr, allocated: allocated }; |
| },msync:function (stream, buffer, offset, length, mmapFlags) { |
| if (!FS.isFile(stream.node.mode)) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENODEV); |
| } |
| if (mmapFlags & 2) { |
| // MAP_PRIVATE calls need not to be synced back to underlying fs |
| return 0; |
| } |
| |
| var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false); |
| // should we check if bytesWritten and length are the same? |
| return 0; |
| }}}; |
| |
| var IDBFS={dbs:{},indexedDB:function () { |
| if (typeof indexedDB !== 'undefined') return indexedDB; |
| var ret = null; |
| if (typeof window === 'object') ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB; |
| assert(ret, 'IDBFS used, but indexedDB not supported'); |
| return ret; |
| },DB_VERSION:21,DB_STORE_NAME:"FILE_DATA",mount:function (mount) { |
| // reuse all of the core MEMFS functionality |
| return MEMFS.mount.apply(null, arguments); |
| },syncfs:function (mount, populate, callback) { |
| IDBFS.getLocalSet(mount, function(err, local) { |
| if (err) return callback(err); |
| |
| IDBFS.getRemoteSet(mount, function(err, remote) { |
| if (err) return callback(err); |
| |
| var src = populate ? remote : local; |
| var dst = populate ? local : remote; |
| |
| IDBFS.reconcile(src, dst, callback); |
| }); |
| }); |
| },getDB:function (name, callback) { |
| // check the cache first |
| var db = IDBFS.dbs[name]; |
| if (db) { |
| return callback(null, db); |
| } |
| |
| var req; |
| try { |
| req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION); |
| } catch (e) { |
| return callback(e); |
| } |
| if (!req) { |
| return callback("Unable to connect to IndexedDB"); |
| } |
| req.onupgradeneeded = function(e) { |
| var db = e.target.result; |
| var transaction = e.target.transaction; |
| |
| var fileStore; |
| |
| if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) { |
| fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME); |
| } else { |
| fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME); |
| } |
| |
| if (!fileStore.indexNames.contains('timestamp')) { |
| fileStore.createIndex('timestamp', 'timestamp', { unique: false }); |
| } |
| }; |
| req.onsuccess = function() { |
| db = req.result; |
| |
| // add to the cache |
| IDBFS.dbs[name] = db; |
| callback(null, db); |
| }; |
| req.onerror = function(e) { |
| callback(this.error); |
| e.preventDefault(); |
| }; |
| },getLocalSet:function (mount, callback) { |
| var entries = {}; |
| |
| function isRealDir(p) { |
| return p !== '.' && p !== '..'; |
| }; |
| function toAbsolute(root) { |
| return function(p) { |
| return PATH.join2(root, p); |
| } |
| }; |
| |
| var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint)); |
| |
| while (check.length) { |
| var path = check.pop(); |
| var stat; |
| |
| try { |
| stat = FS.stat(path); |
| } catch (e) { |
| return callback(e); |
| } |
| |
| if (FS.isDir(stat.mode)) { |
| check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path))); |
| } |
| |
| entries[path] = { timestamp: stat.mtime }; |
| } |
| |
| return callback(null, { type: 'local', entries: entries }); |
| },getRemoteSet:function (mount, callback) { |
| var entries = {}; |
| |
| IDBFS.getDB(mount.mountpoint, function(err, db) { |
| if (err) return callback(err); |
| |
| var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readonly'); |
| transaction.onerror = function(e) { |
| callback(this.error); |
| e.preventDefault(); |
| }; |
| |
| var store = transaction.objectStore(IDBFS.DB_STORE_NAME); |
| var index = store.index('timestamp'); |
| |
| index.openKeyCursor().onsuccess = function(event) { |
| var cursor = event.target.result; |
| |
| if (!cursor) { |
| return callback(null, { type: 'remote', db: db, entries: entries }); |
| } |
| |
| entries[cursor.primaryKey] = { timestamp: cursor.key }; |
| |
| cursor.continue(); |
| }; |
| }); |
| },loadLocalEntry:function (path, callback) { |
| var stat, node; |
| |
| try { |
| var lookup = FS.lookupPath(path); |
| node = lookup.node; |
| stat = FS.stat(path); |
| } catch (e) { |
| return callback(e); |
| } |
| |
| if (FS.isDir(stat.mode)) { |
| return callback(null, { timestamp: stat.mtime, mode: stat.mode }); |
| } else if (FS.isFile(stat.mode)) { |
| // Performance consideration: storing a normal JavaScript array to a IndexedDB is much slower than storing a typed array. |
| // Therefore always convert the file contents to a typed array first before writing the data to IndexedDB. |
| node.contents = MEMFS.getFileDataAsTypedArray(node); |
| return callback(null, { timestamp: stat.mtime, mode: stat.mode, contents: node.contents }); |
| } else { |
| return callback(new Error('node type not supported')); |
| } |
| },storeLocalEntry:function (path, entry, callback) { |
| try { |
| if (FS.isDir(entry.mode)) { |
| FS.mkdir(path, entry.mode); |
| } else if (FS.isFile(entry.mode)) { |
| FS.writeFile(path, entry.contents, { encoding: 'binary', canOwn: true }); |
| } else { |
| return callback(new Error('node type not supported')); |
| } |
| |
| FS.chmod(path, entry.mode); |
| FS.utime(path, entry.timestamp, entry.timestamp); |
| } catch (e) { |
| return callback(e); |
| } |
| |
| callback(null); |
| },removeLocalEntry:function (path, callback) { |
| try { |
| var lookup = FS.lookupPath(path); |
| var stat = FS.stat(path); |
| |
| if (FS.isDir(stat.mode)) { |
| FS.rmdir(path); |
| } else if (FS.isFile(stat.mode)) { |
| FS.unlink(path); |
| } |
| } catch (e) { |
| return callback(e); |
| } |
| |
| callback(null); |
| },loadRemoteEntry:function (store, path, callback) { |
| var req = store.get(path); |
| req.onsuccess = function(event) { callback(null, event.target.result); }; |
| req.onerror = function(e) { |
| callback(this.error); |
| e.preventDefault(); |
| }; |
| },storeRemoteEntry:function (store, path, entry, callback) { |
| var req = store.put(entry, path); |
| req.onsuccess = function() { callback(null); }; |
| req.onerror = function(e) { |
| callback(this.error); |
| e.preventDefault(); |
| }; |
| },removeRemoteEntry:function (store, path, callback) { |
| var req = store.delete(path); |
| req.onsuccess = function() { callback(null); }; |
| req.onerror = function(e) { |
| callback(this.error); |
| e.preventDefault(); |
| }; |
| },reconcile:function (src, dst, callback) { |
| var total = 0; |
| |
| var create = []; |
| Object.keys(src.entries).forEach(function (key) { |
| var e = src.entries[key]; |
| var e2 = dst.entries[key]; |
| if (!e2 || e.timestamp > e2.timestamp) { |
| create.push(key); |
| total++; |
| } |
| }); |
| |
| var remove = []; |
| Object.keys(dst.entries).forEach(function (key) { |
| var e = dst.entries[key]; |
| var e2 = src.entries[key]; |
| if (!e2) { |
| remove.push(key); |
| total++; |
| } |
| }); |
| |
| if (!total) { |
| return callback(null); |
| } |
| |
| var errored = false; |
| var completed = 0; |
| var db = src.type === 'remote' ? src.db : dst.db; |
| var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readwrite'); |
| var store = transaction.objectStore(IDBFS.DB_STORE_NAME); |
| |
| function done(err) { |
| if (err) { |
| if (!done.errored) { |
| done.errored = true; |
| return callback(err); |
| } |
| return; |
| } |
| if (++completed >= total) { |
| return callback(null); |
| } |
| }; |
| |
| transaction.onerror = function(e) { |
| done(this.error); |
| e.preventDefault(); |
| }; |
| |
| // sort paths in ascending order so directory entries are created |
| // before the files inside them |
| create.sort().forEach(function (path) { |
| if (dst.type === 'local') { |
| IDBFS.loadRemoteEntry(store, path, function (err, entry) { |
| if (err) return done(err); |
| IDBFS.storeLocalEntry(path, entry, done); |
| }); |
| } else { |
| IDBFS.loadLocalEntry(path, function (err, entry) { |
| if (err) return done(err); |
| IDBFS.storeRemoteEntry(store, path, entry, done); |
| }); |
| } |
| }); |
| |
| // sort paths in descending order so files are deleted before their |
| // parent directories |
| remove.sort().reverse().forEach(function(path) { |
| if (dst.type === 'local') { |
| IDBFS.removeLocalEntry(path, done); |
| } else { |
| IDBFS.removeRemoteEntry(store, path, done); |
| } |
| }); |
| }}; |
| |
| var NODEFS={isWindows:false,staticInit:function () { |
| NODEFS.isWindows = !!process.platform.match(/^win/); |
| },mount:function (mount) { |
| assert(ENVIRONMENT_IS_NODE); |
| return NODEFS.createNode(null, '/', NODEFS.getMode(mount.opts.root), 0); |
| },createNode:function (parent, name, mode, dev) { |
| if (!FS.isDir(mode) && !FS.isFile(mode) && !FS.isLink(mode)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| var node = FS.createNode(parent, name, mode); |
| node.node_ops = NODEFS.node_ops; |
| node.stream_ops = NODEFS.stream_ops; |
| return node; |
| },getMode:function (path) { |
| var stat; |
| try { |
| stat = fs.lstatSync(path); |
| if (NODEFS.isWindows) { |
| // On Windows, directories return permission bits 'rw-rw-rw-', even though they have 'rwxrwxrwx', so |
| // propagate write bits to execute bits. |
| stat.mode = stat.mode | ((stat.mode & 146) >> 1); |
| } |
| } catch (e) { |
| if (!e.code) throw e; |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| return stat.mode; |
| },realPath:function (node) { |
| var parts = []; |
| while (node.parent !== node) { |
| parts.push(node.name); |
| node = node.parent; |
| } |
| parts.push(node.mount.opts.root); |
| parts.reverse(); |
| return PATH.join.apply(null, parts); |
| },flagsToPermissionStringMap:{0:"r",1:"r+",2:"r+",64:"r",65:"r+",66:"r+",129:"rx+",193:"rx+",514:"w+",577:"w",578:"w+",705:"wx",706:"wx+",1024:"a",1025:"a",1026:"a+",1089:"a",1090:"a+",1153:"ax",1154:"ax+",1217:"ax",1218:"ax+",4096:"rs",4098:"rs+"},flagsToPermissionString:function (flags) { |
| flags &= ~0x200000 /*O_PATH*/; // Ignore this flag from musl, otherwise node.js fails to open the file. |
| flags &= ~0x800 /*O_NONBLOCK*/; // Ignore this flag from musl, otherwise node.js fails to open the file. |
| flags &= ~0x8000 /*O_LARGEFILE*/; // Ignore this flag from musl, otherwise node.js fails to open the file. |
| flags &= ~0x80000 /*O_CLOEXEC*/; // Some applications may pass it; it makes no sense for a single process. |
| if (flags in NODEFS.flagsToPermissionStringMap) { |
| return NODEFS.flagsToPermissionStringMap[flags]; |
| } else { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| },node_ops:{getattr:function (node) { |
| var path = NODEFS.realPath(node); |
| var stat; |
| try { |
| stat = fs.lstatSync(path); |
| } catch (e) { |
| if (!e.code) throw e; |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| // node.js v0.10.20 doesn't report blksize and blocks on Windows. Fake them with default blksize of 4096. |
| // See http://support.microsoft.com/kb/140365 |
| if (NODEFS.isWindows && !stat.blksize) { |
| stat.blksize = 4096; |
| } |
| if (NODEFS.isWindows && !stat.blocks) { |
| stat.blocks = (stat.size+stat.blksize-1)/stat.blksize|0; |
| } |
| return { |
| dev: stat.dev, |
| ino: stat.ino, |
| mode: stat.mode, |
| nlink: stat.nlink, |
| uid: stat.uid, |
| gid: stat.gid, |
| rdev: stat.rdev, |
| size: stat.size, |
| atime: stat.atime, |
| mtime: stat.mtime, |
| ctime: stat.ctime, |
| blksize: stat.blksize, |
| blocks: stat.blocks |
| }; |
| },setattr:function (node, attr) { |
| var path = NODEFS.realPath(node); |
| try { |
| if (attr.mode !== undefined) { |
| fs.chmodSync(path, attr.mode); |
| // update the common node structure mode as well |
| node.mode = attr.mode; |
| } |
| if (attr.timestamp !== undefined) { |
| var date = new Date(attr.timestamp); |
| fs.utimesSync(path, date, date); |
| } |
| if (attr.size !== undefined) { |
| fs.truncateSync(path, attr.size); |
| } |
| } catch (e) { |
| if (!e.code) throw e; |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| },lookup:function (parent, name) { |
| var path = PATH.join2(NODEFS.realPath(parent), name); |
| var mode = NODEFS.getMode(path); |
| return NODEFS.createNode(parent, name, mode); |
| },mknod:function (parent, name, mode, dev) { |
| var node = NODEFS.createNode(parent, name, mode, dev); |
| // create the backing node for this in the fs root as well |
| var path = NODEFS.realPath(node); |
| try { |
| if (FS.isDir(node.mode)) { |
| fs.mkdirSync(path, node.mode); |
| } else { |
| fs.writeFileSync(path, '', { mode: node.mode }); |
| } |
| } catch (e) { |
| if (!e.code) throw e; |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| return node; |
| },rename:function (oldNode, newDir, newName) { |
| var oldPath = NODEFS.realPath(oldNode); |
| var newPath = PATH.join2(NODEFS.realPath(newDir), newName); |
| try { |
| fs.renameSync(oldPath, newPath); |
| } catch (e) { |
| if (!e.code) throw e; |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| },unlink:function (parent, name) { |
| var path = PATH.join2(NODEFS.realPath(parent), name); |
| try { |
| fs.unlinkSync(path); |
| } catch (e) { |
| if (!e.code) throw e; |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| },rmdir:function (parent, name) { |
| var path = PATH.join2(NODEFS.realPath(parent), name); |
| try { |
| fs.rmdirSync(path); |
| } catch (e) { |
| if (!e.code) throw e; |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| },readdir:function (node) { |
| var path = NODEFS.realPath(node); |
| try { |
| return fs.readdirSync(path); |
| } catch (e) { |
| if (!e.code) throw e; |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| },symlink:function (parent, newName, oldPath) { |
| var newPath = PATH.join2(NODEFS.realPath(parent), newName); |
| try { |
| fs.symlinkSync(oldPath, newPath); |
| } catch (e) { |
| if (!e.code) throw e; |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| },readlink:function (node) { |
| var path = NODEFS.realPath(node); |
| try { |
| path = fs.readlinkSync(path); |
| path = NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root), path); |
| return path; |
| } catch (e) { |
| if (!e.code) throw e; |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| }},stream_ops:{open:function (stream) { |
| var path = NODEFS.realPath(stream.node); |
| try { |
| if (FS.isFile(stream.node.mode)) { |
| stream.nfd = fs.openSync(path, NODEFS.flagsToPermissionString(stream.flags)); |
| } |
| } catch (e) { |
| if (!e.code) throw e; |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| },close:function (stream) { |
| try { |
| if (FS.isFile(stream.node.mode) && stream.nfd) { |
| fs.closeSync(stream.nfd); |
| } |
| } catch (e) { |
| if (!e.code) throw e; |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| },read:function (stream, buffer, offset, length, position) { |
| if (length === 0) return 0; // node errors on 0 length reads |
| // FIXME this is terrible. |
| var nbuffer = new Buffer(length); |
| var res; |
| try { |
| res = fs.readSync(stream.nfd, nbuffer, 0, length, position); |
| } catch (e) { |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| if (res > 0) { |
| for (var i = 0; i < res; i++) { |
| buffer[offset + i] = nbuffer[i]; |
| } |
| } |
| return res; |
| },write:function (stream, buffer, offset, length, position) { |
| // FIXME this is terrible. |
| var nbuffer = new Buffer(buffer.subarray(offset, offset + length)); |
| var res; |
| try { |
| res = fs.writeSync(stream.nfd, nbuffer, 0, length, position); |
| } catch (e) { |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| return res; |
| },llseek:function (stream, offset, whence) { |
| var position = offset; |
| if (whence === 1) { // SEEK_CUR. |
| position += stream.position; |
| } else if (whence === 2) { // SEEK_END. |
| if (FS.isFile(stream.node.mode)) { |
| try { |
| var stat = fs.fstatSync(stream.nfd); |
| position += stat.size; |
| } catch (e) { |
| throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
| } |
| } |
| } |
| |
| if (position < 0) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| |
| return position; |
| }}}; |
| |
| var WORKERFS={DIR_MODE:16895,FILE_MODE:33279,reader:null,mount:function (mount) { |
| assert(ENVIRONMENT_IS_WORKER); |
| if (!WORKERFS.reader) WORKERFS.reader = new FileReaderSync(); |
| var root = WORKERFS.createNode(null, '/', WORKERFS.DIR_MODE, 0); |
| var createdParents = {}; |
| function ensureParent(path) { |
| // return the parent node, creating subdirs as necessary |
| var parts = path.split('/'); |
| var parent = root; |
| for (var i = 0; i < parts.length-1; i++) { |
| var curr = parts.slice(0, i+1).join('/'); |
| // Issue 4254: Using curr as a node name will prevent the node |
| // from being found in FS.nameTable when FS.open is called on |
| // a path which holds a child of this node, |
| // given that all FS functions assume node names |
| // are just their corresponding parts within their given path, |
| // rather than incremental aggregates which include their parent's |
| // directories. |
| if (!createdParents[curr]) { |
| createdParents[curr] = WORKERFS.createNode(parent, parts[i], WORKERFS.DIR_MODE, 0); |
| } |
| parent = createdParents[curr]; |
| } |
| return parent; |
| } |
| function base(path) { |
| var parts = path.split('/'); |
| return parts[parts.length-1]; |
| } |
| // We also accept FileList here, by using Array.prototype |
| Array.prototype.forEach.call(mount.opts["files"] || [], function(file) { |
| WORKERFS.createNode(ensureParent(file.name), base(file.name), WORKERFS.FILE_MODE, 0, file, file.lastModifiedDate); |
| }); |
| (mount.opts["blobs"] || []).forEach(function(obj) { |
| WORKERFS.createNode(ensureParent(obj["name"]), base(obj["name"]), WORKERFS.FILE_MODE, 0, obj["data"]); |
| }); |
| (mount.opts["packages"] || []).forEach(function(pack) { |
| pack['metadata'].files.forEach(function(file) { |
| var name = file.filename.substr(1); // remove initial slash |
| WORKERFS.createNode(ensureParent(name), base(name), WORKERFS.FILE_MODE, 0, pack['blob'].slice(file.start, file.end)); |
| }); |
| }); |
| return root; |
| },createNode:function (parent, name, mode, dev, contents, mtime) { |
| var node = FS.createNode(parent, name, mode); |
| node.mode = mode; |
| node.node_ops = WORKERFS.node_ops; |
| node.stream_ops = WORKERFS.stream_ops; |
| node.timestamp = (mtime || new Date).getTime(); |
| assert(WORKERFS.FILE_MODE !== WORKERFS.DIR_MODE); |
| if (mode === WORKERFS.FILE_MODE) { |
| node.size = contents.size; |
| node.contents = contents; |
| } else { |
| node.size = 4096; |
| node.contents = {}; |
| } |
| if (parent) { |
| parent.contents[name] = node; |
| } |
| return node; |
| },node_ops:{getattr:function (node) { |
| return { |
| dev: 1, |
| ino: undefined, |
| mode: node.mode, |
| nlink: 1, |
| uid: 0, |
| gid: 0, |
| rdev: undefined, |
| size: node.size, |
| atime: new Date(node.timestamp), |
| mtime: new Date(node.timestamp), |
| ctime: new Date(node.timestamp), |
| blksize: 4096, |
| blocks: Math.ceil(node.size / 4096), |
| }; |
| },setattr:function (node, attr) { |
| if (attr.mode !== undefined) { |
| node.mode = attr.mode; |
| } |
| if (attr.timestamp !== undefined) { |
| node.timestamp = attr.timestamp; |
| } |
| },lookup:function (parent, name) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
| },mknod:function (parent, name, mode, dev) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| },rename:function (oldNode, newDir, newName) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| },unlink:function (parent, name) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| },rmdir:function (parent, name) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| },readdir:function (node) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| },symlink:function (parent, newName, oldPath) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| },readlink:function (node) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| }},stream_ops:{read:function (stream, buffer, offset, length, position) { |
| if (position >= stream.node.size) return 0; |
| var chunk = stream.node.contents.slice(position, position + length); |
| var ab = WORKERFS.reader.readAsArrayBuffer(chunk); |
| buffer.set(new Uint8Array(ab), offset); |
| return chunk.size; |
| },write:function (stream, buffer, offset, length, position) { |
| throw new FS.ErrnoError(ERRNO_CODES.EIO); |
| },llseek:function (stream, offset, whence) { |
| var position = offset; |
| if (whence === 1) { // SEEK_CUR. |
| position += stream.position; |
| } else if (whence === 2) { // SEEK_END. |
| if (FS.isFile(stream.node.mode)) { |
| position += stream.node.size; |
| } |
| } |
| if (position < 0) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| return position; |
| }}}; |
| |
| var _stdin=STATICTOP; STATICTOP += 16;; |
| |
| var _stdout=STATICTOP; STATICTOP += 16;; |
| |
| var _stderr=STATICTOP; STATICTOP += 16;;var FS={root:null,mounts:[],devices:[null],streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,syncFSRequests:0,handleFSError:function (e) { |
| if (!(e instanceof FS.ErrnoError)) throw e + ' : ' + stackTrace(); |
| return ___setErrNo(e.errno); |
| },lookupPath:function (path, opts) { |
| path = PATH.resolve(FS.cwd(), path); |
| opts = opts || {}; |
| |
| if (!path) return { path: '', node: null }; |
| |
| var defaults = { |
| follow_mount: true, |
| recurse_count: 0 |
| }; |
| for (var key in defaults) { |
| if (opts[key] === undefined) { |
| opts[key] = defaults[key]; |
| } |
| } |
| |
| if (opts.recurse_count > 8) { // max recursive lookup of 8 |
| throw new FS.ErrnoError(ERRNO_CODES.ELOOP); |
| } |
| |
| // split the path |
| var parts = PATH.normalizeArray(path.split('/').filter(function(p) { |
| return !!p; |
| }), false); |
| |
| // start at the root |
| var current = FS.root; |
| var current_path = '/'; |
| |
| for (var i = 0; i < parts.length; i++) { |
| var islast = (i === parts.length-1); |
| if (islast && opts.parent) { |
| // stop resolving |
| break; |
| } |
| |
| current = FS.lookupNode(current, parts[i]); |
| current_path = PATH.join2(current_path, parts[i]); |
| |
| // jump to the mount's root node if this is a mountpoint |
| if (FS.isMountpoint(current)) { |
| if (!islast || (islast && opts.follow_mount)) { |
| current = current.mounted.root; |
| } |
| } |
| |
| // by default, lookupPath will not follow a symlink if it is the final path component. |
| // setting opts.follow = true will override this behavior. |
| if (!islast || opts.follow) { |
| var count = 0; |
| while (FS.isLink(current.mode)) { |
| var link = FS.readlink(current_path); |
| current_path = PATH.resolve(PATH.dirname(current_path), link); |
| |
| var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count }); |
| current = lookup.node; |
| |
| if (count++ > 40) { // limit max consecutive symlinks to 40 (SYMLOOP_MAX). |
| throw new FS.ErrnoError(ERRNO_CODES.ELOOP); |
| } |
| } |
| } |
| } |
| |
| return { path: current_path, node: current }; |
| },getPath:function (node) { |
| var path; |
| while (true) { |
| if (FS.isRoot(node)) { |
| var mount = node.mount.mountpoint; |
| if (!path) return mount; |
| return mount[mount.length-1] !== '/' ? mount + '/' + path : mount + path; |
| } |
| path = path ? node.name + '/' + path : node.name; |
| node = node.parent; |
| } |
| },hashName:function (parentid, name) { |
| var hash = 0; |
| |
| |
| for (var i = 0; i < name.length; i++) { |
| hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0; |
| } |
| return ((parentid + hash) >>> 0) % FS.nameTable.length; |
| },hashAddNode:function (node) { |
| var hash = FS.hashName(node.parent.id, node.name); |
| node.name_next = FS.nameTable[hash]; |
| FS.nameTable[hash] = node; |
| },hashRemoveNode:function (node) { |
| var hash = FS.hashName(node.parent.id, node.name); |
| if (FS.nameTable[hash] === node) { |
| FS.nameTable[hash] = node.name_next; |
| } else { |
| var current = FS.nameTable[hash]; |
| while (current) { |
| if (current.name_next === node) { |
| current.name_next = node.name_next; |
| break; |
| } |
| current = current.name_next; |
| } |
| } |
| },lookupNode:function (parent, name) { |
| var err = FS.mayLookup(parent); |
| if (err) { |
| throw new FS.ErrnoError(err, parent); |
| } |
| var hash = FS.hashName(parent.id, name); |
| for (var node = FS.nameTable[hash]; node; node = node.name_next) { |
| var nodeName = node.name; |
| if (node.parent.id === parent.id && nodeName === name) { |
| return node; |
| } |
| } |
| // if we failed to find it in the cache, call into the VFS |
| return FS.lookup(parent, name); |
| },createNode:function (parent, name, mode, rdev) { |
| if (!FS.FSNode) { |
| FS.FSNode = function(parent, name, mode, rdev) { |
| if (!parent) { |
| parent = this; // root node sets parent to itself |
| } |
| this.parent = parent; |
| this.mount = parent.mount; |
| this.mounted = null; |
| this.id = FS.nextInode++; |
| this.name = name; |
| this.mode = mode; |
| this.node_ops = {}; |
| this.stream_ops = {}; |
| this.rdev = rdev; |
| }; |
| |
| FS.FSNode.prototype = {}; |
| |
| // compatibility |
| var readMode = 292 | 73; |
| var writeMode = 146; |
| |
| // NOTE we must use Object.defineProperties instead of individual calls to |
| // Object.defineProperty in order to make closure compiler happy |
| Object.defineProperties(FS.FSNode.prototype, { |
| read: { |
| get: function() { return (this.mode & readMode) === readMode; }, |
| set: function(val) { val ? this.mode |= readMode : this.mode &= ~readMode; } |
| }, |
| write: { |
| get: function() { return (this.mode & writeMode) === writeMode; }, |
| set: function(val) { val ? this.mode |= writeMode : this.mode &= ~writeMode; } |
| }, |
| isFolder: { |
| get: function() { return FS.isDir(this.mode); } |
| }, |
| isDevice: { |
| get: function() { return FS.isChrdev(this.mode); } |
| } |
| }); |
| } |
| |
| var node = new FS.FSNode(parent, name, mode, rdev); |
| |
| FS.hashAddNode(node); |
| |
| return node; |
| },destroyNode:function (node) { |
| FS.hashRemoveNode(node); |
| },isRoot:function (node) { |
| return node === node.parent; |
| },isMountpoint:function (node) { |
| return !!node.mounted; |
| },isFile:function (mode) { |
| return (mode & 61440) === 32768; |
| },isDir:function (mode) { |
| return (mode & 61440) === 16384; |
| },isLink:function (mode) { |
| return (mode & 61440) === 40960; |
| },isChrdev:function (mode) { |
| return (mode & 61440) === 8192; |
| },isBlkdev:function (mode) { |
| return (mode & 61440) === 24576; |
| },isFIFO:function (mode) { |
| return (mode & 61440) === 4096; |
| },isSocket:function (mode) { |
| return (mode & 49152) === 49152; |
| },flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:function (str) { |
| var flags = FS.flagModes[str]; |
| if (typeof flags === 'undefined') { |
| throw new Error('Unknown file open mode: ' + str); |
| } |
| return flags; |
| },flagsToPermissionString:function (flag) { |
| var perms = ['r', 'w', 'rw'][flag & 3]; |
| if ((flag & 512)) { |
| perms += 'w'; |
| } |
| return perms; |
| },nodePermissions:function (node, perms) { |
| if (FS.ignorePermissions) { |
| return 0; |
| } |
| // return 0 if any user, group or owner bits are set. |
| if (perms.indexOf('r') !== -1 && !(node.mode & 292)) { |
| return ERRNO_CODES.EACCES; |
| } else if (perms.indexOf('w') !== -1 && !(node.mode & 146)) { |
| return ERRNO_CODES.EACCES; |
| } else if (perms.indexOf('x') !== -1 && !(node.mode & 73)) { |
| return ERRNO_CODES.EACCES; |
| } |
| return 0; |
| },mayLookup:function (dir) { |
| var err = FS.nodePermissions(dir, 'x'); |
| if (err) return err; |
| if (!dir.node_ops.lookup) return ERRNO_CODES.EACCES; |
| return 0; |
| },mayCreate:function (dir, name) { |
| try { |
| var node = FS.lookupNode(dir, name); |
| return ERRNO_CODES.EEXIST; |
| } catch (e) { |
| } |
| return FS.nodePermissions(dir, 'wx'); |
| },mayDelete:function (dir, name, isdir) { |
| var node; |
| try { |
| node = FS.lookupNode(dir, name); |
| } catch (e) { |
| return e.errno; |
| } |
| var err = FS.nodePermissions(dir, 'wx'); |
| if (err) { |
| return err; |
| } |
| if (isdir) { |
| if (!FS.isDir(node.mode)) { |
| return ERRNO_CODES.ENOTDIR; |
| } |
| if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) { |
| return ERRNO_CODES.EBUSY; |
| } |
| } else { |
| if (FS.isDir(node.mode)) { |
| return ERRNO_CODES.EISDIR; |
| } |
| } |
| return 0; |
| },mayOpen:function (node, flags) { |
| if (!node) { |
| return ERRNO_CODES.ENOENT; |
| } |
| if (FS.isLink(node.mode)) { |
| return ERRNO_CODES.ELOOP; |
| } else if (FS.isDir(node.mode)) { |
| if (FS.flagsToPermissionString(flags) !== 'r' || // opening for write |
| (flags & 512)) { // TODO: check for O_SEARCH? (== search for dir only) |
| return ERRNO_CODES.EISDIR; |
| } |
| } |
| return FS.nodePermissions(node, FS.flagsToPermissionString(flags)); |
| },MAX_OPEN_FDS:4096,nextfd:function (fd_start, fd_end) { |
| fd_start = fd_start || 0; |
| fd_end = fd_end || FS.MAX_OPEN_FDS; |
| for (var fd = fd_start; fd <= fd_end; fd++) { |
| if (!FS.streams[fd]) { |
| return fd; |
| } |
| } |
| throw new FS.ErrnoError(ERRNO_CODES.EMFILE); |
| },getStream:function (fd) { |
| return FS.streams[fd]; |
| },createStream:function (stream, fd_start, fd_end) { |
| if (!FS.FSStream) { |
| FS.FSStream = function(){}; |
| FS.FSStream.prototype = {}; |
| // compatibility |
| Object.defineProperties(FS.FSStream.prototype, { |
| object: { |
| get: function() { return this.node; }, |
| set: function(val) { this.node = val; } |
| }, |
| isRead: { |
| get: function() { return (this.flags & 2097155) !== 1; } |
| }, |
| isWrite: { |
| get: function() { return (this.flags & 2097155) !== 0; } |
| }, |
| isAppend: { |
| get: function() { return (this.flags & 1024); } |
| } |
| }); |
| } |
| // clone it, so we can return an instance of FSStream |
| var newStream = new FS.FSStream(); |
| for (var p in stream) { |
| newStream[p] = stream[p]; |
| } |
| stream = newStream; |
| var fd = FS.nextfd(fd_start, fd_end); |
| stream.fd = fd; |
| FS.streams[fd] = stream; |
| return stream; |
| },closeStream:function (fd) { |
| FS.streams[fd] = null; |
| },chrdev_stream_ops:{open:function (stream) { |
| var device = FS.getDevice(stream.node.rdev); |
| // override node's stream ops with the device's |
| stream.stream_ops = device.stream_ops; |
| // forward the open call |
| if (stream.stream_ops.open) { |
| stream.stream_ops.open(stream); |
| } |
| },llseek:function () { |
| throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); |
| }},major:function (dev) { |
| return ((dev) >> 8); |
| },minor:function (dev) { |
| return ((dev) & 0xff); |
| },makedev:function (ma, mi) { |
| return ((ma) << 8 | (mi)); |
| },registerDevice:function (dev, ops) { |
| FS.devices[dev] = { stream_ops: ops }; |
| },getDevice:function (dev) { |
| return FS.devices[dev]; |
| },getMounts:function (mount) { |
| var mounts = []; |
| var check = [mount]; |
| |
| while (check.length) { |
| var m = check.pop(); |
| |
| mounts.push(m); |
| |
| check.push.apply(check, m.mounts); |
| } |
| |
| return mounts; |
| },syncfs:function (populate, callback) { |
| if (typeof(populate) === 'function') { |
| callback = populate; |
| populate = false; |
| } |
| |
| FS.syncFSRequests++; |
| |
| if (FS.syncFSRequests > 1) { |
| console.log('warning: ' + FS.syncFSRequests + ' FS.syncfs operations in flight at once, probably just doing extra work'); |
| } |
| |
| var mounts = FS.getMounts(FS.root.mount); |
| var completed = 0; |
| |
| function doCallback(err) { |
| assert(FS.syncFSRequests > 0); |
| FS.syncFSRequests--; |
| return callback(err); |
| } |
| |
| function done(err) { |
| if (err) { |
| if (!done.errored) { |
| done.errored = true; |
| return doCallback(err); |
| } |
| return; |
| } |
| if (++completed >= mounts.length) { |
| doCallback(null); |
| } |
| }; |
| |
| // sync all mounts |
| mounts.forEach(function (mount) { |
| if (!mount.type.syncfs) { |
| return done(null); |
| } |
| mount.type.syncfs(mount, populate, done); |
| }); |
| },mount:function (type, opts, mountpoint) { |
| var root = mountpoint === '/'; |
| var pseudo = !mountpoint; |
| var node; |
| |
| if (root && FS.root) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBUSY); |
| } else if (!root && !pseudo) { |
| var lookup = FS.lookupPath(mountpoint, { follow_mount: false }); |
| |
| mountpoint = lookup.path; // use the absolute path |
| node = lookup.node; |
| |
| if (FS.isMountpoint(node)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBUSY); |
| } |
| |
| if (!FS.isDir(node.mode)) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); |
| } |
| } |
| |
| var mount = { |
| type: type, |
| opts: opts, |
| mountpoint: mountpoint, |
| mounts: [] |
| }; |
| |
| // create a root node for the fs |
| var mountRoot = type.mount(mount); |
| mountRoot.mount = mount; |
| mount.root = mountRoot; |
| |
| if (root) { |
| FS.root = mountRoot; |
| } else if (node) { |
| // set as a mountpoint |
| node.mounted = mount; |
| |
| // add the new mount to the current mount's children |
| if (node.mount) { |
| node.mount.mounts.push(mount); |
| } |
| } |
| |
| return mountRoot; |
| },unmount:function (mountpoint) { |
| var lookup = FS.lookupPath(mountpoint, { follow_mount: false }); |
| |
| if (!FS.isMountpoint(lookup.node)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| |
| // destroy the nodes for this mount, and all its child mounts |
| var node = lookup.node; |
| var mount = node.mounted; |
| var mounts = FS.getMounts(mount); |
| |
| Object.keys(FS.nameTable).forEach(function (hash) { |
| var current = FS.nameTable[hash]; |
| |
| while (current) { |
| var next = current.name_next; |
| |
| if (mounts.indexOf(current.mount) !== -1) { |
| FS.destroyNode(current); |
| } |
| |
| current = next; |
| } |
| }); |
| |
| // no longer a mountpoint |
| node.mounted = null; |
| |
| // remove this mount from the child mounts |
| var idx = node.mount.mounts.indexOf(mount); |
| assert(idx !== -1); |
| node.mount.mounts.splice(idx, 1); |
| },lookup:function (parent, name) { |
| return parent.node_ops.lookup(parent, name); |
| },mknod:function (path, mode, dev) { |
| var lookup = FS.lookupPath(path, { parent: true }); |
| var parent = lookup.node; |
| var name = PATH.basename(path); |
| if (!name || name === '.' || name === '..') { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| var err = FS.mayCreate(parent, name); |
| if (err) { |
| throw new FS.ErrnoError(err); |
| } |
| if (!parent.node_ops.mknod) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| } |
| return parent.node_ops.mknod(parent, name, mode, dev); |
| },create:function (path, mode) { |
| mode = mode !== undefined ? mode : 438 /* 0666 */; |
| mode &= 4095; |
| mode |= 32768; |
| return FS.mknod(path, mode, 0); |
| },mkdir:function (path, mode) { |
| mode = mode !== undefined ? mode : 511 /* 0777 */; |
| mode &= 511 | 512; |
| mode |= 16384; |
| return FS.mknod(path, mode, 0); |
| },mkdirTree:function (path, mode) { |
| var dirs = path.split('/'); |
| var d = ''; |
| for (var i = 0; i < dirs.length; ++i) { |
| if (!dirs[i]) continue; |
| d += '/' + dirs[i]; |
| try { |
| FS.mkdir(d, mode); |
| } catch(e) { |
| if (e.errno != ERRNO_CODES.EEXIST) throw e; |
| } |
| } |
| },mkdev:function (path, mode, dev) { |
| if (typeof(dev) === 'undefined') { |
| dev = mode; |
| mode = 438 /* 0666 */; |
| } |
| mode |= 8192; |
| return FS.mknod(path, mode, dev); |
| },symlink:function (oldpath, newpath) { |
| if (!PATH.resolve(oldpath)) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
| } |
| var lookup = FS.lookupPath(newpath, { parent: true }); |
| var parent = lookup.node; |
| if (!parent) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
| } |
| var newname = PATH.basename(newpath); |
| var err = FS.mayCreate(parent, newname); |
| if (err) { |
| throw new FS.ErrnoError(err); |
| } |
| if (!parent.node_ops.symlink) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| } |
| return parent.node_ops.symlink(parent, newname, oldpath); |
| },rename:function (old_path, new_path) { |
| var old_dirname = PATH.dirname(old_path); |
| var new_dirname = PATH.dirname(new_path); |
| var old_name = PATH.basename(old_path); |
| var new_name = PATH.basename(new_path); |
| // parents must exist |
| var lookup, old_dir, new_dir; |
| try { |
| lookup = FS.lookupPath(old_path, { parent: true }); |
| old_dir = lookup.node; |
| lookup = FS.lookupPath(new_path, { parent: true }); |
| new_dir = lookup.node; |
| } catch (e) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBUSY); |
| } |
| if (!old_dir || !new_dir) throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
| // need to be part of the same mount |
| if (old_dir.mount !== new_dir.mount) { |
| throw new FS.ErrnoError(ERRNO_CODES.EXDEV); |
| } |
| // source must exist |
| var old_node = FS.lookupNode(old_dir, old_name); |
| // old path should not be an ancestor of the new path |
| var relative = PATH.relative(old_path, new_dirname); |
| if (relative.charAt(0) !== '.') { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| // new path should not be an ancestor of the old path |
| relative = PATH.relative(new_path, old_dirname); |
| if (relative.charAt(0) !== '.') { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY); |
| } |
| // see if the new path already exists |
| var new_node; |
| try { |
| new_node = FS.lookupNode(new_dir, new_name); |
| } catch (e) { |
| // not fatal |
| } |
| // early out if nothing needs to change |
| if (old_node === new_node) { |
| return; |
| } |
| // we'll need to delete the old entry |
| var isdir = FS.isDir(old_node.mode); |
| var err = FS.mayDelete(old_dir, old_name, isdir); |
| if (err) { |
| throw new FS.ErrnoError(err); |
| } |
| // need delete permissions if we'll be overwriting. |
| // need create permissions if new doesn't already exist. |
| err = new_node ? |
| FS.mayDelete(new_dir, new_name, isdir) : |
| FS.mayCreate(new_dir, new_name); |
| if (err) { |
| throw new FS.ErrnoError(err); |
| } |
| if (!old_dir.node_ops.rename) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| } |
| if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBUSY); |
| } |
| // if we are going to change the parent, check write permissions |
| if (new_dir !== old_dir) { |
| err = FS.nodePermissions(old_dir, 'w'); |
| if (err) { |
| throw new FS.ErrnoError(err); |
| } |
| } |
| try { |
| if (FS.trackingDelegate['willMovePath']) { |
| FS.trackingDelegate['willMovePath'](old_path, new_path); |
| } |
| } catch(e) { |
| console.log("FS.trackingDelegate['willMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message); |
| } |
| // remove the node from the lookup hash |
| FS.hashRemoveNode(old_node); |
| // do the underlying fs rename |
| try { |
| old_dir.node_ops.rename(old_node, new_dir, new_name); |
| } catch (e) { |
| throw e; |
| } finally { |
| // add the node back to the hash (in case node_ops.rename |
| // changed its name) |
| FS.hashAddNode(old_node); |
| } |
| try { |
| if (FS.trackingDelegate['onMovePath']) FS.trackingDelegate['onMovePath'](old_path, new_path); |
| } catch(e) { |
| console.log("FS.trackingDelegate['onMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message); |
| } |
| },rmdir:function (path) { |
| var lookup = FS.lookupPath(path, { parent: true }); |
| var parent = lookup.node; |
| var name = PATH.basename(path); |
| var node = FS.lookupNode(parent, name); |
| var err = FS.mayDelete(parent, name, true); |
| if (err) { |
| throw new FS.ErrnoError(err); |
| } |
| if (!parent.node_ops.rmdir) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| } |
| if (FS.isMountpoint(node)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBUSY); |
| } |
| try { |
| if (FS.trackingDelegate['willDeletePath']) { |
| FS.trackingDelegate['willDeletePath'](path); |
| } |
| } catch(e) { |
| console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message); |
| } |
| parent.node_ops.rmdir(parent, name); |
| FS.destroyNode(node); |
| try { |
| if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path); |
| } catch(e) { |
| console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message); |
| } |
| },readdir:function (path) { |
| var lookup = FS.lookupPath(path, { follow: true }); |
| var node = lookup.node; |
| if (!node.node_ops.readdir) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); |
| } |
| return node.node_ops.readdir(node); |
| },unlink:function (path) { |
| var lookup = FS.lookupPath(path, { parent: true }); |
| var parent = lookup.node; |
| var name = PATH.basename(path); |
| var node = FS.lookupNode(parent, name); |
| var err = FS.mayDelete(parent, name, false); |
| if (err) { |
| // According to POSIX, we should map EISDIR to EPERM, but |
| // we instead do what Linux does (and we must, as we use |
| // the musl linux libc). |
| throw new FS.ErrnoError(err); |
| } |
| if (!parent.node_ops.unlink) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| } |
| if (FS.isMountpoint(node)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBUSY); |
| } |
| try { |
| if (FS.trackingDelegate['willDeletePath']) { |
| FS.trackingDelegate['willDeletePath'](path); |
| } |
| } catch(e) { |
| console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message); |
| } |
| parent.node_ops.unlink(parent, name); |
| FS.destroyNode(node); |
| try { |
| if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path); |
| } catch(e) { |
| console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message); |
| } |
| },readlink:function (path) { |
| var lookup = FS.lookupPath(path); |
| var link = lookup.node; |
| if (!link) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
| } |
| if (!link.node_ops.readlink) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| return PATH.resolve(FS.getPath(link.parent), link.node_ops.readlink(link)); |
| },stat:function (path, dontFollow) { |
| var lookup = FS.lookupPath(path, { follow: !dontFollow }); |
| var node = lookup.node; |
| if (!node) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
| } |
| if (!node.node_ops.getattr) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| } |
| return node.node_ops.getattr(node); |
| },lstat:function (path) { |
| return FS.stat(path, true); |
| },chmod:function (path, mode, dontFollow) { |
| var node; |
| if (typeof path === 'string') { |
| var lookup = FS.lookupPath(path, { follow: !dontFollow }); |
| node = lookup.node; |
| } else { |
| node = path; |
| } |
| if (!node.node_ops.setattr) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| } |
| node.node_ops.setattr(node, { |
| mode: (mode & 4095) | (node.mode & ~4095), |
| timestamp: Date.now() |
| }); |
| },lchmod:function (path, mode) { |
| FS.chmod(path, mode, true); |
| },fchmod:function (fd, mode) { |
| var stream = FS.getStream(fd); |
| if (!stream) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
| } |
| FS.chmod(stream.node, mode); |
| },chown:function (path, uid, gid, dontFollow) { |
| var node; |
| if (typeof path === 'string') { |
| var lookup = FS.lookupPath(path, { follow: !dontFollow }); |
| node = lookup.node; |
| } else { |
| node = path; |
| } |
| if (!node.node_ops.setattr) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| } |
| node.node_ops.setattr(node, { |
| timestamp: Date.now() |
| // we ignore the uid / gid for now |
| }); |
| },lchown:function (path, uid, gid) { |
| FS.chown(path, uid, gid, true); |
| },fchown:function (fd, uid, gid) { |
| var stream = FS.getStream(fd); |
| if (!stream) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
| } |
| FS.chown(stream.node, uid, gid); |
| },truncate:function (path, len) { |
| if (len < 0) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| var node; |
| if (typeof path === 'string') { |
| var lookup = FS.lookupPath(path, { follow: true }); |
| node = lookup.node; |
| } else { |
| node = path; |
| } |
| if (!node.node_ops.setattr) { |
| throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
| } |
| if (FS.isDir(node.mode)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EISDIR); |
| } |
| if (!FS.isFile(node.mode)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| var err = FS.nodePermissions(node, 'w'); |
| if (err) { |
| throw new FS.ErrnoError(err); |
| } |
| node.node_ops.setattr(node, { |
| size: len, |
| timestamp: Date.now() |
| }); |
| },ftruncate:function (fd, len) { |
| var stream = FS.getStream(fd); |
| if (!stream) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
| } |
| if ((stream.flags & 2097155) === 0) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| FS.truncate(stream.node, len); |
| },utime:function (path, atime, mtime) { |
| var lookup = FS.lookupPath(path, { follow: true }); |
| var node = lookup.node; |
| node.node_ops.setattr(node, { |
| timestamp: Math.max(atime, mtime) |
| }); |
| },open:function (path, flags, mode, fd_start, fd_end) { |
| if (path === "") { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
| } |
| flags = typeof flags === 'string' ? FS.modeStringToFlags(flags) : flags; |
| mode = typeof mode === 'undefined' ? 438 /* 0666 */ : mode; |
| if ((flags & 64)) { |
| mode = (mode & 4095) | 32768; |
| } else { |
| mode = 0; |
| } |
| var node; |
| if (typeof path === 'object') { |
| node = path; |
| } else { |
| path = PATH.normalize(path); |
| try { |
| var lookup = FS.lookupPath(path, { |
| follow: !(flags & 131072) |
| }); |
| node = lookup.node; |
| } catch (e) { |
| // ignore |
| } |
| } |
| // perhaps we need to create the node |
| var created = false; |
| if ((flags & 64)) { |
| if (node) { |
| // if O_CREAT and O_EXCL are set, error out if the node already exists |
| if ((flags & 128)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EEXIST); |
| } |
| } else { |
| // node doesn't exist, try to create it |
| node = FS.mknod(path, mode, 0); |
| created = true; |
| } |
| } |
| if (!node) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
| } |
| // can't truncate a device |
| if (FS.isChrdev(node.mode)) { |
| flags &= ~512; |
| } |
| // if asked only for a directory, then this must be one |
| if ((flags & 65536) && !FS.isDir(node.mode)) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); |
| } |
| // check permissions, if this is not a file we just created now (it is ok to |
| // create and write to a file with read-only permissions; it is read-only |
| // for later use) |
| if (!created) { |
| var err = FS.mayOpen(node, flags); |
| if (err) { |
| throw new FS.ErrnoError(err); |
| } |
| } |
| // do truncation if necessary |
| if ((flags & 512)) { |
| FS.truncate(node, 0); |
| } |
| // we've already handled these, don't pass down to the underlying vfs |
| flags &= ~(128 | 512); |
| |
| // register the stream with the filesystem |
| var stream = FS.createStream({ |
| node: node, |
| path: FS.getPath(node), // we want the absolute path to the node |
| flags: flags, |
| seekable: true, |
| position: 0, |
| stream_ops: node.stream_ops, |
| // used by the file family libc calls (fopen, fwrite, ferror, etc.) |
| ungotten: [], |
| error: false |
| }, fd_start, fd_end); |
| // call the new stream's open function |
| if (stream.stream_ops.open) { |
| stream.stream_ops.open(stream); |
| } |
| if (Module['logReadFiles'] && !(flags & 1)) { |
| if (!FS.readFiles) FS.readFiles = {}; |
| if (!(path in FS.readFiles)) { |
| FS.readFiles[path] = 1; |
| Module['printErr']('read file: ' + path); |
| } |
| } |
| try { |
| if (FS.trackingDelegate['onOpenFile']) { |
| var trackingFlags = 0; |
| if ((flags & 2097155) !== 1) { |
| trackingFlags |= FS.tracking.openFlags.READ; |
| } |
| if ((flags & 2097155) !== 0) { |
| trackingFlags |= FS.tracking.openFlags.WRITE; |
| } |
| FS.trackingDelegate['onOpenFile'](path, trackingFlags); |
| } |
| } catch(e) { |
| console.log("FS.trackingDelegate['onOpenFile']('"+path+"', flags) threw an exception: " + e.message); |
| } |
| return stream; |
| },close:function (stream) { |
| if (stream.getdents) stream.getdents = null; // free readdir state |
| try { |
| if (stream.stream_ops.close) { |
| stream.stream_ops.close(stream); |
| } |
| } catch (e) { |
| throw e; |
| } finally { |
| FS.closeStream(stream.fd); |
| } |
| },llseek:function (stream, offset, whence) { |
| if (!stream.seekable || !stream.stream_ops.llseek) { |
| throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); |
| } |
| stream.position = stream.stream_ops.llseek(stream, offset, whence); |
| stream.ungotten = []; |
| return stream.position; |
| },read:function (stream, buffer, offset, length, position) { |
| if (length < 0 || position < 0) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| if ((stream.flags & 2097155) === 1) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
| } |
| if (FS.isDir(stream.node.mode)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EISDIR); |
| } |
| if (!stream.stream_ops.read) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| var seeking = true; |
| if (typeof position === 'undefined') { |
| position = stream.position; |
| seeking = false; |
| } else if (!stream.seekable) { |
| throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); |
| } |
| var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position); |
| if (!seeking) stream.position += bytesRead; |
| return bytesRead; |
| },write:function (stream, buffer, offset, length, position, canOwn) { |
| if (length < 0 || position < 0) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| if ((stream.flags & 2097155) === 0) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
| } |
| if (FS.isDir(stream.node.mode)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EISDIR); |
| } |
| if (!stream.stream_ops.write) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| if (stream.flags & 1024) { |
| // seek to the end before writing in append mode |
| FS.llseek(stream, 0, 2); |
| } |
| var seeking = true; |
| if (typeof position === 'undefined') { |
| position = stream.position; |
| seeking = false; |
| } else if (!stream.seekable) { |
| throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); |
| } |
| var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn); |
| if (!seeking) stream.position += bytesWritten; |
| try { |
| if (stream.path && FS.trackingDelegate['onWriteToFile']) FS.trackingDelegate['onWriteToFile'](stream.path); |
| } catch(e) { |
| console.log("FS.trackingDelegate['onWriteToFile']('"+path+"') threw an exception: " + e.message); |
| } |
| return bytesWritten; |
| },allocate:function (stream, offset, length) { |
| if (offset < 0 || length <= 0) { |
| throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
| } |
| if ((stream.flags & 2097155) === 0) { |
| throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
| } |
| if (!FS.isFile(stream.node.mode) && !FS.isDir(node.mode)) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENODEV); |
| } |
| if (!stream.stream_ops.allocate) { |
| throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP); |
| } |
| stream.stream_ops.allocate(stream, offset, length); |
| },mmap:function (stream, buffer, offset, length, position, prot, flags) { |
| // TODO if PROT is PROT_WRITE, make sure we have write access |
| if ((stream.flags & 2097155) === 1) { |
| throw new FS.ErrnoError(ERRNO_CODES.EACCES); |
| } |
| if (!stream.stream_ops.mmap) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENODEV); |
| } |
| return stream.stream_ops.mmap(stream, buffer, offset, length, position, prot, flags); |
| },msync:function (stream, buffer, offset, length, mmapFlags) { |
| if (!stream || !stream.stream_ops.msync) { |
| return 0; |
| } |
| return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags); |
| },munmap:function (stream) { |
| return 0; |
| },ioctl:function (stream, cmd, arg) { |
| if (!stream.stream_ops.ioctl) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOTTY); |
| } |
| return stream.stream_ops.ioctl(stream, cmd, arg); |
| },readFile:function (path, opts) { |
| opts = opts || {}; |
| opts.flags = opts.flags || 'r'; |
| opts.encoding = opts.encoding || 'binary'; |
| if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') { |
| throw new Error('Invalid encoding type "' + opts.encoding + '"'); |
| } |
| var ret; |
| var stream = FS.open(path, opts.flags); |
| var stat = FS.stat(path); |
| var length = stat.size; |
| var buf = new Uint8Array(length); |
| FS.read(stream, buf, 0, length, 0); |
| if (opts.encoding === 'utf8') { |
| ret = UTF8ArrayToString(buf, 0); |
| } else if (opts.encoding === 'binary') { |
| ret = buf; |
| } |
| FS.close(stream); |
| return ret; |
| },writeFile:function (path, data, opts) { |
| opts = opts || {}; |
| opts.flags = opts.flags || 'w'; |
| opts.encoding = opts.encoding || 'utf8'; |
| if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') { |
| throw new Error('Invalid encoding type "' + opts.encoding + '"'); |
| } |
| var stream = FS.open(path, opts.flags, opts.mode); |
| if (opts.encoding === 'utf8') { |
| var buf = new Uint8Array(lengthBytesUTF8(data)+1); |
| var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length); |
| FS.write(stream, buf, 0, actualNumBytes, 0, opts.canOwn); |
| } else if (opts.encoding === 'binary') { |
| FS.write(stream, data, 0, data.length, 0, opts.canOwn); |
| } |
| FS.close(stream); |
| },cwd:function () { |
| return FS.currentPath; |
| },chdir:function (path) { |
| var lookup = FS.lookupPath(path, { follow: true }); |
| if (lookup.node === null) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
| } |
| if (!FS.isDir(lookup.node.mode)) { |
| throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); |
| } |
| var err = FS.nodePermissions(lookup.node, 'x'); |
| if (err) { |
| throw new FS.ErrnoError(err); |
| } |
| FS.currentPath = lookup.path; |
| },createDefaultDirectories:function () { |
| FS.mkdir('/tmp'); |
| FS.mkdir('/home'); |
| FS.mkdir('/home/web_user'); |
| },createDefaultDevices:function () { |
| // create /dev |
| FS.mkdir('/dev'); |
| // setup /dev/null |
| FS.registerDevice(FS.makedev(1, 3), { |
| read: function() { return 0; }, |
| write: function(stream, buffer, offset, length, pos) { return length; } |
| }); |
| FS.mkdev('/dev/null', FS.makedev(1, 3)); |
| // setup /dev/tty and /dev/tty1 |
| // stderr needs to print output using Module['printErr'] |
| // so we register a second tty just for it. |
| TTY.register(FS.makedev(5, 0), TTY.default_tty_ops); |
| TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops); |
| FS.mkdev('/dev/tty', FS.makedev(5, 0)); |
| FS.mkdev('/dev/tty1', FS.makedev(6, 0)); |
| // setup /dev/[u]random |
| var random_device; |
| if (typeof crypto !== 'undefined') { |
| // for modern web browsers |
| var randomBuffer = new Uint8Array(1); |
| random_device = function() { crypto.getRandomValues(randomBuffer); return randomBuffer[0]; }; |
| } else if (ENVIRONMENT_IS_NODE) { |
| // for nodejs |
| random_device = function() { return require('crypto').randomBytes(1)[0]; }; |
| } else { |
| // default for ES5 platforms |
| random_device = function() { return (Math.random()*256)|0; }; |
| } |
| FS.createDevice('/dev', 'random', random_device); |
| FS.createDevice('/dev', 'urandom', random_device); |
| // we're not going to emulate the actual shm device, |
| // just create the tmp dirs that reside in it commonly |
| FS.mkdir('/dev/shm'); |
| FS.mkdir('/dev/shm/tmp'); |
| },createSpecialDirectories:function () { |
| // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the name of the stream for fd 6 (see test_unistd_ttyname) |
| FS.mkdir('/proc'); |
| FS.mkdir('/proc/self'); |
| FS.mkdir('/proc/self/fd'); |
| FS.mount({ |
| mount: function() { |
| var node = FS.createNode('/proc/self', 'fd', 16384 | 511 /* 0777 */, 73); |
| node.node_ops = { |
| lookup: function(parent, name) { |
| var fd = +name; |
| var stream = FS.getStream(fd); |
| if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
| var ret = { |
| parent: null, |
| mount: { mountpoint: 'fake' }, |
| node_ops: { readlink: function() { return stream.path } } |
| }; |
| ret.parent = ret; // make it look like a simple root node |
| return ret; |
| } |
| }; |
| return node; |
| } |
| }, {}, '/proc/self/fd'); |
| },createStandardStreams:function () { |
| // TODO deprecate the old functionality of a single |
| // input / output callback and that utilizes FS.createDevice |
| // and instead require a unique set of stream ops |
| |
| // by default, we symlink the standard streams to the |
| // default tty devices. however, if the standard streams |
| // have been overwritten we create a unique device for |
| // them instead. |
| if (Module['stdin']) { |
| FS.createDevice('/dev', 'stdin', Module['stdin']); |
| } else { |
| FS.symlink('/dev/tty', '/dev/stdin'); |
| } |
| if (Module['stdout']) { |
| FS.createDevice('/dev', 'stdout', null, Module['stdout']); |
| } else { |
| FS.symlink('/dev/tty', '/dev/stdout'); |
| } |
| if (Module['stderr']) { |
| FS.createDevice('/dev', 'stderr', null, Module['stderr']); |
| } else { |
| FS.symlink('/dev/tty1', '/dev/stderr'); |
| } |
| |
| // open default streams for the stdin, stdout and stderr devices |
| var stdin = FS.open('/dev/stdin', 'r'); |
| assert(stdin.fd === 0, 'invalid handle for stdin (' + stdin.fd + ')'); |
| |
| var stdout = FS.open('/dev/stdout', 'w'); |
| assert(stdout.fd === 1, 'invalid handle for stdout (' + stdout.fd + ')'); |
| |
| var stderr = FS.open('/dev/stderr', 'w'); |
| assert(stderr.fd === 2, 'invalid handle for stderr (' + stderr.fd + ')'); |
| },ensureErrnoError:function () { |
| if (FS.ErrnoError) return; |
| FS.ErrnoError = function ErrnoError(errno, node) { |
| //Module.printErr(stackTrace()); // useful for debugging |
| this.node = node; |
| this.setErrno = function(errno) { |
| this.errno = errno; |
| for (var key in ERRNO_CODES) { |
| if (ERRNO_CODES[key] === errno) { |
| this.code = key; |
| break; |
| } |
| } |
| }; |
| this.setErrno(errno); |
| this.message = ERRNO_MESSAGES[errno]; |
| }; |
| FS.ErrnoError.prototype = new Error(); |
| FS.ErrnoError.prototype.constructor = FS.ErrnoError; |
| // Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info) |
| [ERRNO_CODES.ENOENT].forEach(function(code) { |
| FS.genericErrors[code] = new FS.ErrnoError(code); |
| FS.genericErrors[code].stack = '<generic error, no stack>'; |
| }); |
| },staticInit:function () { |
| FS.ensureErrnoError(); |
| |
| FS.nameTable = new Array(4096); |
| |
| FS.mount(MEMFS, {}, '/'); |
| |
| FS.createDefaultDirectories(); |
| FS.createDefaultDevices(); |
| FS.createSpecialDirectories(); |
| |
| FS.filesystems = { |
| 'MEMFS': MEMFS, |
| 'IDBFS': IDBFS, |
| 'NODEFS': NODEFS, |
| 'WORKERFS': WORKERFS, |
| }; |
| },init:function (input, output, error) { |
| assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)'); |
| FS.init.initialized = true; |
| |
| FS.ensureErrnoError(); |
| |
| // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here |
| Module['stdin'] = input || Module['stdin']; |
| Module['stdout'] = output || Module['stdout']; |
| Module['stderr'] = error || Module['stderr']; |
| |
| FS.createStandardStreams(); |
| },quit:function () { |
| FS.init.initialized = false; |
| // force-flush all streams, so we get musl std streams printed out |
| var fflush = Module['_fflush']; |
| if (fflush) fflush(0); |
| // close all of our streams |
| for (var i = 0; i < FS.streams.length; i++) { |
| var stream = FS.streams[i]; |
| if (!stream) { |
| continue; |
| } |
| FS.close(stream); |
| } |
| },getMode:function (canRead, canWrite) { |
| var mode = 0; |
| if (canRead) mode |= 292 | 73; |
| if (canWrite) mode |= 146; |
| return mode; |
| },joinPath:function (parts, forceRelative) { |
| var path = PATH.join.apply(null, parts); |
| if (forceRelative && path[0] == '/') path = path.substr(1); |
| return path; |
| },absolutePath:function (relative, base) { |
| return PATH.resolve(base, relative); |
| },standardizePath:function (path) { |
| return PATH.normalize(path); |
| },findObject:function (path, dontResolveLastLink) { |
| var ret = FS.analyzePath(path, dontResolveLastLink); |
| if (ret.exists) { |
| return ret.object; |
| } else { |
| ___setErrNo(ret.error); |
| return null; |
| } |
| },analyzePath:function (path, dontResolveLastLink) { |
| // operate from within the context of the symlink's target |
| try { |
| var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink }); |
| path = lookup.path; |
| } catch (e) { |
| } |
| var ret = { |
| isRoot: false, exists: false, error: 0, name: null, path: null, object: null, |
| parentExists: false, parentPath: null, parentObject: null |
| }; |
| try { |
| var lookup = FS.lookupPath(path, { parent: true }); |
| ret.parentExists = true; |
| ret.parentPath = lookup.path; |
| ret.parentObject = lookup.node; |
| ret.name = PATH.basename(path); |
| lookup = FS.lookupPath(path, { follow: !dontResolveLastLink }); |
| ret.exists = true; |
| ret.path = lookup.path; |
| ret.object = lookup.node; |
| ret.name = lookup.node.name; |
| ret.isRoot = lookup.path === '/'; |
| } catch (e) { |
| ret.error = e.errno; |
| }; |
| return ret; |
| },createFolder:function (parent, name, canRead, canWrite) { |
| var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); |
| var mode = FS.getMode(canRead, canWrite); |
| return FS.mkdir(path, mode); |
| },createPath:function (parent, path, canRead, canWrite) { |
| parent = typeof parent === 'string' ? parent : FS.getPath(parent); |
| var parts = path.split('/').reverse(); |
| while (parts.length) { |
| var part = parts.pop(); |
| if (!part) continue; |
| var current = PATH.join2(parent, part); |
| try { |
| FS.mkdir(current); |
| } catch (e) { |
| // ignore EEXIST |
| } |
| parent = current; |
| } |
| return current; |
| },createFile:function (parent, name, properties, canRead, canWrite) { |
| var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); |
| var mode = FS.getMode(canRead, canWrite); |
| return FS.create(path, mode); |
| },createDataFile:function (parent, name, data, canRead, canWrite, canOwn) { |
| var path = name ? PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name) : parent; |
| var mode = FS.getMode(canRead, canWrite); |
| var node = FS.create(path, mode); |
| if (data) { |
| if (typeof data === 'string') { |
| var arr = new Array(data.length); |
| for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i); |
| data = arr; |
| } |
| // make sure we can write to the file |
| FS.chmod(node, mode | 146); |
| var stream = FS.open(node, 'w'); |
| FS.write(stream, data, 0, data.length, 0, canOwn); |
| FS.close(stream); |
| FS.chmod(node, mode); |
| } |
| return node; |
| },createDevice:function (parent, name, input, output) { |
| var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); |
| var mode = FS.getMode(!!input, !!output); |
| if (!FS.createDevice.major) FS.createDevice.major = 64; |
| var dev = FS.makedev(FS.createDevice.major++, 0); |
| // Create a fake device that a set of stream ops to emulate |
| // the old behavior. |
| FS.registerDevice(dev, { |
| open: function(stream) { |
| stream.seekable = false; |
| }, |
| close: function(stream) { |
| // flush any pending line data |
| if (output && output.buffer && output.buffer.length) { |
| output(10); |
| } |
| }, |
| read: function(stream, buffer, offset, length, pos /* ignored */) { |
| var bytesRead = 0; |
| for (var i = 0; i < length; i++) { |
| var result; |
| try { |
| result = input(); |
| } catch (e) { |
| throw new FS.ErrnoError(ERRNO_CODES.EIO); |
| } |
| if (result === undefined && bytesRead === 0) { |
| throw new FS.ErrnoError(ERRNO_CODES.EAGAIN); |
| } |
| if (result === null || result === undefined) break; |
| bytesRead++; |
| buffer[offset+i] = result; |
| } |
| if (bytesRead) { |
| stream.node.timestamp = Date.now(); |
| } |
| return bytesRead; |
| }, |
| write: function(stream, buffer, offset, length, pos) { |
| for (var i = 0; i < length; i++) { |
| try { |
| output(buffer[offset+i]); |
| } catch (e) { |
| throw new FS.ErrnoError(ERRNO_CODES.EIO); |
| } |
| } |
| if (length) { |
| stream.node.timestamp = Date.now(); |
| } |
| return i; |
| } |
| }); |
| return FS.mkdev(path, mode, dev); |
| },createLink:function (parent, name, target, canRead, canWrite) { |
| var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); |
| return FS.symlink(target, path); |
| },forceLoadFile:function (obj) { |
| if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true; |
| var success = true; |
| if (typeof XMLHttpRequest !== 'undefined') { |
| throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread."); |
| } else if (Module['read']) { |
| // Command-line. |
| try { |
| // WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as |
| // read() will try to parse UTF8. |
| obj.contents = intArrayFromString(Module['read'](obj.url), true); |
| obj.usedBytes = obj.contents.length; |
| } catch (e) { |
| success = false; |
| } |
| } else { |
| throw new Error('Cannot load without read() or XMLHttpRequest.'); |
| } |
| if (!success) ___setErrNo(ERRNO_CODES.EIO); |
| return success; |
| },createLazyFile:function (parent, name, url, canRead, canWrite) { |
| // Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse. |
| function LazyUint8Array() { |
| this.lengthKnown = false; |
| this.chunks = []; // Loaded chunks. Index is the chunk number |
| } |
| LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) { |
| if (idx > this.length-1 || idx < 0) { |
| return undefined; |
| } |
| var chunkOffset = idx % this.chunkSize; |
| var chunkNum = (idx / this.chunkSize)|0; |
| return this.getter(chunkNum)[chunkOffset]; |
| } |
| LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) { |
| this.getter = getter; |
| } |
| LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() { |
| // Find length |
| var xhr = new XMLHttpRequest(); |
| xhr.open('HEAD', url, false); |
| xhr.send(null); |
| if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); |
| var datalength = Number(xhr.getResponseHeader("Content-length")); |
| var header; |
| var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes"; |
| var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip"; |
| |
| var chunkSize = 1024*1024; // Chunk size in bytes |
| |
| if (!hasByteServing) chunkSize = datalength; |
| |
| // Function to get a range from the remote URL. |
| var doXHR = (function(from, to) { |
| if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!"); |
| if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!"); |
| |
| // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available. |
| var xhr = new XMLHttpRequest(); |
| xhr.open('GET', url, false); |
| if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to); |
| |
| // Some hints to the browser that we want binary data. |
| if (typeof Uint8Array != 'undefined') xhr.responseType = 'arraybuffer'; |
| if (xhr.overrideMimeType) { |
| xhr.overrideMimeType('text/plain; charset=x-user-defined'); |
| } |
| |
| xhr.send(null); |
| if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); |
| if (xhr.response !== undefined) { |
| return new Uint8Array(xhr.response || []); |
| } else { |
| return intArrayFromString(xhr.responseText || '', true); |
| } |
| }); |
| var lazyArray = this; |
| lazyArray.setDataGetter(function(chunkNum) { |
| var start = chunkNum * chunkSize; |
| var end = (chunkNum+1) * chunkSize - 1; // including this byte |
| end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block |
| if (typeof(lazyArray.chunks[chunkNum]) === "undefined") { |
| lazyArray.chunks[chunkNum] = doXHR(start, end); |
| } |
| if (typeof(lazyArray.chunks[chunkNum]) === "undefined") throw new Error("doXHR failed!"); |
| return lazyArray.chunks[chunkNum]; |
| }); |
| |
| if (usesGzip || !datalength) { |
| // if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length |
| chunkSize = datalength = 1; // this will force getter(0)/doXHR do download the whole file |
| datalength = this.getter(0).length; |
| chunkSize = datalength; |
| console.log("LazyFiles on gzip forces download of the whole file when length is accessed"); |
| } |
| |
| this._length = datalength; |
| this._chunkSize = chunkSize; |
| this.lengthKnown = true; |
| } |
| if (typeof XMLHttpRequest !== 'undefined') { |
| if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc'; |
| var lazyArray = new LazyUint8Array(); |
| Object.defineProperties(lazyArray, { |
| length: { |
| get: function() { |
| if(!this.lengthKnown) { |
| this.cacheLength(); |
| } |
| return this._length; |
| } |
| }, |
| chunkSize: { |
| get: function() { |
| if(!this.lengthKnown) { |
| this.cacheLength(); |
| } |
| return this._chunkSize; |
| } |
| } |
| }); |
| |
| var properties = { isDevice: false, contents: lazyArray }; |
| } else { |
| var properties = { isDevice: false, url: url }; |
| } |
| |
| var node = FS.createFile(parent, name, properties, canRead, canWrite); |
| // This is a total hack, but I want to get this lazy file code out of the |
| // core of MEMFS. If we want to keep this lazy file concept I feel it should |
| // be its own thin LAZYFS proxying calls to MEMFS. |
| if (properties.contents) { |
| node.contents = properties.contents; |
| } else if (properties.url) { |
| node.contents = null; |
| node.url = properties.url; |
| } |
| // Add a function that defers querying the file size until it is asked the first time. |
| Object.defineProperties(node, { |
| usedBytes: { |
| get: function() { return this.contents.length; } |
| } |
| }); |
| // override each stream op with one that tries to force load the lazy file first |
| var stream_ops = {}; |
| var keys = Object.keys(node.stream_ops); |
| keys.forEach(function(key) { |
| var fn = node.stream_ops[key]; |
| stream_ops[key] = function forceLoadLazyFile() { |
| if (!FS.forceLoadFile(node)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EIO); |
| } |
| return fn.apply(null, arguments); |
| }; |
| }); |
| // use a custom read function |
| stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) { |
| if (!FS.forceLoadFile(node)) { |
| throw new FS.ErrnoError(ERRNO_CODES.EIO); |
| } |
| var contents = stream.node.contents; |
| if (position >= contents.length) |
| return 0; |
| var size = Math.min(contents.length - position, length); |
| assert(size >= 0); |
| if (contents.slice) { // normal array |
| for (var i = 0; i < size; i++) { |
| buffer[offset + i] = contents[position + i]; |
| } |
| } else { |
| for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR |
| buffer[offset + i] = contents.get(position + i); |
| } |
| } |
| return size; |
| }; |
| node.stream_ops = stream_ops; |
| return node; |
| },createPreloadedFile:function (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) { |
| Browser.init(); // XXX perhaps this method should move onto Browser? |
| // TODO we should allow people to just pass in a complete filename instead |
| // of parent and name being that we just join them anyways |
| var fullname = name ? PATH.resolve(PATH.join2(parent, name)) : parent; |
| var dep = getUniqueRunDependency('cp ' + fullname); // might have several active requests for the same fullname |
| function processData(byteArray) { |
| function finish(byteArray) { |
| if (preFinish) preFinish(); |
| if (!dontCreateFile) { |
| FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn); |
| } |
| if (onload) onload(); |
| removeRunDependency(dep); |
| } |
| var handled = false; |
| Module['preloadPlugins'].forEach(function(plugin) { |
| if (handled) return; |
| if (plugin['canHandle'](fullname)) { |
| plugin['handle'](byteArray, fullname, finish, function() { |
| if (onerror) onerror(); |
| removeRunDependency(dep); |
| }); |
| handled = true; |
| } |
| }); |
| if (!handled) finish(byteArray); |
| } |
| addRunDependency(dep); |
| if (typeof url == 'string') { |
| Browser.asyncLoad(url, function(byteArray) { |
| processData(byteArray); |
| }, onerror); |
| } else { |
| processData(url); |
| } |
| },indexedDB:function () { |
| return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB; |
| },DB_NAME:function () { |
| return 'EM_FS_' + window.location.pathname; |
| },DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:function (paths, onload, onerror) { |
| onload = onload || function(){}; |
| onerror = onerror || function(){}; |
| var indexedDB = FS.indexedDB(); |
| try { |
| var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION); |
| } catch (e) { |
| return onerror(e); |
| } |
| openRequest.onupgradeneeded = function openRequest_onupgradeneeded() { |
| console.log('creating db'); |
| var db = openRequest.result; |
| db.createObjectStore(FS.DB_STORE_NAME); |
| }; |
| openRequest.onsuccess = function openRequest_onsuccess() { |
| var db = openRequest.result; |
| var transaction = db.transaction([FS.DB_STORE_NAME], 'readwrite'); |
| var files = transaction.objectStore(FS.DB_STORE_NAME); |
| var ok = 0, fail = 0, total = paths.length; |
| function finish() { |
| if (fail == 0) onload(); else onerror(); |
| } |
| paths.forEach(function(path) { |
| var putRequest = files.put(FS.analyzePath(path).object.contents, path); |
| putRequest.onsuccess = function putRequest_onsuccess() { ok++; if (ok + fail == total) finish() }; |
| putRequest.onerror = function putRequest_onerror() { fail++; if (ok + fail == total) finish() }; |
| }); |
| transaction.onerror = onerror; |
| }; |
| openRequest.onerror = onerror; |
| },loadFilesFromDB:function (paths, onload, onerror) { |
| onload = onload || function(){}; |
| onerror = onerror || function(){}; |
| var indexedDB = FS.indexedDB(); |
| try { |
| var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION); |
| } catch (e) { |
| return onerror(e); |
| } |
| openRequest.onupgradeneeded = onerror; // no database to load from |
| openRequest.onsuccess = function openRequest_onsuccess() { |
| var db = openRequest.result; |
| try { |
| var transaction = db.transaction([FS.DB_STORE_NAME], 'readonly'); |
| } catch(e) { |
| onerror(e); |
| return; |
| } |
| var files = transaction.objectStore(FS.DB_STORE_NAME); |
| var ok = 0, fail = 0, total = paths.length; |
| function finish() { |
| if (fail == 0) onload(); else onerror(); |
| } |
| paths.forEach(function(path) { |
| var getRequest = files.get(path); |
| getRequest.onsuccess = function getRequest_onsuccess() { |
| if (FS.analyzePath(path).exists) { |
| FS.unlink(path); |
| } |
| FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true); |
| ok++; |
| if (ok + fail == total) finish(); |
| }; |
| getRequest.onerror = function getRequest_onerror() { fail++; if (ok + fail == total) finish() }; |
| }); |
| transaction.onerror = onerror; |
| }; |
| openRequest.onerror = onerror; |
| }};var SYSCALLS={DEFAULT_POLLMASK:5,mappings:{},umask:511,calculateAt:function (dirfd, path) { |
| if (path[0] !== '/') { |
| // relative path |
| var dir; |
| if (dirfd === -100) { |
| dir = FS.cwd(); |
| } else { |
| var dirstream = FS.getStream(dirfd); |
| if (!dirstream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
| dir = dirstream.path; |
| } |
| path = PATH.join2(dir, path); |
| } |
| return path; |
| },doStat:function (func, path, buf) { |
| try { |
| var stat = func(path); |
| } catch (e) { |
| if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) { |
| // an error occurred while trying to look up the path; we should just report ENOTDIR |
| return -ERRNO_CODES.ENOTDIR; |
| } |
| throw e; |
| } |
| HEAP32[((buf)>>2)]=stat.dev; |
| HEAP32[(((buf)+(4))>>2)]=0; |
| HEAP32[(((buf)+(8))>>2)]=stat.ino; |
| HEAP32[(((buf)+(12))>>2)]=stat.mode; |
| HEAP32[(((buf)+(16))>>2)]=stat.nlink; |
| HEAP32[(((buf)+(20))>>2)]=stat.uid; |
| HEAP32[(((buf)+(24))>>2)]=stat.gid; |
| HEAP32[(((buf)+(28))>>2)]=stat.rdev; |
| HEAP32[(((buf)+(32))>>2)]=0; |
| HEAP32[(((buf)+(36))>>2)]=stat.size; |
| HEAP32[(((buf)+(40))>>2)]=4096; |
| HEAP32[(((buf)+(44))>>2)]=stat.blocks; |
| HEAP32[(((buf)+(48))>>2)]=(stat.atime.getTime() / 1000)|0; |
| HEAP32[(((buf)+(52))>>2)]=0; |
| HEAP32[(((buf)+(56))>>2)]=(stat.mtime.getTime() / 1000)|0; |
| HEAP32[(((buf)+(60))>>2)]=0; |
| HEAP32[(((buf)+(64))>>2)]=(stat.ctime.getTime() / 1000)|0; |
| HEAP32[(((buf)+(68))>>2)]=0; |
| HEAP32[(((buf)+(72))>>2)]=stat.ino; |
| return 0; |
| },doMsync:function (addr, stream, len, flags) { |
| var buffer = new Uint8Array(HEAPU8.subarray(addr, addr + len)); |
| FS.msync(stream, buffer, 0, len, flags); |
| },doMkdir:function (path, mode) { |
| // remove a trailing slash, if one - /a/b/ has basename of '', but |
| // we want to create b in the context of this function |
| path = PATH.normalize(path); |
| if (path[path.length-1] === '/') path = path.substr(0, path.length-1); |
| FS.mkdir(path, mode, 0); |
| return 0; |
| },doMknod:function (path, mode, dev) { |
| // we don't want this in the JS API as it uses mknod to create all nodes. |
| switch (mode & 61440) { |
| case 32768: |
| case 8192: |
| case 24576: |
| case 4096: |
| case 49152: |
| break; |
| default: return -ERRNO_CODES.EINVAL; |
| } |
| FS.mknod(path, mode, dev); |
| return 0; |
| },doReadlink:function (path, buf, bufsize) { |
| if (bufsize <= 0) return -ERRNO_CODES.EINVAL; |
| var ret = FS.readlink(path); |
| |
| var len = Math.min(bufsize, lengthBytesUTF8(ret)); |
| var endChar = HEAP8[buf+len]; |
| stringToUTF8(ret, buf, bufsize+1); |
| // readlink is one of the rare functions that write out a C string, but does never append a null to the output buffer(!) |
| // stringToUTF8() always appends a null byte, so restore the character under the null byte after the write. |
| HEAP8[buf+len] = endChar; |
| |
| return len; |
| },doAccess:function (path, amode) { |
| if (amode & ~7) { |
| // need a valid mode |
| return -ERRNO_CODES.EINVAL; |
| } |
| var node; |
| var lookup = FS.lookupPath(path, { follow: true }); |
| node = lookup.node; |
| var perms = ''; |
| if (amode & 4) perms += 'r'; |
| if (amode & 2) perms += 'w'; |
| if (amode & 1) perms += 'x'; |
| if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) { |
| return -ERRNO_CODES.EACCES; |
| } |
| return 0; |
| },doDup:function (path, flags, suggestFD) { |
| var suggest = FS.getStream(suggestFD); |
| if (suggest) FS.close(suggest); |
| return FS.open(path, flags, 0, suggestFD, suggestFD).fd; |
| },doReadv:function (stream, iov, iovcnt, offset) { |
| var ret = 0; |
| for (var i = 0; i < iovcnt; i++) { |
| var ptr = HEAP32[(((iov)+(i*8))>>2)]; |
| var len = HEAP32[(((iov)+(i*8 + 4))>>2)]; |
| var curr = FS.read(stream, HEAP8,ptr, len, offset); |
| if (curr < 0) return -1; |
| ret += curr; |
| if (curr < len) break; // nothing more to read |
| } |
| return ret; |
| },doWritev:function (stream, iov, iovcnt, offset) { |
| var ret = 0; |
| for (var i = 0; i < iovcnt; i++) { |
| var ptr = HEAP32[(((iov)+(i*8))>>2)]; |
| var len = HEAP32[(((iov)+(i*8 + 4))>>2)]; |
| var curr = FS.write(stream, HEAP8,ptr, len, offset); |
| if (curr < 0) return -1; |
| ret += curr; |
| } |
| return ret; |
| },varargs:0,get:function (varargs) { |
| SYSCALLS.varargs += 4; |
| var ret = HEAP32[(((SYSCALLS.varargs)-(4))>>2)]; |
| return ret; |
| },getStr:function () { |
| var ret = Pointer_stringify(SYSCALLS.get()); |
| return ret; |
| },getStreamFromFD:function () { |
| var stream = FS.getStream(SYSCALLS.get()); |
| if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
| return stream; |
| },getSocketFromFD:function () { |
| var socket = SOCKFS.getSocket(SYSCALLS.get()); |
| if (!socket) throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
| return socket; |
| },getSocketAddress:function (allowNull) { |
| var addrp = SYSCALLS.get(), addrlen = SYSCALLS.get(); |
| if (allowNull && addrp === 0) return null; |
| var info = __read_sockaddr(addrp, addrlen); |
| if (info.errno) throw new FS.ErrnoError(info.errno); |
| info.addr = DNS.lookup_addr(info.addr) || info.addr; |
| return info; |
| },get64:function () { |
| var low = SYSCALLS.get(), high = SYSCALLS.get(); |
| if (low >= 0) assert(high === 0); |
| else assert(high === -1); |
| return low; |
| },getZero:function () { |
| assert(SYSCALLS.get() === 0); |
| }};function ___syscall54(which, varargs) {SYSCALLS.varargs = varargs; |
| try { |
| // ioctl |
| var stream = SYSCALLS.getStreamFromFD(), op = SYSCALLS.get(); |
| switch (op) { |
| case 21505: { |
| if (!stream.tty) return -ERRNO_CODES.ENOTTY; |
| return 0; |
| } |
| case 21506: { |
| if (!stream.tty) return -ERRNO_CODES.ENOTTY; |
| return 0; // no-op, not actually adjusting terminal settings |
| } |
| case 21519: { |
| if (!stream.tty) return -ERRNO_CODES.ENOTTY; |
| var argp = SYSCALLS.get(); |
| HEAP32[((argp)>>2)]=0; |
| return 0; |
| } |
| case 21520: { |
| if (!stream.tty) return -ERRNO_CODES.ENOTTY; |
| return -ERRNO_CODES.EINVAL; // not supported |
| } |
| case 21531: { |
| var argp = SYSCALLS.get(); |
| return FS.ioctl(stream, op, argp); |
| } |
| default: abort('bad ioctl syscall ' + op); |
| } |
| } catch (e) { |
| if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); |
| return -e.errno; |
| } |
| } |
| |
| function _pthread_cleanup_push(routine, arg) { |
| __ATEXIT__.push(function() { Module['dynCall_vi'](routine, arg) }) |
| _pthread_cleanup_push.level = __ATEXIT__.length; |
| } |
| |
| |
| Module["_pthread_cond_broadcast"] = _pthread_cond_broadcast; |
| |
| function _pthread_cleanup_pop() { |
| assert(_pthread_cleanup_push.level == __ATEXIT__.length, 'cannot pop if something else added meanwhile!'); |
| __ATEXIT__.pop(); |
| _pthread_cleanup_push.level = __ATEXIT__.length; |
| } |
| |
| function ___cxa_begin_catch(ptr) { |
| var info = EXCEPTIONS.infos[ptr]; |
| if (info && !info.caught) { |
| info.caught = true; |
| __ZSt18uncaught_exceptionv.uncaught_exception--; |
| } |
| if (info) info.rethrown = false; |
| EXCEPTIONS.caught.push(ptr); |
| EXCEPTIONS.addRef(EXCEPTIONS.deAdjust(ptr)); |
| return ptr; |
| } |
| |
| |
| function _emscripten_memcpy_big(dest, src, num) { |
| HEAPU8.set(HEAPU8.subarray(src, src+num), dest); |
| return dest; |
| } |
| Module["_memcpy"] = _memcpy; |
| |
| function ___syscall6(which, varargs) {SYSCALLS.varargs = varargs; |
| try { |
| // close |
| var stream = SYSCALLS.getStreamFromFD(); |
| FS.close(stream); |
| return 0; |
| } catch (e) { |
| if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); |
| return -e.errno; |
| } |
| } |
| |
| |
| |
| Module["_sbrk"] = _sbrk; |
| |
| |
| Module["_memmove"] = _memmove; |
| |
| function _gettimeofday(ptr) { |
| var now = Date.now(); |
| HEAP32[((ptr)>>2)]=(now/1000)|0; // seconds |
| HEAP32[(((ptr)+(4))>>2)]=((now % 1000)*1000)|0; // microseconds |
| return 0; |
| } |
| |
| function _pthread_cond_wait() { return 0; } |
| |
| |
| Module["_pthread_mutex_unlock"] = _pthread_mutex_unlock; |
| |
| |
| Module["_pthread_self"] = _pthread_self; |
| |
| function ___syscall140(which, varargs) {SYSCALLS.varargs = varargs; |
| try { |
| // llseek |
| var stream = SYSCALLS.getStreamFromFD(), offset_high = SYSCALLS.get(), offset_low = SYSCALLS.get(), result = SYSCALLS.get(), whence = SYSCALLS.get(); |
| var offset = offset_low; |
| assert(offset_high === 0); |
| FS.llseek(stream, offset, whence); |
| HEAP32[((result)>>2)]=stream.position; |
| if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state |
| return 0; |
| } catch (e) { |
| if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); |
| return -e.errno; |
| } |
| } |
| |
| function ___syscall146(which, varargs) {SYSCALLS.varargs = varargs; |
| try { |
| // writev |
| var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get(); |
| return SYSCALLS.doWritev(stream, iov, iovcnt); |
| } catch (e) { |
| if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); |
| return -e.errno; |
| } |
| } |
| |
| function ___syscall145(which, varargs) {SYSCALLS.varargs = varargs; |
| try { |
| // readv |
| var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get(); |
| return SYSCALLS.doReadv(stream, iov, iovcnt); |
| } catch (e) { |
| if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); |
| return -e.errno; |
| } |
| } |
| |
| var ___dso_handle=STATICTOP; STATICTOP += 16;; |
| FS.staticInit();__ATINIT__.unshift(function() { if (!Module["noFSInit"] && !FS.init.initialized) FS.init() });__ATMAIN__.push(function() { FS.ignorePermissions = false });__ATEXIT__.push(function() { FS.quit() });Module["FS_createFolder"] = FS.createFolder;Module["FS_createPath"] = FS.createPath;Module["FS_createDataFile"] = FS.createDataFile;Module["FS_createPreloadedFile"] = FS.createPreloadedFile;Module["FS_createLazyFile"] = FS.createLazyFile;Module["FS_createLink"] = FS.createLink;Module["FS_createDevice"] = FS.createDevice;Module["FS_unlink"] = FS.unlink;; |
| __ATINIT__.unshift(function() { TTY.init() });__ATEXIT__.push(function() { TTY.shutdown() });; |
| if (ENVIRONMENT_IS_NODE) { var fs = require("fs"); var NODEJS_PATH = require("path"); NODEFS.staticInit(); }; |
| DYNAMICTOP_PTR = allocate(1, "i32", ALLOC_STATIC); |
| |
| STACK_BASE = STACKTOP = Runtime.alignMemory(STATICTOP); |
| |
| STACK_MAX = STACK_BASE + TOTAL_STACK; |
| |
| DYNAMIC_BASE = Runtime.alignMemory(STACK_MAX); |
| |
| HEAP32[DYNAMICTOP_PTR>>2] = DYNAMIC_BASE; |
| |
| staticSealed = true; // seal the static portion of memory |
| |
| |
| |
| Module['wasmTableSize'] = 481; |
| |
| Module['wasmMaxTableSize'] = 481; |
| |
| function invoke_iiiiiiii(index,a1,a2,a3,a4,a5,a6,a7) { |
| try { |
| return Module["dynCall_iiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7); |
| } catch(e) { |
| if (typeof e !== 'number' && e !== 'longjmp') throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| |
| function invoke_iiii(index,a1,a2,a3) { |
| try { |
| return Module["dynCall_iiii"](index,a1,a2,a3); |
| } catch(e) { |
| if (typeof e !== 'number' && e !== 'longjmp') throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| |
| function invoke_viiiii(index,a1,a2,a3,a4,a5) { |
| try { |
| Module["dynCall_viiiii"](index,a1,a2,a3,a4,a5); |
| } catch(e) { |
| if (typeof e !== 'number' && e !== 'longjmp') throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| |
| function invoke_iiiiiid(index,a1,a2,a3,a4,a5,a6) { |
| try { |
| return Module["dynCall_iiiiiid"](index,a1,a2,a3,a4,a5,a6); |
| } catch(e) { |
| if (typeof e !== 'number' && e !== 'longjmp') throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| |
| function invoke_vi(index,a1) { |
| try { |
| Module["dynCall_vi"](index,a1); |
| } catch(e) { |
| if (typeof e !== 'number' && e !== 'longjmp') throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| |
| function invoke_vii(index,a1,a2) { |
| try { |
| Module["dynCall_vii"](index,a1,a2); |
| } catch(e) { |
| if (typeof e !== 'number' && e !== 'longjmp') throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| |
| function invoke_iiiiiii(index,a1,a2,a3,a4,a5,a6) { |
| try { |
| return Module["dynCall_iiiiiii"](index,a1,a2,a3,a4,a5,a6); |
| } catch(e) { |
| if (typeof e !== 'number' && e !== 'longjmp') throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| |
| function invoke_iiiiid(index,a1,a2,a3,a4,a5) { |
| try { |
| return Module["dynCall_iiiiid"](index,a1,a2,a3,a4,a5); |
| } catch(e) { |
| if (typeof e !== 'number' && e !== 'longjmp') throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| |
| function invoke_ii(index,a1) { |
| try { |
| return Module["dynCall_ii"](index,a1); |
| } catch(e) { |
| if (typeof e !== 'number' && e !== 'longjmp') throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| |
| function invoke_viijii(index,a1,a2,a3,a4,a5,a6) { |
| try { |
| Module["dynCall_viijii"](index,a1,a2,a3,a4,a5,a6); |
| } catch(e) { |
| if (typeof e !== 'number' && e !== 'longjmp') throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| |
| function invoke_iiiiij(index,a1,a2,a3,a4,a5,a6) { |
| try { |
| return Module["dynCall_iiiiij"](index,a1,a2,a3,a4,a5,a6); |
| } catch(e) { |
| if (typeof e !== 'number' && e !== 'longjmp') throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| |
| function invoke_viii(index,a1,a2,a3) { |
| try { |
| Module["dynCall_viii"](index,a1,a2,a3); |
| } catch(e) { |
| if (typeof e !== 'number' && e !== 'longjmp') throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| |
| function invoke_v(index) { |
| try { |
| Module["dynCall_v"](index); |
| } catch(e) { |
| if (typeof e !== 'number' && e !== 'longjmp') throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| |
| function invoke_iiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8) { |
| try { |
| return Module["dynCall_iiiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8); |
| } catch(e) { |
| if (typeof e !== 'number' && e !== 'longjmp') throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| |
| function invoke_iiiii(index,a1,a2,a3,a4) { |
| try { |
| return Module["dynCall_iiiii"](index,a1,a2,a3,a4); |
| } catch(e) { |
| if (typeof e !== 'number' && e !== 'longjmp') throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| |
| function invoke_viiiiii(index,a1,a2,a3,a4,a5,a6) { |
| try { |
| Module["dynCall_viiiiii"](index,a1,a2,a3,a4,a5,a6); |
| } catch(e) { |
| if (typeof e !== 'number' && e !== 'longjmp') throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| |
| function invoke_iii(index,a1,a2) { |
| try { |
| return Module["dynCall_iii"](index,a1,a2); |
| } catch(e) { |
| if (typeof e !== 'number' && e !== 'longjmp') throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| |
| function invoke_iiiiii(index,a1,a2,a3,a4,a5) { |
| try { |
| return Module["dynCall_iiiiii"](index,a1,a2,a3,a4,a5); |
| } catch(e) { |
| if (typeof e !== 'number' && e !== 'longjmp') throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| |
| function invoke_viiii(index,a1,a2,a3,a4) { |
| try { |
| Module["dynCall_viiii"](index,a1,a2,a3,a4); |
| } catch(e) { |
| if (typeof e !== 'number' && e !== 'longjmp') throw e; |
| Module["setThrew"](1, 0); |
| } |
| } |
| |
| Module.asmGlobalArg = { "Math": Math, "Int8Array": Int8Array, "Int16Array": Int16Array, "Int32Array": Int32Array, "Uint8Array": Uint8Array, "Uint16Array": Uint16Array, "Uint32Array": Uint32Array, "Float32Array": Float32Array, "Float64Array": Float64Array, "NaN": NaN, "Infinity": Infinity }; |
| |
| Module.asmLibraryArg = { "abort": abort, "assert": assert, "enlargeMemory": enlargeMemory, "getTotalMemory": getTotalMemory, "abortOnCannotGrowMemory": abortOnCannotGrowMemory, "invoke_iiiiiiii": invoke_iiiiiiii, "invoke_iiii": invoke_iiii, "invoke_viiiii": invoke_viiiii, "invoke_iiiiiid": invoke_iiiiiid, "invoke_vi": invoke_vi, "invoke_vii": invoke_vii, "invoke_iiiiiii": invoke_iiiiiii, "invoke_iiiiid": invoke_iiiiid, "invoke_ii": invoke_ii, "invoke_viijii": invoke_viijii, "invoke_iiiiij": invoke_iiiiij, "invoke_viii": invoke_viii, "invoke_v": invoke_v, "invoke_iiiiiiiii": invoke_iiiiiiiii, "invoke_iiiii": invoke_iiiii, "invoke_viiiiii": invoke_viiiiii, "invoke_iii": invoke_iii, "invoke_iiiiii": invoke_iiiiii, "invoke_viiii": invoke_viiii, "_pthread_cleanup_pop": _pthread_cleanup_pop, "_strftime": _strftime, "_pthread_cond_wait": _pthread_cond_wait, "_pthread_key_create": _pthread_key_create, "_abort": _abort, "___gxx_personality_v0": ___gxx_personality_v0, "___assert_fail": ___assert_fail, "___cxa_allocate_exception": ___cxa_allocate_exception, "___cxa_find_matching_catch": ___cxa_find_matching_catch, "__addDays": __addDays, "_strftime_l": _strftime_l, "___setErrNo": ___setErrNo, "___cxa_begin_catch": ___cxa_begin_catch, "_emscripten_memcpy_big": _emscripten_memcpy_big, "___resumeException": ___resumeException, "__ZSt18uncaught_exceptionv": __ZSt18uncaught_exceptionv, "_pthread_getspecific": _pthread_getspecific, "__arraySum": __arraySum, "_pthread_once": _pthread_once, "___syscall54": ___syscall54, "___unlock": ___unlock, "__isLeapYear": __isLeapYear, "_pthread_setspecific": _pthread_setspecific, "___cxa_atexit": ___cxa_atexit, "___cxa_throw": ___cxa_throw, "___lock": ___lock, "___syscall6": ___syscall6, "_pthread_cleanup_push": _pthread_cleanup_push, "_gettimeofday": _gettimeofday, "_atexit": _atexit, "___syscall140": ___syscall140, "___syscall145": ___syscall145, "___syscall146": ___syscall146, "DYNAMICTOP_PTR": DYNAMICTOP_PTR, "tempDoublePtr": tempDoublePtr, "ABORT": ABORT, "STACKTOP": STACKTOP, "STACK_MAX": STACK_MAX, "___dso_handle": ___dso_handle }; |
| // EMSCRIPTEN_START_ASM |
| var asm =Module["asm"]// EMSCRIPTEN_END_ASM |
| (Module.asmGlobalArg, Module.asmLibraryArg, buffer); |
| |
| Module["asm"] = asm; |
| var _main = Module["_main"] = function() { return Module["asm"]["_main"].apply(null, arguments) }; |
| var setThrew = Module["setThrew"] = function() { return Module["asm"]["setThrew"].apply(null, arguments) }; |
| var _fflush = Module["_fflush"] = function() { return Module["asm"]["_fflush"].apply(null, arguments) }; |
| var ___cxa_is_pointer_type = Module["___cxa_is_pointer_type"] = function() { return Module["asm"]["___cxa_is_pointer_type"].apply(null, arguments) }; |
| var ___errno_location = Module["___errno_location"] = function() { return Module["asm"]["___errno_location"].apply(null, arguments) }; |
| var _memset = Module["_memset"] = function() { return Module["asm"]["_memset"].apply(null, arguments) }; |
| var _sbrk = Module["_sbrk"] = function() { return Module["asm"]["_sbrk"].apply(null, arguments) }; |
| var _memcpy = Module["_memcpy"] = function() { return Module["asm"]["_memcpy"].apply(null, arguments) }; |
| var stackAlloc = Module["stackAlloc"] = function() { return Module["asm"]["stackAlloc"].apply(null, arguments) }; |
| var getTempRet0 = Module["getTempRet0"] = function() { return Module["asm"]["getTempRet0"].apply(null, arguments) }; |
| var setTempRet0 = Module["setTempRet0"] = function() { return Module["asm"]["setTempRet0"].apply(null, arguments) }; |
| var _pthread_self = Module["_pthread_self"] = function() { return Module["asm"]["_pthread_self"].apply(null, arguments) }; |
| var _pthread_mutex_unlock = Module["_pthread_mutex_unlock"] = function() { return Module["asm"]["_pthread_mutex_unlock"].apply(null, arguments) }; |
| var __GLOBAL__I_000101 = Module["__GLOBAL__I_000101"] = function() { return Module["asm"]["__GLOBAL__I_000101"].apply(null, arguments) }; |
| var stackRestore = Module["stackRestore"] = function() { return Module["asm"]["stackRestore"].apply(null, arguments) }; |
| var __GLOBAL__sub_I_iostream_cpp = Module["__GLOBAL__sub_I_iostream_cpp"] = function() { return Module["asm"]["__GLOBAL__sub_I_iostream_cpp"].apply(null, arguments) }; |
| var _pthread_cond_broadcast = Module["_pthread_cond_broadcast"] = function() { return Module["asm"]["_pthread_cond_broadcast"].apply(null, arguments) }; |
| var stackSave = Module["stackSave"] = function() { return Module["asm"]["stackSave"].apply(null, arguments) }; |
| var ___cxa_can_catch = Module["___cxa_can_catch"] = function() { return Module["asm"]["___cxa_can_catch"].apply(null, arguments) }; |
| var _free = Module["_free"] = function() { return Module["asm"]["_free"].apply(null, arguments) }; |
| var runPostSets = Module["runPostSets"] = function() { return Module["asm"]["runPostSets"].apply(null, arguments) }; |
| var establishStackSpace = Module["establishStackSpace"] = function() { return Module["asm"]["establishStackSpace"].apply(null, arguments) }; |
| var _memmove = Module["_memmove"] = function() { return Module["asm"]["_memmove"].apply(null, arguments) }; |
| var _malloc = Module["_malloc"] = function() { return Module["asm"]["_malloc"].apply(null, arguments) }; |
| var _pthread_mutex_lock = Module["_pthread_mutex_lock"] = function() { return Module["asm"]["_pthread_mutex_lock"].apply(null, arguments) }; |
| var dynCall_iiiiiiii = Module["dynCall_iiiiiiii"] = function() { return Module["asm"]["dynCall_iiiiiiii"].apply(null, arguments) }; |
| var dynCall_iiii = Module["dynCall_iiii"] = function() { return Module["asm"]["dynCall_iiii"].apply(null, arguments) }; |
| var dynCall_viiiii = Module["dynCall_viiiii"] = function() { return Module["asm"]["dynCall_viiiii"].apply(null, arguments) }; |
| var dynCall_iiiiiid = Module["dynCall_iiiiiid"] = function() { return Module["asm"]["dynCall_iiiiiid"].apply(null, arguments) }; |
| var dynCall_vi = Module["dynCall_vi"] = function() { return Module["asm"]["dynCall_vi"].apply(null, arguments) }; |
| var dynCall_vii = Module["dynCall_vii"] = function() { return Module["asm"]["dynCall_vii"].apply(null, arguments) }; |
| var dynCall_iiiiiii = Module["dynCall_iiiiiii"] = function() { return Module["asm"]["dynCall_iiiiiii"].apply(null, arguments) }; |
| var dynCall_iiiiid = Module["dynCall_iiiiid"] = function() { return Module["asm"]["dynCall_iiiiid"].apply(null, arguments) }; |
| var dynCall_ii = Module["dynCall_ii"] = function() { return Module["asm"]["dynCall_ii"].apply(null, arguments) }; |
| var dynCall_viijii = Module["dynCall_viijii"] = function() { return Module["asm"]["dynCall_viijii"].apply(null, arguments) }; |
| var dynCall_iiiiij = Module["dynCall_iiiiij"] = function() { return Module["asm"]["dynCall_iiiiij"].apply(null, arguments) }; |
| var dynCall_viii = Module["dynCall_viii"] = function() { return Module["asm"]["dynCall_viii"].apply(null, arguments) }; |
| var dynCall_v = Module["dynCall_v"] = function() { return Module["asm"]["dynCall_v"].apply(null, arguments) }; |
| var dynCall_iiiiiiiii = Module["dynCall_iiiiiiiii"] = function() { return Module["asm"]["dynCall_iiiiiiiii"].apply(null, arguments) }; |
| var dynCall_iiiii = Module["dynCall_iiiii"] = function() { return Module["asm"]["dynCall_iiiii"].apply(null, arguments) }; |
| var dynCall_viiiiii = Module["dynCall_viiiiii"] = function() { return Module["asm"]["dynCall_viiiiii"].apply(null, arguments) }; |
| var dynCall_iii = Module["dynCall_iii"] = function() { return Module["asm"]["dynCall_iii"].apply(null, arguments) }; |
| var dynCall_iiiiii = Module["dynCall_iiiiii"] = function() { return Module["asm"]["dynCall_iiiiii"].apply(null, arguments) }; |
| var dynCall_viiii = Module["dynCall_viiii"] = function() { return Module["asm"]["dynCall_viiii"].apply(null, arguments) }; |
| ; |
| |
| Runtime.stackAlloc = Module['stackAlloc']; |
| Runtime.stackSave = Module['stackSave']; |
| Runtime.stackRestore = Module['stackRestore']; |
| Runtime.establishStackSpace = Module['establishStackSpace']; |
| |
| Runtime.setTempRet0 = Module['setTempRet0']; |
| Runtime.getTempRet0 = Module['getTempRet0']; |
| |
| |
| |
| // === Auto-generated postamble setup entry stuff === |
| |
| Module['asm'] = asm; |
| |
| |
| |
| if (memoryInitializer) { |
| if (typeof Module['locateFile'] === 'function') { |
| memoryInitializer = Module['locateFile'](memoryInitializer); |
| } else if (Module['memoryInitializerPrefixURL']) { |
| memoryInitializer = Module['memoryInitializerPrefixURL'] + memoryInitializer; |
| } |
| if (ENVIRONMENT_IS_NODE || ENVIRONMENT_IS_SHELL) { |
| var data = Module['readBinary'](memoryInitializer); |
| HEAPU8.set(data, Runtime.GLOBAL_BASE); |
| } else { |
| addRunDependency('memory initializer'); |
| var applyMemoryInitializer = function(data) { |
| if (data.byteLength) data = new Uint8Array(data); |
| HEAPU8.set(data, Runtime.GLOBAL_BASE); |
| // Delete the typed array that contains the large blob of the memory initializer request response so that |
| // we won't keep unnecessary memory lying around. However, keep the XHR object itself alive so that e.g. |
| // its .status field can still be accessed later. |
| if (Module['memoryInitializerRequest']) delete Module['memoryInitializerRequest'].response; |
| removeRunDependency('memory initializer'); |
| } |
| function doBrowserLoad() { |
| Module['readAsync'](memoryInitializer, applyMemoryInitializer, function() { |
| throw 'could not load memory initializer ' + memoryInitializer; |
| }); |
| } |
| if (Module['memoryInitializerRequest']) { |
| // a network request has already been created, just use that |
| function useRequest() { |
| var request = Module['memoryInitializerRequest']; |
| if (request.status !== 200 && request.status !== 0) { |
| // If you see this warning, the issue may be that you are using locateFile or memoryInitializerPrefixURL, and defining them in JS. That |
| // means that the HTML file doesn't know about them, and when it tries to create the mem init request early, does it to the wrong place. |
| // Look in your browser's devtools network console to see what's going on. |
| console.warn('a problem seems to have happened with Module.memoryInitializerRequest, status: ' + request.status + ', retrying ' + memoryInitializer); |
| doBrowserLoad(); |
| return; |
| } |
| applyMemoryInitializer(request.response); |
| } |
| if (Module['memoryInitializerRequest'].response) { |
| setTimeout(useRequest, 0); // it's already here; but, apply it asynchronously |
| } else { |
| Module['memoryInitializerRequest'].addEventListener('load', useRequest); // wait for it |
| } |
| } else { |
| // fetch it from the network ourselves |
| doBrowserLoad(); |
| } |
| } |
| } |
| |
| |
| function ExitStatus(status) { |
| this.name = "ExitStatus"; |
| this.message = "Program terminated with exit(" + status + ")"; |
| this.status = status; |
| }; |
| ExitStatus.prototype = new Error(); |
| ExitStatus.prototype.constructor = ExitStatus; |
| |
| var initialStackTop; |
| var preloadStartTime = null; |
| var calledMain = false; |
| |
| dependenciesFulfilled = function runCaller() { |
| // If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false) |
| if (!Module['calledRun']) run(); |
| if (!Module['calledRun']) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled |
| } |
| |
| Module['callMain'] = Module.callMain = function callMain(args) { |
| |
| args = args || []; |
| |
| ensureInitRuntime(); |
| |
| var argc = args.length+1; |
| function pad() { |
| for (var i = 0; i < 4-1; i++) { |
| argv.push(0); |
| } |
| } |
| var argv = [allocate(intArrayFromString(Module['thisProgram']), 'i8', ALLOC_NORMAL) ]; |
| pad(); |
| for (var i = 0; i < argc-1; i = i + 1) { |
| argv.push(allocate(intArrayFromString(args[i]), 'i8', ALLOC_NORMAL)); |
| pad(); |
| } |
| argv.push(0); |
| argv = allocate(argv, 'i32', ALLOC_NORMAL); |
| |
| |
| try { |
| |
| var ret = Module['_main'](argc, argv, 0); |
| |
| |
| // if we're not running an evented main loop, it's time to exit |
| exit(ret, /* implicit = */ true); |
| } |
| catch(e) { |
| if (e instanceof ExitStatus) { |
| // exit() throws this once it's done to make sure execution |
| // has been stopped completely |
| return; |
| } else if (e == 'SimulateInfiniteLoop') { |
| // running an evented main loop, don't immediately exit |
| Module['noExitRuntime'] = true; |
| return; |
| } else { |
| if (e && typeof e === 'object' && e.stack) Module.printErr('exception thrown: ' + [e, e.stack]); |
| throw e; |
| } |
| } finally { |
| calledMain = true; |
| } |
| } |
| |
| |
| |
| |
| function run(args) { |
| args = args || Module['arguments']; |
| |
| if (preloadStartTime === null) preloadStartTime = Date.now(); |
| |
| if (runDependencies > 0) { |
| return; |
| } |
| |
| |
| preRun(); |
| |
| if (runDependencies > 0) return; // a preRun added a dependency, run will be called later |
| if (Module['calledRun']) return; // run may have just been called through dependencies being fulfilled just in this very frame |
| |
| function doRun() { |
| if (Module['calledRun']) return; // run may have just been called while the async setStatus time below was happening |
| Module['calledRun'] = true; |
| |
| if (ABORT) return; |
| |
| ensureInitRuntime(); |
| |
| preMain(); |
| |
| |
| if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized'](); |
| |
| if (Module['_main'] && shouldRunNow) Module['callMain'](args); |
| |
| postRun(); |
| } |
| |
| if (Module['setStatus']) { |
| Module['setStatus']('Running...'); |
| setTimeout(function() { |
| setTimeout(function() { |
| Module['setStatus'](''); |
| }, 1); |
| doRun(); |
| }, 1); |
| } else { |
| doRun(); |
| } |
| } |
| Module['run'] = Module.run = run; |
| |
| function exit(status, implicit) { |
| if (implicit && Module['noExitRuntime']) { |
| return; |
| } |
| |
| if (Module['noExitRuntime']) { |
| } else { |
| |
| ABORT = true; |
| EXITSTATUS = status; |
| STACKTOP = initialStackTop; |
| |
| exitRuntime(); |
| |
| if (Module['onExit']) Module['onExit'](status); |
| } |
| |
| if (ENVIRONMENT_IS_NODE) { |
| process['exit'](status); |
| } else if (ENVIRONMENT_IS_SHELL && typeof quit === 'function') { |
| quit(status); |
| } |
| // if we reach here, we must throw an exception to halt the current execution |
| throw new ExitStatus(status); |
| } |
| Module['exit'] = Module.exit = exit; |
| |
| var abortDecorators = []; |
| |
| function abort(what) { |
| if (what !== undefined) { |
| Module.print(what); |
| Module.printErr(what); |
| what = JSON.stringify(what) |
| } else { |
| what = ''; |
| } |
| |
| ABORT = true; |
| EXITSTATUS = 1; |
| |
| var extra = '\nIf this abort() is unexpected, build with -s ASSERTIONS=1 which can give more information.'; |
| |
| var output = 'abort(' + what + ') at ' + stackTrace() + extra; |
| if (abortDecorators) { |
| abortDecorators.forEach(function(decorator) { |
| output = decorator(output, what); |
| }); |
| } |
| throw output; |
| } |
| Module['abort'] = Module.abort = abort; |
| |
| // {{PRE_RUN_ADDITIONS}} |
| |
| if (Module['preInit']) { |
| if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']]; |
| while (Module['preInit'].length > 0) { |
| Module['preInit'].pop()(); |
| } |
| } |
| |
| // shouldRunNow refers to calling main(), not run(). |
| var shouldRunNow = true; |
| if (Module['noInitialRun']) { |
| shouldRunNow = false; |
| } |
| |
| |
| run(); |
| |
| // {{POST_RUN_ADDITIONS}} |
| |
| |
| |
| |
| |
| // {{MODULE_ADDITIONS}} |
| |
| |
| |